diff options
author | Luke Shumaker <lukeshu@sbcglobal.net> | 2016-05-01 15:30:47 -0400 |
---|---|---|
committer | Luke Shumaker <lukeshu@sbcglobal.net> | 2016-05-01 15:30:47 -0400 |
commit | 7e85254903c7c0cb49e381f16b18441ea7b058cc (patch) | |
tree | b22328fcf4c8408fc25a7acb73d1cb1089cd82ac /vendor/monolog/monolog/tests | |
parent | 1de335ad3f395ca6861085393ba366a9e3fb4a0d (diff) | |
parent | 1a365e77dfb8825136626202b1df462731b42060 (diff) |
Merge commit '1a365e'
Diffstat (limited to 'vendor/monolog/monolog/tests')
69 files changed, 7265 insertions, 0 deletions
diff --git a/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php new file mode 100644 index 00000000..a9a3f301 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php @@ -0,0 +1,31 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use Monolog\Handler\TestHandler; + +class ErrorHandlerTest extends \PHPUnit_Framework_TestCase +{ + public function testHandleError() + { + $logger = new Logger('test', array($handler = new TestHandler)); + $errHandler = new ErrorHandler($logger); + + $errHandler->registerErrorHandler(array(E_USER_NOTICE => Logger::EMERGENCY), false); + trigger_error('Foo', E_USER_ERROR); + $this->assertCount(1, $handler->getRecords()); + $this->assertTrue($handler->hasErrorRecords()); + trigger_error('Foo', E_USER_NOTICE); + $this->assertCount(2, $handler->getRecords()); + $this->assertTrue($handler->hasEmergencyRecords()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php new file mode 100644 index 00000000..e7f7334e --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php @@ -0,0 +1,158 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class ChromePHPFormatterTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Formatter\ChromePHPFormatter::format + */ + public function testDefaultFormat() + { + $formatter = new ChromePHPFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('ip' => '127.0.0.1'), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertEquals( + array( + 'meh', + array( + 'message' => 'log', + 'context' => array('from' => 'logger'), + 'extra' => array('ip' => '127.0.0.1'), + ), + 'unknown', + 'error' + ), + $message + ); + } + + /** + * @covers Monolog\Formatter\ChromePHPFormatter::format + */ + public function testFormatWithFileAndLine() + { + $formatter = new ChromePHPFormatter(); + $record = array( + 'level' => Logger::CRITICAL, + 'level_name' => 'CRITICAL', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertEquals( + array( + 'meh', + array( + 'message' => 'log', + 'context' => array('from' => 'logger'), + 'extra' => array('ip' => '127.0.0.1'), + ), + 'test : 14', + 'error' + ), + $message + ); + } + + /** + * @covers Monolog\Formatter\ChromePHPFormatter::format + */ + public function testFormatWithoutContext() + { + $formatter = new ChromePHPFormatter(); + $record = array( + 'level' => Logger::DEBUG, + 'level_name' => 'DEBUG', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertEquals( + array( + 'meh', + 'log', + 'unknown', + 'log' + ), + $message + ); + } + + /** + * @covers Monolog\Formatter\ChromePHPFormatter::formatBatch + */ + public function testBatchFormatThrowException() + { + $formatter = new ChromePHPFormatter(); + $records = array( + array( + 'level' => Logger::INFO, + 'level_name' => 'INFO', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ), + array( + 'level' => Logger::WARNING, + 'level_name' => 'WARNING', + 'channel' => 'foo', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log2', + ), + ); + + $this->assertEquals( + array( + array( + 'meh', + 'log', + 'unknown', + 'info' + ), + array( + 'foo', + 'log2', + 'unknown', + 'warn' + ), + ), + $formatter->formatBatch($records) + ); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php new file mode 100644 index 00000000..546e5c26 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php @@ -0,0 +1,79 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class ElasticaFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function setUp() + { + if (!class_exists("Elastica\Document")) { + $this->markTestSkipped("ruflin/elastica not installed"); + } + } + + /** + * @covers Monolog\Formatter\ElasticaFormatter::__construct + * @covers Monolog\Formatter\ElasticaFormatter::format + * @covers Monolog\Formatter\ElasticaFormatter::getDocument + */ + public function testFormat() + { + // test log message + $msg = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + // expected values + $expected = $msg; + $expected['datetime'] = '1970-01-01T00:00:00+0000'; + $expected['context'] = array( + 'class' => '[object] (stdClass: {})', + 'foo' => 7, + 0 => 'bar', + ); + + // format log message + $formatter = new ElasticaFormatter('my_index', 'doc_type'); + $doc = $formatter->format($msg); + $this->assertInstanceOf('Elastica\Document', $doc); + + // Document parameters + $params = $doc->getParams(); + $this->assertEquals('my_index', $params['_index']); + $this->assertEquals('doc_type', $params['_type']); + + // Document data values + $data = $doc->getData(); + foreach (array_keys($expected) as $key) { + $this->assertEquals($expected[$key], $data[$key]); + } + } + + /** + * @covers Monolog\Formatter\ElasticaFormatter::getIndex + * @covers Monolog\Formatter\ElasticaFormatter::getType + */ + public function testGetters() + { + $formatter = new ElasticaFormatter('my_index', 'doc_type'); + $this->assertEquals('my_index', $formatter->getIndex()); + $this->assertEquals('doc_type', $formatter->getType()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php new file mode 100644 index 00000000..1b2fd97a --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php @@ -0,0 +1,55 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; +use Monolog\TestCase; + +class FlowdockFormatterTest extends TestCase +{ + /** + * @covers Monolog\Formatter\FlowdockFormatter::format + */ + public function testFormat() + { + $formatter = new FlowdockFormatter('test_source', 'source@test.com'); + $record = $this->getRecord(); + + $expected = array( + 'source' => 'test_source', + 'from_address' => 'source@test.com', + 'subject' => 'in test_source: WARNING - test', + 'content' => 'test', + 'tags' => array('#logs', '#warning', '#test'), + 'project' => 'test_source', + ); + $formatted = $formatter->format($record); + + $this->assertEquals($expected, $formatted['flowdock']); + } + + /** + * @ covers Monolog\Formatter\FlowdockFormatter::formatBatch + */ + public function testFormatBatch() + { + $formatter = new FlowdockFormatter('test_source', 'source@test.com'); + $records = array( + $this->getRecord(Logger::WARNING), + $this->getRecord(Logger::DEBUG), + ); + $formatted = $formatter->formatBatch($records); + + $this->assertArrayHasKey('flowdock', $formatted[0]); + $this->assertArrayHasKey('flowdock', $formatted[1]); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php new file mode 100644 index 00000000..3f47a09a --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php @@ -0,0 +1,189 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class GelfMessageFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function setUp() + { + if (!class_exists('\Gelf\Message')) { + $this->markTestSkipped("graylog2/gelf-php or mlehner/gelf-php is not installed"); + } + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testDefaultFormatter() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + $this->assertEquals(0, $message->getTimestamp()); + $this->assertEquals('log', $message->getShortMessage()); + $this->assertEquals('meh', $message->getFacility()); + $this->assertEquals(null, $message->getLine()); + $this->assertEquals(null, $message->getFile()); + $this->assertEquals($this->isLegacy() ? 3 : 'error', $message->getLevel()); + $this->assertNotEmpty($message->getHost()); + + $formatter = new GelfMessageFormatter('mysystem'); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + $this->assertEquals('mysystem', $message->getHost()); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testFormatWithFileAndLine() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + $this->assertEquals('test', $message->getFile()); + $this->assertEquals(14, $message->getLine()); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testFormatWithContext() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $message_array = $message->toArray(); + + $this->assertArrayHasKey('_ctxt_from', $message_array); + $this->assertEquals('logger', $message_array['_ctxt_from']); + + // Test with extraPrefix + $formatter = new GelfMessageFormatter(null, null, 'CTX'); + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $message_array = $message->toArray(); + + $this->assertArrayHasKey('_CTXfrom', $message_array); + $this->assertEquals('logger', $message_array['_CTXfrom']); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testFormatWithContextContainingException() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger', 'exception' => array( + 'class' => '\Exception', + 'file' => '/some/file/in/dir.php:56', + 'trace' => array('/some/file/1.php:23', '/some/file/2.php:3') + )), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log' + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $this->assertEquals("/some/file/in/dir.php", $message->getFile()); + $this->assertEquals("56", $message->getLine()); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testFormatWithExtra() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $message_array = $message->toArray(); + + $this->assertArrayHasKey('_key', $message_array); + $this->assertEquals('pair', $message_array['_key']); + + // Test with extraPrefix + $formatter = new GelfMessageFormatter(null, 'EXT'); + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $message_array = $message->toArray(); + + $this->assertArrayHasKey('_EXTkey', $message_array); + $this->assertEquals('pair', $message_array['_EXTkey']); + } + + private function isLegacy() + { + return interface_exists('\Gelf\IMessagePublisher'); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php new file mode 100644 index 00000000..69e20077 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php @@ -0,0 +1,78 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; +use Monolog\TestCase; + +class JsonFormatterTest extends TestCase +{ + /** + * @covers Monolog\Formatter\JsonFormatter::__construct + * @covers Monolog\Formatter\JsonFormatter::getBatchMode + * @covers Monolog\Formatter\JsonFormatter::isAppendingNewlines + */ + public function testConstruct() + { + $formatter = new JsonFormatter(); + $this->assertEquals(JsonFormatter::BATCH_MODE_JSON, $formatter->getBatchMode()); + $this->assertEquals(true, $formatter->isAppendingNewlines()); + $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES, false); + $this->assertEquals(JsonFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode()); + $this->assertEquals(false, $formatter->isAppendingNewlines()); + } + + /** + * @covers Monolog\Formatter\JsonFormatter::format + */ + public function testFormat() + { + $formatter = new JsonFormatter(); + $record = $this->getRecord(); + $this->assertEquals(json_encode($record)."\n", $formatter->format($record)); + + $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false); + $record = $this->getRecord(); + $this->assertEquals(json_encode($record), $formatter->format($record)); + } + + /** + * @covers Monolog\Formatter\JsonFormatter::formatBatch + * @covers Monolog\Formatter\JsonFormatter::formatBatchJson + */ + public function testFormatBatch() + { + $formatter = new JsonFormatter(); + $records = array( + $this->getRecord(Logger::WARNING), + $this->getRecord(Logger::DEBUG), + ); + $this->assertEquals(json_encode($records), $formatter->formatBatch($records)); + } + + /** + * @covers Monolog\Formatter\JsonFormatter::formatBatch + * @covers Monolog\Formatter\JsonFormatter::formatBatchNewlines + */ + public function testFormatBatchNewlines() + { + $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES); + $records = $expected = array( + $this->getRecord(Logger::WARNING), + $this->getRecord(Logger::DEBUG), + ); + array_walk($expected, function (&$value, $key) { + $value = json_encode($value); + }); + $this->assertEquals(implode("\n", $expected), $formatter->formatBatch($records)); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php new file mode 100644 index 00000000..89e1ca2e --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php @@ -0,0 +1,208 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * @covers Monolog\Formatter\LineFormatter + */ +class LineFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function testDefFormatWithString() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'WARNING', + 'channel' => 'log', + 'context' => array(), + 'message' => 'foo', + 'datetime' => new \DateTime, + 'extra' => array(), + )); + $this->assertEquals('['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message); + } + + public function testDefFormatWithArrayContext() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'message' => 'foo', + 'datetime' => new \DateTime, + 'extra' => array(), + 'context' => array( + 'foo' => 'bar', + 'baz' => 'qux', + 'bool' => false, + 'null' => null, + ) + )); + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foo {"foo":"bar","baz":"qux","bool":false,"null":null} []'."\n", $message); + } + + public function testDefFormatExtras() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array('ip' => '127.0.0.1'), + 'message' => 'log', + )); + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] {"ip":"127.0.0.1"}'."\n", $message); + } + + public function testFormatExtras() + { + $formatter = new LineFormatter("[%datetime%] %channel%.%level_name%: %message% %context% %extra.file% %extra%\n", 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array('ip' => '127.0.0.1', 'file' => 'test'), + 'message' => 'log', + )); + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] test {"ip":"127.0.0.1"}'."\n", $message); + } + + public function testContextAndExtraOptionallyNotShownIfEmpty() + { + $formatter = new LineFormatter(null, 'Y-m-d', false, true); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + 'message' => 'log', + )); + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log '."\n", $message); + } + + public function testDefFormatWithObject() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array('foo' => new TestFoo, 'bar' => new TestBar, 'baz' => array(), 'res' => fopen('php://memory', 'rb')), + 'message' => 'foobar', + )); + + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foobar [] {"foo":"[object] (Monolog\\\\Formatter\\\\TestFoo: {\\"foo\\":\\"foo\\"})","bar":"[object] (Monolog\\\\Formatter\\\\TestBar: {})","baz":[],"res":"[resource]"}'."\n", $message); + } + + public function testDefFormatWithException() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'CRITICAL', + 'channel' => 'core', + 'context' => array('exception' => new \RuntimeException('Foo')), + 'datetime' => new \DateTime, + 'extra' => array(), + 'message' => 'foobar', + )); + + $path = str_replace('\\/', '/', json_encode(__FILE__)); + + $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__-8).')"} []'."\n", $message); + } + + public function testDefFormatWithPreviousException() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $previous = new \LogicException('Wut?'); + $message = $formatter->format(array( + 'level_name' => 'CRITICAL', + 'channel' => 'core', + 'context' => array('exception' => new \RuntimeException('Foo', 0, $previous)), + 'datetime' => new \DateTime, + 'extra' => array(), + 'message' => 'foobar', + )); + + $path = str_replace('\\/', '/', json_encode(__FILE__)); + + $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__-8).', LogicException(code: 0): Wut? at '.substr($path, 1, -1).':'.(__LINE__-12).')"} []'."\n", $message); + } + + public function testBatchFormat() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->formatBatch(array( + array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + ), + array( + 'level_name' => 'WARNING', + 'channel' => 'log', + 'message' => 'foo', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + ), + )); + $this->assertEquals('['.date('Y-m-d').'] test.CRITICAL: bar [] []'."\n".'['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message); + } + + public function testFormatShouldStripInlineLineBreaks() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format( + array( + 'message' => "foo\nbar", + 'context' => array(), + 'extra' => array(), + ) + ); + + $this->assertRegExp('/foo bar/', $message); + } + + public function testFormatShouldNotStripInlineLineBreaksWhenFlagIsSet() + { + $formatter = new LineFormatter(null, 'Y-m-d', true); + $message = $formatter->format( + array( + 'message' => "foo\nbar", + 'context' => array(), + 'extra' => array(), + ) + ); + + $this->assertRegExp('/foo\nbar/', $message); + } +} + +class TestFoo +{ + public $foo = 'foo'; +} + +class TestBar +{ + public function __toString() + { + return 'bar'; + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php new file mode 100644 index 00000000..6d59b3f3 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php @@ -0,0 +1,40 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\TestCase; + +class LogglyFormatterTest extends TestCase +{ + /** + * @covers Monolog\Formatter\LogglyFormatter::__construct + */ + public function testConstruct() + { + $formatter = new LogglyFormatter(); + $this->assertEquals(LogglyFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode()); + $formatter = new LogglyFormatter(LogglyFormatter::BATCH_MODE_JSON); + $this->assertEquals(LogglyFormatter::BATCH_MODE_JSON, $formatter->getBatchMode()); + } + + /** + * @covers Monolog\Formatter\LogglyFormatter::format + */ + public function testFormat() + { + $formatter = new LogglyFormatter(); + $record = $this->getRecord(); + $formatted_decoded = json_decode($formatter->format($record), true); + $this->assertArrayHasKey("timestamp", $formatted_decoded); + $this->assertEquals(new \DateTime($formatted_decoded["timestamp"]), $record["datetime"]); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php new file mode 100644 index 00000000..de4a3c2c --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php @@ -0,0 +1,289 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class LogstashFormatterTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testDefaultFormatter() + { + $formatter = new LogstashFormatter('test', 'hostname'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']); + $this->assertEquals('log', $message['@message']); + $this->assertEquals('meh', $message['@fields']['channel']); + $this->assertContains('meh', $message['@tags']); + $this->assertEquals(Logger::ERROR, $message['@fields']['level']); + $this->assertEquals('test', $message['@type']); + $this->assertEquals('hostname', $message['@source']); + + $formatter = new LogstashFormatter('mysystem'); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals('mysystem', $message['@type']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithFileAndLine() + { + $formatter = new LogstashFormatter('test'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals('test', $message['@fields']['file']); + $this->assertEquals(14, $message['@fields']['line']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithContext() + { + $formatter = new LogstashFormatter('test'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = json_decode($formatter->format($record), true); + + $message_array = $message['@fields']; + + $this->assertArrayHasKey('ctxt_from', $message_array); + $this->assertEquals('logger', $message_array['ctxt_from']); + + // Test with extraPrefix + $formatter = new LogstashFormatter('test', null, null, 'CTX'); + $message = json_decode($formatter->format($record), true); + + $message_array = $message['@fields']; + + $this->assertArrayHasKey('CTXfrom', $message_array); + $this->assertEquals('logger', $message_array['CTXfrom']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithExtra() + { + $formatter = new LogstashFormatter('test'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = json_decode($formatter->format($record), true); + + $message_array = $message['@fields']; + + $this->assertArrayHasKey('key', $message_array); + $this->assertEquals('pair', $message_array['key']); + + // Test with extraPrefix + $formatter = new LogstashFormatter('test', null, 'EXT'); + $message = json_decode($formatter->format($record), true); + + $message_array = $message['@fields']; + + $this->assertArrayHasKey('EXTkey', $message_array); + $this->assertEquals('pair', $message_array['EXTkey']); + } + + public function testFormatWithApplicationName() + { + $formatter = new LogstashFormatter('app', 'test'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('@type', $message); + $this->assertEquals('app', $message['@type']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testDefaultFormatterV1() + { + $formatter = new LogstashFormatter('test', 'hostname', null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']); + $this->assertEquals("1", $message['@version']); + $this->assertEquals('log', $message['message']); + $this->assertEquals('meh', $message['channel']); + $this->assertEquals('ERROR', $message['level']); + $this->assertEquals('test', $message['type']); + $this->assertEquals('hostname', $message['host']); + + $formatter = new LogstashFormatter('mysystem', null, null, 'ctxt_', LogstashFormatter::V1); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals('mysystem', $message['type']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithFileAndLineV1() + { + $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals('test', $message['file']); + $this->assertEquals(14, $message['line']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithContextV1() + { + $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('ctxt_from', $message); + $this->assertEquals('logger', $message['ctxt_from']); + + // Test with extraPrefix + $formatter = new LogstashFormatter('test', null, null, 'CTX', LogstashFormatter::V1); + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('CTXfrom', $message); + $this->assertEquals('logger', $message['CTXfrom']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithExtraV1() + { + $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('key', $message); + $this->assertEquals('pair', $message['key']); + + // Test with extraPrefix + $formatter = new LogstashFormatter('test', null, 'EXT', 'ctxt_', LogstashFormatter::V1); + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('EXTkey', $message); + $this->assertEquals('pair', $message['EXTkey']); + } + + public function testFormatWithApplicationNameV1() + { + $formatter = new LogstashFormatter('app', 'test', null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('type', $message); + $this->assertEquals('app', $message['type']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php new file mode 100644 index 00000000..1554ef46 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php @@ -0,0 +1,253 @@ +<?php + +namespace Monolog\Formatter; + +use Monolog\Logger; + +/** + * @author Florian Plattner <me@florianplattner.de> + */ +class MongoDBFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function setUp() + { + if (!class_exists('MongoDate')) { + $this->markTestSkipped('mongo extension not installed'); + } + } + + public function constructArgumentProvider() + { + return array( + array(1, true, 1, true), + array(0, false, 0, false), + ); + } + + /** + * @param $traceDepth + * @param $traceAsString + * @param $expectedTraceDepth + * @param $expectedTraceAsString + * + * @dataProvider constructArgumentProvider + */ + public function testConstruct($traceDepth, $traceAsString, $expectedTraceDepth, $expectedTraceAsString) + { + $formatter = new MongoDBFormatter($traceDepth, $traceAsString); + + $reflTrace = new \ReflectionProperty($formatter, 'exceptionTraceAsString'); + $reflTrace->setAccessible(true); + $this->assertEquals($expectedTraceAsString, $reflTrace->getValue($formatter)); + + $reflDepth = new\ReflectionProperty($formatter, 'maxNestingLevel'); + $reflDepth->setAccessible(true); + $this->assertEquals($expectedTraceDepth, $reflDepth->getValue($formatter)); + } + + public function testSimpleFormat() + { + $record = array( + 'message' => 'some log message', + 'context' => array(), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(); + $formattedRecord = $formatter->format($record); + + $this->assertCount(7, $formattedRecord); + $this->assertEquals('some log message', $formattedRecord['message']); + $this->assertEquals(array(), $formattedRecord['context']); + $this->assertEquals(Logger::WARNING, $formattedRecord['level']); + $this->assertEquals(Logger::getLevelName(Logger::WARNING), $formattedRecord['level_name']); + $this->assertEquals('test', $formattedRecord['channel']); + $this->assertInstanceOf('\MongoDate', $formattedRecord['datetime']); + $this->assertEquals('0.00000000 1391212800', $formattedRecord['datetime']->__toString()); + $this->assertEquals(array(), $formattedRecord['extra']); + } + + public function testRecursiveFormat() + { + $someObject = new \stdClass(); + $someObject->foo = 'something'; + $someObject->bar = 'stuff'; + + $record = array( + 'message' => 'some log message', + 'context' => array( + 'stuff' => new \DateTime('2014-02-01 02:31:33'), + 'some_object' => $someObject, + 'context_string' => 'some string', + 'context_int' => 123456, + 'except' => new \Exception('exception message', 987), + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(); + $formattedRecord = $formatter->format($record); + + $this->assertCount(5, $formattedRecord['context']); + $this->assertInstanceOf('\MongoDate', $formattedRecord['context']['stuff']); + $this->assertEquals('0.00000000 1391221893', $formattedRecord['context']['stuff']->__toString()); + $this->assertEquals( + array( + 'foo' => 'something', + 'bar' => 'stuff', + 'class' => 'stdClass', + ), + $formattedRecord['context']['some_object'] + ); + $this->assertEquals('some string', $formattedRecord['context']['context_string']); + $this->assertEquals(123456, $formattedRecord['context']['context_int']); + + $this->assertCount(5, $formattedRecord['context']['except']); + $this->assertEquals('exception message', $formattedRecord['context']['except']['message']); + $this->assertEquals(987, $formattedRecord['context']['except']['code']); + $this->assertInternalType('string', $formattedRecord['context']['except']['file']); + $this->assertInternalType('integer', $formattedRecord['context']['except']['code']); + $this->assertInternalType('string', $formattedRecord['context']['except']['trace']); + $this->assertEquals('Exception', $formattedRecord['context']['except']['class']); + } + + public function testFormatDepthArray() + { + $record = array( + 'message' => 'some log message', + 'context' => array( + 'nest2' => array( + 'property' => 'anything', + 'nest3' => array( + 'nest4' => 'value', + 'property' => 'nothing' + ) + ) + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(2); + $formattedResult = $formatter->format($record); + + $this->assertEquals( + array( + 'nest2' => array( + 'property' => 'anything', + 'nest3' => '[...]', + ) + ), + $formattedResult['context'] + ); + } + + public function testFormatDepthArrayInfiniteNesting() + { + $record = array( + 'message' => 'some log message', + 'context' => array( + 'nest2' => array( + 'property' => 'something', + 'nest3' => array( + 'property' => 'anything', + 'nest4' => array( + 'property' => 'nothing', + ), + ) + ) + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(0); + $formattedResult = $formatter->format($record); + + $this->assertEquals( + array( + 'nest2' => array( + 'property' => 'something', + 'nest3' => array( + 'property' => 'anything', + 'nest4' => array( + 'property' => 'nothing', + ) + ), + ) + ), + $formattedResult['context'] + ); + } + + public function testFormatDepthObjects() + { + $someObject = new \stdClass(); + $someObject->property = 'anything'; + $someObject->nest3 = new \stdClass(); + $someObject->nest3->property = 'nothing'; + $someObject->nest3->nest4 = 'invisible'; + + $record = array( + 'message' => 'some log message', + 'context' => array( + 'nest2' => $someObject + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(2, true); + $formattedResult = $formatter->format($record); + + $this->assertEquals( + array( + 'nest2' => array( + 'property' => 'anything', + 'nest3' => '[...]', + 'class' => 'stdClass', + ), + ), + $formattedResult['context'] + ); + } + + public function testFormatDepthException() + { + $record = array( + 'message' => 'some log message', + 'context' => array( + 'nest2' => new \Exception('exception message', 987), + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(2, false); + $formattedRecord = $formatter->format($record); + + $this->assertEquals('exception message', $formattedRecord['context']['nest2']['message']); + $this->assertEquals(987, $formattedRecord['context']['nest2']['code']); + $this->assertEquals('[...]', $formattedRecord['context']['nest2']['trace']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php new file mode 100644 index 00000000..00bbb249 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php @@ -0,0 +1,247 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * @covers Monolog\Formatter\NormalizerFormatter + */ +class NormalizerFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function testFormat() + { + $formatter = new NormalizerFormatter('Y-m-d'); + $formatted = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'message' => 'foo', + 'datetime' => new \DateTime, + 'extra' => array('foo' => new TestFooNorm, 'bar' => new TestBarNorm, 'baz' => array(), 'res' => fopen('php://memory', 'rb')), + 'context' => array( + 'foo' => 'bar', + 'baz' => 'qux', + ), + )); + + $this->assertEquals(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'message' => 'foo', + 'datetime' => date('Y-m-d'), + 'extra' => array( + 'foo' => '[object] (Monolog\\Formatter\\TestFooNorm: {"foo":"foo"})', + 'bar' => '[object] (Monolog\\Formatter\\TestBarNorm: {})', + 'baz' => array(), + 'res' => '[resource]', + ), + 'context' => array( + 'foo' => 'bar', + 'baz' => 'qux', + ) + ), $formatted); + } + + public function testFormatExceptions() + { + $formatter = new NormalizerFormatter('Y-m-d'); + $e = new \LogicException('bar'); + $e2 = new \RuntimeException('foo', 0, $e); + $formatted = $formatter->format(array( + 'exception' => $e2, + )); + + $this->assertGreaterThan(5, count($formatted['exception']['trace'])); + $this->assertTrue(isset($formatted['exception']['previous'])); + unset($formatted['exception']['trace'], $formatted['exception']['previous']); + + $this->assertEquals(array( + 'exception' => array( + 'class' => get_class($e2), + 'message' => $e2->getMessage(), + 'code' => $e2->getCode(), + 'file' => $e2->getFile().':'.$e2->getLine(), + ) + ), $formatted); + } + + public function testBatchFormat() + { + $formatter = new NormalizerFormatter('Y-m-d'); + $formatted = $formatter->formatBatch(array( + array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + ), + array( + 'level_name' => 'WARNING', + 'channel' => 'log', + 'message' => 'foo', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + ), + )); + $this->assertEquals(array( + array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array(), + 'datetime' => date('Y-m-d'), + 'extra' => array(), + ), + array( + 'level_name' => 'WARNING', + 'channel' => 'log', + 'message' => 'foo', + 'context' => array(), + 'datetime' => date('Y-m-d'), + 'extra' => array(), + ), + ), $formatted); + } + + /** + * Test issue #137 + */ + public function testIgnoresRecursiveObjectReferences() + { + // set up the recursion + $foo = new \stdClass(); + $bar = new \stdClass(); + + $foo->bar = $bar; + $bar->foo = $foo; + + // set an error handler to assert that the error is not raised anymore + $that = $this; + set_error_handler(function ($level, $message, $file, $line, $context) use ($that) { + if (error_reporting() & $level) { + restore_error_handler(); + $that->fail("$message should not be raised"); + } + }); + + $formatter = new NormalizerFormatter(); + $reflMethod = new \ReflectionMethod($formatter, 'toJson'); + $reflMethod->setAccessible(true); + $res = $reflMethod->invoke($formatter, array($foo, $bar), true); + + restore_error_handler(); + + $this->assertEquals(@json_encode(array($foo, $bar)), $res); + } + + public function testIgnoresInvalidTypes() + { + // set up the recursion + $resource = fopen(__FILE__, 'r'); + + // set an error handler to assert that the error is not raised anymore + $that = $this; + set_error_handler(function ($level, $message, $file, $line, $context) use ($that) { + if (error_reporting() & $level) { + restore_error_handler(); + $that->fail("$message should not be raised"); + } + }); + + $formatter = new NormalizerFormatter(); + $reflMethod = new \ReflectionMethod($formatter, 'toJson'); + $reflMethod->setAccessible(true); + $res = $reflMethod->invoke($formatter, array($resource), true); + + restore_error_handler(); + + $this->assertEquals(@json_encode(array($resource)), $res); + } + + public function testExceptionTraceWithArgs() + { + if (defined('HHVM_VERSION')) { + $this->markTestSkipped('Not supported in HHVM since it detects errors differently'); + } + + // This happens i.e. in React promises or Guzzle streams where stream wrappers are registered + // and no file or line are included in the trace because it's treated as internal function + set_error_handler(function ($errno, $errstr, $errfile, $errline) { + throw new \ErrorException($errstr, 0, $errno, $errfile, $errline); + }); + + try { + // This will contain $resource and $wrappedResource as arguments in the trace item + $resource = fopen('php://memory', 'rw+'); + fwrite($resource, 'test_resource'); + $wrappedResource = new TestStreamFoo($resource); + // Just do something stupid with a resource/wrapped resource as argument + array_keys($wrappedResource); + } catch (\Exception $e) { + restore_error_handler(); + } + + $formatter = new NormalizerFormatter(); + $record = array('context' => array('exception' => $e)); + $result = $formatter->format($record); + + $this->assertRegExp( + '%"resource":"\[resource\]"%', + $result['context']['exception']['trace'][0] + ); + + if (version_compare(PHP_VERSION, '5.5.0', '>=')) { + $pattern = '%"wrappedResource":"\[object\] \(Monolog\\\\\\\\Formatter\\\\\\\\TestStreamFoo: \)"%'; + } else { + $pattern = '%\\\\"resource\\\\":null%'; + } + + // Tests that the wrapped resource is ignored while encoding, only works for PHP <= 5.4 + $this->assertRegExp( + $pattern, + $result['context']['exception']['trace'][0] + ); + } +} + +class TestFooNorm +{ + public $foo = 'foo'; +} + +class TestBarNorm +{ + public function __toString() + { + return 'bar'; + } +} + +class TestStreamFoo +{ + public $foo; + public $resource; + + public function __construct($resource) + { + $this->resource = $resource; + $this->foo = 'BAR'; + } + + public function __toString() + { + fseek($this->resource, 0); + + return $this->foo . ' - ' . (string) stream_get_contents($this->resource); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php new file mode 100644 index 00000000..c5a4ebb5 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php @@ -0,0 +1,98 @@ +<?php +namespace Monolog\Formatter; + +class ScalarFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function setUp() + { + $this->formatter = new ScalarFormatter(); + } + + public function buildTrace(\Exception $e) + { + $data = array(); + $trace = $e->getTrace(); + foreach ($trace as $frame) { + if (isset($frame['file'])) { + $data[] = $frame['file'].':'.$frame['line']; + } else { + $data[] = json_encode($frame); + } + } + + return $data; + } + + public function encodeJson($data) + { + if (version_compare(PHP_VERSION, '5.4.0', '>=')) { + return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE); + } + + return json_encode($data); + } + + public function testFormat() + { + $exception = new \Exception('foo'); + $formatted = $this->formatter->format(array( + 'foo' => 'string', + 'bar' => 1, + 'baz' => false, + 'bam' => array(1, 2, 3), + 'bat' => array('foo' => 'bar'), + 'bap' => \DateTime::createFromFormat(\DateTime::ISO8601, '1970-01-01T00:00:00+0000'), + 'ban' => $exception + )); + + $this->assertSame(array( + 'foo' => 'string', + 'bar' => 1, + 'baz' => false, + 'bam' => $this->encodeJson(array(1, 2, 3)), + 'bat' => $this->encodeJson(array('foo' => 'bar')), + 'bap' => '1970-01-01 00:00:00', + 'ban' => $this->encodeJson(array( + 'class' => get_class($exception), + 'message' => $exception->getMessage(), + 'code' => $exception->getCode(), + 'file' => $exception->getFile() . ':' . $exception->getLine(), + 'trace' => $this->buildTrace($exception) + )) + ), $formatted); + } + + public function testFormatWithErrorContext() + { + $context = array('file' => 'foo', 'line' => 1); + $formatted = $this->formatter->format(array( + 'context' => $context + )); + + $this->assertSame(array( + 'context' => $this->encodeJson($context) + ), $formatted); + } + + public function testFormatWithExceptionContext() + { + $exception = new \Exception('foo'); + $formatted = $this->formatter->format(array( + 'context' => array( + 'exception' => $exception + ) + )); + + $this->assertSame(array( + 'context' => $this->encodeJson(array( + 'exception' => array( + 'class' => get_class($exception), + 'message' => $exception->getMessage(), + 'code' => $exception->getCode(), + 'file' => $exception->getFile() . ':' . $exception->getLine(), + 'trace' => $this->buildTrace($exception) + ) + )) + ), $formatted); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php new file mode 100644 index 00000000..52f15a36 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php @@ -0,0 +1,142 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class WildfireFormatterTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Formatter\WildfireFormatter::format + */ + public function testDefaultFormat() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('ip' => '127.0.0.1'), + 'message' => 'log', + ); + + $message = $wildfire->format($record); + + $this->assertEquals( + '125|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},' + .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|', + $message + ); + } + + /** + * @covers Monolog\Formatter\WildfireFormatter::format + */ + public function testFormatWithFileAndLine() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = $wildfire->format($record); + + $this->assertEquals( + '129|[{"Type":"ERROR","File":"test","Line":14,"Label":"meh"},' + .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|', + $message + ); + } + + /** + * @covers Monolog\Formatter\WildfireFormatter::format + */ + public function testFormatWithoutContext() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = $wildfire->format($record); + + $this->assertEquals( + '58|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},"log"]|', + $message + ); + } + + /** + * @covers Monolog\Formatter\WildfireFormatter::formatBatch + * @expectedException BadMethodCallException + */ + public function testBatchFormatThrowException() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $wildfire->formatBatch(array($record)); + } + + /** + * @covers Monolog\Formatter\WildfireFormatter::format + */ + public function testTableFormat() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'table-channel', + 'context' => array( + WildfireFormatter::TABLE => array( + array('col1', 'col2', 'col3'), + array('val1', 'val2', 'val3'), + array('foo1', 'foo2', 'foo3'), + array('bar1', 'bar2', 'bar3'), + ), + ), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'table-message', + ); + + $message = $wildfire->format($record); + + $this->assertEquals( + '171|[{"Type":"TABLE","File":"","Line":"","Label":"table-channel: table-message"},[["col1","col2","col3"],["val1","val2","val3"],["foo1","foo2","foo3"],["bar1","bar2","bar3"]]]|', + $message + ); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Functional/Handler/FirePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Functional/Handler/FirePHPHandlerTest.php new file mode 100644 index 00000000..7e4e7eb5 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Functional/Handler/FirePHPHandlerTest.php @@ -0,0 +1,32 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +spl_autoload_register(function ($class) { + $file = __DIR__.'/../../../../src/'.strtr($class, '\\', '/').'.php'; + if (file_exists($file)) { + require $file; + + return true; + } +}); + +use Monolog\Logger; +use Monolog\Handler\FirePHPHandler; +use Monolog\Handler\ChromePHPHandler; + +$logger = new Logger('firephp'); +$logger->pushHandler(new FirePHPHandler); +$logger->pushHandler(new ChromePHPHandler()); + +$logger->addDebug('Debug'); +$logger->addInfo('Info'); +$logger->addWarning('Warning'); +$logger->addError('Error'); diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php new file mode 100644 index 00000000..568eb9da --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php @@ -0,0 +1,115 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; +use Monolog\Processor\WebProcessor; + +class AbstractHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\AbstractHandler::__construct + * @covers Monolog\Handler\AbstractHandler::getLevel + * @covers Monolog\Handler\AbstractHandler::setLevel + * @covers Monolog\Handler\AbstractHandler::getBubble + * @covers Monolog\Handler\AbstractHandler::setBubble + * @covers Monolog\Handler\AbstractHandler::getFormatter + * @covers Monolog\Handler\AbstractHandler::setFormatter + */ + public function testConstructAndGetSet() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false)); + $this->assertEquals(Logger::WARNING, $handler->getLevel()); + $this->assertEquals(false, $handler->getBubble()); + + $handler->setLevel(Logger::ERROR); + $handler->setBubble(true); + $handler->setFormatter($formatter = new LineFormatter); + $this->assertEquals(Logger::ERROR, $handler->getLevel()); + $this->assertEquals(true, $handler->getBubble()); + $this->assertSame($formatter, $handler->getFormatter()); + } + + /** + * @covers Monolog\Handler\AbstractHandler::handleBatch + */ + public function testHandleBatch() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); + $handler->expects($this->exactly(2)) + ->method('handle'); + $handler->handleBatch(array($this->getRecord(), $this->getRecord())); + } + + /** + * @covers Monolog\Handler\AbstractHandler::isHandling + */ + public function testIsHandling() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false)); + $this->assertTrue($handler->isHandling($this->getRecord())); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\AbstractHandler::__construct + */ + public function testHandlesPsrStyleLevels() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array('warning', false)); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + $handler->setLevel('debug'); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\AbstractHandler::getFormatter + * @covers Monolog\Handler\AbstractHandler::getDefaultFormatter + */ + public function testGetFormatterInitializesDefault() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); + $this->assertInstanceOf('Monolog\Formatter\LineFormatter', $handler->getFormatter()); + } + + /** + * @covers Monolog\Handler\AbstractHandler::pushProcessor + * @covers Monolog\Handler\AbstractHandler::popProcessor + * @expectedException LogicException + */ + public function testPushPopProcessor() + { + $logger = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); + $processor1 = new WebProcessor; + $processor2 = new WebProcessor; + + $logger->pushProcessor($processor1); + $logger->pushProcessor($processor2); + + $this->assertEquals($processor2, $logger->popProcessor()); + $this->assertEquals($processor1, $logger->popProcessor()); + $logger->popProcessor(); + } + + /** + * @covers Monolog\Handler\AbstractHandler::pushProcessor + * @expectedException InvalidArgumentException + */ + public function testPushProcessorWithNonCallable() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); + + $handler->pushProcessor(new \stdClass()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php new file mode 100644 index 00000000..24d4f63c --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php @@ -0,0 +1,80 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Processor\WebProcessor; + +class AbstractProcessingHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\AbstractProcessingHandler::handle + */ + public function testHandleLowerLevelMessage() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, true)); + $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\AbstractProcessingHandler::handle + */ + public function testHandleBubbling() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, true)); + $this->assertFalse($handler->handle($this->getRecord())); + } + + /** + * @covers Monolog\Handler\AbstractProcessingHandler::handle + */ + public function testHandleNotBubbling() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, false)); + $this->assertTrue($handler->handle($this->getRecord())); + } + + /** + * @covers Monolog\Handler\AbstractProcessingHandler::handle + */ + public function testHandleIsFalseWhenNotHandled() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, false)); + $this->assertTrue($handler->handle($this->getRecord())); + $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\AbstractProcessingHandler::processRecord + */ + public function testProcessRecord() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler'); + $handler->pushProcessor(new WebProcessor(array( + 'REQUEST_URI' => '', + 'REQUEST_METHOD' => '', + 'REMOTE_ADDR' => '', + 'SERVER_NAME' => '', + 'UNIQUE_ID' => '', + ))); + $handledRecord = null; + $handler->expects($this->once()) + ->method('write') + ->will($this->returnCallback(function ($record) use (&$handledRecord) { + $handledRecord = $record; + })) + ; + $handler->handle($this->getRecord()); + $this->assertEquals(6, count($handledRecord['extra'])); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php new file mode 100644 index 00000000..074d50c6 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php @@ -0,0 +1,137 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use PhpAmqpLib\Message\AMQPMessage; +use PhpAmqpLib\Channel\AMQPChannel; +use PhpAmqpLib\Connection\AMQPConnection; + +/** + * @covers Monolog\Handler\RotatingFileHandler + */ +class AmqpHandlerTest extends TestCase +{ + public function testHandleAmqpExt() + { + if (!class_exists('AMQPConnection') || !class_exists('AMQPExchange')) { + $this->markTestSkipped("amqp-php not installed"); + } + + if (!class_exists('AMQPChannel')) { + $this->markTestSkipped("Please update AMQP to version >= 1.0"); + } + + $messages = array(); + + $exchange = $this->getMock('AMQPExchange', array('publish', 'setName'), array(), '', false); + $exchange->expects($this->once()) + ->method('setName') + ->with('log') + ; + $exchange->expects($this->any()) + ->method('publish') + ->will($this->returnCallback(function ($message, $routing_key, $flags = 0, $attributes = array()) use (&$messages) { + $messages[] = array($message, $routing_key, $flags, $attributes); + })) + ; + + $handler = new AmqpHandler($exchange, 'log'); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + array( + 'message' => 'test', + 'context' => array( + 'data' => array(), + 'foo' => 34, + ), + 'level' => 300, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'extra' => array(), + ), + 'warn.test', + 0, + array( + 'delivery_mode' => 2, + 'Content-type' => 'application/json' + ) + ); + + $handler->handle($record); + + $this->assertCount(1, $messages); + $messages[0][0] = json_decode($messages[0][0], true); + unset($messages[0][0]['datetime']); + $this->assertEquals($expected, $messages[0]); + } + + public function testHandlePhpAmqpLib() + { + if (!class_exists('PhpAmqpLib\Connection\AMQPConnection')) { + $this->markTestSkipped("php-amqplib not installed"); + } + + $messages = array(); + + $exchange = $this->getMock('PhpAmqpLib\Channel\AMQPChannel', array('basic_publish', '__destruct'), array(), '', false); + + $exchange->expects($this->any()) + ->method('basic_publish') + ->will($this->returnCallback(function (AMQPMessage $msg, $exchange = "", $routing_key = "", $mandatory = false, $immediate = false, $ticket = null) use (&$messages) { + $messages[] = array($msg, $exchange, $routing_key, $mandatory, $immediate, $ticket); + })) + ; + + $handler = new AmqpHandler($exchange, 'log'); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + array( + 'message' => 'test', + 'context' => array( + 'data' => array(), + 'foo' => 34, + ), + 'level' => 300, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'extra' => array(), + ), + 'log', + 'warn.test', + false, + false, + null, + array( + 'delivery_mode' => 2, + 'content_type' => 'application/json' + ) + ); + + $handler->handle($record); + + $this->assertCount(1, $messages); + + /* @var $msg AMQPMessage */ + $msg = $messages[0][0]; + $messages[0][0] = json_decode($msg->body, true); + $messages[0][] = $msg->get_properties(); + unset($messages[0][0]['datetime']); + + $this->assertEquals($expected, $messages[0]); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php new file mode 100644 index 00000000..ffb1d746 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php @@ -0,0 +1,130 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\BrowserConsoleHandlerTest + */ +class BrowserConsoleHandlerTest extends TestCase +{ + protected function setUp() + { + BrowserConsoleHandler::reset(); + } + + protected function generateScript() + { + $reflMethod = new \ReflectionMethod('Monolog\Handler\BrowserConsoleHandler', 'generateScript'); + $reflMethod->setAccessible(true); + + return $reflMethod->invoke(null); + } + + public function testStyling() + { + $handler = new BrowserConsoleHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + + $handler->handle($this->getRecord(Logger::DEBUG, 'foo[[bar]]{color: red}')); + + $expected = <<<EOF +(function (c) {if (c && c.groupCollapsed) { +c.log("%cfoo%cbar%c", "font-weight: normal", "color: red", "font-weight: normal"); +}})(console); +EOF; + + $this->assertEquals($expected, $this->generateScript()); + } + + public function testEscaping() + { + $handler = new BrowserConsoleHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + + $handler->handle($this->getRecord(Logger::DEBUG, "[foo] [[\"bar\n[baz]\"]]{color: red}")); + + $expected = <<<EOF +(function (c) {if (c && c.groupCollapsed) { +c.log("%c[foo] %c\"bar\\n[baz]\"%c", "font-weight: normal", "color: red", "font-weight: normal"); +}})(console); +EOF; + + $this->assertEquals($expected, $this->generateScript()); + } + + public function testAutolabel() + { + $handler = new BrowserConsoleHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + + $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}')); + $handler->handle($this->getRecord(Logger::DEBUG, '[[bar]]{macro: autolabel}')); + $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}')); + + $expected = <<<EOF +(function (c) {if (c && c.groupCollapsed) { +c.log("%c%cfoo%c", "font-weight: normal", "background-color: blue; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal"); +c.log("%c%cbar%c", "font-weight: normal", "background-color: green; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal"); +c.log("%c%cfoo%c", "font-weight: normal", "background-color: blue; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal"); +}})(console); +EOF; + + $this->assertEquals($expected, $this->generateScript()); + } + + public function testContext() + { + $handler = new BrowserConsoleHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + + $handler->handle($this->getRecord(Logger::DEBUG, 'test', array('foo' => 'bar'))); + + $expected = <<<EOF +(function (c) {if (c && c.groupCollapsed) { +c.groupCollapsed("%ctest", "font-weight: normal"); +c.log("%c%s", "font-weight: bold", "Context"); +c.log("%s: %o", "foo", "bar"); +c.groupEnd(); +}})(console); +EOF; + + $this->assertEquals($expected, $this->generateScript()); + } + + public function testConcurrentHandlers() + { + $handler1 = new BrowserConsoleHandler(); + $handler1->setFormatter($this->getIdentityFormatter()); + + $handler2 = new BrowserConsoleHandler(); + $handler2->setFormatter($this->getIdentityFormatter()); + + $handler1->handle($this->getRecord(Logger::DEBUG, 'test1')); + $handler2->handle($this->getRecord(Logger::DEBUG, 'test2')); + $handler1->handle($this->getRecord(Logger::DEBUG, 'test3')); + $handler2->handle($this->getRecord(Logger::DEBUG, 'test4')); + + $expected = <<<EOF +(function (c) {if (c && c.groupCollapsed) { +c.log("%ctest1", "font-weight: normal"); +c.log("%ctest2", "font-weight: normal"); +c.log("%ctest3", "font-weight: normal"); +c.log("%ctest4", "font-weight: normal"); +}})(console); +EOF; + + $this->assertEquals($expected, $this->generateScript()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php new file mode 100644 index 00000000..da8b3c39 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php @@ -0,0 +1,158 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class BufferHandlerTest extends TestCase +{ + private $shutdownCheckHandler; + + /** + * @covers Monolog\Handler\BufferHandler::__construct + * @covers Monolog\Handler\BufferHandler::handle + * @covers Monolog\Handler\BufferHandler::close + */ + public function testHandleBuffers() + { + $test = new TestHandler(); + $handler = new BufferHandler($test); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + $handler->close(); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + + /** + * @covers Monolog\Handler\BufferHandler::close + * @covers Monolog\Handler\BufferHandler::flush + */ + public function testPropagatesRecordsAtEndOfRequest() + { + $test = new TestHandler(); + $handler = new BufferHandler($test); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->shutdownCheckHandler = $test; + register_shutdown_function(array($this, 'checkPropagation')); + } + + public function checkPropagation() + { + if (!$this->shutdownCheckHandler->hasWarningRecords() || !$this->shutdownCheckHandler->hasDebugRecords()) { + echo '!!! BufferHandlerTest::testPropagatesRecordsAtEndOfRequest failed to verify that the messages have been propagated' . PHP_EOL; + exit(1); + } + } + + /** + * @covers Monolog\Handler\BufferHandler::handle + */ + public function testHandleBufferLimit() + { + $test = new TestHandler(); + $handler = new BufferHandler($test, 2); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertFalse($test->hasDebugRecords()); + } + + /** + * @covers Monolog\Handler\BufferHandler::handle + */ + public function testHandleBufferLimitWithFlushOnOverflow() + { + $test = new TestHandler(); + $handler = new BufferHandler($test, 3, Logger::DEBUG, true, true); + + // send two records + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertCount(0, $test->getRecords()); + + // overflow + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertTrue($test->hasDebugRecords()); + $this->assertCount(3, $test->getRecords()); + + // should buffer again + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertCount(3, $test->getRecords()); + + $handler->close(); + $this->assertCount(5, $test->getRecords()); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\BufferHandler::handle + */ + public function testHandleLevel() + { + $test = new TestHandler(); + $handler = new BufferHandler($test, 0, Logger::INFO); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertFalse($test->hasDebugRecords()); + } + + /** + * @covers Monolog\Handler\BufferHandler::flush + */ + public function testFlush() + { + $test = new TestHandler(); + $handler = new BufferHandler($test, 0); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->flush(); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue($test->hasDebugRecords()); + $this->assertFalse($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\BufferHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new BufferHandler($test); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->flush(); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php new file mode 100644 index 00000000..2f55faf8 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php @@ -0,0 +1,141 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\ChromePHPHandler + */ +class ChromePHPHandlerTest extends TestCase +{ + protected function setUp() + { + TestChromePHPHandler::reset(); + $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; Chrome/1.0'; + } + + public function testHeaders() + { + $handler = new TestChromePHPHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + + $expected = array( + 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array( + 'version' => ChromePHPHandler::VERSION, + 'columns' => array('label', 'log', 'backtrace', 'type'), + 'rows' => array( + 'test', + 'test', + ), + 'request_uri' => '', + )))) + ); + + $this->assertEquals($expected, $handler->getHeaders()); + } + + public function testHeadersOverflow() + { + $handler = new TestChromePHPHandler(); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 150*1024))); + + // overflow chrome headers limit + $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 100*1024))); + + $expected = array( + 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array( + 'version' => ChromePHPHandler::VERSION, + 'columns' => array('label', 'log', 'backtrace', 'type'), + 'rows' => array( + array( + 'test', + 'test', + 'unknown', + 'log', + ), + array( + 'test', + str_repeat('a', 150*1024), + 'unknown', + 'warn', + ), + array( + 'monolog', + 'Incomplete logs, chrome header size limit reached', + 'unknown', + 'warn', + ), + ), + 'request_uri' => '', + )))) + ); + + $this->assertEquals($expected, $handler->getHeaders()); + } + + public function testConcurrentHandlers() + { + $handler = new TestChromePHPHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + + $handler2 = new TestChromePHPHandler(); + $handler2->setFormatter($this->getIdentityFormatter()); + $handler2->handle($this->getRecord(Logger::DEBUG)); + $handler2->handle($this->getRecord(Logger::WARNING)); + + $expected = array( + 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array( + 'version' => ChromePHPHandler::VERSION, + 'columns' => array('label', 'log', 'backtrace', 'type'), + 'rows' => array( + 'test', + 'test', + 'test', + 'test', + ), + 'request_uri' => '', + )))) + ); + + $this->assertEquals($expected, $handler2->getHeaders()); + } +} + +class TestChromePHPHandler extends ChromePHPHandler +{ + protected $headers = array(); + + public static function reset() + { + self::$initialized = false; + self::$overflowed = false; + self::$sendHeaders = true; + self::$json['rows'] = array(); + } + + protected function sendHeader($header, $content) + { + $this->headers[$header] = $content; + } + + public function getHeaders() + { + return $this->headers; + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php new file mode 100644 index 00000000..78a1d15c --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php @@ -0,0 +1,41 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class CouchDBHandlerTest extends TestCase +{ + public function testHandle() + { + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + 'message' => 'test', + 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34), + 'level' => Logger::WARNING, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'datetime' => $record['datetime']->format('Y-m-d H:i:s'), + 'extra' => array(), + ); + + $handler = new CouchDBHandler(); + + try { + $handler->handle($record); + } catch (\RuntimeException $e) { + $this->markTestSkipped('Could not connect to couchdb server on http://localhost:5984'); + } + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php new file mode 100644 index 00000000..d67da90a --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php @@ -0,0 +1,52 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class DoctrineCouchDBHandlerTest extends TestCase +{ + protected function setup() + { + if (!class_exists('Doctrine\CouchDB\CouchDBClient')) { + $this->markTestSkipped('The "doctrine/couchdb" package is not installed'); + } + } + + public function testHandle() + { + $client = $this->getMockBuilder('Doctrine\\CouchDB\\CouchDBClient') + ->setMethods(array('postDocument')) + ->disableOriginalConstructor() + ->getMock(); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + 'message' => 'test', + 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34), + 'level' => Logger::WARNING, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'datetime' => $record['datetime']->format('Y-m-d H:i:s'), + 'extra' => array(), + ); + + $client->expects($this->once()) + ->method('postDocument') + ->with($expected); + + $handler = new DoctrineCouchDBHandler($client); + $handler->handle($record); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php new file mode 100644 index 00000000..a38a8cb7 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php @@ -0,0 +1,73 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +class DynamoDbHandlerTest extends TestCase +{ + public function setUp() + { + if (!class_exists('Aws\DynamoDb\DynamoDbClient')) { + $this->markTestSkipped('aws/aws-sdk-php not installed'); + } + + $this->client = $this->getMockBuilder('Aws\DynamoDb\DynamoDbClient') + ->setMethods(array('formatAttributes', '__call')) + ->disableOriginalConstructor()->getMock(); + } + + public function testConstruct() + { + $this->assertInstanceOf('Monolog\Handler\DynamoDbHandler', new DynamoDbHandler($this->client, 'foo')); + } + + public function testInterface() + { + $this->assertInstanceOf('Monolog\Handler\HandlerInterface', new DynamoDbHandler($this->client, 'foo')); + } + + public function testGetFormatter() + { + $handler = new DynamoDbHandler($this->client, 'foo'); + $this->assertInstanceOf('Monolog\Formatter\ScalarFormatter', $handler->getFormatter()); + } + + public function testHandle() + { + $record = $this->getRecord(); + $formatter = $this->getMock('Monolog\Formatter\FormatterInterface'); + $formatted = array('foo' => 1, 'bar' => 2); + $handler = new DynamoDbHandler($this->client, 'foo'); + $handler->setFormatter($formatter); + + $formatter + ->expects($this->once()) + ->method('format') + ->with($record) + ->will($this->returnValue($formatted)); + $this->client + ->expects($this->once()) + ->method('formatAttributes') + ->with($this->isType('array')) + ->will($this->returnValue($formatted)); + $this->client + ->expects($this->once()) + ->method('__call') + ->with('putItem', array(array( + 'TableName' => 'foo', + 'Item' => $formatted + ))); + + $handler->handle($record); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php new file mode 100644 index 00000000..1687074b --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php @@ -0,0 +1,239 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\ElasticaFormatter; +use Monolog\Formatter\NormalizerFormatter; +use Monolog\TestCase; +use Monolog\Logger; +use Elastica\Client; +use Elastica\Request; +use Elastica\Response; + +class ElasticSearchHandlerTest extends TestCase +{ + /** + * @var Client mock + */ + protected $client; + + /** + * @var array Default handler options + */ + protected $options = array( + 'index' => 'my_index', + 'type' => 'doc_type', + ); + + public function setUp() + { + // Elastica lib required + if (!class_exists("Elastica\Client")) { + $this->markTestSkipped("ruflin/elastica not installed"); + } + + // base mock Elastica Client object + $this->client = $this->getMockBuilder('Elastica\Client') + ->setMethods(array('addDocuments')) + ->disableOriginalConstructor() + ->getMock(); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::write + * @covers Monolog\Handler\ElasticSearchHandler::handleBatch + * @covers Monolog\Handler\ElasticSearchHandler::bulkSend + * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter + */ + public function testHandle() + { + // log message + $msg = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + // format expected result + $formatter = new ElasticaFormatter($this->options['index'], $this->options['type']); + $expected = array($formatter->format($msg)); + + // setup ES client mock + $this->client->expects($this->any()) + ->method('addDocuments') + ->with($expected); + + // perform tests + $handler = new ElasticSearchHandler($this->client, $this->options); + $handler->handle($msg); + $handler->handleBatch(array($msg)); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::setFormatter + */ + public function testSetFormatter() + { + $handler = new ElasticSearchHandler($this->client); + $formatter = new ElasticaFormatter('index_new', 'type_new'); + $handler->setFormatter($formatter); + $this->assertInstanceOf('Monolog\Formatter\ElasticaFormatter', $handler->getFormatter()); + $this->assertEquals('index_new', $handler->getFormatter()->getIndex()); + $this->assertEquals('type_new', $handler->getFormatter()->getType()); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::setFormatter + * @expectedException InvalidArgumentException + * @expectedExceptionMessage ElasticSearchHandler is only compatible with ElasticaFormatter + */ + public function testSetFormatterInvalid() + { + $handler = new ElasticSearchHandler($this->client); + $formatter = new NormalizerFormatter(); + $handler->setFormatter($formatter); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::__construct + * @covers Monolog\Handler\ElasticSearchHandler::getOptions + */ + public function testOptions() + { + $expected = array( + 'index' => $this->options['index'], + 'type' => $this->options['type'], + 'ignore_error' => false, + ); + $handler = new ElasticSearchHandler($this->client, $this->options); + $this->assertEquals($expected, $handler->getOptions()); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::bulkSend + * @dataProvider providerTestConnectionErrors + */ + public function testConnectionErrors($ignore, $expectedError) + { + $clientOpts = array('host' => '127.0.0.1', 'port' => 1); + $client = new Client($clientOpts); + $handlerOpts = array('ignore_error' => $ignore); + $handler = new ElasticSearchHandler($client, $handlerOpts); + + if ($expectedError) { + $this->setExpectedException($expectedError[0], $expectedError[1]); + $handler->handle($this->getRecord()); + } else { + $this->assertFalse($handler->handle($this->getRecord())); + } + } + + /** + * @return array + */ + public function providerTestConnectionErrors() + { + return array( + array(false, array('RuntimeException', 'Error sending messages to Elasticsearch')), + array(true, false), + ); + } + + /** + * Integration test using localhost Elastic Search server + * + * @covers Monolog\Handler\ElasticSearchHandler::__construct + * @covers Monolog\Handler\ElasticSearchHandler::handleBatch + * @covers Monolog\Handler\ElasticSearchHandler::bulkSend + * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter + */ + public function testHandleIntegration() + { + $msg = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $expected = $msg; + $expected['datetime'] = $msg['datetime']->format(\DateTime::ISO8601); + $expected['context'] = array( + 'class' => '[object] (stdClass: {})', + 'foo' => 7, + 0 => 'bar', + ); + + $client = new Client(); + $handler = new ElasticSearchHandler($client, $this->options); + try { + $handler->handleBatch(array($msg)); + } catch (\RuntimeException $e) { + $this->markTestSkipped("Cannot connect to Elastic Search server on localhost"); + } + + // check document id from ES server response + $documentId = $this->getCreatedDocId($client->getLastResponse()); + $this->assertNotEmpty($documentId, 'No elastic document id received'); + + // retrieve document source from ES and validate + $document = $this->getDocSourceFromElastic( + $client, + $this->options['index'], + $this->options['type'], + $documentId + ); + $this->assertEquals($expected, $document); + + // remove test index from ES + $client->request("/{$this->options['index']}", Request::DELETE); + } + + /** + * Return last created document id from ES response + * @param Response $response Elastica Response object + * @return string|null + */ + protected function getCreatedDocId(Response $response) + { + $data = $response->getData(); + if (!empty($data['items'][0]['create']['_id'])) { + return $data['items'][0]['create']['_id']; + } + } + + /** + * Retrieve document by id from Elasticsearch + * @param Client $client Elastica client + * @param string $index + * @param string $type + * @param string $documentId + * @return array + */ + protected function getDocSourceFromElastic(Client $client, $index, $type, $documentId) + { + $resp = $client->request("/{$index}/{$type}/{$documentId}", Request::GET); + $data = $resp->getData(); + if (!empty($data['_source'])) { + return $data['_source']; + } + + return array(); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php new file mode 100644 index 00000000..99785cbb --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php @@ -0,0 +1,66 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; + +function error_log() +{ + $GLOBALS['error_log'][] = func_get_args(); +} + +class ErrorLogHandlerTest extends TestCase +{ + protected function setUp() + { + $GLOBALS['error_log'] = array(); + } + + /** + * @covers Monolog\Handler\ErrorLogHandler::__construct + * @expectedException InvalidArgumentException + * @expectedExceptionMessage The given message type "42" is not supported + */ + public function testShouldNotAcceptAnInvalidTypeOnContructor() + { + new ErrorLogHandler(42); + } + + /** + * @covers Monolog\Handler\ErrorLogHandler::write + */ + public function testShouldLogMessagesUsingErrorLogFuncion() + { + $type = ErrorLogHandler::OPERATING_SYSTEM; + $handler = new ErrorLogHandler($type); + $handler->setFormatter(new LineFormatter('%channel%.%level_name%: %message% %context% %extra%', null, true)); + $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz")); + + $this->assertSame("test.ERROR: Foo\nBar\r\n\r\nBaz [] []", $GLOBALS['error_log'][0][0]); + $this->assertSame($GLOBALS['error_log'][0][1], $type); + + $handler = new ErrorLogHandler($type, Logger::DEBUG, true, true); + $handler->setFormatter(new LineFormatter(null, null, true)); + $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz")); + + $this->assertStringMatchesFormat('[%s] test.ERROR: Foo', $GLOBALS['error_log'][1][0]); + $this->assertSame($GLOBALS['error_log'][1][1], $type); + + $this->assertStringMatchesFormat('Bar', $GLOBALS['error_log'][2][0]); + $this->assertSame($GLOBALS['error_log'][2][1], $type); + + $this->assertStringMatchesFormat('Baz [] []', $GLOBALS['error_log'][3][0]); + $this->assertSame($GLOBALS['error_log'][3][1], $type); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php new file mode 100644 index 00000000..31b7686a --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php @@ -0,0 +1,170 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\TestCase; + +class FilterHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\FilterHandler::isHandling + */ + public function testIsHandling() + { + $test = new TestHandler(); + $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::INFO))); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::NOTICE))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::WARNING))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::ERROR))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::CRITICAL))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::ALERT))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::EMERGENCY))); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + * @covers Monolog\Handler\FilterHandler::setAcceptedLevels + * @covers Monolog\Handler\FilterHandler::isHandling + */ + public function testHandleProcessOnlyNeededLevels() + { + $test = new TestHandler(); + $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE); + + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertTrue($test->hasInfoRecords()); + $handler->handle($this->getRecord(Logger::NOTICE)); + $this->assertTrue($test->hasNoticeRecords()); + + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertFalse($test->hasWarningRecords()); + $handler->handle($this->getRecord(Logger::ERROR)); + $this->assertFalse($test->hasErrorRecords()); + $handler->handle($this->getRecord(Logger::CRITICAL)); + $this->assertFalse($test->hasCriticalRecords()); + $handler->handle($this->getRecord(Logger::ALERT)); + $this->assertFalse($test->hasAlertRecords()); + $handler->handle($this->getRecord(Logger::EMERGENCY)); + $this->assertFalse($test->hasEmergencyRecords()); + + $test = new TestHandler(); + $handler = new FilterHandler($test, array(Logger::INFO, Logger::ERROR)); + + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertTrue($test->hasInfoRecords()); + $handler->handle($this->getRecord(Logger::NOTICE)); + $this->assertFalse($test->hasNoticeRecords()); + $handler->handle($this->getRecord(Logger::ERROR)); + $this->assertTrue($test->hasErrorRecords()); + $handler->handle($this->getRecord(Logger::CRITICAL)); + $this->assertFalse($test->hasCriticalRecords()); + } + + /** + * @covers Monolog\Handler\FilterHandler::setAcceptedLevels + * @covers Monolog\Handler\FilterHandler::getAcceptedLevels + */ + public function testAcceptedLevelApi() + { + $test = new TestHandler(); + $handler = new FilterHandler($test); + + $levels = array(Logger::INFO, Logger::ERROR); + $handler->setAcceptedLevels($levels); + $this->assertSame($levels, $handler->getAcceptedLevels()); + + $handler->setAcceptedLevels(array('info', 'error')); + $this->assertSame($levels, $handler->getAcceptedLevels()); + + $levels = array(Logger::CRITICAL, Logger::ALERT, Logger::EMERGENCY); + $handler->setAcceptedLevels(Logger::CRITICAL, Logger::EMERGENCY); + $this->assertSame($levels, $handler->getAcceptedLevels()); + + $handler->setAcceptedLevels('critical', 'emergency'); + $this->assertSame($levels, $handler->getAcceptedLevels()); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new FilterHandler($test, Logger::DEBUG, Logger::EMERGENCY); + $handler->pushProcessor( + function ($record) { + $record['extra']['foo'] = true; + + return $record; + } + ); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + */ + public function testHandleRespectsBubble() + { + $test = new TestHandler(); + + $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, false); + $this->assertTrue($handler->handle($this->getRecord(Logger::INFO))); + $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING))); + + $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, true); + $this->assertFalse($handler->handle($this->getRecord(Logger::INFO))); + $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING))); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + */ + public function testHandleWithCallback() + { + $test = new TestHandler(); + $handler = new FilterHandler( + function ($record, $handler) use ($test) { + return $test; + }, Logger::INFO, Logger::NOTICE, false + ); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + * @expectedException \RuntimeException + */ + public function testHandleWithBadCallbackThrowsException() + { + $handler = new FilterHandler( + function ($record, $handler) { + return 'foo'; + } + ); + $handler->handle($this->getRecord(Logger::WARNING)); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php new file mode 100644 index 00000000..a3d350d5 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php @@ -0,0 +1,240 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy; +use Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy; + +class FingersCrossedHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\FingersCrossedHandler::__construct + * @covers Monolog\Handler\FingersCrossedHandler::handle + */ + public function testHandleBuffers() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->close(); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 3); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + */ + public function testHandleStopsBufferingAfterTrigger() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasDebugRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + * @covers Monolog\Handler\FingersCrossedHandler::reset + */ + public function testHandleRestartBufferingAfterReset() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->reset(); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + */ + public function testHandleRestartBufferingAfterBeingTriggeredWhenStopBufferingIsDisabled() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, Logger::WARNING, 0, false, false); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + */ + public function testHandleBufferLimit() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, Logger::WARNING, 2); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertFalse($test->hasDebugRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + */ + public function testHandleWithCallback() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler(function ($record, $handler) use ($test) { + return $test; + }); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 3); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + * @expectedException RuntimeException + */ + public function testHandleWithBadCallbackThrowsException() + { + $handler = new FingersCrossedHandler(function ($record, $handler) { + return 'foo'; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::isHandling + */ + public function testIsHandlingAlways() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, Logger::ERROR); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::__construct + * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct + * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated + */ + public function testErrorLevelActivationStrategy() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::__construct + * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct + * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated + */ + public function testErrorLevelActivationStrategyWithPsrLevel() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy('warning')); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct + * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated + */ + public function testChannelLevelActivationStrategy() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy(Logger::ERROR, array('othertest' => Logger::DEBUG))); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertFalse($test->hasWarningRecords()); + $record = $this->getRecord(Logger::DEBUG); + $record['channel'] = 'othertest'; + $handler->handle($record); + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct + * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated + */ + public function testChannelLevelActivationStrategyWithPsrLevels() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy('error', array('othertest' => 'debug'))); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertFalse($test->hasWarningRecords()); + $record = $this->getRecord(Logger::DEBUG); + $record['channel'] = 'othertest'; + $handler->handle($record); + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, Logger::INFO); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::close + */ + public function testPassthruOnClose() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, Logger::INFO); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->close(); + $this->assertFalse($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php new file mode 100644 index 00000000..0eb10a63 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php @@ -0,0 +1,96 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\FirePHPHandler + */ +class FirePHPHandlerTest extends TestCase +{ + public function setUp() + { + TestFirePHPHandler::reset(); + $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; FirePHP/1.0'; + } + + public function testHeaders() + { + $handler = new TestFirePHPHandler; + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + + $expected = array( + 'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2', + 'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1', + 'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3', + 'X-Wf-1-1-1-1' => 'test', + 'X-Wf-1-1-1-2' => 'test', + ); + + $this->assertEquals($expected, $handler->getHeaders()); + } + + public function testConcurrentHandlers() + { + $handler = new TestFirePHPHandler; + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + + $handler2 = new TestFirePHPHandler; + $handler2->setFormatter($this->getIdentityFormatter()); + $handler2->handle($this->getRecord(Logger::DEBUG)); + $handler2->handle($this->getRecord(Logger::WARNING)); + + $expected = array( + 'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2', + 'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1', + 'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3', + 'X-Wf-1-1-1-1' => 'test', + 'X-Wf-1-1-1-2' => 'test', + ); + + $expected2 = array( + 'X-Wf-1-1-1-3' => 'test', + 'X-Wf-1-1-1-4' => 'test', + ); + + $this->assertEquals($expected, $handler->getHeaders()); + $this->assertEquals($expected2, $handler2->getHeaders()); + } +} + +class TestFirePHPHandler extends FirePHPHandler +{ + protected $headers = array(); + + public static function reset() + { + self::$initialized = false; + self::$sendHeaders = true; + self::$messageIndex = 1; + } + + protected function sendHeader($header, $content) + { + $this->headers[$header] = $content; + } + + public function getHeaders() + { + return $this->headers; + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php new file mode 100644 index 00000000..91cdd312 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php @@ -0,0 +1,85 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\LineFormatter; +use Monolog\Logger; +use Monolog\TestCase; + +/** + * @coversDefaultClass \Monolog\Handler\FleepHookHandler + */ +class FleepHookHandlerTest extends TestCase +{ + /** + * Default token to use in tests + */ + const TOKEN = '123abc'; + + /** + * @var FleepHookHandler + */ + private $handler; + + public function setUp() + { + parent::setUp(); + + if (!extension_loaded('openssl')) { + $this->markTestSkipped('This test requires openssl extension to run'); + } + + // Create instances of the handler and logger for convenience + $this->handler = new FleepHookHandler(self::TOKEN); + } + + /** + * @covers ::__construct + */ + public function testConstructorSetsExpectedDefaults() + { + $this->assertEquals(Logger::DEBUG, $this->handler->getLevel()); + $this->assertEquals(true, $this->handler->getBubble()); + } + + /** + * @covers ::getDefaultFormatter + */ + public function testHandlerUsesLineFormatterWhichIgnoresEmptyArrays() + { + $record = array( + 'message' => 'msg', + 'context' => array(), + 'level' => Logger::DEBUG, + 'level_name' => Logger::getLevelName(Logger::DEBUG), + 'channel' => 'channel', + 'datetime' => new \DateTime(), + 'extra' => array(), + ); + + $expectedFormatter = new LineFormatter(null, null, true, true); + $expected = $expectedFormatter->format($record); + + $handlerFormatter = $this->handler->getFormatter(); + $actual = $handlerFormatter->format($record); + + $this->assertEquals($expected, $actual, 'Empty context and extra arrays should not be rendered'); + } + + /** + * @covers ::__construct + */ + public function testConnectionStringisConstructedCorrectly() + { + $this->assertEquals('ssl://' . FleepHookHandler::FLEEP_HOST . ':443', $this->handler->getConnectionString()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php new file mode 100644 index 00000000..4b120d51 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php @@ -0,0 +1,88 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\FlowdockFormatter; +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Dominik Liebler <liebler.dominik@gmail.com> + * @see https://www.hipchat.com/docs/api + */ +class FlowdockHandlerTest extends TestCase +{ + /** + * @var resource + */ + private $res; + + /** + * @var FlowdockHandler + */ + private $handler; + + public function setUp() + { + if (!extension_loaded('openssl')) { + $this->markTestSkipped('This test requires openssl to run'); + } + } + + public function testWriteHeader() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v1\/messages\/team_inbox\/.* HTTP\/1.1\\r\\nHost: api.flowdock.com\\r\\nContent-Type: application\/json\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + /** + * @depends testWriteHeader + */ + public function testWriteContent($content) + { + $this->assertRegexp('/"source":"test_source"/', $content); + $this->assertRegexp('/"from_address":"source@test\.com"/', $content); + } + + private function createHandler($token = 'myToken') + { + $constructorArgs = array($token, Logger::DEBUG); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\FlowdockHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $constructorArgs + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + + $this->handler->setFormatter(new FlowdockFormatter('test_source', 'source@test.com')); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php new file mode 100644 index 00000000..d60a6db3 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php @@ -0,0 +1,93 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Gelf\Message; +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\GelfMessageFormatter; + +class GelfHandlerLegacyTest extends TestCase +{ + public function setUp() + { + if (!class_exists('Gelf\MessagePublisher') || !class_exists('Gelf\Message')) { + $this->markTestSkipped("mlehner/gelf-php not installed"); + } + } + + /** + * @covers Monolog\Handler\GelfHandler::__construct + */ + public function testConstruct() + { + $handler = new GelfHandler($this->getMessagePublisher()); + $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler); + } + + protected function getHandler($messagePublisher) + { + $handler = new GelfHandler($messagePublisher); + + return $handler; + } + + protected function getMessagePublisher() + { + return new MockMessagePublisher('localhost'); + } + + public function testDebug() + { + $messagePublisher = $this->getMessagePublisher(); + $handler = $this->getHandler($messagePublisher); + + $record = $this->getRecord(Logger::DEBUG, "A test debug message"); + $handler->handle($record); + + $this->assertEquals(7, $messagePublisher->lastMessage->getLevel()); + $this->assertEquals('test', $messagePublisher->lastMessage->getFacility()); + $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage()); + $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage()); + } + + public function testWarning() + { + $messagePublisher = $this->getMessagePublisher(); + $handler = $this->getHandler($messagePublisher); + + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $handler->handle($record); + + $this->assertEquals(4, $messagePublisher->lastMessage->getLevel()); + $this->assertEquals('test', $messagePublisher->lastMessage->getFacility()); + $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage()); + $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage()); + } + + public function testInjectedGelfMessageFormatter() + { + $messagePublisher = $this->getMessagePublisher(); + $handler = $this->getHandler($messagePublisher); + + $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX')); + + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $record['extra']['blarg'] = 'yep'; + $record['context']['from'] = 'logger'; + $handler->handle($record); + + $this->assertEquals('mysystem', $messagePublisher->lastMessage->getHost()); + $this->assertArrayHasKey('_EXTblarg', $messagePublisher->lastMessage->toArray()); + $this->assertArrayHasKey('_CTXfrom', $messagePublisher->lastMessage->toArray()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php new file mode 100644 index 00000000..8cdd64f4 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php @@ -0,0 +1,117 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Gelf\Message; +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\GelfMessageFormatter; + +class GelfHandlerTest extends TestCase +{ + public function setUp() + { + if (!class_exists('Gelf\Publisher') || !class_exists('Gelf\Message')) { + $this->markTestSkipped("graylog2/gelf-php not installed"); + } + } + + /** + * @covers Monolog\Handler\GelfHandler::__construct + */ + public function testConstruct() + { + $handler = new GelfHandler($this->getMessagePublisher()); + $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler); + } + + protected function getHandler($messagePublisher) + { + $handler = new GelfHandler($messagePublisher); + + return $handler; + } + + protected function getMessagePublisher() + { + return $this->getMock('Gelf\Publisher', array('publish'), array(), '', false); + } + + public function testDebug() + { + $record = $this->getRecord(Logger::DEBUG, "A test debug message"); + $expectedMessage = new Message(); + $expectedMessage + ->setLevel(7) + ->setFacility("test") + ->setShortMessage($record['message']) + ->setTimestamp($record['datetime']) + ; + + $messagePublisher = $this->getMessagePublisher(); + $messagePublisher->expects($this->once()) + ->method('publish') + ->with($expectedMessage); + + $handler = $this->getHandler($messagePublisher); + + $handler->handle($record); + } + + public function testWarning() + { + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $expectedMessage = new Message(); + $expectedMessage + ->setLevel(4) + ->setFacility("test") + ->setShortMessage($record['message']) + ->setTimestamp($record['datetime']) + ; + + $messagePublisher = $this->getMessagePublisher(); + $messagePublisher->expects($this->once()) + ->method('publish') + ->with($expectedMessage); + + $handler = $this->getHandler($messagePublisher); + + $handler->handle($record); + } + + public function testInjectedGelfMessageFormatter() + { + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $record['extra']['blarg'] = 'yep'; + $record['context']['from'] = 'logger'; + + $expectedMessage = new Message(); + $expectedMessage + ->setLevel(4) + ->setFacility("test") + ->setHost("mysystem") + ->setShortMessage($record['message']) + ->setTimestamp($record['datetime']) + ->setAdditional("EXTblarg", 'yep') + ->setAdditional("CTXfrom", 'logger') + ; + + $messagePublisher = $this->getMessagePublisher(); + $messagePublisher->expects($this->once()) + ->method('publish') + ->with($expectedMessage); + + $handler = $this->getHandler($messagePublisher); + $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX')); + $handler->handle($record); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php new file mode 100644 index 00000000..c6298a6e --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php @@ -0,0 +1,89 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class GroupHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\GroupHandler::__construct + * @expectedException InvalidArgumentException + */ + public function testConstructorOnlyTakesHandler() + { + new GroupHandler(array(new TestHandler(), "foo")); + } + + /** + * @covers Monolog\Handler\GroupHandler::__construct + * @covers Monolog\Handler\GroupHandler::handle + */ + public function testHandle() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new GroupHandler($testHandlers); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + } + + /** + * @covers Monolog\Handler\GroupHandler::handleBatch + */ + public function testHandleBatch() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new GroupHandler($testHandlers); + $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO))); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + } + + /** + * @covers Monolog\Handler\GroupHandler::isHandling + */ + public function testIsHandling() + { + $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING)); + $handler = new GroupHandler($testHandlers); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR))); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\GroupHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new GroupHandler(array($test)); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php new file mode 100644 index 00000000..d58386a1 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php @@ -0,0 +1,166 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Rafael Dohms <rafael@doh.ms> + * @see https://www.hipchat.com/docs/api + */ +class HipChatHandlerTest extends TestCase +{ + private $res; + private $handler; + + public function testWriteHeader() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: api.hipchat.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + /** + * @depends testWriteHeader + */ + public function testWriteContent($content) + { + $this->assertRegexp('/from=Monolog&room_id=room1¬ify=0&message=test1&message_format=text&color=red$/', $content); + } + + public function testWriteWithComplexMessage() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content); + } + + /** + * @dataProvider provideLevelColors + */ + public function testWriteWithErrorLevelsAndColors($level, $expectedColor) + { + $this->createHandler(); + $this->handler->handle($this->getRecord($level, 'Backup of database "example" finished in 16 minutes.')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/color='.$expectedColor.'/', $content); + } + + public function provideLevelColors() + { + return array( + array(Logger::DEBUG, 'gray'), + array(Logger::INFO, 'green'), + array(Logger::WARNING, 'yellow'), + array(Logger::ERROR, 'red'), + array(Logger::CRITICAL, 'red'), + array(Logger::ALERT, 'red'), + array(Logger::EMERGENCY,'red'), + array(Logger::NOTICE, 'green'), + ); + } + + /** + * @dataProvider provideBatchRecords + */ + public function testHandleBatch($records, $expectedColor) + { + $this->createHandler(); + + $this->handler->handleBatch($records); + + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/color='.$expectedColor.'/', $content); + } + + public function provideBatchRecords() + { + return array( + array( + array( + array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()), + array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()), + array('level' => Logger::CRITICAL, 'message' => 'Everything is broken!', 'level_name' => 'critical', 'datetime' => new \DateTime()) + ), + 'red', + ), + array( + array( + array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()), + array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()), + ), + 'yellow', + ), + array( + array( + array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()), + array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()), + ), + 'green', + ), + array( + array( + array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()), + ), + 'gray', + ), + ); + } + + private function createHandler($token = 'myToken', $room = 'room1', $name = 'Monolog', $notify = false) + { + $constructorArgs = array($token, $room, $name, $notify, Logger::DEBUG); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\HipChatHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $constructorArgs + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + + $this->handler->setFormatter($this->getIdentityFormatter()); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testCreateWithTooLongName() + { + $hipChatHandler = new \Monolog\Handler\HipChatHandler('token', 'room', 'SixteenCharsHere'); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php new file mode 100644 index 00000000..7af60be8 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php @@ -0,0 +1,84 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Robert Kaufmann III <rok3@rok3.me> + */ +class LogEntriesHandlerTest extends TestCase +{ + /** + * @var resource + */ + private $res; + + /** + * @var LogEntriesHandler + */ + private $handler; + + public function testWriteContent() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Critical write test')); + + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] test.CRITICAL: Critical write test/', $content); + } + + public function testWriteBatchContent() + { + $records = array( + $this->getRecord(), + $this->getRecord(), + $this->getRecord() + ); + $this->createHandler(); + $this->handler->handleBatch($records); + + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/(testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] .* \[\] \[\]\n){3}/', $content); + } + + private function createHandler() + { + $useSSL = extension_loaded('openssl'); + $args = array('testToken', $useSSL, Logger::DEBUG, true); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\LogEntriesHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $args + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php new file mode 100644 index 00000000..6754f3d6 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php @@ -0,0 +1,75 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\TestCase; + +class MailHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\MailHandler::handleBatch + */ + public function testHandleBatch() + { + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $formatter->expects($this->once()) + ->method('formatBatch'); // Each record is formatted + + $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler'); + $handler->expects($this->once()) + ->method('send'); + $handler->expects($this->never()) + ->method('write'); // write is for individual records + + $handler->setFormatter($formatter); + + $handler->handleBatch($this->getMultipleRecords()); + } + + /** + * @covers Monolog\Handler\MailHandler::handleBatch + */ + public function testHandleBatchNotSendsMailIfMessagesAreBelowLevel() + { + $records = array( + $this->getRecord(Logger::DEBUG, 'debug message 1'), + $this->getRecord(Logger::DEBUG, 'debug message 2'), + $this->getRecord(Logger::INFO, 'information'), + ); + + $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler'); + $handler->expects($this->never()) + ->method('send'); + $handler->setLevel(Logger::ERROR); + + $handler->handleBatch($records); + } + + /** + * @covers Monolog\Handler\MailHandler::write + */ + public function testHandle() + { + $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler'); + + $record = $this->getRecord(); + $records = array($record); + $records[0]['formatted'] = '['.$record['datetime']->format('Y-m-d H:i:s').'] test.WARNING: test [] []'."\n"; + + $handler->expects($this->once()) + ->method('send') + ->with($records[0]['formatted'], $records); + + $handler->handle($record); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php b/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php new file mode 100644 index 00000000..fbaab9bc --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php @@ -0,0 +1,26 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Raven_Client; + +class MockRavenClient extends Raven_Client +{ + public function capture($data, $stack, $vars = null) + { + $this->lastData = $data; + $this->lastStack = $stack; + } + + public $lastData; + public $lastStack; +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php new file mode 100644 index 00000000..0fdef63a --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php @@ -0,0 +1,65 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class MongoDBHandlerTest extends TestCase +{ + /** + * @expectedException InvalidArgumentException + */ + public function testConstructorShouldThrowExceptionForInvalidMongo() + { + new MongoDBHandler(new \stdClass(), 'DB', 'Collection'); + } + + public function testHandle() + { + $mongo = $this->getMock('Mongo', array('selectCollection'), array(), '', false); + $collection = $this->getMock('stdClass', array('save')); + + $mongo->expects($this->once()) + ->method('selectCollection') + ->with('DB', 'Collection') + ->will($this->returnValue($collection)); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + 'message' => 'test', + 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34), + 'level' => Logger::WARNING, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'datetime' => $record['datetime']->format('Y-m-d H:i:s'), + 'extra' => array(), + ); + + $collection->expects($this->once()) + ->method('save') + ->with($expected); + + $handler = new MongoDBHandler($mongo, 'DB', 'Collection'); + $handler->handle($record); + } +} + +if (!class_exists('Mongo')) { + class Mongo + { + public function selectCollection() + { + } + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php new file mode 100644 index 00000000..c2553ee4 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php @@ -0,0 +1,61 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +class NativeMailerHandlerTest extends TestCase +{ + /** + * @expectedException InvalidArgumentException + */ + public function testConstructorHeaderInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', "receiver@example.org\r\nFrom: faked@attacker.org"); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testSetterHeaderInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); + $mailer->addHeader("Content-Type: text/html\r\nFrom: faked@attacker.org"); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testSetterArrayHeaderInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); + $mailer->addHeader(array("Content-Type: text/html\r\nFrom: faked@attacker.org")); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testSetterContentTypeInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); + $mailer->setContentType("text/html\r\nFrom: faked@attacker.org"); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testSetterEncodingInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); + $mailer->setEncoding("utf-8\r\nFrom: faked@attacker.org"); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php new file mode 100644 index 00000000..22014908 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php @@ -0,0 +1,192 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class NewRelicHandlerTest extends TestCase +{ + public static $appname; + public static $customParameters; + public static $transactionName; + + public function setUp() + { + self::$appname = null; + self::$customParameters = array(); + self::$transactionName = null; + } + + /** + * @expectedException Monolog\Handler\MissingExtensionException + */ + public function testThehandlerThrowsAnExceptionIfTheNRExtensionIsNotLoaded() + { + $handler = new StubNewRelicHandlerWithoutExtension(); + $handler->handle($this->getRecord(Logger::ERROR)); + } + + public function testThehandlerCanHandleTheRecord() + { + $handler = new StubNewRelicHandler(); + $handler->handle($this->getRecord(Logger::ERROR)); + } + + public function testThehandlerCanAddContextParamsToTheNewRelicTrace() + { + $handler = new StubNewRelicHandler(); + $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('a' => 'b'))); + $this->assertEquals(array('context_a' => 'b'), self::$customParameters); + } + + public function testThehandlerCanAddExplodedContextParamsToTheNewRelicTrace() + { + $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true); + $handler->handle($this->getRecord( + Logger::ERROR, + 'log message', + array('a' => array('key1' => 'value1', 'key2' => 'value2')) + )); + $this->assertEquals( + array('context_a_key1' => 'value1', 'context_a_key2' => 'value2'), + self::$customParameters + ); + } + + public function testThehandlerCanAddExtraParamsToTheNewRelicTrace() + { + $record = $this->getRecord(Logger::ERROR, 'log message'); + $record['extra'] = array('c' => 'd'); + + $handler = new StubNewRelicHandler(); + $handler->handle($record); + + $this->assertEquals(array('extra_c' => 'd'), self::$customParameters); + } + + public function testThehandlerCanAddExplodedExtraParamsToTheNewRelicTrace() + { + $record = $this->getRecord(Logger::ERROR, 'log message'); + $record['extra'] = array('c' => array('key1' => 'value1', 'key2' => 'value2')); + + $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true); + $handler->handle($record); + + $this->assertEquals( + array('extra_c_key1' => 'value1', 'extra_c_key2' => 'value2'), + self::$customParameters + ); + } + + public function testThehandlerCanAddExtraContextAndParamsToTheNewRelicTrace() + { + $record = $this->getRecord(Logger::ERROR, 'log message', array('a' => 'b')); + $record['extra'] = array('c' => 'd'); + + $handler = new StubNewRelicHandler(); + $handler->handle($record); + + $expected = array( + 'context_a' => 'b', + 'extra_c' => 'd', + ); + + $this->assertEquals($expected, self::$customParameters); + } + + public function testTheAppNameIsNullByDefault() + { + $handler = new StubNewRelicHandler(); + $handler->handle($this->getRecord(Logger::ERROR, 'log message')); + + $this->assertEquals(null, self::$appname); + } + + public function testTheAppNameCanBeInjectedFromtheConstructor() + { + $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName'); + $handler->handle($this->getRecord(Logger::ERROR, 'log message')); + + $this->assertEquals('myAppName', self::$appname); + } + + public function testTheAppNameCanBeOverriddenFromEachLog() + { + $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName'); + $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('appname' => 'logAppName'))); + + $this->assertEquals('logAppName', self::$appname); + } + + public function testTheTransactionNameIsNullByDefault() + { + $handler = new StubNewRelicHandler(); + $handler->handle($this->getRecord(Logger::ERROR, 'log message')); + + $this->assertEquals(null, self::$transactionName); + } + + public function testTheTransactionNameCanBeInjectedFromtheConstructor() + { + $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction'); + $handler->handle($this->getRecord(Logger::ERROR, 'log message')); + + $this->assertEquals('myTransaction', self::$transactionName); + } + + public function testTheTransactionNameCanBeOverriddenFromEachLog() + { + $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction'); + $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('transaction_name' => 'logTransactName'))); + + $this->assertEquals('logTransactName', self::$transactionName); + } +} + +class StubNewRelicHandlerWithoutExtension extends NewRelicHandler +{ + protected function isNewRelicEnabled() + { + return false; + } +} + +class StubNewRelicHandler extends NewRelicHandler +{ + protected function isNewRelicEnabled() + { + return true; + } +} + +function newrelic_notice_error() +{ + return true; +} + +function newrelic_set_appname($appname) +{ + return NewRelicHandlerTest::$appname = $appname; +} + +function newrelic_name_transaction($transactionName) +{ + return NewRelicHandlerTest::$transactionName = $transactionName; +} + +function newrelic_add_custom_parameter($key, $value) +{ + NewRelicHandlerTest::$customParameters[$key] = $value; + + return true; +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php new file mode 100644 index 00000000..292df78c --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php @@ -0,0 +1,33 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\NullHandler::handle + */ +class NullHandlerTest extends TestCase +{ + public function testHandle() + { + $handler = new NullHandler(); + $this->assertTrue($handler->handle($this->getRecord())); + } + + public function testHandleLowerLevelRecord() + { + $handler = new NullHandler(Logger::WARNING); + $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG))); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php new file mode 100644 index 00000000..64eaab16 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php @@ -0,0 +1,50 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\PsrHandler::handle + */ +class PsrHandlerTest extends TestCase +{ + public function logLevelProvider() + { + $levels = array(); + $monologLogger = new Logger(''); + + foreach ($monologLogger->getLevels() as $levelName => $level) { + $levels[] = array($levelName, $level); + } + + return $levels; + } + + /** + * @dataProvider logLevelProvider + */ + public function testHandlesAllLevels($levelName, $level) + { + $message = 'Hello, world! ' . $level; + $context = array('foo' => 'bar', 'level' => $level); + + $psrLogger = $this->getMock('Psr\Log\NullLogger'); + $psrLogger->expects($this->once()) + ->method('log') + ->with(strtolower($levelName), $message, $context); + + $handler = new PsrHandler($psrLogger); + $handler->handle(array('level' => $level, 'level_name' => $levelName, 'message' => $message, 'context' => $context)); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php new file mode 100644 index 00000000..89408236 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php @@ -0,0 +1,141 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * Almost all examples (expected header, titles, messages) taken from + * https://www.pushover.net/api + * @author Sebastian Göttschkes <sebastian.goettschkes@googlemail.com> + * @see https://www.pushover.net/api + */ +class PushoverHandlerTest extends TestCase +{ + private $res; + private $handler; + + public function testWriteHeader() + { + $this->createHandler(); + $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/1\/messages.json HTTP\/1.1\\r\\nHost: api.pushover.net\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + /** + * @depends testWriteHeader + */ + public function testWriteContent($content) + { + $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}$/', $content); + } + + public function testWriteWithComplexTitle() + { + $this->createHandler('myToken', 'myUser', 'Backup finished - SQL1', Logger::EMERGENCY); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/title=Backup\+finished\+-\+SQL1/', $content); + } + + public function testWriteWithComplexMessage() + { + $this->createHandler(); + $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content); + } + + public function testWriteWithTooLongMessage() + { + $message = str_pad('test', 520, 'a'); + $this->createHandler(); + $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications + $this->handler->handle($this->getRecord(Logger::CRITICAL, $message)); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $expectedMessage = substr($message, 0, 505); + + $this->assertRegexp('/message=' . $expectedMessage . '&title/', $content); + } + + public function testWriteWithHighPriority() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}&priority=1$/', $content); + } + + public function testWriteWithEmergencyPriority() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200$/', $content); + } + + public function testWriteToMultipleUsers() + { + $this->createHandler('myToken', array('userA', 'userB')); + $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/token=myToken&user=userA&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200POST/', $content); + $this->assertRegexp('/token=myToken&user=userB&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200$/', $content); + } + + private function createHandler($token = 'myToken', $user = 'myUser', $title = 'Monolog') + { + $constructorArgs = array($token, $user, $title); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\PushoverHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $constructorArgs + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + + $this->handler->setFormatter($this->getIdentityFormatter()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php new file mode 100644 index 00000000..8fe86961 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php @@ -0,0 +1,150 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; + +class RavenHandlerTest extends TestCase +{ + public function setUp() + { + if (!class_exists("Raven_Client")) { + $this->markTestSkipped("raven/raven not installed"); + } + + require_once __DIR__ . '/MockRavenClient.php'; + } + + /** + * @covers Monolog\Handler\RavenHandler::__construct + */ + public function testConstruct() + { + $handler = new RavenHandler($this->getRavenClient()); + $this->assertInstanceOf('Monolog\Handler\RavenHandler', $handler); + } + + protected function getHandler($ravenClient) + { + $handler = new RavenHandler($ravenClient); + + return $handler; + } + + protected function getRavenClient() + { + $dsn = 'http://43f6017361224d098402974103bfc53d:a6a0538fc2934ba2bed32e08741b2cd3@marca.python.live.cheggnet.com:9000/1'; + + return new MockRavenClient($dsn); + } + + public function testDebug() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $record = $this->getRecord(Logger::DEBUG, "A test debug message"); + $handler->handle($record); + + $this->assertEquals($ravenClient::DEBUG, $ravenClient->lastData['level']); + $this->assertContains($record['message'], $ravenClient->lastData['message']); + } + + public function testWarning() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $handler->handle($record); + + $this->assertEquals($ravenClient::WARNING, $ravenClient->lastData['level']); + $this->assertContains($record['message'], $ravenClient->lastData['message']); + } + + public function testTag() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $tags = array(1, 2, 'foo'); + $record = $this->getRecord(Logger::INFO, "test", array('tags' => $tags)); + $handler->handle($record); + + $this->assertEquals($tags, $ravenClient->lastData['tags']); + } + + public function testException() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + try { + $this->methodThatThrowsAnException(); + } catch (\Exception $e) { + $record = $this->getRecord(Logger::ERROR, $e->getMessage(), array('exception' => $e)); + $handler->handle($record); + } + + $this->assertEquals($record['message'], $ravenClient->lastData['message']); + } + + public function testHandleBatch() + { + $records = $this->getMultipleRecords(); + $records[] = $this->getRecord(Logger::WARNING, 'warning'); + $records[] = $this->getRecord(Logger::WARNING, 'warning'); + + $logFormatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $logFormatter->expects($this->once())->method('formatBatch'); + + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $formatter->expects($this->once())->method('format')->with($this->callback(function ($record) { + return $record['level'] == 400; + })); + + $handler = $this->getHandler($this->getRavenClient()); + $handler->setBatchFormatter($logFormatter); + $handler->setFormatter($formatter); + $handler->handleBatch($records); + } + + public function testHandleBatchDoNothingIfRecordsAreBelowLevel() + { + $records = array( + $this->getRecord(Logger::DEBUG, 'debug message 1'), + $this->getRecord(Logger::DEBUG, 'debug message 2'), + $this->getRecord(Logger::INFO, 'information'), + ); + + $handler = $this->getMock('Monolog\Handler\RavenHandler', null, array($this->getRavenClient())); + $handler->expects($this->never())->method('handle'); + $handler->setLevel(Logger::ERROR); + $handler->handleBatch($records); + } + + public function testGetSetBatchFormatter() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $handler->setBatchFormatter($formatter = new LineFormatter()); + $this->assertSame($formatter, $handler->getBatchFormatter()); + } + + private function methodThatThrowsAnException() + { + throw new \Exception('This is an exception'); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php new file mode 100644 index 00000000..3629f8a2 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php @@ -0,0 +1,71 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; + +class RedisHandlerTest extends TestCase +{ + /** + * @expectedException InvalidArgumentException + */ + public function testConstructorShouldThrowExceptionForInvalidRedis() + { + new RedisHandler(new \stdClass(), 'key'); + } + + public function testConstructorShouldWorkWithPredis() + { + $redis = $this->getMock('Predis\Client'); + $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key')); + } + + public function testConstructorShouldWorkWithRedis() + { + $redis = $this->getMock('Redis'); + $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key')); + } + + public function testPredisHandle() + { + $redis = $this->getMock('Predis\Client', array('rpush')); + + // Predis\Client uses rpush + $redis->expects($this->once()) + ->method('rpush') + ->with('key', 'test'); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $handler = new RedisHandler($redis, 'key'); + $handler->setFormatter(new LineFormatter("%message%")); + $handler->handle($record); + } + + public function testRedisHandle() + { + $redis = $this->getMock('Redis', array('rpush')); + + // Redis uses rPush + $redis->expects($this->once()) + ->method('rPush') + ->with('key', 'test'); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $handler = new RedisHandler($redis, 'key'); + $handler->setFormatter(new LineFormatter("%message%")); + $handler->handle($record); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php new file mode 100644 index 00000000..f4cefda1 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php @@ -0,0 +1,99 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +/** + * @covers Monolog\Handler\RotatingFileHandler + */ +class RotatingFileHandlerTest extends TestCase +{ + public function setUp() + { + $dir = __DIR__.'/Fixtures'; + chmod($dir, 0777); + if (!is_writable($dir)) { + $this->markTestSkipped($dir.' must be writeable to test the RotatingFileHandler.'); + } + } + + public function testRotationCreatesNewFile() + { + touch(__DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot'); + + $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot'); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord()); + + $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot'; + $this->assertTrue(file_exists($log)); + $this->assertEquals('test', file_get_contents($log)); + } + + /** + * @dataProvider rotationTests + */ + public function testRotation($createFile) + { + touch($old1 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot'); + touch($old2 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 2).'.rot'); + touch($old3 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 3).'.rot'); + touch($old4 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 4).'.rot'); + + $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot'; + + if ($createFile) { + touch($log); + } + + $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord()); + + $handler->close(); + + $this->assertTrue(file_exists($log)); + $this->assertTrue(file_exists($old1)); + $this->assertEquals($createFile, file_exists($old2)); + $this->assertEquals($createFile, file_exists($old3)); + $this->assertEquals($createFile, file_exists($old4)); + $this->assertEquals('test', file_get_contents($log)); + } + + public function rotationTests() + { + return array( + 'Rotation is triggered when the file of the current day is not present' + => array(true), + 'Rotation is not triggered when the file is already present' + => array(false), + ); + } + + public function testReuseCurrentFile() + { + $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot'; + file_put_contents($log, "foo"); + $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot'); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord()); + $this->assertEquals('footest', file_get_contents($log)); + } + + public function tearDown() + { + foreach (glob(__DIR__.'/Fixtures/*.rot') as $file) { + unlink($file); + } + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php new file mode 100644 index 00000000..b354cee1 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php @@ -0,0 +1,33 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +/** + * @covers Monolog\Handler\SamplingHandler::handle + */ +class SamplingHandlerTest extends TestCase +{ + public function testHandle() + { + $testHandler = new TestHandler(); + $handler = new SamplingHandler($testHandler, 2); + for ($i = 0; $i < 10000; $i++) { + $handler->handle($this->getRecord()); + } + $count = count($testHandler->getRecords()); + // $count should be half of 10k, so between 4k and 6k + $this->assertLessThan(6000, $count); + $this->assertGreaterThan(4000, $count); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php new file mode 100644 index 00000000..d657fae3 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php @@ -0,0 +1,133 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Greg Kedzierski <greg@gregkedzierski.com> + * @see https://api.slack.com/ + */ +class SlackHandlerTest extends TestCase +{ + /** + * @var resource + */ + private $res; + + /** + * @var SlackHandler + */ + private $handler; + + public function setUp() + { + if (!extension_loaded('openssl')) { + $this->markTestSkipped('This test requires openssl to run'); + } + } + + public function testWriteHeader() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/api\/chat.postMessage HTTP\/1.1\\r\\nHost: slack.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + } + + public function testWriteContent() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/token=myToken&channel=channel1&username=Monolog&text=&attachments=.*$/', $content); + } + + public function testWriteContentWithEmoji() + { + $this->createHandler('myToken', 'channel1', 'Monolog', true, 'alien'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/icon_emoji=%3Aalien%3A$/', $content); + } + + /** + * @dataProvider provideLevelColors + */ + public function testWriteContentWithColors($level, $expectedColor) + { + $this->createHandler(); + $this->handler->handle($this->getRecord($level, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/color%22%3A%22'.$expectedColor.'/', $content); + } + + public function testWriteContentWithPlainTextMessage() + { + $this->createHandler('myToken', 'channel1', 'Monolog', false); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/text=test1/', $content); + } + + public function provideLevelColors() + { + return array( + array(Logger::DEBUG, '%23e3e4e6'), // escaped #e3e4e6 + array(Logger::INFO, 'good'), + array(Logger::NOTICE, 'good'), + array(Logger::WARNING, 'warning'), + array(Logger::ERROR, 'danger'), + array(Logger::CRITICAL, 'danger'), + array(Logger::ALERT, 'danger'), + array(Logger::EMERGENCY,'danger'), + ); + } + + private function createHandler($token = 'myToken', $channel = 'channel1', $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $useShortAttachment = false, $includeExtra = false) + { + $constructorArgs = array($token, $channel, $username, $useAttachment, $iconEmoji, Logger::DEBUG, true, $useShortAttachment, $includeExtra); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\SlackHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $constructorArgs + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + + $this->handler->setFormatter($this->getIdentityFormatter()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php new file mode 100644 index 00000000..2e3d504a --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php @@ -0,0 +1,282 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Pablo de Leon Belloc <pablolb@gmail.com> + */ +class SocketHandlerTest extends TestCase +{ + /** + * @var Monolog\Handler\SocketHandler + */ + private $handler; + + /** + * @var resource + */ + private $res; + + /** + * @expectedException UnexpectedValueException + */ + public function testInvalidHostname() + { + $this->createHandler('garbage://here'); + $this->writeRecord('data'); + } + + /** + * @expectedException \InvalidArgumentException + */ + public function testBadConnectionTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setConnectionTimeout(-1); + } + + public function testSetConnectionTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setConnectionTimeout(10.1); + $this->assertEquals(10.1, $this->handler->getConnectionTimeout()); + } + + /** + * @expectedException \InvalidArgumentException + */ + public function testBadTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setTimeout(-1); + } + + public function testSetTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setTimeout(10.25); + $this->assertEquals(10.25, $this->handler->getTimeout()); + } + + public function testSetConnectionString() + { + $this->createHandler('tcp://localhost:9090'); + $this->assertEquals('tcp://localhost:9090', $this->handler->getConnectionString()); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testExceptionIsThrownOnFsockopenError() + { + $this->setMockHandler(array('fsockopen')); + $this->handler->expects($this->once()) + ->method('fsockopen') + ->will($this->returnValue(false)); + $this->writeRecord('Hello world'); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testExceptionIsThrownOnPfsockopenError() + { + $this->setMockHandler(array('pfsockopen')); + $this->handler->expects($this->once()) + ->method('pfsockopen') + ->will($this->returnValue(false)); + $this->handler->setPersistent(true); + $this->writeRecord('Hello world'); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testExceptionIsThrownIfCannotSetTimeout() + { + $this->setMockHandler(array('streamSetTimeout')); + $this->handler->expects($this->once()) + ->method('streamSetTimeout') + ->will($this->returnValue(false)); + $this->writeRecord('Hello world'); + } + + /** + * @expectedException RuntimeException + */ + public function testWriteFailsOnIfFwriteReturnsFalse() + { + $this->setMockHandler(array('fwrite')); + + $callback = function ($arg) { + $map = array( + 'Hello world' => 6, + 'world' => false, + ); + + return $map[$arg]; + }; + + $this->handler->expects($this->exactly(2)) + ->method('fwrite') + ->will($this->returnCallback($callback)); + + $this->writeRecord('Hello world'); + } + + /** + * @expectedException RuntimeException + */ + public function testWriteFailsIfStreamTimesOut() + { + $this->setMockHandler(array('fwrite', 'streamGetMetadata')); + + $callback = function ($arg) { + $map = array( + 'Hello world' => 6, + 'world' => 5, + ); + + return $map[$arg]; + }; + + $this->handler->expects($this->exactly(1)) + ->method('fwrite') + ->will($this->returnCallback($callback)); + $this->handler->expects($this->exactly(1)) + ->method('streamGetMetadata') + ->will($this->returnValue(array('timed_out' => true))); + + $this->writeRecord('Hello world'); + } + + /** + * @expectedException RuntimeException + */ + public function testWriteFailsOnIncompleteWrite() + { + $this->setMockHandler(array('fwrite', 'streamGetMetadata')); + + $res = $this->res; + $callback = function ($string) use ($res) { + fclose($res); + + return strlen('Hello'); + }; + + $this->handler->expects($this->exactly(1)) + ->method('fwrite') + ->will($this->returnCallback($callback)); + $this->handler->expects($this->exactly(1)) + ->method('streamGetMetadata') + ->will($this->returnValue(array('timed_out' => false))); + + $this->writeRecord('Hello world'); + } + + public function testWriteWithMemoryFile() + { + $this->setMockHandler(); + $this->writeRecord('test1'); + $this->writeRecord('test2'); + $this->writeRecord('test3'); + fseek($this->res, 0); + $this->assertEquals('test1test2test3', fread($this->res, 1024)); + } + + public function testWriteWithMock() + { + $this->setMockHandler(array('fwrite')); + + $callback = function ($arg) { + $map = array( + 'Hello world' => 6, + 'world' => 5, + ); + + return $map[$arg]; + }; + + $this->handler->expects($this->exactly(2)) + ->method('fwrite') + ->will($this->returnCallback($callback)); + + $this->writeRecord('Hello world'); + } + + public function testClose() + { + $this->setMockHandler(); + $this->writeRecord('Hello world'); + $this->assertInternalType('resource', $this->res); + $this->handler->close(); + $this->assertFalse(is_resource($this->res), "Expected resource to be closed after closing handler"); + } + + public function testCloseDoesNotClosePersistentSocket() + { + $this->setMockHandler(); + $this->handler->setPersistent(true); + $this->writeRecord('Hello world'); + $this->assertTrue(is_resource($this->res)); + $this->handler->close(); + $this->assertTrue(is_resource($this->res)); + } + + private function createHandler($connectionString) + { + $this->handler = new SocketHandler($connectionString); + $this->handler->setFormatter($this->getIdentityFormatter()); + } + + private function writeRecord($string) + { + $this->handler->handle($this->getRecord(Logger::WARNING, $string)); + } + + private function setMockHandler(array $methods = array()) + { + $this->res = fopen('php://memory', 'a'); + + $defaultMethods = array('fsockopen', 'pfsockopen', 'streamSetTimeout'); + $newMethods = array_diff($methods, $defaultMethods); + + $finalMethods = array_merge($defaultMethods, $newMethods); + + $this->handler = $this->getMock( + '\Monolog\Handler\SocketHandler', $finalMethods, array('localhost:1234') + ); + + if (!in_array('fsockopen', $methods)) { + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + } + + if (!in_array('pfsockopen', $methods)) { + $this->handler->expects($this->any()) + ->method('pfsockopen') + ->will($this->returnValue($this->res)); + } + + if (!in_array('streamSetTimeout', $methods)) { + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + } + + $this->handler->setFormatter($this->getIdentityFormatter()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php new file mode 100644 index 00000000..44d3d9f1 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php @@ -0,0 +1,118 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class StreamHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWrite() + { + $handle = fopen('php://memory', 'a+'); + $handler = new StreamHandler($handle); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::WARNING, 'test')); + $handler->handle($this->getRecord(Logger::WARNING, 'test2')); + $handler->handle($this->getRecord(Logger::WARNING, 'test3')); + fseek($handle, 0); + $this->assertEquals('testtest2test3', fread($handle, 100)); + } + + /** + * @covers Monolog\Handler\StreamHandler::close + */ + public function testClose() + { + $handle = fopen('php://memory', 'a+'); + $handler = new StreamHandler($handle); + $this->assertTrue(is_resource($handle)); + $handler->close(); + $this->assertFalse(is_resource($handle)); + } + + /** + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteCreatesTheStreamResource() + { + $handler = new StreamHandler('php://memory'); + $handler->handle($this->getRecord()); + } + + /** + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteLocking() + { + $temp = sys_get_temp_dir() . DIRECTORY_SEPARATOR . 'monolog_locked_log'; + $handler = new StreamHandler($temp, Logger::DEBUG, true, null, true); + $handler->handle($this->getRecord()); + } + + /** + * @expectedException LogicException + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteMissingResource() + { + $handler = new StreamHandler(null); + $handler->handle($this->getRecord()); + } + + public function invalidArgumentProvider() + { + return array( + array(1), + array(array()), + array(array('bogus://url')), + ); + } + + /** + * @dataProvider invalidArgumentProvider + * @expectedException InvalidArgumentException + * @covers Monolog\Handler\StreamHandler::__construct + */ + public function testWriteInvalidArgument($invalidArgument) + { + $handler = new StreamHandler($invalidArgument); + } + + /** + * @expectedException UnexpectedValueException + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteInvalidResource() + { + $handler = new StreamHandler('bogus://url'); + $handler->handle($this->getRecord()); + } + + /** + * @expectedException UnexpectedValueException + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteNonExistingResource() + { + $handler = new StreamHandler('/foo/bar/baz/'.rand(0, 10000)); + $handler->handle($this->getRecord()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php new file mode 100644 index 00000000..8f9e46bf --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php @@ -0,0 +1,44 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +class SyslogHandlerTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Handler\SyslogHandler::__construct + */ + public function testConstruct() + { + $handler = new SyslogHandler('test'); + $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); + + $handler = new SyslogHandler('test', LOG_USER); + $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); + + $handler = new SyslogHandler('test', 'user'); + $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); + + $handler = new SyslogHandler('test', LOG_USER, Logger::DEBUG, true, LOG_PERROR); + $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); + } + + /** + * @covers Monolog\Handler\SyslogHandler::__construct + */ + public function testConstructInvalidFacility() + { + $this->setExpectedException('UnexpectedValueException'); + $handler = new SyslogHandler('test', 'unknown'); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php new file mode 100644 index 00000000..497812b3 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php @@ -0,0 +1,49 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +/** + * @requires extension sockets + */ +class SyslogUdpHandlerTest extends \PHPUnit_Framework_TestCase +{ + /** + * @expectedException UnexpectedValueException + */ + public function testWeValidateFacilities() + { + $handler = new SyslogUdpHandler("ip", null, "invalidFacility"); + } + + public function testWeSplitIntoLines() + { + $handler = new SyslogUdpHandler("127.0.0.1", 514, "authpriv"); + $handler->setFormatter(new \Monolog\Formatter\ChromePHPFormatter()); + + $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('write'), array('lol', 'lol')); + $socket->expects($this->at(0)) + ->method('write') + ->with("lol", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 "); + $socket->expects($this->at(1)) + ->method('write') + ->with("hej", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 "); + + $handler->setSocket($socket); + + $handler->handle($this->getRecordWithMessage("hej\nlol")); + } + + protected function getRecordWithMessage($msg) + { + return array('message' => $msg, 'level' => \Monolog\Logger::WARNING, 'context' => null, 'extra' => array(), 'channel' => 'lol'); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php new file mode 100644 index 00000000..801d80a9 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php @@ -0,0 +1,56 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\TestHandler + */ +class TestHandlerTest extends TestCase +{ + /** + * @dataProvider methodProvider + */ + public function testHandler($method, $level) + { + $handler = new TestHandler; + $record = $this->getRecord($level, 'test'.$method); + $this->assertFalse($handler->{'has'.$method}($record)); + $this->assertFalse($handler->{'has'.$method.'Records'}()); + $handler->handle($record); + + $this->assertFalse($handler->{'has'.$method}('bar')); + $this->assertTrue($handler->{'has'.$method}($record)); + $this->assertTrue($handler->{'has'.$method}('test'.$method)); + $this->assertTrue($handler->{'has'.$method.'Records'}()); + + $records = $handler->getRecords(); + unset($records[0]['formatted']); + $this->assertEquals(array($record), $records); + } + + public function methodProvider() + { + return array( + array('Emergency', Logger::EMERGENCY), + array('Alert' , Logger::ALERT), + array('Critical' , Logger::CRITICAL), + array('Error' , Logger::ERROR), + array('Warning' , Logger::WARNING), + array('Info' , Logger::INFO), + array('Notice' , Logger::NOTICE), + array('Debug' , Logger::DEBUG), + ); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php new file mode 100644 index 00000000..bcaf52b3 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php @@ -0,0 +1,46 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +/** + * @requires extension sockets + */ +class UdpSocketTest extends TestCase +{ + public function testWeDoNotTruncateShortMessages() + { + $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol')); + + $socket->expects($this->at(0)) + ->method('send') + ->with("HEADER: The quick brown fox jumps over the lazy dog"); + + $socket->write("The quick brown fox jumps over the lazy dog", "HEADER: "); + } + + public function testLongMessagesAreTruncated() + { + $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol')); + + $truncatedString = str_repeat("derp", 16254).'d'; + + $socket->expects($this->exactly(1)) + ->method('send') + ->with("HEADER" . $truncatedString); + + $longString = str_repeat("derp", 20000); + + $socket->write($longString, "HEADER"); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php new file mode 100644 index 00000000..8d37a1fc --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php @@ -0,0 +1,121 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class WhatFailureGroupHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::__construct + * @expectedException InvalidArgumentException + */ + public function testConstructorOnlyTakesHandler() + { + new WhatFailureGroupHandler(array(new TestHandler(), "foo")); + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::__construct + * @covers Monolog\Handler\WhatFailureGroupHandler::handle + */ + public function testHandle() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new WhatFailureGroupHandler($testHandlers); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::handleBatch + */ + public function testHandleBatch() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new WhatFailureGroupHandler($testHandlers); + $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO))); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::isHandling + */ + public function testIsHandling() + { + $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING)); + $handler = new WhatFailureGroupHandler($testHandlers); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR))); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new WhatFailureGroupHandler(array($test)); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::handle + */ + public function testHandleException() + { + $test = new TestHandler(); + $exception = new ExceptionTestHandler(); + $handler = new WhatFailureGroupHandler(array($exception, $test, $exception)); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } +} + +class ExceptionTestHandler extends TestHandler +{ + /** + * {@inheritdoc} + */ + public function handle(array $record) + { + parent::handle($record); + + throw new \Exception("ExceptionTestHandler::handle"); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php new file mode 100644 index 00000000..416039e6 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php @@ -0,0 +1,69 @@ +<?php +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +class ZendMonitorHandlerTest extends TestCase +{ + protected $zendMonitorHandler; + + public function setUp() + { + if (!function_exists('zend_monitor_custom_event')) { + $this->markTestSkipped('ZendServer is not installed'); + } + } + + /** + * @covers Monolog\Handler\ZendMonitorHandler::write + */ + public function testWrite() + { + $record = $this->getRecord(); + $formatterResult = array( + 'message' => $record['message'] + ); + + $zendMonitor = $this->getMockBuilder('Monolog\Handler\ZendMonitorHandler') + ->setMethods(array('writeZendMonitorCustomEvent', 'getDefaultFormatter')) + ->getMock(); + + $formatterMock = $this->getMockBuilder('Monolog\Formatter\NormalizerFormatter') + ->disableOriginalConstructor() + ->getMock(); + + $formatterMock->expects($this->once()) + ->method('format') + ->will($this->returnValue($formatterResult)); + + $zendMonitor->expects($this->once()) + ->method('getDefaultFormatter') + ->will($this->returnValue($formatterMock)); + + $levelMap = $zendMonitor->getLevelMap(); + + $zendMonitor->expects($this->once()) + ->method('writeZendMonitorCustomEvent') + ->with($levelMap[$record['level']], $record['message'], $formatterResult); + + $zendMonitor->handle($record); + } + + /** + * @covers Monolog\Handler\ZendMonitorHandler::getDefaultFormatter + */ + public function testGetDefaultFormatterReturnsNormalizerFormatter() + { + $zendMonitor = new ZendMonitorHandler(); + $this->assertInstanceOf('Monolog\Formatter\NormalizerFormatter', $zendMonitor->getDefaultFormatter()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/LoggerTest.php b/vendor/monolog/monolog/tests/Monolog/LoggerTest.php new file mode 100644 index 00000000..7a19c0b4 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/LoggerTest.php @@ -0,0 +1,409 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use Monolog\Processor\WebProcessor; +use Monolog\Handler\TestHandler; + +class LoggerTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Logger::getName + */ + public function testGetName() + { + $logger = new Logger('foo'); + $this->assertEquals('foo', $logger->getName()); + } + + /** + * @covers Monolog\Logger::getLevelName + */ + public function testGetLevelName() + { + $this->assertEquals('ERROR', Logger::getLevelName(Logger::ERROR)); + } + + /** + * @covers Monolog\Logger::getLevelName + * @expectedException InvalidArgumentException + */ + public function testGetLevelNameThrows() + { + Logger::getLevelName(5); + } + + /** + * @covers Monolog\Logger::__construct + */ + public function testChannel() + { + $logger = new Logger('foo'); + $handler = new TestHandler; + $logger->pushHandler($handler); + $logger->addWarning('test'); + list($record) = $handler->getRecords(); + $this->assertEquals('foo', $record['channel']); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testLog() + { + $logger = new Logger(__METHOD__); + + $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle')); + $handler->expects($this->once()) + ->method('handle'); + $logger->pushHandler($handler); + + $this->assertTrue($logger->addWarning('test')); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testLogNotHandled() + { + $logger = new Logger(__METHOD__); + + $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'), array(Logger::ERROR)); + $handler->expects($this->never()) + ->method('handle'); + $logger->pushHandler($handler); + + $this->assertFalse($logger->addWarning('test')); + } + + public function testHandlersInCtor() + { + $handler1 = new TestHandler; + $handler2 = new TestHandler; + $logger = new Logger(__METHOD__, array($handler1, $handler2)); + + $this->assertEquals($handler1, $logger->popHandler()); + $this->assertEquals($handler2, $logger->popHandler()); + } + + public function testProcessorsInCtor() + { + $processor1 = new WebProcessor; + $processor2 = new WebProcessor; + $logger = new Logger(__METHOD__, array(), array($processor1, $processor2)); + + $this->assertEquals($processor1, $logger->popProcessor()); + $this->assertEquals($processor2, $logger->popProcessor()); + } + + /** + * @covers Monolog\Logger::pushHandler + * @covers Monolog\Logger::popHandler + * @expectedException LogicException + */ + public function testPushPopHandler() + { + $logger = new Logger(__METHOD__); + $handler1 = new TestHandler; + $handler2 = new TestHandler; + + $logger->pushHandler($handler1); + $logger->pushHandler($handler2); + + $this->assertEquals($handler2, $logger->popHandler()); + $this->assertEquals($handler1, $logger->popHandler()); + $logger->popHandler(); + } + + /** + * @covers Monolog\Logger::pushProcessor + * @covers Monolog\Logger::popProcessor + * @expectedException LogicException + */ + public function testPushPopProcessor() + { + $logger = new Logger(__METHOD__); + $processor1 = new WebProcessor; + $processor2 = new WebProcessor; + + $logger->pushProcessor($processor1); + $logger->pushProcessor($processor2); + + $this->assertEquals($processor2, $logger->popProcessor()); + $this->assertEquals($processor1, $logger->popProcessor()); + $logger->popProcessor(); + } + + /** + * @covers Monolog\Logger::pushProcessor + * @expectedException InvalidArgumentException + */ + public function testPushProcessorWithNonCallable() + { + $logger = new Logger(__METHOD__); + + $logger->pushProcessor(new \stdClass()); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testProcessorsAreExecuted() + { + $logger = new Logger(__METHOD__); + $handler = new TestHandler; + $logger->pushHandler($handler); + $logger->pushProcessor(function ($record) { + $record['extra']['win'] = true; + + return $record; + }); + $logger->addError('test'); + list($record) = $handler->getRecords(); + $this->assertTrue($record['extra']['win']); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testProcessorsAreCalledOnlyOnce() + { + $logger = new Logger(__METHOD__); + $handler = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler->expects($this->any()) + ->method('handle') + ->will($this->returnValue(true)) + ; + $logger->pushHandler($handler); + + $processor = $this->getMockBuilder('Monolog\Processor\WebProcessor') + ->disableOriginalConstructor() + ->setMethods(array('__invoke')) + ->getMock() + ; + $processor->expects($this->once()) + ->method('__invoke') + ->will($this->returnArgument(0)) + ; + $logger->pushProcessor($processor); + + $logger->addError('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testProcessorsNotCalledWhenNotHandled() + { + $logger = new Logger(__METHOD__); + $handler = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler->expects($this->once()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler); + $that = $this; + $logger->pushProcessor(function ($record) use ($that) { + $that->fail('The processor should not be called'); + }); + $logger->addAlert('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testHandlersNotCalledBeforeFirstHandling() + { + $logger = new Logger(__METHOD__); + + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->never()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + $handler1->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler1); + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->once()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler2->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler2); + + $handler3 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler3->expects($this->once()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + $handler3->expects($this->never()) + ->method('handle') + ; + $logger->pushHandler($handler3); + + $logger->debug('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testBubblingWhenTheHandlerReturnsFalse() + { + $logger = new Logger(__METHOD__); + + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler1->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler1); + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler2->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler2); + + $logger->debug('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testNotBubblingWhenTheHandlerReturnsTrue() + { + $logger = new Logger(__METHOD__); + + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler1->expects($this->never()) + ->method('handle') + ; + $logger->pushHandler($handler1); + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler2->expects($this->once()) + ->method('handle') + ->will($this->returnValue(true)) + ; + $logger->pushHandler($handler2); + + $logger->debug('test'); + } + + /** + * @covers Monolog\Logger::isHandling + */ + public function testIsHandling() + { + $logger = new Logger(__METHOD__); + + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + + $logger->pushHandler($handler1); + $this->assertFalse($logger->isHandling(Logger::DEBUG)); + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + + $logger->pushHandler($handler2); + $this->assertTrue($logger->isHandling(Logger::DEBUG)); + } + + /** + * @dataProvider logMethodProvider + * @covers Monolog\Logger::addDebug + * @covers Monolog\Logger::addInfo + * @covers Monolog\Logger::addNotice + * @covers Monolog\Logger::addWarning + * @covers Monolog\Logger::addError + * @covers Monolog\Logger::addCritical + * @covers Monolog\Logger::addAlert + * @covers Monolog\Logger::addEmergency + * @covers Monolog\Logger::debug + * @covers Monolog\Logger::info + * @covers Monolog\Logger::notice + * @covers Monolog\Logger::warn + * @covers Monolog\Logger::err + * @covers Monolog\Logger::crit + * @covers Monolog\Logger::alert + * @covers Monolog\Logger::emerg + */ + public function testLogMethods($method, $expectedLevel) + { + $logger = new Logger('foo'); + $handler = new TestHandler; + $logger->pushHandler($handler); + $logger->{$method}('test'); + list($record) = $handler->getRecords(); + $this->assertEquals($expectedLevel, $record['level']); + } + + public function logMethodProvider() + { + return array( + // monolog methods + array('addDebug', Logger::DEBUG), + array('addInfo', Logger::INFO), + array('addNotice', Logger::NOTICE), + array('addWarning', Logger::WARNING), + array('addError', Logger::ERROR), + array('addCritical', Logger::CRITICAL), + array('addAlert', Logger::ALERT), + array('addEmergency', Logger::EMERGENCY), + + // ZF/Sf2 compat methods + array('debug', Logger::DEBUG), + array('info', Logger::INFO), + array('notice', Logger::NOTICE), + array('warn', Logger::WARNING), + array('err', Logger::ERROR), + array('crit', Logger::CRITICAL), + array('alert', Logger::ALERT), + array('emerg', Logger::EMERGENCY), + ); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php new file mode 100644 index 00000000..5adb505d --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php @@ -0,0 +1,29 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class GitProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\GitProcessor::__invoke + */ + public function testProcessor() + { + $processor = new GitProcessor(); + $record = $processor($this->getRecord()); + + $this->assertArrayHasKey('git', $record['extra']); + $this->assertTrue(!is_array($record['extra']['git']['branch'])); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php new file mode 100644 index 00000000..0dd411d7 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php @@ -0,0 +1,123 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Acme; + +class Tester +{ + public function test($handler, $record) + { + $handler->handle($record); + } +} + +function tester($handler, $record) +{ + $handler->handle($record); +} + +namespace Monolog\Processor; + +use Monolog\Logger; +use Monolog\TestCase; +use Monolog\Handler\TestHandler; + +class IntrospectionProcessorTest extends TestCase +{ + public function getHandler() + { + $processor = new IntrospectionProcessor(); + $handler = new TestHandler(); + $handler->pushProcessor($processor); + + return $handler; + } + + public function testProcessorFromClass() + { + $handler = $this->getHandler(); + $tester = new \Acme\Tester; + $tester->test($handler, $this->getRecord()); + list($record) = $handler->getRecords(); + $this->assertEquals(__FILE__, $record['extra']['file']); + $this->assertEquals(18, $record['extra']['line']); + $this->assertEquals('Acme\Tester', $record['extra']['class']); + $this->assertEquals('test', $record['extra']['function']); + } + + public function testProcessorFromFunc() + { + $handler = $this->getHandler(); + \Acme\tester($handler, $this->getRecord()); + list($record) = $handler->getRecords(); + $this->assertEquals(__FILE__, $record['extra']['file']); + $this->assertEquals(24, $record['extra']['line']); + $this->assertEquals(null, $record['extra']['class']); + $this->assertEquals('Acme\tester', $record['extra']['function']); + } + + public function testLevelTooLow() + { + $input = array( + 'level' => Logger::DEBUG, + 'extra' => array(), + ); + + $expected = $input; + + $processor = new IntrospectionProcessor(Logger::CRITICAL); + $actual = $processor($input); + + $this->assertEquals($expected, $actual); + } + + public function testLevelEqual() + { + $input = array( + 'level' => Logger::CRITICAL, + 'extra' => array(), + ); + + $expected = $input; + $expected['extra'] = array( + 'file' => null, + 'line' => null, + 'class' => 'ReflectionMethod', + 'function' => 'invokeArgs', + ); + + $processor = new IntrospectionProcessor(Logger::CRITICAL); + $actual = $processor($input); + + $this->assertEquals($expected, $actual); + } + + public function testLevelHigher() + { + $input = array( + 'level' => Logger::EMERGENCY, + 'extra' => array(), + ); + + $expected = $input; + $expected['extra'] = array( + 'file' => null, + 'line' => null, + 'class' => 'ReflectionMethod', + 'function' => 'invokeArgs', + ); + + $processor = new IntrospectionProcessor(Logger::CRITICAL); + $actual = $processor($input); + + $this->assertEquals($expected, $actual); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php new file mode 100644 index 00000000..eb666144 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php @@ -0,0 +1,42 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class MemoryPeakUsageProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke + * @covers Monolog\Processor\MemoryProcessor::formatBytes + */ + public function testProcessor() + { + $processor = new MemoryPeakUsageProcessor(); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('memory_peak_usage', $record['extra']); + $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_peak_usage']); + } + + /** + * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke + * @covers Monolog\Processor\MemoryProcessor::formatBytes + */ + public function testProcessorWithoutFormatting() + { + $processor = new MemoryPeakUsageProcessor(true, false); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('memory_peak_usage', $record['extra']); + $this->assertInternalType('int', $record['extra']['memory_peak_usage']); + $this->assertGreaterThan(0, $record['extra']['memory_peak_usage']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php new file mode 100644 index 00000000..4692dbfc --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php @@ -0,0 +1,42 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class MemoryUsageProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\MemoryUsageProcessor::__invoke + * @covers Monolog\Processor\MemoryProcessor::formatBytes + */ + public function testProcessor() + { + $processor = new MemoryUsageProcessor(); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('memory_usage', $record['extra']); + $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_usage']); + } + + /** + * @covers Monolog\Processor\MemoryUsageProcessor::__invoke + * @covers Monolog\Processor\MemoryProcessor::formatBytes + */ + public function testProcessorWithoutFormatting() + { + $processor = new MemoryUsageProcessor(true, false); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('memory_usage', $record['extra']); + $this->assertInternalType('int', $record['extra']['memory_usage']); + $this->assertGreaterThan(0, $record['extra']['memory_usage']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php new file mode 100644 index 00000000..458d2a33 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php @@ -0,0 +1,30 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class ProcessIdProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\ProcessIdProcessor::__invoke + */ + public function testProcessor() + { + $processor = new ProcessIdProcessor(); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('process_id', $record['extra']); + $this->assertInternalType('int', $record['extra']['process_id']); + $this->assertGreaterThan(0, $record['extra']['process_id']); + $this->assertEquals(getmypid(), $record['extra']['process_id']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php new file mode 100644 index 00000000..81bfbdc3 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php @@ -0,0 +1,43 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +class PsrLogMessageProcessorTest extends \PHPUnit_Framework_TestCase +{ + /** + * @dataProvider getPairs + */ + public function testReplacement($val, $expected) + { + $proc = new PsrLogMessageProcessor; + + $message = $proc(array( + 'message' => '{foo}', + 'context' => array('foo' => $val) + )); + $this->assertEquals($expected, $message['message']); + } + + public function getPairs() + { + return array( + array('foo', 'foo'), + array('3', '3'), + array(3, '3'), + array(null, ''), + array(true, '1'), + array(false, ''), + array(new \stdClass, '[object stdClass]'), + array(array(), '[array]'), + ); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php new file mode 100644 index 00000000..851a9dc2 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php @@ -0,0 +1,29 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class TagProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\TagProcessor::__invoke + */ + public function testProcessor() + { + $tags = array(1, 2, 3); + $processor = new TagProcessor($tags); + $record = $processor($this->getRecord()); + + $this->assertEquals($tags, $record['extra']['tags']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php new file mode 100644 index 00000000..7ced62ca --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php @@ -0,0 +1,27 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class UidProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\UidProcessor::__invoke + */ + public function testProcessor() + { + $processor = new UidProcessor(); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('uid', $record['extra']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php new file mode 100644 index 00000000..dba89412 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php @@ -0,0 +1,98 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class WebProcessorTest extends TestCase +{ + public function testProcessor() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'HTTP_REFERER' => 'D', + 'SERVER_NAME' => 'F', + 'UNIQUE_ID' => 'G', + ); + + $processor = new WebProcessor($server); + $record = $processor($this->getRecord()); + $this->assertEquals($server['REQUEST_URI'], $record['extra']['url']); + $this->assertEquals($server['REMOTE_ADDR'], $record['extra']['ip']); + $this->assertEquals($server['REQUEST_METHOD'], $record['extra']['http_method']); + $this->assertEquals($server['HTTP_REFERER'], $record['extra']['referrer']); + $this->assertEquals($server['SERVER_NAME'], $record['extra']['server']); + $this->assertEquals($server['UNIQUE_ID'], $record['extra']['unique_id']); + } + + public function testProcessorDoNothingIfNoRequestUri() + { + $server = array( + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + ); + $processor = new WebProcessor($server); + $record = $processor($this->getRecord()); + $this->assertEmpty($record['extra']); + } + + public function testProcessorReturnNullIfNoHttpReferer() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'SERVER_NAME' => 'F', + ); + $processor = new WebProcessor($server); + $record = $processor($this->getRecord()); + $this->assertNull($record['extra']['referrer']); + } + + public function testProcessorDoesNotAddUniqueIdIfNotPresent() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'SERVER_NAME' => 'F', + ); + $processor = new WebProcessor($server); + $record = $processor($this->getRecord()); + $this->assertFalse(isset($record['extra']['unique_id'])); + } + + public function testProcessorAddsOnlyRequestedExtraFields() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'SERVER_NAME' => 'F', + ); + + $processor = new WebProcessor($server, array('url', 'http_method')); + $record = $processor($this->getRecord()); + + $this->assertSame(array('url' => 'A', 'http_method' => 'C'), $record['extra']); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testInvalidData() + { + new WebProcessor(new \stdClass); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php b/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php new file mode 100644 index 00000000..ab899449 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php @@ -0,0 +1,47 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use Monolog\Handler\TestHandler; +use Monolog\Formatter\LineFormatter; +use Monolog\Processor\PsrLogMessageProcessor; +use Psr\Log\Test\LoggerInterfaceTest; + +class PsrLogCompatTest extends LoggerInterfaceTest +{ + private $handler; + + public function getLogger() + { + $logger = new Logger('foo'); + $logger->pushHandler($handler = new TestHandler); + $logger->pushProcessor(new PsrLogMessageProcessor); + $handler->setFormatter(new LineFormatter('%level_name% %message%')); + + $this->handler = $handler; + + return $logger; + } + + public function getLogs() + { + $convert = function ($record) { + $lower = function ($match) { + return strtolower($match[0]); + }; + + return preg_replace_callback('{^[A-Z]+}', $lower, $record['formatted']); + }; + + return array_map($convert, $this->handler->getRecords()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/TestCase.php b/vendor/monolog/monolog/tests/Monolog/TestCase.php new file mode 100644 index 00000000..cae79340 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/TestCase.php @@ -0,0 +1,58 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +class TestCase extends \PHPUnit_Framework_TestCase +{ + /** + * @return array Record + */ + protected function getRecord($level = Logger::WARNING, $message = 'test', $context = array()) + { + return array( + 'message' => $message, + 'context' => $context, + 'level' => $level, + 'level_name' => Logger::getLevelName($level), + 'channel' => 'test', + 'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true))), + 'extra' => array(), + ); + } + + /** + * @return array + */ + protected function getMultipleRecords() + { + return array( + $this->getRecord(Logger::DEBUG, 'debug message 1'), + $this->getRecord(Logger::DEBUG, 'debug message 2'), + $this->getRecord(Logger::INFO, 'information'), + $this->getRecord(Logger::WARNING, 'warning'), + $this->getRecord(Logger::ERROR, 'error') + ); + } + + /** + * @return Monolog\Formatter\FormatterInterface + */ + protected function getIdentityFormatter() + { + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $formatter->expects($this->any()) + ->method('format') + ->will($this->returnCallback(function ($record) { return $record['message']; })); + + return $formatter; + } +} diff --git a/vendor/monolog/monolog/tests/bootstrap.php b/vendor/monolog/monolog/tests/bootstrap.php new file mode 100644 index 00000000..b78740e2 --- /dev/null +++ b/vendor/monolog/monolog/tests/bootstrap.php @@ -0,0 +1,15 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +$loader = require __DIR__ . "/../vendor/autoload.php"; +$loader->addPsr4('Monolog\\', __DIR__.'/Monolog'); + +date_default_timezone_set('UTC'); |