Update to MediaWiki 1.25.2

155 files changed, 16585 insertions, 0 deletions

diff --git a/vendor/monolog/monolog/CHANGELOG.mdown b/vendor/monolog/monolog/CHANGELOG.mdown
new file mode 100644
index 00000000..47042c73
--- /dev/null
+++ b/vendor/monolog/monolog/CHANGELOG.mdown
@@ -0,0 +1,202 @@
+### 1.12.0 (2014-12-29)
+
+  * Break: HandlerInterface::isHandling now receives a partial record containing only a level key. This was always the intent and does not break any Monolog handler but is strictly speaking a BC break and you should check if you relied on any other field in your own handlers.
+  * Added PsrHandler to forward records to another PSR-3 logger
+  * Added SamplingHandler to wrap around a handler and include only every Nth record
+  * Added MongoDBFormatter to support better storage with MongoDBHandler (it must be enabled manually for now)
+  * Added exception codes in the output of most formatters
+  * Added LineFormatter::includeStacktraces to enable exception stack traces in logs (uses more than one line)
+  * Added $useShortAttachment to SlackHandler to minify attachment size and $includeExtra to append extra data
+  * Added $host to HipChatHandler for users of private instances
+  * Added $transactionName to NewRelicHandler and support for a transaction_name context value
+  * Fixed MandrillHandler to avoid outputing API call responses
+  * Fixed some non-standard behaviors in SyslogUdpHandler
+
+### 1.11.0 (2014-09-30)
+
+  * Break: The NewRelicHandler extra and context data are now prefixed with extra_ and context_ to avoid clashes. Watch out if you have scripts reading those from the API and rely on names
+  * Added WhatFailureGroupHandler to suppress any exception coming from the wrapped handlers and avoid chain failures if a logging service fails
+  * Added MandrillHandler to send emails via the Mandrillapp.com API
+  * Added SlackHandler to log records to a Slack.com account
+  * Added FleepHookHandler to log records to a Fleep.io account
+  * Added LogglyHandler::addTag to allow adding tags to an existing handler
+  * Added $ignoreEmptyContextAndExtra to LineFormatter to avoid empty [] at the end
+  * Added $useLocking to StreamHandler and RotatingFileHandler to enable flock() while writing
+  * Added support for PhpAmqpLib in the AmqpHandler
+  * Added FingersCrossedHandler::clear and BufferHandler::clear to reset them between batches in long running jobs
+  * Added support for adding extra fields from $_SERVER in the WebProcessor
+  * Fixed support for non-string values in PrsLogMessageProcessor
+  * Fixed SwiftMailer messages being sent with the wrong date in long running scripts
+  * Fixed minor PHP 5.6 compatibility issues
+  * Fixed BufferHandler::close being called twice
+
+### 1.10.0 (2014-06-04)
+
+  * Added Logger::getHandlers() and Logger::getProcessors() methods
+  * Added $passthruLevel argument to FingersCrossedHandler to let it always pass some records through even if the trigger level is not reached
+  * Added support for extra data in NewRelicHandler
+  * Added $expandNewlines flag to the ErrorLogHandler to create multiple log entries when a message has multiple lines
+
+### 1.9.1 (2014-04-24)
+
+  * Fixed regression in RotatingFileHandler file permissions
+  * Fixed initialization of the BufferHandler to make sure it gets flushed after receiving records
+  * Fixed ChromePHPHandler and FirePHPHandler's activation strategies to be more conservative
+
+### 1.9.0 (2014-04-20)
+
+  * Added LogEntriesHandler to send logs to a LogEntries account
+  * Added $filePermissions to tweak file mode on StreamHandler and RotatingFileHandler
+  * Added $useFormatting flag to MemoryProcessor to make it send raw data in bytes
+  * Added support for table formatting in FirePHPHandler via the table context key
+  * Added a TagProcessor to add tags to records, and support for tags in RavenHandler
+  * Added $appendNewline flag to the JsonFormatter to enable using it when logging to files
+  * Added sound support to the PushoverHandler
+  * Fixed multi-threading support in StreamHandler
+  * Fixed empty headers issue when ChromePHPHandler received no records
+  * Fixed default format of the ErrorLogHandler
+
+### 1.8.0 (2014-03-23)
+
+  * Break: the LineFormatter now strips newlines by default because this was a bug, set $allowInlineLineBreaks to true if you need them
+  * Added BrowserConsoleHandler to send logs to any browser's console via console.log() injection in the output
+  * Added FilterHandler to filter records and only allow those of a given list of levels through to the wrapped handler
+  * Added FlowdockHandler to send logs to a Flowdock account
+  * Added RollbarHandler to send logs to a Rollbar account
+  * Added HtmlFormatter to send prettier log emails with colors for each log level
+  * Added GitProcessor to add the current branch/commit to extra record data
+  * Added a Monolog\Registry class to allow easier global access to pre-configured loggers
+  * Added support for the new official graylog2/gelf-php lib for GelfHandler, upgrade if you can by replacing the mlehner/gelf-php requirement
+  * Added support for HHVM
+  * Added support for Loggly batch uploads
+  * Added support for tweaking the content type and encoding in NativeMailerHandler
+  * Added $skipClassesPartials to tweak the ignored classes in the IntrospectionProcessor
+  * Fixed batch request support in GelfHandler
+
+### 1.7.0 (2013-11-14)
+
+  * Added ElasticSearchHandler to send logs to an Elastic Search server
+  * Added DynamoDbHandler and ScalarFormatter to send logs to Amazon's Dynamo DB
+  * Added SyslogUdpHandler to send logs to a remote syslogd server
+  * Added LogglyHandler to send logs to a Loggly account
+  * Added $level to IntrospectionProcessor so it only adds backtraces when needed
+  * Added $version to LogstashFormatter to allow using the new v1 Logstash format
+  * Added $appName to NewRelicHandler
+  * Added configuration of Pushover notification retries/expiry
+  * Added $maxColumnWidth to NativeMailerHandler to change the 70 chars default
+  * Added chainability to most setters for all handlers
+  * Fixed RavenHandler batch processing so it takes the message from the record with highest priority
+  * Fixed HipChatHandler batch processing so it sends all messages at once
+  * Fixed issues with eAccelerator
+  * Fixed and improved many small things
+
+### 1.6.0 (2013-07-29)
+
+  * Added HipChatHandler to send logs to a HipChat chat room
+  * Added ErrorLogHandler to send logs to PHP's error_log function
+  * Added NewRelicHandler to send logs to NewRelic's service
+  * Added Monolog\ErrorHandler helper class to register a Logger as exception/error/fatal handler
+  * Added ChannelLevelActivationStrategy for the FingersCrossedHandler to customize levels by channel
+  * Added stack traces output when normalizing exceptions (json output & co)
+  * Added Monolog\Logger::API constant (currently 1)
+  * Added support for ChromePHP's v4.0 extension
+  * Added support for message priorities in PushoverHandler, see $highPriorityLevel and $emergencyLevel
+  * Added support for sending messages to multiple users at once with the PushoverHandler
+  * Fixed RavenHandler's support for batch sending of messages (when behind a Buffer or FingersCrossedHandler)
+  * Fixed normalization of Traversables with very large data sets, only the first 1000 items are shown now
+  * Fixed issue in RotatingFileHandler when an open_basedir restriction is active
+  * Fixed minor issues in RavenHandler and bumped the API to Raven 0.5.0
+  * Fixed SyslogHandler issue when many were used concurrently with different facilities
+
+### 1.5.0 (2013-04-23)
+
+  * Added ProcessIdProcessor to inject the PID in log records
+  * Added UidProcessor to inject a unique identifier to all log records of one request/run
+  * Added support for previous exceptions in the LineFormatter exception serialization
+  * Added Monolog\Logger::getLevels() to get all available levels
+  * Fixed ChromePHPHandler so it avoids sending headers larger than Chrome can handle
+
+### 1.4.1 (2013-04-01)
+
+  * Fixed exception formatting in the LineFormatter to be more minimalistic
+  * Fixed RavenHandler's handling of context/extra data, requires Raven client >0.1.0
+  * Fixed log rotation in RotatingFileHandler to work with long running scripts spanning multiple days
+  * Fixed WebProcessor array access so it checks for data presence
+  * Fixed Buffer, Group and FingersCrossed handlers to make use of their processors
+
+### 1.4.0 (2013-02-13)
+
+  * Added RedisHandler to log to Redis via the Predis library or the phpredis extension
+  * Added ZendMonitorHandler to log to the Zend Server monitor
+  * Added the possibility to pass arrays of handlers and processors directly in the Logger constructor
+  * Added `$useSSL` option to the PushoverHandler which is enabled by default
+  * Fixed ChromePHPHandler and FirePHPHandler issue when multiple instances are used simultaneously
+  * Fixed header injection capability in the NativeMailHandler
+
+### 1.3.1 (2013-01-11)
+
+  * Fixed LogstashFormatter to be usable with stream handlers
+  * Fixed GelfMessageFormatter levels on Windows
+
+### 1.3.0 (2013-01-08)
+
+  * Added PSR-3 compliance, the `Monolog\Logger` class is now an instance of `Psr\Log\LoggerInterface`
+  * Added PsrLogMessageProcessor that you can selectively enable for full PSR-3 compliance
+  * Added LogstashFormatter (combine with SocketHandler or StreamHandler to send logs to Logstash)
+  * Added PushoverHandler to send mobile notifications
+  * Added CouchDBHandler and DoctrineCouchDBHandler
+  * Added RavenHandler to send data to Sentry servers
+  * Added support for the new MongoClient class in MongoDBHandler
+  * Added microsecond precision to log records' timestamps
+  * Added `$flushOnOverflow` param to BufferHandler to flush by batches instead of losing
+    the oldest entries
+  * Fixed normalization of objects with cyclic references
+
+### 1.2.1 (2012-08-29)
+
+  * Added new $logopts arg to SyslogHandler to provide custom openlog options
+  * Fixed fatal error in SyslogHandler
+
+### 1.2.0 (2012-08-18)
+
+  * Added AmqpHandler (for use with AMQP servers)
+  * Added CubeHandler
+  * Added NativeMailerHandler::addHeader() to send custom headers in mails
+  * Added the possibility to specify more than one recipient in NativeMailerHandler
+  * Added the possibility to specify float timeouts in SocketHandler
+  * Added NOTICE and EMERGENCY levels to conform with RFC 5424
+  * Fixed the log records to use the php default timezone instead of UTC
+  * Fixed BufferHandler not being flushed properly on PHP fatal errors
+  * Fixed normalization of exotic resource types
+  * Fixed the default format of the SyslogHandler to avoid duplicating datetimes in syslog
+
+### 1.1.0 (2012-04-23)
+
+  * Added Monolog\Logger::isHandling() to check if a handler will
+    handle the given log level
+  * Added ChromePHPHandler
+  * Added MongoDBHandler
+  * Added GelfHandler (for use with Graylog2 servers)
+  * Added SocketHandler (for use with syslog-ng for example)
+  * Added NormalizerFormatter
+  * Added the possibility to change the activation strategy of the FingersCrossedHandler
+  * Added possibility to show microseconds in logs
+  * Added `server` and `referer` to WebProcessor output
+
+### 1.0.2 (2011-10-24)
+
+  * Fixed bug in IE with large response headers and FirePHPHandler
+
+### 1.0.1 (2011-08-25)
+
+  * Added MemoryPeakUsageProcessor and MemoryUsageProcessor
+  * Added Monolog\Logger::getName() to get a logger's channel name
+
+### 1.0.0 (2011-07-06)
+
+  * Added IntrospectionProcessor to get info from where the logger was called
+  * Fixed WebProcessor in CLI
+
+### 1.0.0-RC1 (2011-07-01)
+
+  * Initial release
diff --git a/vendor/monolog/monolog/LICENSE b/vendor/monolog/monolog/LICENSE
new file mode 100644
index 00000000..35727045
--- /dev/null
+++ b/vendor/monolog/monolog/LICENSE
@@ -0,0 +1,19 @@
+Copyright (c) 2011-2014 Jordi Boggiano
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is furnished
+to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/vendor/monolog/monolog/README.mdown b/vendor/monolog/monolog/README.mdown
new file mode 100644
index 00000000..add476a8
--- /dev/null
+++ b/vendor/monolog/monolog/README.mdown
@@ -0,0 +1,283 @@
+Monolog - Logging for PHP 5.3+ [![Build Status](https://secure.travis-ci.org/Seldaek/monolog.png)](http://travis-ci.org/Seldaek/monolog)
+==============================
+
+[![Total Downloads](https://poser.pugx.org/monolog/monolog/downloads.png)](https://packagist.org/packages/monolog/monolog)
+[![Latest Stable Version](https://poser.pugx.org/monolog/monolog/v/stable.png)](https://packagist.org/packages/monolog/monolog)
+[![Reference Status](https://www.versioneye.com/php/monolog:monolog/reference_badge.svg)](https://www.versioneye.com/php/monolog:monolog/references)
+
+
+Monolog sends your logs to files, sockets, inboxes, databases and various
+web services. See the complete list of handlers below. Special handlers
+allow you to build advanced logging strategies.
+
+This library implements the [PSR-3](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-3-logger-interface.md)
+interface that you can type-hint against in your own libraries to keep
+a maximum of interoperability. You can also use it in your applications to
+make sure you can always use another compatible logger at a later time.
+As of 1.11.0 Monolog public APIs will also accept PSR-3 log levels.
+Internally Monolog still uses its own level scheme since it predates PSR-3.
+
+Usage
+-----
+
+Install the latest version with `composer require monolog/monolog`
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+
+// create a log channel
+$log = new Logger('name');
+$log->pushHandler(new StreamHandler('path/to/your.log', Logger::WARNING));
+
+// add records to the log
+$log->addWarning('Foo');
+$log->addError('Bar');
+```
+
+Core Concepts
+-------------
+
+Every `Logger` instance has a channel (name) and a stack of handlers. Whenever
+you add a record to the logger, it traverses the handler stack. Each handler
+decides whether it fully handled the record, and if so, the propagation of the
+record ends there.
+
+This allows for flexible logging setups, for example having a `StreamHandler` at
+the bottom of the stack that will log anything to disk, and on top of that add
+a `MailHandler` that will send emails only when an error message is logged.
+Handlers also have a `$bubble` property which defines whether they block the
+record or not if they handled it. In this example, setting the `MailHandler`'s
+`$bubble` argument to false means that records handled by the `MailHandler` will
+not propagate to the `StreamHandler` anymore.
+
+You can create many `Logger`s, each defining a channel (e.g.: db, request,
+router, ..) and each of them combining various handlers, which can be shared
+or not. The channel is reflected in the logs and allows you to easily see or
+filter records.
+
+Each Handler also has a Formatter, a default one with settings that make sense
+will be created if you don't set one. The formatters normalize and format
+incoming records so that they can be used by the handlers to output useful
+information.
+
+Custom severity levels are not available. Only the eight
+[RFC 5424](http://tools.ietf.org/html/rfc5424) levels (debug, info, notice,
+warning, error, critical, alert, emergency) are present for basic filtering
+purposes, but for sorting and other use cases that would require
+flexibility, you should add Processors to the Logger that can add extra
+information (tags, user ip, ..) to the records before they are handled.
+
+Log Levels
+----------
+
+Monolog supports the logging levels described by [RFC 5424](http://tools.ietf.org/html/rfc5424).
+
+- **DEBUG** (100): Detailed debug information.
+
+- **INFO** (200): Interesting events. Examples: User logs in, SQL logs.
+
+- **NOTICE** (250): Normal but significant events.
+
+- **WARNING** (300): Exceptional occurrences that are not errors. Examples:
+  Use of deprecated APIs, poor use of an API, undesirable things that are not
+  necessarily wrong.
+
+- **ERROR** (400): Runtime errors that do not require immediate action but
+  should typically be logged and monitored.
+
+- **CRITICAL** (500): Critical conditions. Example: Application component
+  unavailable, unexpected exception.
+
+- **ALERT** (550): Action must be taken immediately. Example: Entire website
+  down, database unavailable, etc. This should trigger the SMS alerts and wake
+  you up.
+
+- **EMERGENCY** (600): Emergency: system is unusable.
+
+Docs
+====
+
+**See the `doc` directory for more detailed documentation.
+The following is only a list of all parts that come with Monolog.**
+
+Handlers
+--------
+
+### Log to files and syslog
+
+- _StreamHandler_: Logs records into any PHP stream, use this for log files.
+- _RotatingFileHandler_: Logs records to a file and creates one logfile per day.
+  It will also delete files older than `$maxFiles`. You should use
+  [logrotate](http://linuxcommand.org/man_pages/logrotate8.html) for high profile
+  setups though, this is just meant as a quick and dirty solution.
+- _SyslogHandler_: Logs records to the syslog.
+- _ErrorLogHandler_: Logs records to PHP's
+  [`error_log()`](http://docs.php.net/manual/en/function.error-log.php) function.
+
+### Send alerts and emails
+
+- _NativeMailerHandler_: Sends emails using PHP's
+  [`mail()`](http://php.net/manual/en/function.mail.php) function.
+- _SwiftMailerHandler_: Sends emails using a [`Swift_Mailer`](http://swiftmailer.org/) instance.
+- _PushoverHandler_: Sends mobile notifications via the [Pushover](https://www.pushover.net/) API.
+- _HipChatHandler_: Logs records to a [HipChat](http://hipchat.com) chat room using its API.
+- _FlowdockHandler_: Logs records to a [Flowdock](https://www.flowdock.com/) account.
+- _SlackHandler_: Logs records to a [Slack](https://www.slack.com/) account.
+- _MandrillHandler_: Sends emails via the Mandrill API using a [`Swift_Message`](http://swiftmailer.org/) instance.
+- _FleepHookHandler_: Logs records to a [Fleep](https://fleep.io/) conversation using Webhooks.
+
+### Log specific servers and networked logging
+
+- _SocketHandler_: Logs records to [sockets](http://php.net/fsockopen), use this
+  for UNIX and TCP sockets. See an [example](https://github.com/Seldaek/monolog/blob/master/doc/sockets.md).
+- _AmqpHandler_: Logs records to an [amqp](http://www.amqp.org/) compatible
+  server. Requires the [php-amqp](http://pecl.php.net/package/amqp) extension (1.0+).
+- _GelfHandler_: Logs records to a [Graylog2](http://www.graylog2.org) server.
+- _CubeHandler_: Logs records to a [Cube](http://square.github.com/cube/) server.
+- _RavenHandler_: Logs records to a [Sentry](http://getsentry.com/) server using
+  [raven](https://packagist.org/packages/raven/raven).
+- _ZendMonitorHandler_: Logs records to the Zend Monitor present in Zend Server.
+- _NewRelicHandler_: Logs records to a [NewRelic](http://newrelic.com/) application.
+- _LogglyHandler_: Logs records to a [Loggly](http://www.loggly.com/) account.
+- _RollbarHandler_: Logs records to a [Rollbar](https://rollbar.com/) account.
+- _SyslogUdpHandler_: Logs records to a remote [Syslogd](http://www.rsyslog.com/) server.
+- _LogEntriesHandler_: Logs records to a [LogEntries](http://logentries.com/) account.
+
+### Logging in development
+
+- _FirePHPHandler_: Handler for [FirePHP](http://www.firephp.org/), providing
+  inline `console` messages within [FireBug](http://getfirebug.com/).
+- _ChromePHPHandler_: Handler for [ChromePHP](http://www.chromephp.com/), providing
+  inline `console` messages within Chrome.
+- _BrowserConsoleHandler_: Handler to send logs to browser's Javascript `console` with
+  no browser extension required. Most browsers supporting `console` API are supported.
+
+### Log to databases
+
+- _RedisHandler_: Logs records to a [redis](http://redis.io) server.
+- _MongoDBHandler_: Handler to write records in MongoDB via a
+  [Mongo](http://pecl.php.net/package/mongo) extension connection.
+- _CouchDBHandler_: Logs records to a CouchDB server.
+- _DoctrineCouchDBHandler_: Logs records to a CouchDB server via the Doctrine CouchDB ODM.
+- _ElasticSearchHandler_: Logs records to an Elastic Search server.
+- _DynamoDbHandler_: Logs records to a DynamoDB table with the [AWS SDK](https://github.com/aws/aws-sdk-php).
+
+### Wrappers / Special Handlers
+
+- _FingersCrossedHandler_: A very interesting wrapper. It takes a logger as
+  parameter and will accumulate log records of all levels until a record
+  exceeds the defined severity level. At which point it delivers all records,
+  including those of lower severity, to the handler it wraps. This means that
+  until an error actually happens you will not see anything in your logs, but
+  when it happens you will have the full information, including debug and info
+  records. This provides you with all the information you need, but only when
+  you need it.
+- _WhatFailureGroupHandler_: This handler extends the _GroupHandler_ ignoring
+   exceptions raised by each child handler. This allows you to ignore issues
+   where a remote tcp connection may have died but you do not want your entire
+   application to crash and may wish to continue to log to other handlers.
+- _BufferHandler_: This handler will buffer all the log records it receives
+  until `close()` is called at which point it will call `handleBatch()` on the
+  handler it wraps with all the log messages at once. This is very useful to
+  send an email with all records at once for example instead of having one mail
+  for every log record.
+- _GroupHandler_: This handler groups other handlers. Every record received is
+  sent to all the handlers it is configured with.
+- _FilterHandler_: This handler only lets records of the given levels through
+   to the wrapped handler.
+- _SamplingHandler_: Wraps around another handler and lets you sample records
+   if you only want to store some of them.
+- _NullHandler_: Any record it can handle will be thrown away. This can be used
+  to put on top of an existing handler stack to disable it temporarily.
+- _PsrHandler_: Can be used to forward log records to an existing PSR-3 logger
+- _TestHandler_: Used for testing, it records everything that is sent to it and
+  has accessors to read out the information.
+
+Formatters
+----------
+
+- _LineFormatter_: Formats a log record into a one-line string.
+- _HtmlFormatter_: Used to format log records into a human readable html table, mainly suitable for emails.
+- _NormalizerFormatter_: Normalizes objects/resources down to strings so a record can easily be serialized/encoded.
+- _ScalarFormatter_: Used to format log records into an associative array of scalar values.
+- _JsonFormatter_: Encodes a log record into json.
+- _WildfireFormatter_: Used to format log records into the Wildfire/FirePHP protocol, only useful for the FirePHPHandler.
+- _ChromePHPFormatter_: Used to format log records into the ChromePHP format, only useful for the ChromePHPHandler.
+- _GelfMessageFormatter_: Used to format log records into Gelf message instances, only useful for the GelfHandler.
+- _LogstashFormatter_: Used to format log records into [logstash](http://logstash.net/) event json, useful for any handler listed under inputs [here](http://logstash.net/docs/latest).
+- _ElasticaFormatter_: Used to format log records into an Elastica\Document object, only useful for the ElasticSearchHandler.
+- _LogglyFormatter_: Used to format log records into Loggly messages, only useful for the LogglyHandler.
+- _FlowdockFormatter_: Used to format log records into Flowdock messages, only useful for the FlowdockHandler.
+- _MongoDBFormatter_: Converts \DateTime instances to \MongoDate and objects recursively to arrays, only useful with the MongoDBHandler.
+
+Processors
+----------
+
+- _IntrospectionProcessor_: Adds the line/file/class/method from which the log call originated.
+- _WebProcessor_: Adds the current request URI, request method and client IP to a log record.
+- _MemoryUsageProcessor_: Adds the current memory usage to a log record.
+- _MemoryPeakUsageProcessor_: Adds the peak memory usage to a log record.
+- _ProcessIdProcessor_: Adds the process id to a log record.
+- _UidProcessor_: Adds a unique identifier to a log record.
+- _GitProcessor_: Adds the current git branch and commit to a log record.
+- _TagProcessor_: Adds an array of predefined tags to a log record.
+
+Utilities
+---------
+
+- _Registry_: The `Monolog\Registry` class lets you configure global loggers that you
+  can then statically access from anywhere. It is not really a best practice but can
+  help in some older codebases or for ease of use.
+- _ErrorHandler_: The `Monolog\ErrorHandler` class allows you to easily register
+  a Logger instance as an exception handler, error handler or fatal error handler.
+- _ErrorLevelActivationStrategy_: Activates a FingersCrossedHandler when a certain log
+  level is reached.
+- _ChannelLevelActivationStrategy_: Activates a FingersCrossedHandler when a certain
+  log level is reached, depending on which channel received the log record.
+
+About
+=====
+
+Requirements
+------------
+
+- Monolog works with PHP 5.3 or above, and is also tested to work with HHVM.
+
+Submitting bugs and feature requests
+------------------------------------
+
+Bugs and feature request are tracked on [GitHub](https://github.com/Seldaek/monolog/issues)
+
+Frameworks Integration
+----------------------
+
+- Frameworks and libraries using [PSR-3](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-3-logger-interface.md)
+  can be used very easily with Monolog since it implements the interface.
+- [Symfony2](http://symfony.com) comes out of the box with Monolog.
+- [Silex](http://silex.sensiolabs.org/) comes out of the box with Monolog.
+- [Laravel 4](http://laravel.com/) comes out of the box with Monolog.
+- [PPI](http://www.ppi.io/) comes out of the box with Monolog.
+- [CakePHP](http://cakephp.org/) is usable with Monolog via the [cakephp-monolog](https://github.com/jadb/cakephp-monolog) plugin.
+- [Slim](http://www.slimframework.com/) is usable with Monolog via the [Slim-Monolog](https://github.com/Flynsarmy/Slim-Monolog) log writer.
+- [XOOPS 2.6](http://xoops.org/) comes out of the box with Monolog.
+- [Aura.Web_Project](https://github.com/auraphp/Aura.Web_Project) comes out of the box with Monolog.
+
+Author
+------
+
+Jordi Boggiano - <j.boggiano@seld.be> - <http://twitter.com/seldaek><br />
+See also the list of [contributors](https://github.com/Seldaek/monolog/contributors) which participated in this project.
+
+License
+-------
+
+Monolog is licensed under the MIT License - see the `LICENSE` file for details
+
+Acknowledgements
+----------------
+
+This library is heavily inspired by Python's [Logbook](http://packages.python.org/Logbook/)
+library, although most concepts have been adjusted to fit to the PHP world.
diff --git a/vendor/monolog/monolog/composer.json b/vendor/monolog/monolog/composer.json
new file mode 100644
index 00000000..43704236
--- /dev/null
+++ b/vendor/monolog/monolog/composer.json
@@ -0,0 +1,50 @@
+{
+    "name": "monolog/monolog",
+    "description": "Sends your logs to files, sockets, inboxes, databases and various web services",
+    "keywords": ["log", "logging", "psr-3"],
+    "homepage": "http://github.com/Seldaek/monolog",
+    "type": "library",
+    "license": "MIT",
+    "authors": [
+        {
+            "name": "Jordi Boggiano",
+            "email": "j.boggiano@seld.be",
+            "homepage": "http://seld.be"
+        }
+    ],
+    "require": {
+        "php": ">=5.3.0",
+        "psr/log": "~1.0"
+    },
+    "require-dev": {
+        "phpunit/phpunit": "~4.0",
+        "graylog2/gelf-php": "~1.0",
+        "raven/raven": "~0.5",
+        "ruflin/elastica": "0.90.*",
+        "doctrine/couchdb": "~1.0@dev",
+        "aws/aws-sdk-php": "~2.4, >2.4.8",
+        "videlalvaro/php-amqplib": "~2.4"
+    },
+    "suggest": {
+        "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server",
+        "raven/raven": "Allow sending log messages to a Sentry server",
+        "doctrine/couchdb": "Allow sending log messages to a CouchDB server",
+        "ruflin/elastica": "Allow sending log messages to an Elastic Search server",
+        "videlalvaro/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib",
+        "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+        "ext-mongo": "Allow sending log messages to a MongoDB server",
+        "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB",
+        "rollbar/rollbar": "Allow sending log messages to Rollbar"
+    },
+    "autoload": {
+        "psr-4": {"Monolog\\": "src/Monolog"}
+    },
+    "provide": {
+        "psr/log-implementation": "1.0.0"
+    },
+    "extra": {
+        "branch-alias": {
+            "dev-master": "1.12.x-dev"
+        }
+    }
+}
diff --git a/vendor/monolog/monolog/doc/extending.md b/vendor/monolog/monolog/doc/extending.md
new file mode 100644
index 00000000..bb39ddcf
--- /dev/null
+++ b/vendor/monolog/monolog/doc/extending.md
@@ -0,0 +1,76 @@
+Extending Monolog
+=================
+
+Monolog is fully extensible, allowing you to adapt your logger to your needs.
+
+Writing your own handler
+------------------------
+
+Monolog provides many built-in handlers. But if the one you need does not
+exist, you can write it and use it in your logger. The only requirement is
+to implement `Monolog\Handler\HandlerInterface`.
+
+Let's write a PDOHandler to log records to a database. We will extend the
+abstract class provided by Monolog to keep things DRY.
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\AbstractProcessingHandler;
+
+class PDOHandler extends AbstractProcessingHandler
+{
+    private $initialized = false;
+    private $pdo;
+    private $statement;
+
+    public function __construct(PDO $pdo, $level = Logger::DEBUG, $bubble = true)
+    {
+        $this->pdo = $pdo;
+        parent::__construct($level, $bubble);
+    }
+
+    protected function write(array $record)
+    {
+        if (!$this->initialized) {
+            $this->initialize();
+        }
+
+        $this->statement->execute(array(
+            'channel' => $record['channel'],
+            'level' => $record['level'],
+            'message' => $record['formatted'],
+            'time' => $record['datetime']->format('U'),
+        ));
+    }
+
+    private function initialize()
+    {
+        $this->pdo->exec(
+            'CREATE TABLE IF NOT EXISTS monolog '
+            .'(channel VARCHAR(255), level INTEGER, message LONGTEXT, time INTEGER UNSIGNED)'
+        );
+        $this->statement = $this->pdo->prepare(
+            'INSERT INTO monolog (channel, level, message, time) VALUES (:channel, :level, :message, :time)'
+        );
+
+        $this->initialized = true;
+    }
+}
+```
+
+You can now use this handler in your logger:
+
+```php
+<?php
+
+$logger->pushHandler(new PDOHandler(new PDO('sqlite:logs.sqlite')));
+
+// You can now use your logger
+$logger->addInfo('My logger is now ready');
+```
+
+The `Monolog\Handler\AbstractProcessingHandler` class provides most of the
+logic needed for the handler, including the use of processors and the formatting
+of the record (which is why we use ``$record['formatted']`` instead of ``$record['message']``).
diff --git a/vendor/monolog/monolog/doc/sockets.md b/vendor/monolog/monolog/doc/sockets.md
new file mode 100644
index 00000000..fad30a9f
--- /dev/null
+++ b/vendor/monolog/monolog/doc/sockets.md
@@ -0,0 +1,37 @@
+Sockets Handler
+===============
+
+This handler allows you to write your logs to sockets using [fsockopen](http://php.net/fsockopen)
+or [pfsockopen](http://php.net/pfsockopen).
+
+Persistent sockets are mainly useful in web environments where you gain some performance not closing/opening
+the connections between requests.
+
+Basic Example
+-------------
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\SocketHandler;
+
+// Create the logger
+$logger = new Logger('my_logger');
+
+// Create the handler
+$handler = new SocketHandler('unix:///var/log/httpd_app_log.socket');
+$handler->setPersistent(true);
+
+// Now add the handler
+$logger->pushHandler($handler, Logger::DEBUG);
+
+// You can now use your logger
+$logger->addInfo('My logger is now ready');
+
+```
+
+In this example, using syslog-ng, you should see the log on the log server:
+
+    cweb1 [2012-02-26 00:12:03] my_logger.INFO: My logger is now ready [] []
+
diff --git a/vendor/monolog/monolog/doc/usage.md b/vendor/monolog/monolog/doc/usage.md
new file mode 100644
index 00000000..7585fa2a
--- /dev/null
+++ b/vendor/monolog/monolog/doc/usage.md
@@ -0,0 +1,162 @@
+Using Monolog
+=============
+
+Installation
+------------
+
+Monolog is available on Packagist ([monolog/monolog](http://packagist.org/packages/monolog/monolog))
+and as such installable via [Composer](http://getcomposer.org/).
+
+```bash
+php composer.phar require monolog/monolog
+```
+
+If you do not use Composer, you can grab the code from GitHub, and use any
+PSR-0 compatible autoloader (e.g. the [Symfony2 ClassLoader component](https://github.com/symfony/ClassLoader))
+to load Monolog classes.
+
+Configuring a logger
+--------------------
+
+Here is a basic setup to log to a file and to firephp on the DEBUG level:
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+use Monolog\Handler\FirePHPHandler;
+
+// Create the logger
+$logger = new Logger('my_logger');
+// Now add some handlers
+$logger->pushHandler(new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG));
+$logger->pushHandler(new FirePHPHandler());
+
+// You can now use your logger
+$logger->addInfo('My logger is now ready');
+```
+
+Let's explain it. The first step is to create the logger instance which will
+be used in your code. The argument is a channel name, which is useful when
+you use several loggers (see below for more details about it).
+
+The logger itself does not know how to handle a record. It delegates it to
+some handlers. The code above registers two handlers in the stack to allow
+handling records in two different ways.
+
+Note that the FirePHPHandler is called first as it is added on top of the
+stack. This allows you to temporarily add a logger with bubbling disabled if
+you want to override other configured loggers.
+
+Adding extra data in the records
+--------------------------------
+
+Monolog provides two different ways to add extra informations along the simple
+textual message.
+
+### Using the logging context
+
+The first way is the context, allowing to pass an array of data along the
+record:
+
+```php
+<?php
+
+$logger->addInfo('Adding a new user', array('username' => 'Seldaek'));
+```
+
+Simple handlers (like the StreamHandler for instance) will simply format
+the array to a string but richer handlers can take advantage of the context
+(FirePHP is able to display arrays in pretty way for instance).
+
+### Using processors
+
+The second way is to add extra data for all records by using a processor.
+Processors can be any callable. They will get the record as parameter and
+must return it after having eventually changed the `extra` part of it. Let's
+write a processor adding some dummy data in the record:
+
+```php
+<?php
+
+$logger->pushProcessor(function ($record) {
+    $record['extra']['dummy'] = 'Hello world!';
+
+    return $record;
+});
+```
+
+Monolog provides some built-in processors that can be used in your project.
+Look at the [README file](https://github.com/Seldaek/monolog/blob/master/README.mdown) for the list.
+
+> Tip: processors can also be registered on a specific handler instead of
+  the logger to apply only for this handler.
+
+Leveraging channels
+-------------------
+
+Channels are a great way to identify to which part of the application a record
+is related. This is useful in big applications (and is leveraged by
+MonologBundle in Symfony2).
+
+Picture two loggers sharing a handler that writes to a single log file.
+Channels would allow you to identify the logger that issued every record.
+You can easily grep through the log files filtering this or that channel.
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+use Monolog\Handler\FirePHPHandler;
+
+// Create some handlers
+$stream = new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG);
+$firephp = new FirePHPHandler();
+
+// Create the main logger of the app
+$logger = new Logger('my_logger');
+$logger->pushHandler($stream);
+$logger->pushHandler($firephp);
+
+// Create a logger for the security-related stuff with a different channel
+$securityLogger = new Logger('security');
+$securityLogger->pushHandler($stream);
+$securityLogger->pushHandler($firephp);
+```
+
+Customizing log format
+----------------------
+
+In Monolog it's easy to customize the format of the logs written into files,
+sockets, mails, databases and other handlers. Most of the handlers use the
+
+```php
+$record['formatted']
+```
+
+value to be automatically put into the log device. This value depends on the
+formatter settings. You can choose between predefined formatter classes or
+write your own (e.g. a multiline text file for human-readable output).
+
+To configure a predefined formatter class, just set it as the handler's field:
+
+```php
+// the default date format is "Y-m-d H:i:s"
+$dateFormat = "Y n j, g:i a";
+// the default output format is "[%datetime%] %channel%.%level_name%: %message% %context% %extra%\n"
+$output = "%datetime% > %level_name% > %message% %context% %extra%\n";
+// finally, create a formatter
+$formatter = new LineFormatter($output, $dateFormat);
+
+// Create a handler
+$stream = new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG);
+$stream->setFormatter($formatter);
+// bind it to a logger object
+$securityLogger = new Logger('security');
+$securityLogger->pushHandler($stream);
+```
+
+You may also reuse the same formatter between multiple handlers and share those
+handlers between multiple loggers.
diff --git a/vendor/monolog/monolog/phpunit.xml.dist b/vendor/monolog/monolog/phpunit.xml.dist
new file mode 100644
index 00000000..17545707
--- /dev/null
+++ b/vendor/monolog/monolog/phpunit.xml.dist
@@ -0,0 +1,15 @@
+<?xml version="1.0" encoding="UTF-8"?>
+
+<phpunit bootstrap="tests/bootstrap.php" colors="true">
+    <testsuites>
+        <testsuite name="Monolog Test Suite">
+            <directory>tests/Monolog/</directory>
+        </testsuite>
+    </testsuites>
+
+    <filter>
+        <whitelist>
+            <directory suffix=".php">src/Monolog/</directory>
+        </whitelist>
+    </filter>
+</phpunit>
diff --git a/vendor/monolog/monolog/src/Monolog/ErrorHandler.php b/vendor/monolog/monolog/src/Monolog/ErrorHandler.php
new file mode 100644
index 00000000..c8923354
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/ErrorHandler.php
@@ -0,0 +1,208 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Psr\Log\LoggerInterface;
+use Psr\Log\LogLevel;
+
+/**
+ * Monolog error handler
+ *
+ * A facility to enable logging of runtime errors, exceptions and fatal errors.
+ *
+ * Quick setup: <code>ErrorHandler::register($logger);</code>
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class ErrorHandler
+{
+    private $logger;
+
+    private $previousExceptionHandler;
+    private $uncaughtExceptionLevel;
+
+    private $previousErrorHandler;
+    private $errorLevelMap;
+
+    private $fatalLevel;
+    private $reservedMemory;
+    private static $fatalErrors = array(E_ERROR, E_PARSE, E_CORE_ERROR, E_COMPILE_ERROR, E_USER_ERROR);
+
+    public function __construct(LoggerInterface $logger)
+    {
+        $this->logger = $logger;
+    }
+
+    /**
+     * Registers a new ErrorHandler for a given Logger
+     *
+     * By default it will handle errors, exceptions and fatal errors
+     *
+     * @param  LoggerInterface $logger
+     * @param  array|false     $errorLevelMap  an array of E_* constant to LogLevel::* constant mapping, or false to disable error handling
+     * @param  int|false       $exceptionLevel a LogLevel::* constant, or false to disable exception handling
+     * @param  int|false       $fatalLevel     a LogLevel::* constant, or false to disable fatal error handling
+     * @return ErrorHandler
+     */
+    public static function register(LoggerInterface $logger, $errorLevelMap = array(), $exceptionLevel = null, $fatalLevel = null)
+    {
+        $handler = new static($logger);
+        if ($errorLevelMap !== false) {
+            $handler->registerErrorHandler($errorLevelMap);
+        }
+        if ($exceptionLevel !== false) {
+            $handler->registerExceptionHandler($exceptionLevel);
+        }
+        if ($fatalLevel !== false) {
+            $handler->registerFatalHandler($fatalLevel);
+        }
+
+        return $handler;
+    }
+
+    public function registerExceptionHandler($level = null, $callPrevious = true)
+    {
+        $prev = set_exception_handler(array($this, 'handleException'));
+        $this->uncaughtExceptionLevel = $level;
+        if ($callPrevious && $prev) {
+            $this->previousExceptionHandler = $prev;
+        }
+    }
+
+    public function registerErrorHandler(array $levelMap = array(), $callPrevious = true, $errorTypes = -1)
+    {
+        $prev = set_error_handler(array($this, 'handleError'), $errorTypes);
+        $this->errorLevelMap = array_replace($this->defaultErrorLevelMap(), $levelMap);
+        if ($callPrevious) {
+            $this->previousErrorHandler = $prev ?: true;
+        }
+    }
+
+    public function registerFatalHandler($level = null, $reservedMemorySize = 20)
+    {
+        register_shutdown_function(array($this, 'handleFatalError'));
+
+        $this->reservedMemory = str_repeat(' ', 1024 * $reservedMemorySize);
+        $this->fatalLevel = $level;
+    }
+
+    protected function defaultErrorLevelMap()
+    {
+        return array(
+            E_ERROR             => LogLevel::CRITICAL,
+            E_WARNING           => LogLevel::WARNING,
+            E_PARSE             => LogLevel::ALERT,
+            E_NOTICE            => LogLevel::NOTICE,
+            E_CORE_ERROR        => LogLevel::CRITICAL,
+            E_CORE_WARNING      => LogLevel::WARNING,
+            E_COMPILE_ERROR     => LogLevel::ALERT,
+            E_COMPILE_WARNING   => LogLevel::WARNING,
+            E_USER_ERROR        => LogLevel::ERROR,
+            E_USER_WARNING      => LogLevel::WARNING,
+            E_USER_NOTICE       => LogLevel::NOTICE,
+            E_STRICT            => LogLevel::NOTICE,
+            E_RECOVERABLE_ERROR => LogLevel::ERROR,
+            E_DEPRECATED        => LogLevel::NOTICE,
+            E_USER_DEPRECATED   => LogLevel::NOTICE,
+        );
+    }
+
+    /**
+     * @private
+     */
+    public function handleException(\Exception $e)
+    {
+        $this->logger->log(
+            $this->uncaughtExceptionLevel === null ? LogLevel::ERROR : $this->uncaughtExceptionLevel,
+            sprintf('Uncaught Exception %s: "%s" at %s line %s', get_class($e), $e->getMessage(), $e->getFile(), $e->getLine()),
+            array('exception' => $e)
+        );
+
+        if ($this->previousExceptionHandler) {
+            call_user_func($this->previousExceptionHandler, $e);
+        }
+    }
+
+    /**
+     * @private
+     */
+    public function handleError($code, $message, $file = '', $line = 0, $context = array())
+    {
+        if (!(error_reporting() & $code)) {
+            return;
+        }
+
+        $level = isset($this->errorLevelMap[$code]) ? $this->errorLevelMap[$code] : LogLevel::CRITICAL;
+        $this->logger->log($level, self::codeToString($code).': '.$message, array('code' => $code, 'message' => $message, 'file' => $file, 'line' => $line));
+
+        if ($this->previousErrorHandler === true) {
+            return false;
+        } elseif ($this->previousErrorHandler) {
+            return call_user_func($this->previousErrorHandler, $code, $message, $file, $line, $context);
+        }
+    }
+
+    /**
+     * @private
+     */
+    public function handleFatalError()
+    {
+        $this->reservedMemory = null;
+
+        $lastError = error_get_last();
+        if ($lastError && in_array($lastError['type'], self::$fatalErrors)) {
+            $this->logger->log(
+                $this->fatalLevel === null ? LogLevel::ALERT : $this->fatalLevel,
+                'Fatal Error ('.self::codeToString($lastError['type']).'): '.$lastError['message'],
+                array('code' => $lastError['type'], 'message' => $lastError['message'], 'file' => $lastError['file'], 'line' => $lastError['line'])
+            );
+        }
+    }
+
+    private static function codeToString($code)
+    {
+        switch ($code) {
+            case E_ERROR:
+                return 'E_ERROR';
+            case E_WARNING:
+                return 'E_WARNING';
+            case E_PARSE:
+                return 'E_PARSE';
+            case E_NOTICE:
+                return 'E_NOTICE';
+            case E_CORE_ERROR:
+                return 'E_CORE_ERROR';
+            case E_CORE_WARNING:
+                return 'E_CORE_WARNING';
+            case E_COMPILE_ERROR:
+                return 'E_COMPILE_ERROR';
+            case E_COMPILE_WARNING:
+                return 'E_COMPILE_WARNING';
+            case E_USER_ERROR:
+                return 'E_USER_ERROR';
+            case E_USER_WARNING:
+                return 'E_USER_WARNING';
+            case E_USER_NOTICE:
+                return 'E_USER_NOTICE';
+            case E_STRICT:
+                return 'E_STRICT';
+            case E_RECOVERABLE_ERROR:
+                return 'E_RECOVERABLE_ERROR';
+            case E_DEPRECATED:
+                return 'E_DEPRECATED';
+            case E_USER_DEPRECATED:
+                return 'E_USER_DEPRECATED';
+        }
+
+        return 'Unknown PHP error';
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php
new file mode 100644
index 00000000..56d3e278
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php
@@ -0,0 +1,79 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * Formats a log message according to the ChromePHP array format
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class ChromePHPFormatter implements FormatterInterface
+{
+    /**
+     * Translates Monolog log levels to Wildfire levels.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => 'log',
+        Logger::INFO      => 'info',
+        Logger::NOTICE    => 'info',
+        Logger::WARNING   => 'warn',
+        Logger::ERROR     => 'error',
+        Logger::CRITICAL  => 'error',
+        Logger::ALERT     => 'error',
+        Logger::EMERGENCY => 'error',
+    );
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        // Retrieve the line and file if set and remove them from the formatted extra
+        $backtrace = 'unknown';
+        if (isset($record['extra']['file']) && isset($record['extra']['line'])) {
+            $backtrace = $record['extra']['file'].' : '.$record['extra']['line'];
+            unset($record['extra']['file']);
+            unset($record['extra']['line']);
+        }
+
+        $message = array('message' => $record['message']);
+        if ($record['context']) {
+            $message['context'] = $record['context'];
+        }
+        if ($record['extra']) {
+            $message['extra'] = $record['extra'];
+        }
+        if (count($message) === 1) {
+            $message = reset($message);
+        }
+
+        return array(
+            $record['channel'],
+            $message,
+            $backtrace,
+            $this->logLevels[$record['level']],
+        );
+    }
+
+    public function formatBatch(array $records)
+    {
+        $formatted = array();
+
+        foreach ($records as $record) {
+            $formatted[] = $this->format($record);
+        }
+
+        return $formatted;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/ElasticaFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/ElasticaFormatter.php
new file mode 100644
index 00000000..b0b0cf06
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/ElasticaFormatter.php
@@ -0,0 +1,87 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Elastica\Document;
+
+/**
+ * Format a log message into an Elastica Document
+ *
+ * @author Jelle Vink <jelle.vink@gmail.com>
+ */
+class ElasticaFormatter extends NormalizerFormatter
+{
+    /**
+     * @var string Elastic search index name
+     */
+    protected $index;
+
+    /**
+     * @var string Elastic search document type
+     */
+    protected $type;
+
+    /**
+     * @param string $index Elastic Search index name
+     * @param string $type  Elastic Search document type
+     */
+    public function __construct($index, $type)
+    {
+        parent::__construct(\DateTime::ISO8601);
+        $this->index = $index;
+        $this->type = $type;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        $record = parent::format($record);
+
+        return $this->getDocument($record);
+    }
+
+    /**
+     * Getter index
+     * @return string
+     */
+    public function getIndex()
+    {
+        return $this->index;
+    }
+
+    /**
+     * Getter type
+     * @return string
+     */
+    public function getType()
+    {
+        return $this->type;
+    }
+
+    /**
+     * Convert a log message into an Elastica Document
+     *
+     * @param  array    $record Log message
+     * @return Document
+     */
+    protected function getDocument($record)
+    {
+        $document = new Document();
+        $document->setData($record);
+        $document->setType($this->type);
+        $document->setIndex($this->index);
+
+        return $document;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/FlowdockFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/FlowdockFormatter.php
new file mode 100644
index 00000000..af63d011
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/FlowdockFormatter.php
@@ -0,0 +1,104 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * formats the record to be used in the FlowdockHandler
+ *
+ * @author Dominik Liebler <liebler.dominik@gmail.com>
+ */
+class FlowdockFormatter implements FormatterInterface
+{
+    /**
+     * @var string
+     */
+    private $source;
+
+    /**
+     * @var string
+     */
+    private $sourceEmail;
+
+    /**
+     * @param string $source
+     * @param string $sourceEmail
+     */
+    public function __construct($source, $sourceEmail)
+    {
+        $this->source = $source;
+        $this->sourceEmail = $sourceEmail;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        $tags = array(
+            '#logs',
+            '#' . strtolower($record['level_name']),
+            '#' . $record['channel'],
+        );
+
+        foreach ($record['extra'] as $value) {
+            $tags[] = '#' . $value;
+        }
+
+        $subject = sprintf(
+            'in %s: %s - %s',
+            $this->source,
+            $record['level_name'],
+            $this->getShortMessage($record['message'])
+        );
+
+        $record['flowdock'] = array(
+            'source' => $this->source,
+            'from_address' => $this->sourceEmail,
+            'subject' => $subject,
+            'content' => $record['message'],
+            'tags' => $tags,
+            'project' => $this->source,
+        );
+
+        return $record;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function formatBatch(array $records)
+    {
+        $formatted = array();
+
+        foreach ($records as $record) {
+            $formatted[] = $this->format($record);
+        }
+
+        return $formatted;
+    }
+
+    /**
+     * @param string $message
+     *
+     * @return string
+     */
+    public function getShortMessage($message)
+    {
+        $maxLength = 45;
+
+        if (strlen($message) > $maxLength) {
+            $message = substr($message, 0, $maxLength - 4) . ' ...';
+        }
+
+        return $message;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php b/vendor/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php
new file mode 100644
index 00000000..b5de7511
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php
@@ -0,0 +1,36 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Interface for formatters
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+interface FormatterInterface
+{
+    /**
+     * Formats a log record.
+     *
+     * @param  array $record A record to format
+     * @return mixed The formatted record
+     */
+    public function format(array $record);
+
+    /**
+     * Formats a set of log records.
+     *
+     * @param  array $records A set of records to format
+     * @return mixed The formatted set of records
+     */
+    public function formatBatch(array $records);
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php
new file mode 100644
index 00000000..8d01c64c
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php
@@ -0,0 +1,101 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Gelf\Message;
+
+/**
+ * Serializes a log message to GELF
+ * @see http://www.graylog2.org/about/gelf
+ *
+ * @author Matt Lehner <mlehner@gmail.com>
+ */
+class GelfMessageFormatter extends NormalizerFormatter
+{
+    /**
+     * @var string the name of the system for the Gelf log message
+     */
+    protected $systemName;
+
+    /**
+     * @var string a prefix for 'extra' fields from the Monolog record (optional)
+     */
+    protected $extraPrefix;
+
+    /**
+     * @var string a prefix for 'context' fields from the Monolog record (optional)
+     */
+    protected $contextPrefix;
+
+    /**
+     * Translates Monolog log levels to Graylog2 log priorities.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => 7,
+        Logger::INFO      => 6,
+        Logger::NOTICE    => 5,
+        Logger::WARNING   => 4,
+        Logger::ERROR     => 3,
+        Logger::CRITICAL  => 2,
+        Logger::ALERT     => 1,
+        Logger::EMERGENCY => 0,
+    );
+
+    public function __construct($systemName = null, $extraPrefix = null, $contextPrefix = 'ctxt_')
+    {
+        parent::__construct('U.u');
+
+        $this->systemName = $systemName ?: gethostname();
+
+        $this->extraPrefix = $extraPrefix;
+        $this->contextPrefix = $contextPrefix;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        $record = parent::format($record);
+        $message = new Message();
+        $message
+            ->setTimestamp($record['datetime'])
+            ->setShortMessage((string) $record['message'])
+            ->setFacility($record['channel'])
+            ->setHost($this->systemName)
+            ->setLine(isset($record['extra']['line']) ? $record['extra']['line'] : null)
+            ->setFile(isset($record['extra']['file']) ? $record['extra']['file'] : null)
+            ->setLevel($this->logLevels[$record['level']]);
+
+        // Do not duplicate these values in the additional fields
+        unset($record['extra']['line']);
+        unset($record['extra']['file']);
+
+        foreach ($record['extra'] as $key => $val) {
+            $message->setAdditional($this->extraPrefix . $key, is_scalar($val) ? $val : $this->toJson($val));
+        }
+
+        foreach ($record['context'] as $key => $val) {
+            $message->setAdditional($this->contextPrefix . $key, is_scalar($val) ? $val : $this->toJson($val));
+        }
+
+        if (null === $message->getFile() && isset($record['context']['exception']['file'])) {
+            if (preg_match("/^(.+):([0-9]+)$/", $record['context']['exception']['file'], $matches)) {
+                $message->setFile($matches[1]);
+                $message->setLine($matches[2]);
+            }
+        }
+
+        return $message;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/HtmlFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/HtmlFormatter.php
new file mode 100644
index 00000000..255d2887
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/HtmlFormatter.php
@@ -0,0 +1,140 @@
+<?php
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * Formats incoming records into an HTML table
+ *
+ * This is especially useful for html email logging
+ *
+ * @author Tiago Brito <tlfbrito@gmail.com>
+ */
+class HtmlFormatter extends NormalizerFormatter
+{
+    /**
+     * Translates Monolog log levels to html color priorities.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => '#cccccc',
+        Logger::INFO      => '#468847',
+        Logger::NOTICE    => '#3a87ad',
+        Logger::WARNING   => '#c09853',
+        Logger::ERROR     => '#f0ad4e',
+        Logger::CRITICAL  => '#FF7708',
+        Logger::ALERT     => '#C12A19',
+        Logger::EMERGENCY => '#000000',
+    );
+
+    /**
+     * @param string $dateFormat The format of the timestamp: one supported by DateTime::format
+     */
+    public function __construct($dateFormat = null)
+    {
+        parent::__construct($dateFormat);
+    }
+
+    /**
+     * Creates an HTML table row
+     *
+     * @param  string $th       Row header content
+     * @param  string $td       Row standard cell content
+     * @param  bool   $escapeTd false if td content must not be html escaped
+     * @return string
+     */
+    private function addRow($th, $td = ' ', $escapeTd = true)
+    {
+        $th = htmlspecialchars($th, ENT_NOQUOTES, 'UTF-8');
+        if ($escapeTd) {
+            $td = '<pre>'.htmlspecialchars($td, ENT_NOQUOTES, 'UTF-8').'</pre>';
+        }
+
+        return "<tr style=\"padding: 4px;spacing: 0;text-align: left;\">\n<th style=\"background: #cccccc\" width=\"100px\">$th:</th>\n<td style=\"padding: 4px;spacing: 0;text-align: left;background: #eeeeee\">".$td."</td>\n</tr>";
+    }
+
+    /**
+     * Create a HTML h1 tag
+     *
+     * @param  string  $title Text to be in the h1
+     * @param  integer $level Error level
+     * @return string
+     */
+    private function addTitle($title, $level)
+    {
+        $title = htmlspecialchars($title, ENT_NOQUOTES, 'UTF-8');
+
+        return '<h1 style="background: '.$this->logLevels[$level].';color: #ffffff;padding: 5px;" class="monolog-output">'.$title.'</h1>';
+    }
+    /**
+     * Formats a log record.
+     *
+     * @param  array $record A record to format
+     * @return mixed The formatted record
+     */
+    public function format(array $record)
+    {
+        $output = $this->addTitle($record['level_name'], $record['level']);
+        $output .= '<table cellspacing="1" width="100%" class="monolog-output">';
+
+        $output .= $this->addRow('Message', (string) $record['message']);
+        $output .= $this->addRow('Time', $record['datetime']->format($this->dateFormat));
+        $output .= $this->addRow('Channel', $record['channel']);
+        if ($record['context']) {
+            $embeddedTable = '<table cellspacing="1" width="100%">';
+            foreach ($record['context'] as $key => $value) {
+                $embeddedTable .= $this->addRow($key, $this->convertToString($value));
+            }
+            $embeddedTable .= '</table>';
+            $output .= $this->addRow('Context', $embeddedTable, false);
+        }
+        if ($record['extra']) {
+            $embeddedTable = '<table cellspacing="1" width="100%">';
+            foreach ($record['extra'] as $key => $value) {
+                $embeddedTable .= $this->addRow($key, $this->convertToString($value));
+            }
+            $embeddedTable .= '</table>';
+            $output .= $this->addRow('Extra', $embeddedTable, false);
+        }
+
+        return $output.'</table>';
+    }
+
+    /**
+     * Formats a set of log records.
+     *
+     * @param  array $records A set of records to format
+     * @return mixed The formatted set of records
+     */
+    public function formatBatch(array $records)
+    {
+        $message = '';
+        foreach ($records as $record) {
+            $message .= $this->format($record);
+        }
+
+        return $message;
+    }
+
+    protected function convertToString($data)
+    {
+        if (null === $data || is_scalar($data)) {
+            return (string) $data;
+        }
+
+        $data = $this->normalize($data);
+        if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+            return json_encode($data, JSON_PRETTY_PRINT | JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+        }
+
+        return str_replace('\\/', '/', json_encode($data));
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php
new file mode 100644
index 00000000..7963dbf1
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php
@@ -0,0 +1,116 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Encodes whatever record data is passed to it as json
+ *
+ * This can be useful to log to databases or remote APIs
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class JsonFormatter implements FormatterInterface
+{
+    const BATCH_MODE_JSON = 1;
+    const BATCH_MODE_NEWLINES = 2;
+
+    protected $batchMode;
+    protected $appendNewline;
+
+    /**
+     * @param int $batchMode
+     */
+    public function __construct($batchMode = self::BATCH_MODE_JSON, $appendNewline = true)
+    {
+        $this->batchMode = $batchMode;
+        $this->appendNewline = $appendNewline;
+    }
+
+    /**
+     * The batch mode option configures the formatting style for
+     * multiple records. By default, multiple records will be
+     * formatted as a JSON-encoded array. However, for
+     * compatibility with some API endpoints, alternive styles
+     * are available.
+     *
+     * @return int
+     */
+    public function getBatchMode()
+    {
+        return $this->batchMode;
+    }
+
+    /**
+     * True if newlines are appended to every formatted record
+     *
+     * @return bool
+     */
+    public function isAppendingNewlines()
+    {
+        return $this->appendNewline;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        return json_encode($record) . ($this->appendNewline ? "\n" : '');
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function formatBatch(array $records)
+    {
+        switch ($this->batchMode) {
+            case static::BATCH_MODE_NEWLINES:
+                return $this->formatBatchNewlines($records);
+
+            case static::BATCH_MODE_JSON:
+            default:
+                return $this->formatBatchJson($records);
+        }
+    }
+
+    /**
+     * Return a JSON-encoded array of records.
+     *
+     * @param  array  $records
+     * @return string
+     */
+    protected function formatBatchJson(array $records)
+    {
+        return json_encode($records);
+    }
+
+    /**
+     * Use new lines to separate records instead of a
+     * JSON-encoded array.
+     *
+     * @param  array  $records
+     * @return string
+     */
+    protected function formatBatchNewlines(array $records)
+    {
+        $instance = $this;
+
+        $oldNewline = $this->appendNewline;
+        $this->appendNewline = false;
+        array_walk($records, function (&$value, $key) use ($instance) {
+            $value = $instance->format($value);
+        });
+        $this->appendNewline = $oldNewline;
+
+        return implode("\n", $records);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php
new file mode 100644
index 00000000..6983d1a5
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php
@@ -0,0 +1,159 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Exception;
+
+/**
+ * Formats incoming records into a one-line string
+ *
+ * This is especially useful for logging to files
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class LineFormatter extends NormalizerFormatter
+{
+    const SIMPLE_FORMAT = "[%datetime%] %channel%.%level_name%: %message% %context% %extra%\n";
+
+    protected $format;
+    protected $allowInlineLineBreaks;
+    protected $ignoreEmptyContextAndExtra;
+    protected $includeStacktraces;
+
+    /**
+     * @param string $format                     The format of the message
+     * @param string $dateFormat                 The format of the timestamp: one supported by DateTime::format
+     * @param bool   $allowInlineLineBreaks      Whether to allow inline line breaks in log entries
+     * @param bool   $ignoreEmptyContextAndExtra
+     */
+    public function __construct($format = null, $dateFormat = null, $allowInlineLineBreaks = false, $ignoreEmptyContextAndExtra = false)
+    {
+        $this->format = $format ?: static::SIMPLE_FORMAT;
+        $this->allowInlineLineBreaks = $allowInlineLineBreaks;
+        $this->ignoreEmptyContextAndExtra = $ignoreEmptyContextAndExtra;
+        parent::__construct($dateFormat);
+    }
+
+    public function includeStacktraces($include = true)
+    {
+        $this->includeStacktraces = $include;
+        if ($this->includeStacktraces) {
+            $this->allowInlineLineBreaks = true;
+        }
+    }
+
+    public function allowInlineLineBreaks($allow = true)
+    {
+        $this->allowInlineLineBreaks = $allow;
+    }
+
+    public function ignoreEmptyContextAndExtra($ignore = true)
+    {
+        $this->ignoreEmptyContextAndExtra = $ignore;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        $vars = parent::format($record);
+
+        $output = $this->format;
+
+        foreach ($vars['extra'] as $var => $val) {
+            if (false !== strpos($output, '%extra.'.$var.'%')) {
+                $output = str_replace('%extra.'.$var.'%', $this->stringify($val), $output);
+                unset($vars['extra'][$var]);
+            }
+        }
+
+        if ($this->ignoreEmptyContextAndExtra) {
+            if (empty($vars['context'])) {
+                unset($vars['context']);
+                $output = str_replace('%context%', '', $output);
+            }
+
+            if (empty($vars['extra'])) {
+                unset($vars['extra']);
+                $output = str_replace('%extra%', '', $output);
+            }
+        }
+
+        foreach ($vars as $var => $val) {
+            if (false !== strpos($output, '%'.$var.'%')) {
+                $output = str_replace('%'.$var.'%', $this->stringify($val), $output);
+            }
+        }
+
+        return $output;
+    }
+
+    public function formatBatch(array $records)
+    {
+        $message = '';
+        foreach ($records as $record) {
+            $message .= $this->format($record);
+        }
+
+        return $message;
+    }
+
+    public function stringify($value)
+    {
+        return $this->replaceNewlines($this->convertToString($value));
+    }
+
+    protected function normalizeException(Exception $e)
+    {
+        $previousText = '';
+        if ($previous = $e->getPrevious()) {
+            do {
+                $previousText .= ', '.get_class($previous).'(code: '.$previous->getCode().'): '.$previous->getMessage().' at '.$previous->getFile().':'.$previous->getLine();
+            } while ($previous = $previous->getPrevious());
+        }
+
+        $str = '[object] ('.get_class($e).'(code: '.$e->getCode().'): '.$e->getMessage().' at '.$e->getFile().':'.$e->getLine().$previousText.')';
+        if ($this->includeStacktraces) {
+            $str .= "\n[stacktrace]\n".$e->getTraceAsString();
+        }
+
+        return $str;
+    }
+
+    protected function convertToString($data)
+    {
+        if (null === $data || is_bool($data)) {
+            return var_export($data, true);
+        }
+
+        if (is_scalar($data)) {
+            return (string) $data;
+        }
+
+        if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+            return $this->toJson($data, true);
+        }
+
+        return str_replace('\\/', '/', @json_encode($data));
+    }
+
+    protected function replaceNewlines($str)
+    {
+        if ($this->allowInlineLineBreaks) {
+            return $str;
+        }
+
+        return strtr($str, array("\r\n" => ' ', "\r" => ' ', "\n" => ' '));
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php
new file mode 100644
index 00000000..f02bceb0
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php
@@ -0,0 +1,47 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Encodes message information into JSON in a format compatible with Loggly.
+ *
+ * @author Adam Pancutt <adam@pancutt.com>
+ */
+class LogglyFormatter extends JsonFormatter
+{
+    /**
+     * Overrides the default batch mode to new lines for compatibility with the
+     * Loggly bulk API.
+     *
+     * @param integer $batchMode
+     */
+    public function __construct($batchMode = self::BATCH_MODE_NEWLINES, $appendNewline = false)
+    {
+        parent::__construct($batchMode, $appendNewline);
+    }
+
+    /**
+     * Appends the 'timestamp' parameter for indexing by Loggly.
+     *
+     * @see https://www.loggly.com/docs/automated-parsing/#json
+     * @see \Monolog\Formatter\JsonFormatter::format()
+     */
+    public function format(array $record)
+    {
+        if (isset($record["datetime"]) && ($record["datetime"] instanceof \DateTime)) {
+            $record["timestamp"] = $record["datetime"]->format("Y-m-d\TH:i:s.uO");
+            // TODO 2.0 unset the 'datetime' parameter, retained for BC
+        }
+
+        return parent::format($record);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php
new file mode 100644
index 00000000..7a7b3b3c
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php
@@ -0,0 +1,165 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Serializes a log message to Logstash Event Format
+ *
+ * @see http://logstash.net/
+ * @see https://github.com/logstash/logstash/blob/master/lib/logstash/event.rb
+ *
+ * @author Tim Mower <timothy.mower@gmail.com>
+ */
+class LogstashFormatter extends NormalizerFormatter
+{
+    const V0 = 0;
+    const V1 = 1;
+
+    /**
+     * @var string the name of the system for the Logstash log message, used to fill the @source field
+     */
+    protected $systemName;
+
+    /**
+     * @var string an application name for the Logstash log message, used to fill the @type field
+     */
+    protected $applicationName;
+
+    /**
+     * @var string a prefix for 'extra' fields from the Monolog record (optional)
+     */
+    protected $extraPrefix;
+
+    /**
+     * @var string a prefix for 'context' fields from the Monolog record (optional)
+     */
+    protected $contextPrefix;
+
+    /**
+     * @var integer logstash format version to use
+     */
+    protected $version;
+
+    /**
+     * @param string $applicationName the application that sends the data, used as the "type" field of logstash
+     * @param string $systemName      the system/machine name, used as the "source" field of logstash, defaults to the hostname of the machine
+     * @param string $extraPrefix     prefix for extra keys inside logstash "fields"
+     * @param string $contextPrefix   prefix for context keys inside logstash "fields", defaults to ctxt_
+     */
+    public function __construct($applicationName, $systemName = null, $extraPrefix = null, $contextPrefix = 'ctxt_', $version = self::V0)
+    {
+        // logstash requires a ISO 8601 format date with optional millisecond precision.
+        parent::__construct('Y-m-d\TH:i:s.uP');
+
+        $this->systemName = $systemName ?: gethostname();
+        $this->applicationName = $applicationName;
+        $this->extraPrefix = $extraPrefix;
+        $this->contextPrefix = $contextPrefix;
+        $this->version = $version;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        $record = parent::format($record);
+
+        if ($this->version === self::V1) {
+            $message = $this->formatV1($record);
+        } else {
+            $message = $this->formatV0($record);
+        }
+
+        return $this->toJson($message) . "\n";
+    }
+
+    protected function formatV0(array $record)
+    {
+        if (empty($record['datetime'])) {
+            $record['datetime'] = gmdate('c');
+        }
+        $message = array(
+            '@timestamp' => $record['datetime'],
+            '@source' => $this->systemName,
+            '@fields' => array()
+        );
+        if (isset($record['message'])) {
+            $message['@message'] = $record['message'];
+        }
+        if (isset($record['channel'])) {
+            $message['@tags'] = array($record['channel']);
+            $message['@fields']['channel'] = $record['channel'];
+        }
+        if (isset($record['level'])) {
+            $message['@fields']['level'] = $record['level'];
+        }
+        if ($this->applicationName) {
+            $message['@type'] = $this->applicationName;
+        }
+        if (isset($record['extra']['server'])) {
+            $message['@source_host'] = $record['extra']['server'];
+        }
+        if (isset($record['extra']['url'])) {
+            $message['@source_path'] = $record['extra']['url'];
+        }
+        if (!empty($record['extra'])) {
+            foreach ($record['extra'] as $key => $val) {
+                $message['@fields'][$this->extraPrefix . $key] = $val;
+            }
+        }
+        if (!empty($record['context'])) {
+            foreach ($record['context'] as $key => $val) {
+                $message['@fields'][$this->contextPrefix . $key] = $val;
+            }
+        }
+
+        return $message;
+    }
+
+    protected function formatV1(array $record)
+    {
+        if (empty($record['datetime'])) {
+            $record['datetime'] = gmdate('c');
+        }
+        $message = array(
+            '@timestamp' => $record['datetime'],
+            '@version' => 1,
+            'host' => $this->systemName,
+        );
+        if (isset($record['message'])) {
+            $message['message'] = $record['message'];
+        }
+        if (isset($record['channel'])) {
+            $message['type'] = $record['channel'];
+            $message['channel'] = $record['channel'];
+        }
+        if (isset($record['level_name'])) {
+            $message['level'] = $record['level_name'];
+        }
+        if ($this->applicationName) {
+            $message['type'] = $this->applicationName;
+        }
+        if (!empty($record['extra'])) {
+            foreach ($record['extra'] as $key => $val) {
+                $message[$this->extraPrefix . $key] = $val;
+            }
+        }
+        if (!empty($record['context'])) {
+            foreach ($record['context'] as $key => $val) {
+                $message[$this->contextPrefix . $key] = $val;
+            }
+        }
+
+        return $message;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php
new file mode 100644
index 00000000..eb067bb7
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php
@@ -0,0 +1,105 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Formats a record for use with the MongoDBHandler.
+ *
+ * @author Florian Plattner <me@florianplattner.de>
+ */
+class MongoDBFormatter implements FormatterInterface
+{
+    private $exceptionTraceAsString;
+    private $maxNestingLevel;
+
+    /**
+     * @param int  $maxNestingLevel        0 means infinite nesting, the $record itself is level 1, $record['context'] is 2
+     * @param bool $exceptionTraceAsString set to false to log exception traces as a sub documents instead of strings
+     */
+    public function __construct($maxNestingLevel = 3, $exceptionTraceAsString = true)
+    {
+        $this->maxNestingLevel = max($maxNestingLevel, 0);
+        $this->exceptionTraceAsString = (bool) $exceptionTraceAsString;
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    public function format(array $record)
+    {
+        return $this->formatArray($record);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    public function formatBatch(array $records)
+    {
+        foreach ($records as $key => $record) {
+            $records[$key] = $this->format($record);
+        }
+
+        return $records;
+    }
+
+    protected function formatArray(array $record, $nestingLevel = 0)
+    {
+        if ($this->maxNestingLevel == 0 || $nestingLevel <= $this->maxNestingLevel) {
+            foreach ($record as $name => $value) {
+                if ($value instanceof \DateTime) {
+                    $record[$name] = $this->formatDate($value, $nestingLevel + 1);
+                } elseif ($value instanceof \Exception) {
+                    $record[$name] = $this->formatException($value, $nestingLevel + 1);
+                } elseif (is_array($value)) {
+                    $record[$name] = $this->formatArray($value, $nestingLevel + 1);
+                } elseif (is_object($value)) {
+                    $record[$name] = $this->formatObject($value, $nestingLevel + 1);
+                }
+            }
+        } else {
+            $record = '[...]';
+        }
+
+        return $record;
+    }
+
+    protected function formatObject($value, $nestingLevel)
+    {
+        $objectVars = get_object_vars($value);
+        $objectVars['class'] = get_class($value);
+
+        return $this->formatArray($objectVars, $nestingLevel);
+    }
+
+    protected function formatException(\Exception $exception, $nestingLevel)
+    {
+        $formattedException = array(
+            'class' => get_class($exception),
+            'message' => $exception->getMessage(),
+            'code' => $exception->getCode(),
+            'file' => $exception->getFile() . ':' . $exception->getLine(),
+        );
+
+        if ($this->exceptionTraceAsString === true) {
+            $formattedException['trace'] = $exception->getTraceAsString();
+        } else {
+            $formattedException['trace'] = $exception->getTrace();
+        }
+
+        return $this->formatArray($formattedException, $nestingLevel);
+    }
+
+    protected function formatDate(\DateTime $value, $nestingLevel)
+    {
+        return new \MongoDate($value->getTimestamp());
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php
new file mode 100644
index 00000000..beafea64
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php
@@ -0,0 +1,141 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Exception;
+
+/**
+ * Normalizes incoming records to remove objects/resources so it's easier to dump to various targets
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class NormalizerFormatter implements FormatterInterface
+{
+    const SIMPLE_DATE = "Y-m-d H:i:s";
+
+    protected $dateFormat;
+
+    /**
+     * @param string $dateFormat The format of the timestamp: one supported by DateTime::format
+     */
+    public function __construct($dateFormat = null)
+    {
+        $this->dateFormat = $dateFormat ?: static::SIMPLE_DATE;
+        if (!function_exists('json_encode')) {
+            throw new \RuntimeException('PHP\'s json extension is required to use Monolog\'s NormalizerFormatter');
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        return $this->normalize($record);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function formatBatch(array $records)
+    {
+        foreach ($records as $key => $record) {
+            $records[$key] = $this->format($record);
+        }
+
+        return $records;
+    }
+
+    protected function normalize($data)
+    {
+        if (null === $data || is_scalar($data)) {
+            return $data;
+        }
+
+        if (is_array($data) || $data instanceof \Traversable) {
+            $normalized = array();
+
+            $count = 1;
+            foreach ($data as $key => $value) {
+                if ($count++ >= 1000) {
+                    $normalized['...'] = 'Over 1000 items, aborting normalization';
+                    break;
+                }
+                $normalized[$key] = $this->normalize($value);
+            }
+
+            return $normalized;
+        }
+
+        if ($data instanceof \DateTime) {
+            return $data->format($this->dateFormat);
+        }
+
+        if (is_object($data)) {
+            if ($data instanceof Exception) {
+                return $this->normalizeException($data);
+            }
+
+            return sprintf("[object] (%s: %s)", get_class($data), $this->toJson($data, true));
+        }
+
+        if (is_resource($data)) {
+            return '[resource]';
+        }
+
+        return '[unknown('.gettype($data).')]';
+    }
+
+    protected function normalizeException(Exception $e)
+    {
+        $data = array(
+            'class' => get_class($e),
+            'message' => $e->getMessage(),
+            'code' => $e->getCode(),
+            'file' => $e->getFile().':'.$e->getLine(),
+        );
+
+        $trace = $e->getTrace();
+        foreach ($trace as $frame) {
+            if (isset($frame['file'])) {
+                $data['trace'][] = $frame['file'].':'.$frame['line'];
+            } else {
+                // We should again normalize the frames, because it might contain invalid items
+                $data['trace'][] = $this->toJson($this->normalize($frame), true);
+            }
+        }
+
+        if ($previous = $e->getPrevious()) {
+            $data['previous'] = $this->normalizeException($previous);
+        }
+
+        return $data;
+    }
+
+    protected function toJson($data, $ignoreErrors = false)
+    {
+        // suppress json_encode errors since it's twitchy with some inputs
+        if ($ignoreErrors) {
+            if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+                return @json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+            }
+
+            return @json_encode($data);
+        }
+
+        if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+            return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+        }
+
+        return json_encode($data);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php
new file mode 100644
index 00000000..5d345d53
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php
@@ -0,0 +1,48 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Formats data into an associative array of scalar values.
+ * Objects and arrays will be JSON encoded.
+ *
+ * @author Andrew Lawson <adlawson@gmail.com>
+ */
+class ScalarFormatter extends NormalizerFormatter
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        foreach ($record as $key => $value) {
+            $record[$key] = $this->normalizeValue($value);
+        }
+
+        return $record;
+    }
+
+    /**
+     * @param  mixed $value
+     * @return mixed
+     */
+    protected function normalizeValue($value)
+    {
+        $normalized = $this->normalize($value);
+
+        if (is_array($normalized) || is_object($normalized)) {
+            return $this->toJson($normalized, true);
+        }
+
+        return $normalized;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php
new file mode 100644
index 00000000..654710a8
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php
@@ -0,0 +1,113 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * Serializes a log message according to Wildfire's header requirements
+ *
+ * @author Eric Clemmons (@ericclemmons) <eric@uxdriven.com>
+ * @author Christophe Coevoet <stof@notk.org>
+ * @author Kirill chEbba Chebunin <iam@chebba.org>
+ */
+class WildfireFormatter extends NormalizerFormatter
+{
+    const TABLE = 'table';
+
+    /**
+     * Translates Monolog log levels to Wildfire levels.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => 'LOG',
+        Logger::INFO      => 'INFO',
+        Logger::NOTICE    => 'INFO',
+        Logger::WARNING   => 'WARN',
+        Logger::ERROR     => 'ERROR',
+        Logger::CRITICAL  => 'ERROR',
+        Logger::ALERT     => 'ERROR',
+        Logger::EMERGENCY => 'ERROR',
+    );
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        // Retrieve the line and file if set and remove them from the formatted extra
+        $file = $line = '';
+        if (isset($record['extra']['file'])) {
+            $file = $record['extra']['file'];
+            unset($record['extra']['file']);
+        }
+        if (isset($record['extra']['line'])) {
+            $line = $record['extra']['line'];
+            unset($record['extra']['line']);
+        }
+
+        $record = $this->normalize($record);
+        $message = array('message' => $record['message']);
+        $handleError = false;
+        if ($record['context']) {
+            $message['context'] = $record['context'];
+            $handleError = true;
+        }
+        if ($record['extra']) {
+            $message['extra'] = $record['extra'];
+            $handleError = true;
+        }
+        if (count($message) === 1) {
+            $message = reset($message);
+        }
+
+        if (isset($record['context'][self::TABLE])) {
+            $type  = 'TABLE';
+            $label = $record['channel'] .': '. $record['message'];
+            $message = $record['context'][self::TABLE];
+        } else {
+            $type  = $this->logLevels[$record['level']];
+            $label = $record['channel'];
+        }
+
+        // Create JSON object describing the appearance of the message in the console
+        $json = $this->toJson(array(
+            array(
+                'Type'  => $type,
+                'File'  => $file,
+                'Line'  => $line,
+                'Label' => $label,
+            ),
+            $message,
+        ), $handleError);
+
+        // The message itself is a serialization of the above JSON object + it's length
+        return sprintf(
+            '%s|%s|',
+            strlen($json),
+            $json
+        );
+    }
+
+    public function formatBatch(array $records)
+    {
+        throw new \BadMethodCallException('Batch formatting does not make sense for the WildfireFormatter');
+    }
+
+    protected function normalize($data)
+    {
+        if (is_object($data) && !$data instanceof \DateTime) {
+            return $data;
+        }
+
+        return parent::normalize($data);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php
new file mode 100644
index 00000000..69ede49a
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php
@@ -0,0 +1,184 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\FormatterInterface;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Base Handler class providing the Handler structure
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+abstract class AbstractHandler implements HandlerInterface
+{
+    protected $level = Logger::DEBUG;
+    protected $bubble = true;
+
+    /**
+     * @var FormatterInterface
+     */
+    protected $formatter;
+    protected $processors = array();
+
+    /**
+     * @param integer $level  The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($level = Logger::DEBUG, $bubble = true)
+    {
+        $this->setLevel($level);
+        $this->bubble = $bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function isHandling(array $record)
+    {
+        return $record['level'] >= $this->level;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        foreach ($records as $record) {
+            $this->handle($record);
+        }
+    }
+
+    /**
+     * Closes the handler.
+     *
+     * This will be called automatically when the object is destroyed
+     */
+    public function close()
+    {
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function pushProcessor($callback)
+    {
+        if (!is_callable($callback)) {
+            throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given');
+        }
+        array_unshift($this->processors, $callback);
+
+        return $this;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function popProcessor()
+    {
+        if (!$this->processors) {
+            throw new \LogicException('You tried to pop from an empty processor stack.');
+        }
+
+        return array_shift($this->processors);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setFormatter(FormatterInterface $formatter)
+    {
+        $this->formatter = $formatter;
+
+        return $this;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getFormatter()
+    {
+        if (!$this->formatter) {
+            $this->formatter = $this->getDefaultFormatter();
+        }
+
+        return $this->formatter;
+    }
+
+    /**
+     * Sets minimum logging level at which this handler will be triggered.
+     *
+     * @param  integer $level
+     * @return self
+     */
+    public function setLevel($level)
+    {
+        $this->level = Logger::toMonologLevel($level);
+
+        return $this;
+    }
+
+    /**
+     * Gets minimum logging level at which this handler will be triggered.
+     *
+     * @return integer
+     */
+    public function getLevel()
+    {
+        return $this->level;
+    }
+
+    /**
+     * Sets the bubbling behavior.
+     *
+     * @param  Boolean $bubble true means that this handler allows bubbling.
+     *                         false means that bubbling is not permitted.
+     * @return self
+     */
+    public function setBubble($bubble)
+    {
+        $this->bubble = $bubble;
+
+        return $this;
+    }
+
+    /**
+     * Gets the bubbling behavior.
+     *
+     * @return Boolean true means that this handler allows bubbling.
+     *                 false means that bubbling is not permitted.
+     */
+    public function getBubble()
+    {
+        return $this->bubble;
+    }
+
+    public function __destruct()
+    {
+        try {
+            $this->close();
+        } catch (\Exception $e) {
+            // do nothing
+        }
+    }
+
+    /**
+     * Gets the default formatter.
+     *
+     * @return FormatterInterface
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter();
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php
new file mode 100644
index 00000000..6f18f72e
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php
@@ -0,0 +1,66 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Base Handler class providing the Handler structure
+ *
+ * Classes extending it should (in most cases) only implement write($record)
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+abstract class AbstractProcessingHandler extends AbstractHandler
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if (!$this->isHandling($record)) {
+            return false;
+        }
+
+        $record = $this->processRecord($record);
+
+        $record['formatted'] = $this->getFormatter()->format($record);
+
+        $this->write($record);
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * Writes the record down to the log of the implementing handler
+     *
+     * @param  array $record
+     * @return void
+     */
+    abstract protected function write(array $record);
+
+    /**
+     * Processes a record.
+     *
+     * @param  array $record
+     * @return array
+     */
+    protected function processRecord(array $record)
+    {
+        if ($this->processors) {
+            foreach ($this->processors as $processor) {
+                $record = call_user_func($processor, $record);
+            }
+        }
+
+        return $record;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php
new file mode 100644
index 00000000..3eb83bd4
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php
@@ -0,0 +1,92 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Common syslog functionality
+ */
+abstract class AbstractSyslogHandler extends AbstractProcessingHandler
+{
+    protected $facility;
+
+    /**
+     * Translates Monolog log levels to syslog log priorities.
+     */
+    protected $logLevels = array(
+        Logger::DEBUG     => LOG_DEBUG,
+        Logger::INFO      => LOG_INFO,
+        Logger::NOTICE    => LOG_NOTICE,
+        Logger::WARNING   => LOG_WARNING,
+        Logger::ERROR     => LOG_ERR,
+        Logger::CRITICAL  => LOG_CRIT,
+        Logger::ALERT     => LOG_ALERT,
+        Logger::EMERGENCY => LOG_EMERG,
+    );
+
+    /**
+     * List of valid log facility names.
+     */
+    protected $facilities = array(
+        'auth'     => LOG_AUTH,
+        'authpriv' => LOG_AUTHPRIV,
+        'cron'     => LOG_CRON,
+        'daemon'   => LOG_DAEMON,
+        'kern'     => LOG_KERN,
+        'lpr'      => LOG_LPR,
+        'mail'     => LOG_MAIL,
+        'news'     => LOG_NEWS,
+        'syslog'   => LOG_SYSLOG,
+        'user'     => LOG_USER,
+        'uucp'     => LOG_UUCP,
+    );
+
+    /**
+     * @param mixed   $facility
+     * @param integer $level    The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble   Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($facility = LOG_USER, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+
+        if (!defined('PHP_WINDOWS_VERSION_BUILD')) {
+            $this->facilities['local0'] = LOG_LOCAL0;
+            $this->facilities['local1'] = LOG_LOCAL1;
+            $this->facilities['local2'] = LOG_LOCAL2;
+            $this->facilities['local3'] = LOG_LOCAL3;
+            $this->facilities['local4'] = LOG_LOCAL4;
+            $this->facilities['local5'] = LOG_LOCAL5;
+            $this->facilities['local6'] = LOG_LOCAL6;
+            $this->facilities['local7'] = LOG_LOCAL7;
+        }
+
+        // convert textual description of facility to syslog constant
+        if (array_key_exists(strtolower($facility), $this->facilities)) {
+            $facility = $this->facilities[strtolower($facility)];
+        } elseif (!in_array($facility, array_values($this->facilities), true)) {
+            throw new \UnexpectedValueException('Unknown facility value "'.$facility.'" given');
+        }
+
+        $this->facility = $facility;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter('%channel%.%level_name%: %message% %context% %extra%');
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php
new file mode 100644
index 00000000..a28ba02a
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php
@@ -0,0 +1,98 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\JsonFormatter;
+use PhpAmqpLib\Message\AMQPMessage;
+use PhpAmqpLib\Channel\AMQPChannel;
+use AMQPExchange;
+
+class AmqpHandler extends AbstractProcessingHandler
+{
+    /**
+     * @var AMQPExchange|AMQPChannel $exchange
+     */
+    protected $exchange;
+
+    /**
+     * @var string
+     */
+    protected $exchangeName;
+
+    /**
+     * @param AMQPExchange|AMQPChannel $exchange     AMQPExchange (php AMQP ext) or PHP AMQP lib channel, ready for use
+     * @param string                   $exchangeName
+     * @param int                      $level
+     * @param bool                     $bubble       Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($exchange, $exchangeName = 'log', $level = Logger::DEBUG, $bubble = true)
+    {
+        if ($exchange instanceof AMQPExchange) {
+            $exchange->setName($exchangeName);
+        } elseif ($exchange instanceof AMQPChannel) {
+            $this->exchangeName = $exchangeName;
+        } else {
+            throw new \InvalidArgumentException('PhpAmqpLib\Channel\AMQPChannel or AMQPExchange instance required');
+        }
+        $this->exchange = $exchange;
+
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function write(array $record)
+    {
+        $data = $record["formatted"];
+
+        $routingKey = sprintf(
+            '%s.%s',
+            // TODO 2.0 remove substr call
+            substr($record['level_name'], 0, 4),
+            $record['channel']
+        );
+
+        if ($this->exchange instanceof AMQPExchange) {
+            $this->exchange->publish(
+                $data,
+                strtolower($routingKey),
+                0,
+                array(
+                    'delivery_mode' => 2,
+                    'Content-type' => 'application/json'
+                )
+            );
+        } else {
+            $this->exchange->basic_publish(
+                new AMQPMessage(
+                    (string) $data,
+                    array(
+                        'delivery_mode' => 2,
+                        'content_type' => 'application/json'
+                    )
+                ),
+                $this->exchangeName,
+                strtolower($routingKey)
+            );
+        }
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php
new file mode 100644
index 00000000..43190b92
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php
@@ -0,0 +1,184 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Handler sending logs to browser's javascript console with no browser extension required
+ *
+ * @author Olivier Poitrey <rs@dailymotion.com>
+ */
+class BrowserConsoleHandler extends AbstractProcessingHandler
+{
+    protected static $initialized = false;
+    protected static $records = array();
+
+    /**
+     * {@inheritDoc}
+     *
+     * Formatted output may contain some formatting markers to be transfered to `console.log` using the %c format.
+     *
+     * Example of formatted string:
+     *
+     *     You can do [[blue text]]{color: blue} or [[green background]]{background-color: green; color: white}
+     *
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter('[[%channel%]]{macro: autolabel} [[%level_name%]]{font-weight: bold} %message%');
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function write(array $record)
+    {
+        // Accumulate records
+        self::$records[] = $record;
+
+        // Register shutdown handler if not already done
+        if (PHP_SAPI !== 'cli' && !self::$initialized) {
+            self::$initialized = true;
+            register_shutdown_function(array('Monolog\Handler\BrowserConsoleHandler', 'send'));
+        }
+    }
+
+    /**
+     * Convert records to javascript console commands and send it to the browser.
+     * This method is automatically called on PHP shutdown if output is HTML.
+     */
+    public static function send()
+    {
+        // Check content type
+        foreach (headers_list() as $header) {
+            if (stripos($header, 'content-type:') === 0) {
+                if (stripos($header, 'text/html') === false) {
+                    // This handler only works with HTML outputs
+                    return;
+                }
+                break;
+            }
+        }
+
+        if (count(self::$records)) {
+            echo '<script>' . self::generateScript() . '</script>';
+            self::reset();
+        }
+    }
+
+    /**
+     * Forget all logged records
+     */
+    public static function reset()
+    {
+        self::$records = array();
+    }
+
+    private static function generateScript()
+    {
+        $script = array();
+        foreach (self::$records as $record) {
+            $context = self::dump('Context', $record['context']);
+            $extra = self::dump('Extra', $record['extra']);
+
+            if (empty($context) && empty($extra)) {
+                $script[] = self::call_array('log', self::handleStyles($record['formatted']));
+            } else {
+                $script = array_merge($script,
+                    array(self::call_array('groupCollapsed', self::handleStyles($record['formatted']))),
+                    $context,
+                    $extra,
+                    array(self::call('groupEnd'))
+                );
+            }
+        }
+
+        return "(function (c) {if (c && c.groupCollapsed) {\n" . implode("\n", $script) . "\n}})(console);";
+    }
+
+    private static function handleStyles($formatted)
+    {
+        $args = array(self::quote('font-weight: normal'));
+        $format = '%c' . $formatted;
+        preg_match_all('/\[\[(.*?)\]\]\{([^}]*)\}/s', $format, $matches, PREG_OFFSET_CAPTURE | PREG_SET_ORDER);
+
+        foreach (array_reverse($matches) as $match) {
+            $args[] = self::quote(self::handleCustomStyles($match[2][0], $match[1][0]));
+            $args[] = '"font-weight: normal"';
+
+            $pos = $match[0][1];
+            $format = substr($format, 0, $pos) . '%c' . $match[1][0] . '%c' . substr($format, $pos + strlen($match[0][0]));
+        }
+
+        array_unshift($args, self::quote($format));
+
+        return $args;
+    }
+
+    private static function handleCustomStyles($style, $string)
+    {
+        static $colors = array('blue', 'green', 'red', 'magenta', 'orange', 'black', 'grey');
+        static $labels = array();
+
+        return preg_replace_callback('/macro\s*:(.*?)(?:;|$)/', function ($m) use ($string, &$colors, &$labels) {
+            if (trim($m[1]) === 'autolabel') {
+                // Format the string as a label with consistent auto assigned background color
+                if (!isset($labels[$string])) {
+                    $labels[$string] = $colors[count($labels) % count($colors)];
+                }
+                $color = $labels[$string];
+
+                return "background-color: $color; color: white; border-radius: 3px; padding: 0 2px 0 2px";
+            }
+
+            return $m[1];
+        }, $style);
+    }
+
+    private static function dump($title, array $dict)
+    {
+        $script = array();
+        $dict = array_filter($dict);
+        if (empty($dict)) {
+            return $script;
+        }
+        $script[] = self::call('log', self::quote('%c%s'), self::quote('font-weight: bold'), self::quote($title));
+        foreach ($dict as $key => $value) {
+            $value = json_encode($value);
+            if (empty($value)) {
+                $value = self::quote('');
+            }
+            $script[] = self::call('log', self::quote('%s: %o'), self::quote($key), $value);
+        }
+
+        return $script;
+    }
+
+    private static function quote($arg)
+    {
+        return '"' . addcslashes($arg, "\"\n") . '"';
+    }
+
+    private static function call()
+    {
+        $args = func_get_args();
+        $method = array_shift($args);
+
+        return self::call_array($method, $args);
+    }
+
+    private static function call_array($method, array $args)
+    {
+        return 'c.' . $method . '(' . implode(', ', $args) . ');';
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php
new file mode 100644
index 00000000..6d8136f7
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php
@@ -0,0 +1,117 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Buffers all records until closing the handler and then pass them as batch.
+ *
+ * This is useful for a MailHandler to send only one mail per request instead of
+ * sending one per log message.
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class BufferHandler extends AbstractHandler
+{
+    protected $handler;
+    protected $bufferSize = 0;
+    protected $bufferLimit;
+    protected $flushOnOverflow;
+    protected $buffer = array();
+    protected $initialized = false;
+
+    /**
+     * @param HandlerInterface $handler         Handler.
+     * @param integer          $bufferLimit     How many entries should be buffered at most, beyond that the oldest items are removed from the buffer.
+     * @param integer          $level           The minimum logging level at which this handler will be triggered
+     * @param Boolean          $bubble          Whether the messages that are handled can bubble up the stack or not
+     * @param Boolean          $flushOnOverflow If true, the buffer is flushed when the max size has been reached, by default oldest entries are discarded
+     */
+    public function __construct(HandlerInterface $handler, $bufferLimit = 0, $level = Logger::DEBUG, $bubble = true, $flushOnOverflow = false)
+    {
+        parent::__construct($level, $bubble);
+        $this->handler = $handler;
+        $this->bufferLimit = (int) $bufferLimit;
+        $this->flushOnOverflow = $flushOnOverflow;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($record['level'] < $this->level) {
+            return false;
+        }
+
+        if (!$this->initialized) {
+            // __destructor() doesn't get called on Fatal errors
+            register_shutdown_function(array($this, 'close'));
+            $this->initialized = true;
+        }
+
+        if ($this->bufferLimit > 0 && $this->bufferSize === $this->bufferLimit) {
+            if ($this->flushOnOverflow) {
+                $this->flush();
+            } else {
+                array_shift($this->buffer);
+                $this->bufferSize--;
+            }
+        }
+
+        if ($this->processors) {
+            foreach ($this->processors as $processor) {
+                $record = call_user_func($processor, $record);
+            }
+        }
+
+        $this->buffer[] = $record;
+        $this->bufferSize++;
+
+        return false === $this->bubble;
+    }
+
+    public function flush()
+    {
+        if ($this->bufferSize === 0) {
+            return;
+        }
+
+        $this->handler->handleBatch($this->buffer);
+        $this->clear();
+    }
+
+    public function __destruct()
+    {
+        // suppress the parent behavior since we already have register_shutdown_function()
+        // to call close(), and the reference contained there will prevent this from being
+        // GC'd until the end of the request
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        $this->flush();
+    }
+
+    /**
+     * Clears the buffer without flushing any messages down to the wrapped handler.
+     */
+    public function clear()
+    {
+        $this->bufferSize = 0;
+        $this->buffer = array();
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php
new file mode 100644
index 00000000..bc659349
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php
@@ -0,0 +1,204 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\ChromePHPFormatter;
+use Monolog\Logger;
+
+/**
+ * Handler sending logs to the ChromePHP extension (http://www.chromephp.com/)
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class ChromePHPHandler extends AbstractProcessingHandler
+{
+    /**
+     * Version of the extension
+     */
+    const VERSION = '4.0';
+
+    /**
+     * Header name
+     */
+    const HEADER_NAME = 'X-ChromeLogger-Data';
+
+    protected static $initialized = false;
+
+    /**
+     * Tracks whether we sent too much data
+     *
+     * Chrome limits the headers to 256KB, so when we sent 240KB we stop sending
+     *
+     * @var Boolean
+     */
+    protected static $overflowed = false;
+
+    protected static $json = array(
+        'version' => self::VERSION,
+        'columns' => array('label', 'log', 'backtrace', 'type'),
+        'rows' => array(),
+    );
+
+    protected static $sendHeaders = true;
+
+    /**
+     * @param integer $level  The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+        if (!function_exists('json_encode')) {
+            throw new \RuntimeException('PHP\'s json extension is required to use Monolog\'s ChromePHPHandler');
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        $messages = array();
+
+        foreach ($records as $record) {
+            if ($record['level'] < $this->level) {
+                continue;
+            }
+            $messages[] = $this->processRecord($record);
+        }
+
+        if (!empty($messages)) {
+            $messages = $this->getFormatter()->formatBatch($messages);
+            self::$json['rows'] = array_merge(self::$json['rows'], $messages);
+            $this->send();
+        }
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new ChromePHPFormatter();
+    }
+
+    /**
+     * Creates & sends header for a record
+     *
+     * @see sendHeader()
+     * @see send()
+     * @param array $record
+     */
+    protected function write(array $record)
+    {
+        self::$json['rows'][] = $record['formatted'];
+
+        $this->send();
+    }
+
+    /**
+     * Sends the log header
+     *
+     * @see sendHeader()
+     */
+    protected function send()
+    {
+        if (self::$overflowed || !self::$sendHeaders) {
+            return;
+        }
+
+        if (!self::$initialized) {
+            self::$initialized = true;
+
+            self::$sendHeaders = $this->headersAccepted();
+            if (!self::$sendHeaders) {
+                return;
+            }
+
+            self::$json['request_uri'] = isset($_SERVER['REQUEST_URI']) ? $_SERVER['REQUEST_URI'] : '';
+        }
+
+        $json = @json_encode(self::$json);
+        $data = base64_encode(utf8_encode($json));
+        if (strlen($data) > 240*1024) {
+            self::$overflowed = true;
+
+            $record = array(
+                'message' => 'Incomplete logs, chrome header size limit reached',
+                'context' => array(),
+                'level' => Logger::WARNING,
+                'level_name' => Logger::getLevelName(Logger::WARNING),
+                'channel' => 'monolog',
+                'datetime' => new \DateTime(),
+                'extra' => array(),
+            );
+            self::$json['rows'][count(self::$json['rows']) - 1] = $this->getFormatter()->format($record);
+            $json = @json_encode(self::$json);
+            $data = base64_encode(utf8_encode($json));
+        }
+
+        if (trim($data) !== '') {
+            $this->sendHeader(self::HEADER_NAME, $data);
+        }
+    }
+
+    /**
+     * Send header string to the client
+     *
+     * @param string $header
+     * @param string $content
+     */
+    protected function sendHeader($header, $content)
+    {
+        if (!headers_sent() && self::$sendHeaders) {
+            header(sprintf('%s: %s', $header, $content));
+        }
+    }
+
+    /**
+     * Verifies if the headers are accepted by the current user agent
+     *
+     * @return Boolean
+     */
+    protected function headersAccepted()
+    {
+        if (empty($_SERVER['HTTP_USER_AGENT'])) {
+            return false;
+        }
+
+        return preg_match('{\bChrome/\d+[\.\d+]*\b}', $_SERVER['HTTP_USER_AGENT']);
+    }
+
+    /**
+     * BC getter for the sendHeaders property that has been made static
+     */
+    public function __get($property)
+    {
+        if ('sendHeaders' !== $property) {
+            throw new \InvalidArgumentException('Undefined property '.$property);
+        }
+
+        return static::$sendHeaders;
+    }
+
+    /**
+     * BC setter for the sendHeaders property that has been made static
+     */
+    public function __set($property, $value)
+    {
+        if ('sendHeaders' !== $property) {
+            throw new \InvalidArgumentException('Undefined property '.$property);
+        }
+
+        static::$sendHeaders = $value;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php
new file mode 100644
index 00000000..b3687c3d
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php
@@ -0,0 +1,72 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\JsonFormatter;
+use Monolog\Logger;
+
+/**
+ * CouchDB handler
+ *
+ * @author Markus Bachmann <markus.bachmann@bachi.biz>
+ */
+class CouchDBHandler extends AbstractProcessingHandler
+{
+    private $options;
+
+    public function __construct(array $options = array(), $level = Logger::DEBUG, $bubble = true)
+    {
+        $this->options = array_merge(array(
+            'host'     => 'localhost',
+            'port'     => 5984,
+            'dbname'   => 'logger',
+            'username' => null,
+            'password' => null,
+        ), $options);
+
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function write(array $record)
+    {
+        $basicAuth = null;
+        if ($this->options['username']) {
+            $basicAuth = sprintf('%s:%s@', $this->options['username'], $this->options['password']);
+        }
+
+        $url = 'http://'.$basicAuth.$this->options['host'].':'.$this->options['port'].'/'.$this->options['dbname'];
+        $context = stream_context_create(array(
+            'http' => array(
+                'method'        => 'POST',
+                'content'       => $record['formatted'],
+                'ignore_errors' => true,
+                'max_redirects' => 0,
+                'header'        => 'Content-type: application/json',
+            )
+        ));
+
+        if (false === @file_get_contents($url, null, $context)) {
+            throw new \RuntimeException(sprintf('Could not connect to %s', $url));
+        }
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php
new file mode 100644
index 00000000..d968720c
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php
@@ -0,0 +1,145 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Logs to Cube.
+ *
+ * @link http://square.github.com/cube/
+ * @author Wan Chen <kami@kamisama.me>
+ */
+class CubeHandler extends AbstractProcessingHandler
+{
+    private $udpConnection = null;
+    private $httpConnection = null;
+    private $scheme = null;
+    private $host = null;
+    private $port = null;
+    private $acceptedSchemes = array('http', 'udp');
+
+    /**
+     * Create a Cube handler
+     *
+     * @throws UnexpectedValueException when given url is not a valid url.
+     *                                  A valid url must consists of three parts : protocol://host:port
+     *                                  Only valid protocol used by Cube are http and udp
+     */
+    public function __construct($url, $level = Logger::DEBUG, $bubble = true)
+    {
+        $urlInfos = parse_url($url);
+
+        if (!isset($urlInfos['scheme']) || !isset($urlInfos['host']) || !isset($urlInfos['port'])) {
+            throw new \UnexpectedValueException('URL "'.$url.'" is not valid');
+        }
+
+        if (!in_array($urlInfos['scheme'], $this->acceptedSchemes)) {
+            throw new \UnexpectedValueException(
+                'Invalid protocol (' . $urlInfos['scheme']  . ').'
+                . ' Valid options are ' . implode(', ', $this->acceptedSchemes));
+        }
+
+        $this->scheme = $urlInfos['scheme'];
+        $this->host = $urlInfos['host'];
+        $this->port = $urlInfos['port'];
+
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * Establish a connection to an UDP socket
+     *
+     * @throws LogicException when unable to connect to the socket
+     */
+    protected function connectUdp()
+    {
+        if (!extension_loaded('sockets')) {
+            throw new MissingExtensionException('The sockets extension is required to use udp URLs with the CubeHandler');
+        }
+
+        $this->udpConnection = socket_create(AF_INET, SOCK_DGRAM, 0);
+        if (!$this->udpConnection) {
+            throw new \LogicException('Unable to create a socket');
+        }
+
+        if (!socket_connect($this->udpConnection, $this->host, $this->port)) {
+            throw new \LogicException('Unable to connect to the socket at ' . $this->host . ':' . $this->port);
+        }
+    }
+
+    /**
+     * Establish a connection to a http server
+     */
+    protected function connectHttp()
+    {
+        if (!extension_loaded('curl')) {
+            throw new \LogicException('The curl extension is needed to use http URLs with the CubeHandler');
+        }
+
+        $this->httpConnection = curl_init('http://'.$this->host.':'.$this->port.'/1.0/event/put');
+
+        if (!$this->httpConnection) {
+            throw new \LogicException('Unable to connect to ' . $this->host . ':' . $this->port);
+        }
+
+        curl_setopt($this->httpConnection, CURLOPT_CUSTOMREQUEST, "POST");
+        curl_setopt($this->httpConnection, CURLOPT_RETURNTRANSFER, true);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $date = $record['datetime'];
+
+        $data = array('time' => $date->format('Y-m-d\TH:i:s.uO'));
+        unset($record['datetime']);
+
+        if (isset($record['context']['type'])) {
+            $data['type'] = $record['context']['type'];
+            unset($record['context']['type']);
+        } else {
+            $data['type'] = $record['channel'];
+        }
+
+        $data['data'] = $record['context'];
+        $data['data']['level'] = $record['level'];
+
+        $this->{'write'.$this->scheme}(json_encode($data));
+    }
+
+    private function writeUdp($data)
+    {
+        if (!$this->udpConnection) {
+            $this->connectUdp();
+        }
+
+        socket_send($this->udpConnection, $data, strlen($data), 0);
+    }
+
+    private function writeHttp($data)
+    {
+        if (!$this->httpConnection) {
+            $this->connectHttp();
+        }
+
+        curl_setopt($this->httpConnection, CURLOPT_POSTFIELDS, '['.$data.']');
+        curl_setopt($this->httpConnection, CURLOPT_HTTPHEADER, array(
+                'Content-Type: application/json',
+                'Content-Length: ' . strlen('['.$data.']'))
+        );
+
+        return curl_exec($this->httpConnection);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php
new file mode 100644
index 00000000..b91ffec9
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php
@@ -0,0 +1,45 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\NormalizerFormatter;
+use Doctrine\CouchDB\CouchDBClient;
+
+/**
+ * CouchDB handler for Doctrine CouchDB ODM
+ *
+ * @author Markus Bachmann <markus.bachmann@bachi.biz>
+ */
+class DoctrineCouchDBHandler extends AbstractProcessingHandler
+{
+    private $client;
+
+    public function __construct(CouchDBClient $client, $level = Logger::DEBUG, $bubble = true)
+    {
+        $this->client = $client;
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function write(array $record)
+    {
+        $this->client->postDocument($record['formatted']);
+    }
+
+    protected function getDefaultFormatter()
+    {
+        return new NormalizerFormatter;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php
new file mode 100644
index 00000000..e7f843c8
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php
@@ -0,0 +1,89 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Aws\Common\Aws;
+use Aws\DynamoDb\DynamoDbClient;
+use Monolog\Formatter\ScalarFormatter;
+use Monolog\Logger;
+
+/**
+ * Amazon DynamoDB handler (http://aws.amazon.com/dynamodb/)
+ *
+ * @link https://github.com/aws/aws-sdk-php/
+ * @author Andrew Lawson <adlawson@gmail.com>
+ */
+class DynamoDbHandler extends AbstractProcessingHandler
+{
+    const DATE_FORMAT = 'Y-m-d\TH:i:s.uO';
+
+    /**
+     * @var DynamoDbClient
+     */
+    protected $client;
+
+    /**
+     * @var string
+     */
+    protected $table;
+
+    /**
+     * @param DynamoDbClient $client
+     * @param string         $table
+     * @param integer        $level
+     * @param boolean        $bubble
+     */
+    public function __construct(DynamoDbClient $client, $table, $level = Logger::DEBUG, $bubble = true)
+    {
+        if (!defined('Aws\Common\Aws::VERSION') || version_compare('3.0', Aws::VERSION, '<=')) {
+            throw new \RuntimeException('The DynamoDbHandler is only known to work with the AWS SDK 2.x releases');
+        }
+
+        $this->client = $client;
+        $this->table = $table;
+
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $filtered = $this->filterEmptyFields($record['formatted']);
+        $formatted = $this->client->formatAttributes($filtered);
+
+        $this->client->putItem(array(
+            'TableName' => $this->table,
+            'Item' => $formatted
+        ));
+    }
+
+    /**
+     * @param  array $record
+     * @return array
+     */
+    protected function filterEmptyFields(array $record)
+    {
+        return array_filter($record, function ($value) {
+            return !empty($value) || false === $value || 0 === $value;
+        });
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new ScalarFormatter(self::DATE_FORMAT);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php
new file mode 100644
index 00000000..96e5d57f
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php
@@ -0,0 +1,128 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FormatterInterface;
+use Monolog\Formatter\ElasticaFormatter;
+use Monolog\Logger;
+use Elastica\Client;
+use Elastica\Exception\ExceptionInterface;
+
+/**
+ * Elastic Search handler
+ *
+ * Usage example:
+ *
+ *    $client = new \Elastica\Client();
+ *    $options = array(
+ *        'index' => 'elastic_index_name',
+ *        'type' => 'elastic_doc_type',
+ *    );
+ *    $handler = new ElasticSearchHandler($client, $options);
+ *    $log = new Logger('application');
+ *    $log->pushHandler($handler);
+ *
+ * @author Jelle Vink <jelle.vink@gmail.com>
+ */
+class ElasticSearchHandler extends AbstractProcessingHandler
+{
+    /**
+     * @var Client
+     */
+    protected $client;
+
+    /**
+     * @var array Handler config options
+     */
+    protected $options = array();
+
+    /**
+     * @param Client  $client  Elastica Client object
+     * @param array   $options Handler configuration
+     * @param integer $level   The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble  Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(Client $client, array $options = array(), $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+        $this->client = $client;
+        $this->options = array_merge(
+            array(
+                'index'          => 'monolog',      // Elastic index name
+                'type'           => 'record',       // Elastic document type
+                'ignore_error'   => false,          // Suppress Elastica exceptions
+            ),
+            $options
+        );
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function write(array $record)
+    {
+        $this->bulkSend(array($record['formatted']));
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setFormatter(FormatterInterface $formatter)
+    {
+        if ($formatter instanceof ElasticaFormatter) {
+            return parent::setFormatter($formatter);
+        }
+        throw new \InvalidArgumentException('ElasticSearchHandler is only compatible with ElasticaFormatter');
+    }
+
+    /**
+     * Getter options
+     * @return array
+     */
+    public function getOptions()
+    {
+        return $this->options;
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new ElasticaFormatter($this->options['index'], $this->options['type']);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        $documents = $this->getFormatter()->formatBatch($records);
+        $this->bulkSend($documents);
+    }
+
+    /**
+     * Use Elasticsearch bulk API to send list of documents
+     * @param  array             $documents
+     * @throws \RuntimeException
+     */
+    protected function bulkSend(array $documents)
+    {
+        try {
+            $this->client->addDocuments($documents);
+        } catch (ExceptionInterface $e) {
+            if (!$this->options['ignore_error']) {
+                throw new \RuntimeException("Error sending messages to Elasticsearch", 0, $e);
+            }
+        }
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php
new file mode 100644
index 00000000..d1e1ee60
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php
@@ -0,0 +1,82 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Logger;
+
+/**
+ * Stores to PHP error_log() handler.
+ *
+ * @author Elan Ruusamäe <glen@delfi.ee>
+ */
+class ErrorLogHandler extends AbstractProcessingHandler
+{
+    const OPERATING_SYSTEM = 0;
+    const SAPI = 4;
+
+    protected $messageType;
+    protected $expandNewlines;
+
+    /**
+     * @param integer $messageType    Says where the error should go.
+     * @param integer $level          The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble         Whether the messages that are handled can bubble up the stack or not
+     * @param Boolean $expandNewlines If set to true, newlines in the message will be expanded to be take multiple log entries
+     */
+    public function __construct($messageType = self::OPERATING_SYSTEM, $level = Logger::DEBUG, $bubble = true, $expandNewlines = false)
+    {
+        parent::__construct($level, $bubble);
+
+        if (false === in_array($messageType, self::getAvailableTypes())) {
+            $message = sprintf('The given message type "%s" is not supported', print_r($messageType, true));
+            throw new \InvalidArgumentException($message);
+        }
+
+        $this->messageType = $messageType;
+        $this->expandNewlines = $expandNewlines;
+    }
+
+    /**
+     * @return array With all available types
+     */
+    public static function getAvailableTypes()
+    {
+        return array(
+            self::OPERATING_SYSTEM,
+            self::SAPI,
+        );
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter('[%datetime%] %channel%.%level_name%: %message% %context% %extra%');
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        if ($this->expandNewlines) {
+            $lines = preg_split('{[\r\n]+}', (string) $record['formatted']);
+            foreach ($lines as $line) {
+                error_log($line, $this->messageType);
+            }
+        } else {
+            error_log((string) $record['formatted'], $this->messageType);
+        }
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php
new file mode 100644
index 00000000..dad82273
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php
@@ -0,0 +1,140 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Simple handler wrapper that filters records based on a list of levels
+ *
+ * It can be configured with an exact list of levels to allow, or a min/max level.
+ *
+ * @author Hennadiy Verkh
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class FilterHandler extends AbstractHandler
+{
+    /**
+     * Handler or factory callable($record, $this)
+     *
+     * @var callable|\Monolog\Handler\HandlerInterface
+     */
+    protected $handler;
+
+    /**
+     * Minimum level for logs that are passes to handler
+     *
+     * @var int[]
+     */
+    protected $acceptedLevels;
+
+    /**
+     * Whether the messages that are handled can bubble up the stack or not
+     *
+     * @var Boolean
+     */
+    protected $bubble;
+
+    /**
+     * @param callable|HandlerInterface $handler        Handler or factory callable($record, $this).
+     * @param int|array                 $minLevelOrList A list of levels to accept or a minimum level if maxLevel is provided
+     * @param int                       $maxLevel       Maximum level to accept, only used if $minLevelOrList is not an array
+     * @param Boolean                   $bubble         Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($handler, $minLevelOrList = Logger::DEBUG, $maxLevel = Logger::EMERGENCY, $bubble = true)
+    {
+        $this->handler  = $handler;
+        $this->bubble   = $bubble;
+        $this->setAcceptedLevels($minLevelOrList, $maxLevel);
+
+        if (!$this->handler instanceof HandlerInterface && !is_callable($this->handler)) {
+            throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object");
+        }
+    }
+
+    /**
+     * @return array
+     */
+    public function getAcceptedLevels()
+    {
+        return array_flip($this->acceptedLevels);
+    }
+
+    /**
+     * @param int|array $minLevelOrList A list of levels to accept or a minimum level if maxLevel is provided
+     * @param int       $maxLevel       Maximum level to accept, only used if $minLevelOrList is not an array
+     */
+    public function setAcceptedLevels($minLevelOrList = Logger::DEBUG, $maxLevel = Logger::EMERGENCY)
+    {
+        if (is_array($minLevelOrList)) {
+            $acceptedLevels = array_map('Monolog\Logger::toMonologLevel', $minLevelOrList);
+        } else {
+            $minLevelOrList = Logger::toMonologLevel($minLevelOrList);
+            $maxLevel = Logger::toMonologLevel($maxLevel);
+            $acceptedLevels = array_values(array_filter(Logger::getLevels(), function ($level) use ($minLevelOrList, $maxLevel) {
+                return $level >= $minLevelOrList && $level <= $maxLevel;
+            }));
+        }
+        $this->acceptedLevels = array_flip($acceptedLevels);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function isHandling(array $record)
+    {
+        return isset($this->acceptedLevels[$record['level']]);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if (!$this->isHandling($record)) {
+            return false;
+        }
+
+        // The same logic as in FingersCrossedHandler
+        if (!$this->handler instanceof HandlerInterface) {
+            $this->handler = call_user_func($this->handler, $record, $this);
+            if (!$this->handler instanceof HandlerInterface) {
+                throw new \RuntimeException("The factory callable should return a HandlerInterface");
+            }
+        }
+
+        if ($this->processors) {
+            foreach ($this->processors as $processor) {
+                $record = call_user_func($processor, $record);
+            }
+        }
+
+        $this->handler->handle($record);
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        $filtered = array();
+        foreach ($records as $record) {
+            if ($this->isHandling($record)) {
+                $filtered[] = $record;
+            }
+        }
+
+        $this->handler->handleBatch($filtered);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php
new file mode 100644
index 00000000..c3e42efe
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php
@@ -0,0 +1,28 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\FingersCrossed;
+
+/**
+ * Interface for activation strategies for the FingersCrossedHandler.
+ *
+ * @author Johannes M. Schmitt <schmittjoh@gmail.com>
+ */
+interface ActivationStrategyInterface
+{
+    /**
+     * Returns whether the given record activates the handler.
+     *
+     * @param  array   $record
+     * @return Boolean
+     */
+    public function isHandlerActivated(array $record);
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php
new file mode 100644
index 00000000..e3b403f6
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php
@@ -0,0 +1,59 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+*
+* (c) Jordi Boggiano <j.boggiano@seld.be>
+*
+* For the full copyright and license information, please view the LICENSE
+* file that was distributed with this source code.
+*/
+
+namespace Monolog\Handler\FingersCrossed;
+
+use Monolog\Logger;
+
+/**
+ * Channel and Error level based monolog activation strategy. Allows to trigger activation
+ * based on level per channel. e.g. trigger activation on level 'ERROR' by default, except
+ * for records of the 'sql' channel; those should trigger activation on level 'WARN'.
+ *
+ * Example:
+ *
+ * <code>
+ *   $activationStrategy = new ChannelLevelActivationStrategy(
+ *       Logger::CRITICAL,
+ *       array(
+ *           'request' => Logger::ALERT,
+ *           'sensitive' => Logger::ERROR,
+ *       )
+ *   );
+ *   $handler = new FingersCrossedHandler(new StreamHandler('php://stderr'), $activationStrategy);
+ * </code>
+ *
+ * @author Mike Meessen <netmikey@gmail.com>
+ */
+class ChannelLevelActivationStrategy implements ActivationStrategyInterface
+{
+    private $defaultActionLevel;
+    private $channelToActionLevel;
+
+    /**
+     * @param int   $defaultActionLevel   The default action level to be used if the record's category doesn't match any
+     * @param array $channelToActionLevel An array that maps channel names to action levels.
+     */
+    public function __construct($defaultActionLevel, $channelToActionLevel = array())
+    {
+        $this->defaultActionLevel = Logger::toMonologLevel($defaultActionLevel);
+        $this->channelToActionLevel = array_map('Monolog\Logger::toMonologLevel', $channelToActionLevel);
+    }
+
+    public function isHandlerActivated(array $record)
+    {
+        if (isset($this->channelToActionLevel[$record['channel']])) {
+            return $record['level'] >= $this->channelToActionLevel[$record['channel']];
+        }
+
+        return $record['level'] >= $this->defaultActionLevel;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php
new file mode 100644
index 00000000..6e630852
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php
@@ -0,0 +1,34 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\FingersCrossed;
+
+use Monolog\Logger;
+
+/**
+ * Error level based activation strategy.
+ *
+ * @author Johannes M. Schmitt <schmittjoh@gmail.com>
+ */
+class ErrorLevelActivationStrategy implements ActivationStrategyInterface
+{
+    private $actionLevel;
+
+    public function __construct($actionLevel)
+    {
+        $this->actionLevel = Logger::toMonologLevel($actionLevel);
+    }
+
+    public function isHandlerActivated(array $record)
+    {
+        return $record['level'] >= $this->actionLevel;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php
new file mode 100644
index 00000000..a81c9e64
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php
@@ -0,0 +1,150 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy;
+use Monolog\Handler\FingersCrossed\ActivationStrategyInterface;
+use Monolog\Logger;
+
+/**
+ * Buffers all records until a certain level is reached
+ *
+ * The advantage of this approach is that you don't get any clutter in your log files.
+ * Only requests which actually trigger an error (or whatever your actionLevel is) will be
+ * in the logs, but they will contain all records, not only those above the level threshold.
+ *
+ * You can find the various activation strategies in the
+ * Monolog\Handler\FingersCrossed\ namespace.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class FingersCrossedHandler extends AbstractHandler
+{
+    protected $handler;
+    protected $activationStrategy;
+    protected $buffering = true;
+    protected $bufferSize;
+    protected $buffer = array();
+    protected $stopBuffering;
+    protected $passthruLevel;
+
+    /**
+     * @param callable|HandlerInterface       $handler            Handler or factory callable($record, $fingersCrossedHandler).
+     * @param int|ActivationStrategyInterface $activationStrategy Strategy which determines when this handler takes action
+     * @param int                             $bufferSize         How many entries should be buffered at most, beyond that the oldest items are removed from the buffer.
+     * @param Boolean                         $bubble             Whether the messages that are handled can bubble up the stack or not
+     * @param Boolean                         $stopBuffering      Whether the handler should stop buffering after being triggered (default true)
+     * @param int                             $passthruLevel      Minimum level to always flush to handler on close, even if strategy not triggered
+     */
+    public function __construct($handler, $activationStrategy = null, $bufferSize = 0, $bubble = true, $stopBuffering = true, $passthruLevel = null)
+    {
+        if (null === $activationStrategy) {
+            $activationStrategy = new ErrorLevelActivationStrategy(Logger::WARNING);
+        }
+
+        // convert simple int activationStrategy to an object
+        if (!$activationStrategy instanceof ActivationStrategyInterface) {
+            $activationStrategy = new ErrorLevelActivationStrategy($activationStrategy);
+        }
+
+        $this->handler = $handler;
+        $this->activationStrategy = $activationStrategy;
+        $this->bufferSize = $bufferSize;
+        $this->bubble = $bubble;
+        $this->stopBuffering = $stopBuffering;
+        $this->passthruLevel = $passthruLevel;
+
+        if (!$this->handler instanceof HandlerInterface && !is_callable($this->handler)) {
+            throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object");
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function isHandling(array $record)
+    {
+        return true;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($this->processors) {
+            foreach ($this->processors as $processor) {
+                $record = call_user_func($processor, $record);
+            }
+        }
+
+        if ($this->buffering) {
+            $this->buffer[] = $record;
+            if ($this->bufferSize > 0 && count($this->buffer) > $this->bufferSize) {
+                array_shift($this->buffer);
+            }
+            if ($this->activationStrategy->isHandlerActivated($record)) {
+                if ($this->stopBuffering) {
+                    $this->buffering = false;
+                }
+                if (!$this->handler instanceof HandlerInterface) {
+                    $this->handler = call_user_func($this->handler, $record, $this);
+                    if (!$this->handler instanceof HandlerInterface) {
+                        throw new \RuntimeException("The factory callable should return a HandlerInterface");
+                    }
+                }
+                $this->handler->handleBatch($this->buffer);
+                $this->buffer = array();
+            }
+        } else {
+            $this->handler->handle($record);
+        }
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        if (null !== $this->passthruLevel) {
+            $level = $this->passthruLevel;
+            $this->buffer = array_filter($this->buffer, function ($record) use ($level) {
+                return $record['level'] >= $level;
+            });
+            if (count($this->buffer) > 0) {
+                $this->handler->handleBatch($this->buffer);
+                $this->buffer = array();
+            }
+        }
+    }
+
+    /**
+     * Resets the state of the handler. Stops forwarding records to the wrapped handler.
+     */
+    public function reset()
+    {
+        $this->buffering = true;
+    }
+
+    /**
+     * Clears the buffer without flushing any messages down to the wrapped handler.
+     *
+     * It also resets the handler to its initial buffering state.
+     */
+    public function clear()
+    {
+        $this->buffer = array();
+        $this->reset();
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php
new file mode 100644
index 00000000..fee47950
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php
@@ -0,0 +1,195 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\WildfireFormatter;
+
+/**
+ * Simple FirePHP Handler (http://www.firephp.org/), which uses the Wildfire protocol.
+ *
+ * @author Eric Clemmons (@ericclemmons) <eric@uxdriven.com>
+ */
+class FirePHPHandler extends AbstractProcessingHandler
+{
+    /**
+     * WildFire JSON header message format
+     */
+    const PROTOCOL_URI = 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2';
+
+    /**
+     * FirePHP structure for parsing messages & their presentation
+     */
+    const STRUCTURE_URI = 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1';
+
+    /**
+     * Must reference a "known" plugin, otherwise headers won't display in FirePHP
+     */
+    const PLUGIN_URI = 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3';
+
+    /**
+     * Header prefix for Wildfire to recognize & parse headers
+     */
+    const HEADER_PREFIX = 'X-Wf';
+
+    /**
+     * Whether or not Wildfire vendor-specific headers have been generated & sent yet
+     */
+    protected static $initialized = false;
+
+    /**
+     * Shared static message index between potentially multiple handlers
+     * @var int
+     */
+    protected static $messageIndex = 1;
+
+    protected static $sendHeaders = true;
+
+    /**
+     * Base header creation function used by init headers & record headers
+     *
+     * @param  array  $meta    Wildfire Plugin, Protocol & Structure Indexes
+     * @param  string $message Log message
+     * @return array  Complete header string ready for the client as key and message as value
+     */
+    protected function createHeader(array $meta, $message)
+    {
+        $header = sprintf('%s-%s', self::HEADER_PREFIX, join('-', $meta));
+
+        return array($header => $message);
+    }
+
+    /**
+     * Creates message header from record
+     *
+     * @see createHeader()
+     * @param  array  $record
+     * @return string
+     */
+    protected function createRecordHeader(array $record)
+    {
+        // Wildfire is extensible to support multiple protocols & plugins in a single request,
+        // but we're not taking advantage of that (yet), so we're using "1" for simplicity's sake.
+        return $this->createHeader(
+            array(1, 1, 1, self::$messageIndex++),
+            $record['formatted']
+        );
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new WildfireFormatter();
+    }
+
+    /**
+     * Wildfire initialization headers to enable message parsing
+     *
+     * @see createHeader()
+     * @see sendHeader()
+     * @return array
+     */
+    protected function getInitHeaders()
+    {
+        // Initial payload consists of required headers for Wildfire
+        return array_merge(
+            $this->createHeader(array('Protocol', 1), self::PROTOCOL_URI),
+            $this->createHeader(array(1, 'Structure', 1), self::STRUCTURE_URI),
+            $this->createHeader(array(1, 'Plugin', 1), self::PLUGIN_URI)
+        );
+    }
+
+    /**
+     * Send header string to the client
+     *
+     * @param string $header
+     * @param string $content
+     */
+    protected function sendHeader($header, $content)
+    {
+        if (!headers_sent() && self::$sendHeaders) {
+            header(sprintf('%s: %s', $header, $content));
+        }
+    }
+
+    /**
+     * Creates & sends header for a record, ensuring init headers have been sent prior
+     *
+     * @see sendHeader()
+     * @see sendInitHeaders()
+     * @param array $record
+     */
+    protected function write(array $record)
+    {
+        if (!self::$sendHeaders) {
+            return;
+        }
+
+        // WildFire-specific headers must be sent prior to any messages
+        if (!self::$initialized) {
+            self::$initialized = true;
+
+            self::$sendHeaders = $this->headersAccepted();
+            if (!self::$sendHeaders) {
+                return;
+            }
+
+            foreach ($this->getInitHeaders() as $header => $content) {
+                $this->sendHeader($header, $content);
+            }
+        }
+
+        $header = $this->createRecordHeader($record);
+        if (trim(current($header)) !== '') {
+            $this->sendHeader(key($header), current($header));
+        }
+    }
+
+    /**
+     * Verifies if the headers are accepted by the current user agent
+     *
+     * @return Boolean
+     */
+    protected function headersAccepted()
+    {
+        if (!empty($_SERVER['HTTP_USER_AGENT']) && preg_match('{\bFirePHP/\d+\.\d+\b}', $_SERVER['HTTP_USER_AGENT'])) {
+            return true;
+        }
+
+        return isset($_SERVER['HTTP_X_FIREPHP_VERSION']);
+    }
+
+    /**
+     * BC getter for the sendHeaders property that has been made static
+     */
+    public function __get($property)
+    {
+        if ('sendHeaders' !== $property) {
+            throw new \InvalidArgumentException('Undefined property '.$property);
+        }
+
+        return static::$sendHeaders;
+    }
+
+    /**
+     * BC setter for the sendHeaders property that has been made static
+     */
+    public function __set($property, $value)
+    {
+        if ('sendHeaders' !== $property) {
+            throw new \InvalidArgumentException('Undefined property '.$property);
+        }
+
+        static::$sendHeaders = $value;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php
new file mode 100644
index 00000000..388692c4
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php
@@ -0,0 +1,126 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Logger;
+
+/**
+ * Sends logs to Fleep.io using Webhook integrations
+ *
+ * You'll need a Fleep.io account to use this handler.
+ *
+ * @see https://fleep.io/integrations/webhooks/ Fleep Webhooks Documentation
+ * @author Ando Roots <ando@sqroot.eu>
+ */
+class FleepHookHandler extends SocketHandler
+{
+    const FLEEP_HOST = 'fleep.io';
+
+    const FLEEP_HOOK_URI = '/hook/';
+
+    /**
+     * @var string Webhook token (specifies the conversation where logs are sent)
+     */
+    protected $token;
+
+    /**
+     * Construct a new Fleep.io Handler.
+     *
+     * For instructions on how to create a new web hook in your conversations
+     * see https://fleep.io/integrations/webhooks/
+     *
+     * @param  string                    $token  Webhook token
+     * @param  bool|int                  $level  The minimum logging level at which this handler will be triggered
+     * @param  bool                      $bubble Whether the messages that are handled can bubble up the stack or not
+     * @throws MissingExtensionException
+     */
+    public function __construct($token, $level = Logger::DEBUG, $bubble = true)
+    {
+        if (!extension_loaded('openssl')) {
+            throw new MissingExtensionException('The OpenSSL PHP extension is required to use the FleepHookHandler');
+        }
+
+        $this->token = $token;
+
+        $connectionString = 'ssl://' . self::FLEEP_HOST . ':443';
+        parent::__construct($connectionString, $level, $bubble);
+    }
+
+    /**
+     * Returns the default formatter to use with this handler
+     *
+     * Overloaded to remove empty context and extra arrays from the end of the log message.
+     *
+     * @return LineFormatter
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter(null, null, true, true);
+    }
+
+    /**
+     * Handles a log record
+     *
+     * @param array $record
+     */
+    public function write(array $record)
+    {
+        parent::write($record);
+        $this->closeSocket();
+    }
+
+    /**
+     * {@inheritdoc}
+     *
+     * @param  array  $record
+     * @return string
+     */
+    protected function generateDataStream($record)
+    {
+        $content = $this->buildContent($record);
+
+        return $this->buildHeader($content) . $content;
+    }
+
+    /**
+     * Builds the header of the API Call
+     *
+     * @param  string $content
+     * @return string
+     */
+    private function buildHeader($content)
+    {
+        $header = "POST " . self::FLEEP_HOOK_URI . $this->token . " HTTP/1.1\r\n";
+        $header .= "Host: " . self::FLEEP_HOST . "\r\n";
+        $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+        $header .= "Content-Length: " . strlen($content) . "\r\n";
+        $header .= "\r\n";
+
+        return $header;
+    }
+
+    /**
+     * Builds the body of API call
+     *
+     * @param  array  $record
+     * @return string
+     */
+    private function buildContent($record)
+    {
+        $dataArray = array(
+            'message' => $record['formatted']
+        );
+
+        return http_build_query($dataArray);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php
new file mode 100644
index 00000000..6eaaa9d4
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php
@@ -0,0 +1,103 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Sends notifications through the Flowdock push API
+ *
+ * This must be configured with a FlowdockFormatter instance via setFormatter()
+ *
+ * Notes:
+ * API token - Flowdock API token
+ *
+ * @author Dominik Liebler <liebler.dominik@gmail.com>
+ * @see https://www.flowdock.com/api/push
+ */
+class FlowdockHandler extends SocketHandler
+{
+    /**
+     * @var string
+     */
+    protected $apiToken;
+
+    /**
+     * @param string   $apiToken
+     * @param bool|int $level    The minimum logging level at which this handler will be triggered
+     * @param bool     $bubble   Whether the messages that are handled can bubble up the stack or not
+     *
+     * @throws MissingExtensionException if OpenSSL is missing
+     */
+    public function __construct($apiToken, $level = Logger::DEBUG, $bubble = true)
+    {
+        if (!extension_loaded('openssl')) {
+            throw new MissingExtensionException('The OpenSSL PHP extension is required to use the FlowdockHandler');
+        }
+
+        parent::__construct('ssl://api.flowdock.com:443', $level, $bubble);
+        $this->apiToken = $apiToken;
+    }
+
+    /**
+     * {@inheritdoc}
+     *
+     * @param array $record
+     */
+    protected function write(array $record)
+    {
+        parent::write($record);
+
+        $this->closeSocket();
+    }
+
+    /**
+     * {@inheritdoc}
+     *
+     * @param  array  $record
+     * @return string
+     */
+    protected function generateDataStream($record)
+    {
+        $content = $this->buildContent($record);
+
+        return $this->buildHeader($content) . $content;
+    }
+
+    /**
+     * Builds the body of API call
+     *
+     * @param  array  $record
+     * @return string
+     */
+    private function buildContent($record)
+    {
+        return json_encode($record['formatted']['flowdock']);
+    }
+
+    /**
+     * Builds the header of the API Call
+     *
+     * @param  string $content
+     * @return string
+     */
+    private function buildHeader($content)
+    {
+        $header = "POST /v1/messages/team_inbox/" . $this->apiToken . " HTTP/1.1\r\n";
+        $header .= "Host: api.flowdock.com\r\n";
+        $header .= "Content-Type: application/json\r\n";
+        $header .= "Content-Length: " . strlen($content) . "\r\n";
+        $header .= "\r\n";
+
+        return $header;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php
new file mode 100644
index 00000000..790f6364
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php
@@ -0,0 +1,72 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\IMessagePublisher;
+use Gelf\PublisherInterface;
+use InvalidArgumentException;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+/**
+ * Handler to send messages to a Graylog2 (http://www.graylog2.org) server
+ *
+ * @author Matt Lehner <mlehner@gmail.com>
+ * @author Benjamin Zikarsky <benjamin@zikarsky.de>
+ */
+class GelfHandler extends AbstractProcessingHandler
+{
+    /**
+     * @var Publisher the publisher object that sends the message to the server
+     */
+    protected $publisher;
+
+    /**
+     * @param PublisherInterface|IMessagePublisher $publisher a publisher object
+     * @param integer                              $level     The minimum logging level at which this handler will be triggered
+     * @param boolean                              $bubble    Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($publisher, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+
+        if (!$publisher instanceof IMessagePublisher && !$publisher instanceof PublisherInterface) {
+            throw new InvalidArgumentException("Invalid publisher, expected a Gelf\IMessagePublisher or Gelf\PublisherInterface instance");
+        }
+
+        $this->publisher = $publisher;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        $this->publisher = null;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $this->publisher->publish($record['formatted']);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new GelfMessageFormatter();
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php
new file mode 100644
index 00000000..99384d35
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php
@@ -0,0 +1,80 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Forwards records to multiple handlers
+ *
+ * @author Lenar Lõhmus <lenar@city.ee>
+ */
+class GroupHandler extends AbstractHandler
+{
+    protected $handlers;
+
+    /**
+     * @param array   $handlers Array of Handlers.
+     * @param Boolean $bubble   Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(array $handlers, $bubble = true)
+    {
+        foreach ($handlers as $handler) {
+            if (!$handler instanceof HandlerInterface) {
+                throw new \InvalidArgumentException('The first argument of the GroupHandler must be an array of HandlerInterface instances.');
+            }
+        }
+
+        $this->handlers = $handlers;
+        $this->bubble = $bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function isHandling(array $record)
+    {
+        foreach ($this->handlers as $handler) {
+            if ($handler->isHandling($record)) {
+                return true;
+            }
+        }
+
+        return false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($this->processors) {
+            foreach ($this->processors as $processor) {
+                $record = call_user_func($processor, $record);
+            }
+        }
+
+        foreach ($this->handlers as $handler) {
+            $handler->handle($record);
+        }
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        foreach ($this->handlers as $handler) {
+            $handler->handleBatch($records);
+        }
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php b/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php
new file mode 100644
index 00000000..d920c4ba
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php
@@ -0,0 +1,90 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FormatterInterface;
+
+/**
+ * Interface that all Monolog Handlers must implement
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+interface HandlerInterface
+{
+    /**
+     * Checks whether the given record will be handled by this handler.
+     *
+     * This is mostly done for performance reasons, to avoid calling processors for nothing.
+     *
+     * Handlers should still check the record levels within handle(), returning false in isHandling()
+     * is no guarantee that handle() will not be called, and isHandling() might not be called
+     * for a given record.
+     *
+     * @param array $record Partial log record containing only a level key
+     *
+     * @return Boolean
+     */
+    public function isHandling(array $record);
+
+    /**
+     * Handles a record.
+     *
+     * All records may be passed to this method, and the handler should discard
+     * those that it does not want to handle.
+     *
+     * The return value of this function controls the bubbling process of the handler stack.
+     * Unless the bubbling is interrupted (by returning true), the Logger class will keep on
+     * calling further handlers in the stack with a given log record.
+     *
+     * @param  array   $record The record to handle
+     * @return Boolean true means that this handler handled the record, and that bubbling is not permitted.
+     *                        false means the record was either not processed or that this handler allows bubbling.
+     */
+    public function handle(array $record);
+
+    /**
+     * Handles a set of records at once.
+     *
+     * @param array $records The records to handle (an array of record arrays)
+     */
+    public function handleBatch(array $records);
+
+    /**
+     * Adds a processor in the stack.
+     *
+     * @param  callable $callback
+     * @return self
+     */
+    public function pushProcessor($callback);
+
+    /**
+     * Removes the processor on top of the stack and returns it.
+     *
+     * @return callable
+     */
+    public function popProcessor();
+
+    /**
+     * Sets the formatter.
+     *
+     * @param  FormatterInterface $formatter
+     * @return self
+     */
+    public function setFormatter(FormatterInterface $formatter);
+
+    /**
+     * Gets the formatter.
+     *
+     * @return FormatterInterface
+     */
+    public function getFormatter();
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php
new file mode 100644
index 00000000..29614d31
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php
@@ -0,0 +1,300 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Sends notifications through the hipchat api to a hipchat room
+ *
+ * Notes:
+ * API token - HipChat API token
+ * Room      - HipChat Room Id or name, where messages are sent
+ * Name      - Name used to send the message (from)
+ * notify    - Should the message trigger a notification in the clients
+ *
+ * @author Rafael Dohms <rafael@doh.ms>
+ * @see    https://www.hipchat.com/docs/api
+ */
+class HipChatHandler extends SocketHandler
+{
+    /**
+     * The maximum allowed length for the name used in the "from" field.
+     */
+    const MAXIMUM_NAME_LENGTH = 15;
+
+    /**
+     * The maximum allowed length for the message.
+     */
+    const MAXIMUM_MESSAGE_LENGTH = 9500;
+
+    /**
+     * @var string
+     */
+    private $token;
+
+    /**
+     * @var array
+     */
+    private $room;
+
+    /**
+     * @var string
+     */
+    private $name;
+
+    /**
+     * @var boolean
+     */
+    private $notify;
+
+    /**
+     * @var string
+     */
+    private $format;
+
+    /**
+     * @param string  $token  HipChat API Token
+     * @param string  $room   The room that should be alerted of the message (Id or Name)
+     * @param string  $name   Name used in the "from" field
+     * @param bool    $notify Trigger a notification in clients or not
+     * @param int     $level  The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+     * @param Boolean $useSSL Whether to connect via SSL.
+     * @param string  $format The format of the messages (default to text, can be set to html if you have html in the messages)
+     * @param string  $host   The HipChat server hostname.
+     */
+    public function __construct($token, $room, $name = 'Monolog', $notify = false, $level = Logger::CRITICAL, $bubble = true, $useSSL = true, $format = 'text', $host = 'api.hipchat.com')
+    {
+        if (!$this->validateStringLength($name, static::MAXIMUM_NAME_LENGTH)) {
+            throw new \InvalidArgumentException('The supplied name is too long. HipChat\'s v1 API supports names up to 15 UTF-8 characters.');
+        }
+
+        $connectionString = $useSSL ? 'ssl://'.$host.':443' : $host.':80';
+        parent::__construct($connectionString, $level, $bubble);
+
+        $this->token = $token;
+        $this->name = $name;
+        $this->notify = $notify;
+        $this->room = $room;
+        $this->format = $format;
+    }
+
+    /**
+     * {@inheritdoc}
+     *
+     * @param  array  $record
+     * @return string
+     */
+    protected function generateDataStream($record)
+    {
+        $content = $this->buildContent($record);
+
+        return $this->buildHeader($content) . $content;
+    }
+
+    /**
+     * Builds the body of API call
+     *
+     * @param  array  $record
+     * @return string
+     */
+    private function buildContent($record)
+    {
+        $dataArray = array(
+            'from' => $this->name,
+            'room_id' => $this->room,
+            'notify' => $this->notify,
+            'message' => $record['formatted'],
+            'message_format' => $this->format,
+            'color' => $this->getAlertColor($record['level']),
+        );
+
+        return http_build_query($dataArray);
+    }
+
+    /**
+     * Builds the header of the API Call
+     *
+     * @param  string $content
+     * @return string
+     */
+    private function buildHeader($content)
+    {
+        $header = "POST /v1/rooms/message?format=json&auth_token=".$this->token." HTTP/1.1\r\n";
+        $header .= "Host: api.hipchat.com\r\n";
+        $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+        $header .= "Content-Length: " . strlen($content) . "\r\n";
+        $header .= "\r\n";
+
+        return $header;
+    }
+
+    /**
+     * Assigns a color to each level of log records.
+     *
+     * @param  integer $level
+     * @return string
+     */
+    protected function getAlertColor($level)
+    {
+        switch (true) {
+            case $level >= Logger::ERROR:
+                return 'red';
+            case $level >= Logger::WARNING:
+                return 'yellow';
+            case $level >= Logger::INFO:
+                return 'green';
+            case $level == Logger::DEBUG:
+                return 'gray';
+            default:
+                return 'yellow';
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     *
+     * @param array $record
+     */
+    protected function write(array $record)
+    {
+        parent::write($record);
+        $this->closeSocket();
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        if (count($records) == 0) {
+            return true;
+        }
+
+        $batchRecords = $this->combineRecords($records);
+
+        $handled = false;
+        foreach ($batchRecords as $batchRecord) {
+            if ($this->isHandling($batchRecord)) {
+                $this->write($batchRecord);
+                $handled = true;
+            }
+        }
+
+        if (!$handled) {
+            return false;
+        }
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * Combines multiple records into one. Error level of the combined record
+     * will be the highest level from the given records. Datetime will be taken
+     * from the first record.
+     *
+     * @param $records
+     * @return array
+     */
+    private function combineRecords($records)
+    {
+        $batchRecord = null;
+        $batchRecords = array();
+        $messages = array();
+        $formattedMessages = array();
+        $level = 0;
+        $levelName = null;
+        $datetime = null;
+
+        foreach ($records as $record) {
+            $record = $this->processRecord($record);
+
+            if ($record['level'] > $level) {
+                $level = $record['level'];
+                $levelName = $record['level_name'];
+            }
+
+            if (null === $datetime) {
+                $datetime = $record['datetime'];
+            }
+
+            $messages[] = $record['message'];
+            $messgeStr = implode(PHP_EOL, $messages);
+            $formattedMessages[] = $this->getFormatter()->format($record);
+            $formattedMessageStr = implode('', $formattedMessages);
+
+            $batchRecord = array(
+                'message'   => $messgeStr,
+                'formatted' => $formattedMessageStr,
+                'context'   => array(),
+                'extra'     => array(),
+            );
+
+            if (!$this->validateStringLength($batchRecord['formatted'], static::MAXIMUM_MESSAGE_LENGTH)) {
+                // Pop the last message and implode the remainging messages
+                $lastMessage = array_pop($messages);
+                $lastFormattedMessage = array_pop($formattedMessages);
+                $batchRecord['message'] = implode(PHP_EOL, $messages);
+                $batchRecord['formatted'] = implode('', $formattedMessages);
+
+                $batchRecords[] = $batchRecord;
+                $messages = array($lastMessage);
+                $formattedMessages = array($lastFormattedMessage);
+
+                $batchRecord = null;
+            }
+        }
+
+        if (null !== $batchRecord) {
+            $batchRecords[] = $batchRecord;
+        }
+
+        // Set the max level and datetime for all records
+        foreach ($batchRecords as &$batchRecord) {
+            $batchRecord = array_merge(
+                $batchRecord,
+                array(
+                    'level'      => $level,
+                    'level_name' => $levelName,
+                    'datetime'   => $datetime
+                )
+            );
+        }
+
+        return $batchRecords;
+    }
+
+    /**
+     * Validates the length of a string.
+     *
+     * If the `mb_strlen()` function is available, it will use that, as HipChat
+     * allows UTF-8 characters. Otherwise, it will fall back to `strlen()`.
+     *
+     * Note that this might cause false failures in the specific case of using
+     * a valid name with less than 16 characters, but 16 or more bytes, on a
+     * system where `mb_strlen()` is unavailable.
+     *
+     * @param string $str
+     * @param int    $length
+     *
+     * @return bool
+     */
+    private function validateStringLength($str, $length)
+    {
+        if (function_exists('mb_strlen')) {
+            return (mb_strlen($str) <= $length);
+        }
+
+        return (strlen($str) <= $length);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php
new file mode 100644
index 00000000..8bf388b3
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php
@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * @author Robert Kaufmann III <rok3@rok3.me>
+ */
+class LogEntriesHandler extends SocketHandler
+{
+    /**
+     * @var string
+     */
+    protected $logToken;
+
+    /**
+     * @param string  $token  Log token supplied by LogEntries
+     * @param boolean $useSSL Whether or not SSL encryption should be used.
+     * @param int     $level  The minimum logging level to trigger this handler
+     * @param boolean $bubble Whether or not messages that are handled should bubble up the stack.
+     *
+     * @throws MissingExtensionExcpetion If SSL encryption is set to true and OpenSSL is missing
+     */
+    public function __construct($token, $useSSL = true, $level = Logger::DEBUG, $bubble = true)
+    {
+        if ($useSSL && !extension_loaded('openssl')) {
+            throw new MissingExtensionException('The OpenSSL PHP plugin is required to use SSL encrypted connection for LogEntriesHandler');
+        }
+
+        $endpoint = $useSSL ? 'ssl://api.logentries.com:20000' : 'data.logentries.com:80';
+        parent::__construct($endpoint, $level, $bubble);
+        $this->logToken = $token;
+    }
+
+    /**
+     * {@inheritdoc}
+     *
+     * @param  array  $record
+     * @return string
+     */
+    protected function generateDataStream($record)
+    {
+        return $this->logToken . ' ' . $record['formatted'];
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php
new file mode 100644
index 00000000..efd94d30
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php
@@ -0,0 +1,98 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LogglyFormatter;
+
+/**
+ * Sends errors to Loggly.
+ *
+ * @author Przemek Sobstel <przemek@sobstel.org>
+ * @author Adam Pancutt <adam@pancutt.com>
+ */
+class LogglyHandler extends AbstractProcessingHandler
+{
+    const HOST = 'logs-01.loggly.com';
+    const ENDPOINT_SINGLE = 'inputs';
+    const ENDPOINT_BATCH = 'bulk';
+
+    protected $token;
+
+    protected $tag;
+
+    public function __construct($token, $level = Logger::DEBUG, $bubble = true)
+    {
+        if (!extension_loaded('curl')) {
+            throw new \LogicException('The curl extension is needed to use the LogglyHandler');
+        }
+
+        $this->token = $token;
+
+        parent::__construct($level, $bubble);
+    }
+
+    public function setTag($tag)
+    {
+        $this->tag = $tag;
+    }
+
+    public function addTag($tag)
+    {
+        $this->tag = (strlen($this->tag) > 0) ? $this->tag .','. $tag : $tag;
+    }
+
+    protected function write(array $record)
+    {
+        $this->send($record["formatted"], self::ENDPOINT_SINGLE);
+    }
+
+    public function handleBatch(array $records)
+    {
+        $level = $this->level;
+
+        $records = array_filter($records, function ($record) use ($level) {
+            return ($record['level'] >= $level);
+        });
+
+        if ($records) {
+            $this->send($this->getFormatter()->formatBatch($records), self::ENDPOINT_BATCH);
+        }
+    }
+
+    protected function send($data, $endpoint)
+    {
+        $url = sprintf("https://%s/%s/%s/", self::HOST, $endpoint, $this->token);
+
+        $headers = array('Content-Type: application/json');
+
+        if ($this->tag) {
+            $headers[] = "X-LOGGLY-TAG: {$this->tag}";
+        }
+
+        $ch = curl_init();
+
+        curl_setopt($ch, CURLOPT_URL, $url);
+        curl_setopt($ch, CURLOPT_POST, true);
+        curl_setopt($ch, CURLOPT_POSTFIELDS, $data);
+        curl_setopt($ch, CURLOPT_HTTPHEADER, $headers);
+        curl_setopt($ch, CURLOPT_RETURNTRANSFER, true);
+
+        curl_exec($ch);
+        curl_close($ch);
+    }
+
+    protected function getDefaultFormatter()
+    {
+        return new LogglyFormatter();
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php
new file mode 100644
index 00000000..86292727
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php
@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Base class for all mail handlers
+ *
+ * @author Gyula Sallai
+ */
+abstract class MailHandler extends AbstractProcessingHandler
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        $messages = array();
+
+        foreach ($records as $record) {
+            if ($record['level'] < $this->level) {
+                continue;
+            }
+            $messages[] = $this->processRecord($record);
+        }
+
+        if (!empty($messages)) {
+            $this->send((string) $this->getFormatter()->formatBatch($messages), $messages);
+        }
+    }
+
+    /**
+     * Send a mail with the given content
+     *
+     * @param string $content
+     * @param array  $records the array of log records that formed this content
+     */
+    abstract protected function send($content, array $records);
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $this->send((string) $record['formatted'], array($record));
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php
new file mode 100644
index 00000000..60a2901e
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php
@@ -0,0 +1,69 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * MandrillHandler uses cURL to send the emails to the Mandrill API
+ *
+ * @author Adam Nicholson <adamnicholson10@gmail.com>
+ */
+class MandrillHandler extends MailHandler
+{
+    protected $client;
+    protected $message;
+
+    /**
+     * @param string                  $apiKey  A valid Mandrill API key
+     * @param callable|\Swift_Message $message An example message for real messages, only the body will be replaced
+     * @param integer                 $level   The minimum logging level at which this handler will be triggered
+     * @param Boolean                 $bubble  Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($apiKey, $message, $level = Logger::ERROR, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+
+        if (!$message instanceof \Swift_Message && is_callable($message)) {
+            $message = call_user_func($message);
+        }
+        if (!$message instanceof \Swift_Message) {
+            throw new \InvalidArgumentException('You must provide either a Swift_Message instance or a callable returning it');
+        }
+        $this->message = $message;
+        $this->apiKey = $apiKey;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function send($content, array $records)
+    {
+        $message = clone $this->message;
+        $message->setBody($content);
+        $message->setDate(time());
+
+        $ch = curl_init();
+
+        curl_setopt($ch, CURLOPT_URL, 'https://mandrillapp.com/api/1.0/messages/send-raw.json');
+        curl_setopt($ch, CURLOPT_POST, 1);
+        curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
+        curl_setopt($ch, CURLOPT_POSTFIELDS, http_build_query(array(
+            'key' => $this->apiKey,
+            'raw_message' => (string) $message,
+            'async' => false,
+        )));
+
+        curl_exec($ch);
+        curl_close($ch);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php b/vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php
new file mode 100644
index 00000000..4724a7e2
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php
@@ -0,0 +1,21 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Exception can be thrown if an extension for an handler is missing
+ *
+ * @author  Christian Bergau <cbergau86@gmail.com>
+ */
+class MissingExtensionException extends \Exception
+{
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php
new file mode 100644
index 00000000..6c431f2b
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php
@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\NormalizerFormatter;
+
+/**
+ * Logs to a MongoDB database.
+ *
+ * usage example:
+ *
+ *   $log = new Logger('application');
+ *   $mongodb = new MongoDBHandler(new \Mongo("mongodb://localhost:27017"), "logs", "prod");
+ *   $log->pushHandler($mongodb);
+ *
+ * @author Thomas Tourlourat <thomas@tourlourat.com>
+ */
+class MongoDBHandler extends AbstractProcessingHandler
+{
+    protected $mongoCollection;
+
+    public function __construct($mongo, $database, $collection, $level = Logger::DEBUG, $bubble = true)
+    {
+        if (!($mongo instanceof \MongoClient || $mongo instanceof \Mongo)) {
+            throw new \InvalidArgumentException('MongoClient or Mongo instance required');
+        }
+
+        $this->mongoCollection = $mongo->selectCollection($database, $collection);
+
+        parent::__construct($level, $bubble);
+    }
+
+    protected function write(array $record)
+    {
+        $this->mongoCollection->save($record["formatted"]);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new NormalizerFormatter();
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php
new file mode 100644
index 00000000..0fe6b642
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php
@@ -0,0 +1,155 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * NativeMailerHandler uses the mail() function to send the emails
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ * @author Mark Garrett <mark@moderndeveloperllc.com>
+ */
+class NativeMailerHandler extends MailHandler
+{
+    /**
+     * The email addresses to which the message will be sent
+     * @var array
+     */
+    protected $to;
+
+    /**
+     * The subject of the email
+     * @var string
+     */
+    protected $subject;
+
+    /**
+     * Optional headers for the message
+     * @var array
+     */
+    protected $headers = array();
+
+    /**
+     * The wordwrap length for the message
+     * @var integer
+     */
+    protected $maxColumnWidth;
+
+    /**
+     * The Content-type for the message
+     * @var string
+     */
+    protected $contentType = 'text/plain';
+
+    /**
+     * The encoding for the message
+     * @var string
+     */
+    protected $encoding = 'utf-8';
+
+    /**
+     * @param string|array $to             The receiver of the mail
+     * @param string       $subject        The subject of the mail
+     * @param string       $from           The sender of the mail
+     * @param integer      $level          The minimum logging level at which this handler will be triggered
+     * @param boolean      $bubble         Whether the messages that are handled can bubble up the stack or not
+     * @param int          $maxColumnWidth The maximum column width that the message lines will have
+     */
+    public function __construct($to, $subject, $from, $level = Logger::ERROR, $bubble = true, $maxColumnWidth = 70)
+    {
+        parent::__construct($level, $bubble);
+        $this->to = is_array($to) ? $to : array($to);
+        $this->subject = $subject;
+        $this->addHeader(sprintf('From: %s', $from));
+        $this->maxColumnWidth = $maxColumnWidth;
+    }
+
+    /**
+     * Add headers to the message
+     *
+     * @param  string|array $headers Custom added headers
+     * @return null
+     */
+    public function addHeader($headers)
+    {
+        foreach ((array) $headers as $header) {
+            if (strpos($header, "\n") !== false || strpos($header, "\r") !== false) {
+                throw new \InvalidArgumentException('Headers can not contain newline characters for security reasons');
+            }
+            $this->headers[] = $header;
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function send($content, array $records)
+    {
+        $content = wordwrap($content, $this->maxColumnWidth);
+        $headers = ltrim(implode("\r\n", $this->headers) . "\r\n", "\r\n");
+        $headers .= 'Content-type: ' . $this->getContentType() . '; charset=' . $this->getEncoding() . "\r\n";
+        if ($this->getContentType() == 'text/html' && false === strpos($headers, 'MIME-Version:')) {
+            $headers .= 'MIME-Version: 1.0' . "\r\n";
+        }
+        foreach ($this->to as $to) {
+            mail($to, $this->subject, $content, $headers);
+        }
+    }
+
+    /**
+     * @return string $contentType
+     */
+    public function getContentType()
+    {
+        return $this->contentType;
+    }
+
+    /**
+     * @return string $encoding
+     */
+    public function getEncoding()
+    {
+        return $this->encoding;
+    }
+
+    /**
+     * @param  string $contentType The content type of the email - Defaults to text/plain. Use text/html for HTML
+     *                             messages.
+     * @return self
+     */
+    public function setContentType($contentType)
+    {
+        if (strpos($contentType, "\n") !== false || strpos($contentType, "\r") !== false) {
+            throw new \InvalidArgumentException('The content type can not contain newline characters to prevent email header injection');
+        }
+
+        $this->contentType = $contentType;
+
+        return $this;
+    }
+
+    /**
+     * @param  string $encoding
+     * @return self
+     */
+    public function setEncoding($encoding)
+    {
+        if (strpos($encoding, "\n") !== false || strpos($encoding, "\r") !== false) {
+            throw new \InvalidArgumentException('The content type can not contain newline characters to prevent email header injection');
+        }
+
+        $this->encoding = $encoding;
+
+        return $this;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php
new file mode 100644
index 00000000..9807410d
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php
@@ -0,0 +1,174 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Class to record a log on a NewRelic application
+ *
+ * @see https://docs.newrelic.com/docs/agents/php-agent
+ */
+class NewRelicHandler extends AbstractProcessingHandler
+{
+    /**
+     * Name of the New Relic application that will receive logs from this handler.
+     *
+     * @var string
+     */
+    protected $appName;
+
+    /**
+     * Name of the current transaction
+     *
+     * @var string
+     */
+    protected $transactionName;
+
+    /**
+     * Some context and extra data is passed into the handler as arrays of values. Do we send them as is
+     * (useful if we are using the API), or explode them for display on the NewRelic RPM website?
+     *
+     * @var boolean
+     */
+    protected $explodeArrays;
+
+    /**
+     * {@inheritDoc}
+     *
+     * @param string  $appName
+     * @param boolean $explodeArrays
+     * @param string  $transactionName
+     */
+    public function __construct(
+        $level = Logger::ERROR,
+        $bubble = true,
+        $appName = null,
+        $explodeArrays = false,
+        $transactionName = null
+    ) {
+        parent::__construct($level, $bubble);
+
+        $this->appName       = $appName;
+        $this->explodeArrays = $explodeArrays;
+        $this->transactionName = $transactionName;
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function write(array $record)
+    {
+        if (!$this->isNewRelicEnabled()) {
+            throw new MissingExtensionException('The newrelic PHP extension is required to use the NewRelicHandler');
+        }
+
+        if ($appName = $this->getAppName($record['context'])) {
+            $this->setNewRelicAppName($appName);
+        }
+
+        if ($transactionName = $this->getTransactionName($record['context'])) {
+            $this->setNewRelicTransactionName($transactionName);
+            unset($record['context']['transaction_name']);
+        }
+
+        if (isset($record['context']['exception']) && $record['context']['exception'] instanceof \Exception) {
+            newrelic_notice_error($record['message'], $record['context']['exception']);
+            unset($record['context']['exception']);
+        } else {
+            newrelic_notice_error($record['message']);
+        }
+
+        foreach ($record['context'] as $key => $parameter) {
+            if (is_array($parameter) && $this->explodeArrays) {
+                foreach ($parameter as $paramKey => $paramValue) {
+                    newrelic_add_custom_parameter('context_' . $key . '_' . $paramKey, $paramValue);
+                }
+            } else {
+                newrelic_add_custom_parameter('context_' . $key, $parameter);
+            }
+        }
+
+        foreach ($record['extra'] as $key => $parameter) {
+            if (is_array($parameter) && $this->explodeArrays) {
+                foreach ($parameter as $paramKey => $paramValue) {
+                    newrelic_add_custom_parameter('extra_' . $key . '_' . $paramKey, $paramValue);
+                }
+            } else {
+                newrelic_add_custom_parameter('extra_' . $key, $parameter);
+            }
+        }
+    }
+
+    /**
+     * Checks whether the NewRelic extension is enabled in the system.
+     *
+     * @return bool
+     */
+    protected function isNewRelicEnabled()
+    {
+        return extension_loaded('newrelic');
+    }
+
+    /**
+     * Returns the appname where this log should be sent. Each log can override the default appname, set in this
+     * handler's constructor, by providing the appname in it's context.
+     *
+     * @param  array       $context
+     * @return null|string
+     */
+    protected function getAppName(array $context)
+    {
+        if (isset($context['appname'])) {
+            return $context['appname'];
+        }
+
+        return $this->appName;
+    }
+
+    /**
+     * Returns the name of the current transaction. Each log can override the default transaction name, set in this
+     * handler's constructor, by providing the transaction_name in it's context
+     *
+     * @param array $context
+     *
+     * @return null|string
+     */
+    protected function getTransactionName(array $context)
+    {
+        if (isset($context['transaction_name'])) {
+            return $context['transaction_name'];
+        }
+
+        return $this->transactionName;
+    }
+
+    /**
+     * Sets the NewRelic application that should receive this log.
+     *
+     * @param string $appName
+     */
+    protected function setNewRelicAppName($appName)
+    {
+        newrelic_set_appname($appName);
+    }
+
+    /**
+     * Overwrites the name of the current transaction
+     *
+     * @param $transactionName
+     */
+    protected function setNewRelicTransactionName($transactionName)
+    {
+        newrelic_name_transaction($transactionName);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php
new file mode 100644
index 00000000..3754e45d
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php
@@ -0,0 +1,45 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Blackhole
+ *
+ * Any record it can handle will be thrown away. This can be used
+ * to put on top of an existing stack to override it temporarily.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class NullHandler extends AbstractHandler
+{
+    /**
+     * @param integer $level The minimum logging level at which this handler will be triggered
+     */
+    public function __construct($level = Logger::DEBUG)
+    {
+        parent::__construct($level, false);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($record['level'] < $this->level) {
+            return false;
+        }
+
+        return true;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php
new file mode 100644
index 00000000..1ae85845
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php
@@ -0,0 +1,56 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Psr\Log\LoggerInterface;
+
+/**
+ * Proxies log messages to an existing PSR-3 compliant logger.
+ *
+ * @author Michael Moussa <michael.moussa@gmail.com>
+ */
+class PsrHandler extends AbstractHandler
+{
+    /**
+     * PSR-3 compliant logger
+     *
+     * @var LoggerInterface
+     */
+    protected $logger;
+
+    /**
+     * @param LoggerInterface $logger The underlying PSR-3 compliant logger to which messages will be proxied
+     * @param int             $level  The minimum logging level at which this handler will be triggered
+     * @param Boolean         $bubble Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(LoggerInterface $logger, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+
+        $this->logger = $logger;
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    public function handle(array $record)
+    {
+        if (!$this->isHandling($record)) {
+            return false;
+        }
+
+        $this->logger->log(strtolower($record['level_name']), $record['message'], $record['context']);
+
+        return false === $this->bubble;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php
new file mode 100644
index 00000000..cd2fcfa3
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php
@@ -0,0 +1,172 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Sends notifications through the pushover api to mobile phones
+ *
+ * @author Sebastian Göttschkes <sebastian.goettschkes@googlemail.com>
+ * @see    https://www.pushover.net/api
+ */
+class PushoverHandler extends SocketHandler
+{
+    private $token;
+    private $users;
+    private $title;
+    private $user;
+    private $retry;
+    private $expire;
+
+    private $highPriorityLevel;
+    private $emergencyLevel;
+
+    /**
+     * All parameters that can be sent to Pushover
+     * @see https://pushover.net/api
+     * @var array
+     */
+    private $parameterNames = array(
+        'token' => true,
+        'user' => true,
+        'message' => true,
+        'device' => true,
+        'title' => true,
+        'url' => true,
+        'url_title' => true,
+        'priority' => true,
+        'timestamp' => true,
+        'sound' => true,
+        'retry' => true,
+        'expire' => true,
+        'callback' => true,
+    );
+
+    /**
+     * Sounds the api supports by default
+     * @see https://pushover.net/api#sounds
+     * @var array
+     */
+    private $sounds = array(
+        'pushover', 'bike', 'bugle', 'cashregister', 'classical', 'cosmic', 'falling', 'gamelan', 'incoming',
+        'intermission', 'magic', 'mechanical', 'pianobar', 'siren', 'spacealarm', 'tugboat', 'alien', 'climb',
+        'persistent', 'echo', 'updown', 'none',
+    );
+
+    /**
+     * @param string       $token             Pushover api token
+     * @param string|array $users             Pushover user id or array of ids the message will be sent to
+     * @param string       $title             Title sent to the Pushover API
+     * @param integer      $level             The minimum logging level at which this handler will be triggered
+     * @param Boolean      $bubble            Whether the messages that are handled can bubble up the stack or not
+     * @param Boolean      $useSSL            Whether to connect via SSL. Required when pushing messages to users that are not
+     *                                        the pushover.net app owner. OpenSSL is required for this option.
+     * @param integer      $highPriorityLevel The minimum logging level at which this handler will start
+     *                                        sending "high priority" requests to the Pushover API
+     * @param integer      $emergencyLevel    The minimum logging level at which this handler will start
+     *                                        sending "emergency" requests to the Pushover API
+     * @param integer      $retry             The retry parameter specifies how often (in seconds) the Pushover servers will send the same notification to the user.
+     * @param integer      $expire            The expire parameter specifies how many seconds your notification will continue to be retried for (every retry seconds).
+     */
+    public function __construct($token, $users, $title = null, $level = Logger::CRITICAL, $bubble = true, $useSSL = true, $highPriorityLevel = Logger::CRITICAL, $emergencyLevel = Logger::EMERGENCY, $retry = 30, $expire = 25200)
+    {
+        $connectionString = $useSSL ? 'ssl://api.pushover.net:443' : 'api.pushover.net:80';
+        parent::__construct($connectionString, $level, $bubble);
+
+        $this->token = $token;
+        $this->users = (array) $users;
+        $this->title = $title ?: gethostname();
+        $this->highPriorityLevel = Logger::toMonologLevel($highPriorityLevel);
+        $this->emergencyLevel = Logger::toMonologLevel($emergencyLevel);
+        $this->retry = $retry;
+        $this->expire = $expire;
+    }
+
+    protected function generateDataStream($record)
+    {
+        $content = $this->buildContent($record);
+
+        return $this->buildHeader($content) . $content;
+    }
+
+    private function buildContent($record)
+    {
+        // Pushover has a limit of 512 characters on title and message combined.
+        $maxMessageLength = 512 - strlen($this->title);
+        $message = substr($record['message'], 0, $maxMessageLength);
+        $timestamp = $record['datetime']->getTimestamp();
+
+        $dataArray = array(
+            'token' => $this->token,
+            'user' => $this->user,
+            'message' => $message,
+            'title' => $this->title,
+            'timestamp' => $timestamp
+        );
+
+        if (isset($record['level']) && $record['level'] >= $this->emergencyLevel) {
+            $dataArray['priority'] = 2;
+            $dataArray['retry'] = $this->retry;
+            $dataArray['expire'] = $this->expire;
+        } elseif (isset($record['level']) && $record['level'] >= $this->highPriorityLevel) {
+            $dataArray['priority'] = 1;
+        }
+
+        // First determine the available parameters
+        $context = array_intersect_key($record['context'], $this->parameterNames);
+        $extra = array_intersect_key($record['extra'], $this->parameterNames);
+
+        // Least important info should be merged with subsequent info
+        $dataArray = array_merge($extra, $context, $dataArray);
+
+        // Only pass sounds that are supported by the API
+        if (isset($dataArray['sound']) && !in_array($dataArray['sound'], $this->sounds)) {
+            unset($dataArray['sound']);
+        }
+
+        return http_build_query($dataArray);
+    }
+
+    private function buildHeader($content)
+    {
+        $header = "POST /1/messages.json HTTP/1.1\r\n";
+        $header .= "Host: api.pushover.net\r\n";
+        $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+        $header .= "Content-Length: " . strlen($content) . "\r\n";
+        $header .= "\r\n";
+
+        return $header;
+    }
+
+    protected function write(array $record)
+    {
+        foreach ($this->users as $user) {
+            $this->user = $user;
+
+            parent::write($record);
+            $this->closeSocket();
+        }
+
+        $this->user = null;
+    }
+
+    public function setHighPriorityLevel($value)
+    {
+        $this->highPriorityLevel = $value;
+    }
+
+    public function setEmergencyLevel($value)
+    {
+        $this->emergencyLevel = $value;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php
new file mode 100644
index 00000000..f5743cd6
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php
@@ -0,0 +1,181 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Formatter\FormatterInterface;
+use Monolog\Logger;
+use Raven_Client;
+
+/**
+ * Handler to send messages to a Sentry (https://github.com/getsentry/sentry) server
+ * using raven-php (https://github.com/getsentry/raven-php)
+ *
+ * @author Marc Abramowitz <marc@marc-abramowitz.com>
+ */
+class RavenHandler extends AbstractProcessingHandler
+{
+    /**
+     * Translates Monolog log levels to Raven log levels.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => Raven_Client::DEBUG,
+        Logger::INFO      => Raven_Client::INFO,
+        Logger::NOTICE    => Raven_Client::INFO,
+        Logger::WARNING   => Raven_Client::WARNING,
+        Logger::ERROR     => Raven_Client::ERROR,
+        Logger::CRITICAL  => Raven_Client::FATAL,
+        Logger::ALERT     => Raven_Client::FATAL,
+        Logger::EMERGENCY => Raven_Client::FATAL,
+    );
+
+    /**
+     * @var Raven_Client the client object that sends the message to the server
+     */
+    protected $ravenClient;
+
+    /**
+     * @var LineFormatter The formatter to use for the logs generated via handleBatch()
+     */
+    protected $batchFormatter;
+
+    /**
+     * @param Raven_Client $ravenClient
+     * @param integer      $level       The minimum logging level at which this handler will be triggered
+     * @param Boolean      $bubble      Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(Raven_Client $ravenClient, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+
+        $this->ravenClient = $ravenClient;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        $level = $this->level;
+
+        // filter records based on their level
+        $records = array_filter($records, function ($record) use ($level) {
+            return $record['level'] >= $level;
+        });
+
+        if (!$records) {
+            return;
+        }
+
+        // the record with the highest severity is the "main" one
+        $record = array_reduce($records, function ($highest, $record) {
+            if ($record['level'] >= $highest['level']) {
+                return $record;
+            }
+
+            return $highest;
+        });
+
+        // the other ones are added as a context item
+        $logs = array();
+        foreach ($records as $r) {
+            $logs[] = $this->processRecord($r);
+        }
+
+        if ($logs) {
+            $record['context']['logs'] = (string) $this->getBatchFormatter()->formatBatch($logs);
+        }
+
+        $this->handle($record);
+    }
+
+    /**
+     * Sets the formatter for the logs generated by handleBatch().
+     *
+     * @param FormatterInterface $formatter
+     */
+    public function setBatchFormatter(FormatterInterface $formatter)
+    {
+        $this->batchFormatter = $formatter;
+    }
+
+    /**
+     * Gets the formatter for the logs generated by handleBatch().
+     *
+     * @return FormatterInterface
+     */
+    public function getBatchFormatter()
+    {
+        if (!$this->batchFormatter) {
+            $this->batchFormatter = $this->getDefaultBatchFormatter();
+        }
+
+        return $this->batchFormatter;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $options = array();
+        $options['level'] = $this->logLevels[$record['level']];
+        $options['tags'] = array();
+        if (!empty($record['extra']['tags'])) {
+            $options['tags'] = array_merge($options['tags'], $record['extra']['tags']);
+            unset($record['extra']['tags']);
+        }
+        if (!empty($record['context']['tags'])) {
+            $options['tags'] = array_merge($options['tags'], $record['context']['tags']);
+            unset($record['context']['tags']);
+        }
+        if (!empty($record['context']['logger'])) {
+            $options['logger'] = $record['context']['logger'];
+            unset($record['context']['logger']);
+        } else {
+            $options['logger'] = $record['channel'];
+        }
+        if (!empty($record['context'])) {
+            $options['extra']['context'] = $record['context'];
+        }
+        if (!empty($record['extra'])) {
+            $options['extra']['extra'] = $record['extra'];
+        }
+
+        if (isset($record['context']['exception']) && $record['context']['exception'] instanceof \Exception) {
+            $options['extra']['message'] = $record['formatted'];
+            $this->ravenClient->captureException($record['context']['exception'], $options);
+
+            return;
+        }
+
+        $this->ravenClient->captureMessage($record['formatted'], array(), $options);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter('[%channel%] %message%');
+    }
+
+    /**
+     * Gets the default formatter for the logs generated by handleBatch().
+     *
+     * @return FormatterInterface
+     */
+    protected function getDefaultBatchFormatter()
+    {
+        return new LineFormatter();
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php
new file mode 100644
index 00000000..3fc7f34b
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php
@@ -0,0 +1,58 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Logs to a Redis key using rpush
+ *
+ * usage example:
+ *
+ *   $log = new Logger('application');
+ *   $redis = new RedisHandler(new Predis\Client("tcp://localhost:6379"), "logs", "prod");
+ *   $log->pushHandler($redis);
+ *
+ * @author Thomas Tourlourat <thomas@tourlourat.com>
+ */
+class RedisHandler extends AbstractProcessingHandler
+{
+    private $redisClient;
+    private $redisKey;
+
+    # redis instance, key to use
+    public function __construct($redis, $key, $level = Logger::DEBUG, $bubble = true)
+    {
+        if (!(($redis instanceof \Predis\Client) || ($redis instanceof \Redis))) {
+            throw new \InvalidArgumentException('Predis\Client or Redis instance required');
+        }
+
+        $this->redisClient = $redis;
+        $this->redisKey = $key;
+
+        parent::__construct($level, $bubble);
+    }
+
+    protected function write(array $record)
+    {
+        $this->redisClient->rpush($this->redisKey, $record["formatted"]);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter();
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php
new file mode 100644
index 00000000..81abf086
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php
@@ -0,0 +1,73 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use RollbarNotifier;
+use Exception;
+use Monolog\Logger;
+
+/**
+ * Sends errors to Rollbar
+ *
+ * @author Paul Statezny <paulstatezny@gmail.com>
+ */
+class RollbarHandler extends AbstractProcessingHandler
+{
+    /**
+     * Rollbar notifier
+     *
+     * @var RollbarNotifier
+     */
+    protected $rollbarNotifier;
+
+    /**
+     * @param RollbarNotifier $rollbarNotifier RollbarNotifier object constructed with valid token
+     * @param integer         $level           The minimum logging level at which this handler will be triggered
+     * @param boolean         $bubble          Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(RollbarNotifier $rollbarNotifier, $level = Logger::ERROR, $bubble = true)
+    {
+        $this->rollbarNotifier = $rollbarNotifier;
+
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        if (isset($record['context']['exception']) && $record['context']['exception'] instanceof Exception) {
+            $this->rollbarNotifier->report_exception($record['context']['exception']);
+        } else {
+            $extraData = array(
+                'level' => $record['level'],
+                'channel' => $record['channel'],
+                'datetime' => $record['datetime']->format('U'),
+            );
+
+            $this->rollbarNotifier->report_message(
+                $record['message'],
+                $record['level_name'],
+                array_merge($record['context'], $record['extra'], $extraData)
+            );
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        $this->rollbarNotifier->flush();
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php
new file mode 100644
index 00000000..4168c32f
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php
@@ -0,0 +1,153 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores logs to files that are rotated every day and a limited number of files are kept.
+ *
+ * This rotation is only intended to be used as a workaround. Using logrotate to
+ * handle the rotation is strongly encouraged when you can use it.
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class RotatingFileHandler extends StreamHandler
+{
+    protected $filename;
+    protected $maxFiles;
+    protected $mustRotate;
+    protected $nextRotation;
+    protected $filenameFormat;
+    protected $dateFormat;
+
+    /**
+     * @param string   $filename
+     * @param integer  $maxFiles       The maximal amount of files to keep (0 means unlimited)
+     * @param integer  $level          The minimum logging level at which this handler will be triggered
+     * @param Boolean  $bubble         Whether the messages that are handled can bubble up the stack or not
+     * @param int|null $filePermission Optional file permissions (default (0644) are only for owner read/write)
+     * @param Boolean  $useLocking     Try to lock log file before doing any writes
+     */
+    public function __construct($filename, $maxFiles = 0, $level = Logger::DEBUG, $bubble = true, $filePermission = null, $useLocking = false)
+    {
+        $this->filename = $filename;
+        $this->maxFiles = (int) $maxFiles;
+        $this->nextRotation = new \DateTime('tomorrow');
+        $this->filenameFormat = '{filename}-{date}';
+        $this->dateFormat = 'Y-m-d';
+
+        parent::__construct($this->getTimedFilename(), $level, $bubble, $filePermission, $useLocking);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        parent::close();
+
+        if (true === $this->mustRotate) {
+            $this->rotate();
+        }
+    }
+
+    public function setFilenameFormat($filenameFormat, $dateFormat)
+    {
+        $this->filenameFormat = $filenameFormat;
+        $this->dateFormat = $dateFormat;
+        $this->url = $this->getTimedFilename();
+        $this->close();
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        // on the first record written, if the log is new, we should rotate (once per day)
+        if (null === $this->mustRotate) {
+            $this->mustRotate = !file_exists($this->url);
+        }
+
+        if ($this->nextRotation < $record['datetime']) {
+            $this->mustRotate = true;
+            $this->close();
+        }
+
+        parent::write($record);
+    }
+
+    /**
+     * Rotates the files.
+     */
+    protected function rotate()
+    {
+        // update filename
+        $this->url = $this->getTimedFilename();
+        $this->nextRotation = new \DateTime('tomorrow');
+
+        // skip GC of old logs if files are unlimited
+        if (0 === $this->maxFiles) {
+            return;
+        }
+
+        $logFiles = glob($this->getGlobPattern());
+        if ($this->maxFiles >= count($logFiles)) {
+            // no files to remove
+            return;
+        }
+
+        // Sorting the files by name to remove the older ones
+        usort($logFiles, function ($a, $b) {
+            return strcmp($b, $a);
+        });
+
+        foreach (array_slice($logFiles, $this->maxFiles) as $file) {
+            if (is_writable($file)) {
+                unlink($file);
+            }
+        }
+    }
+
+    protected function getTimedFilename()
+    {
+        $fileInfo = pathinfo($this->filename);
+        $timedFilename = str_replace(
+            array('{filename}', '{date}'),
+            array($fileInfo['filename'], date($this->dateFormat)),
+            $fileInfo['dirname'] . '/' . $this->filenameFormat
+        );
+
+        if (!empty($fileInfo['extension'])) {
+            $timedFilename .= '.'.$fileInfo['extension'];
+        }
+
+        return $timedFilename;
+    }
+
+    protected function getGlobPattern()
+    {
+        $fileInfo = pathinfo($this->filename);
+        $glob = str_replace(
+            array('{filename}', '{date}'),
+            array($fileInfo['filename'], '*'),
+            $fileInfo['dirname'] . '/' . $this->filenameFormat
+        );
+        if (!empty($fileInfo['extension'])) {
+            $glob .= '.'.$fileInfo['extension'];
+        }
+
+        return $glob;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php
new file mode 100644
index 00000000..487e26f6
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php
@@ -0,0 +1,83 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+
+/**
+ * Sampling handler
+ *
+ * A sampled event stream can be useful for logging high frequency events in
+ * a production environment where you only need an idea of what is happening
+ * and are not concerned with capturing every occurrence. Since the decision to
+ * handle or not handle a particular event is determined randomly, the
+ * resulting sampled log is not guaranteed to contain 1/N of the events that
+ * occurred in the application, but based on the Law of large numbers, it will
+ * tend to be close to this ratio with a large number of attempts.
+ *
+ * @author Bryan Davis <bd808@wikimedia.org>
+ * @author Kunal Mehta <legoktm@gmail.com>
+ */
+class SamplingHandler extends AbstractHandler
+{
+    /**
+     * @var callable|HandlerInterface $handler
+     */
+    protected $handler;
+
+    /**
+     * @var int $factor
+     */
+    protected $factor;
+
+    /**
+     * @param callable|HandlerInterface $handler Handler or factory callable($record, $fingersCrossedHandler).
+     * @param int                       $factor  Sample factor
+     */
+    public function __construct($handler, $factor)
+    {
+        parent::__construct();
+        $this->handler = $handler;
+        $this->factor = $factor;
+
+        if (!$this->handler instanceof HandlerInterface && !is_callable($this->handler)) {
+            throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object");
+        }
+    }
+
+    public function isHandling(array $record)
+    {
+        return $this->handler->isHandling($record);
+    }
+
+    public function handle(array $record)
+    {
+        if ($this->isHandling($record) && mt_rand(1, $this->factor) === 1) {
+            // The same logic as in FingersCrossedHandler
+            if (!$this->handler instanceof HandlerInterface) {
+                $this->handler = call_user_func($this->handler, $record, $this);
+                if (!$this->handler instanceof HandlerInterface) {
+                    throw new \RuntimeException("The factory callable should return a HandlerInterface");
+                }
+            }
+
+            if ($this->processors) {
+                foreach ($this->processors as $processor) {
+                    $record = call_user_func($processor, $record);
+                }
+            }
+
+            $this->handler->handle($record);
+        }
+
+        return false === $this->bubble;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php
new file mode 100644
index 00000000..e3c8e11b
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php
@@ -0,0 +1,234 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Sends notifications through Slack API
+ *
+ * @author Greg Kedzierski <greg@gregkedzierski.com>
+ * @see    https://api.slack.com/
+ */
+class SlackHandler extends SocketHandler
+{
+    /**
+     * Slack API token
+     * @var string
+     */
+    private $token;
+
+    /**
+     * Slack channel (encoded ID or name)
+     * @var string
+     */
+    private $channel;
+
+    /**
+     * Name of a bot
+     * @var string
+     */
+    private $username;
+
+    /**
+     * Emoji icon name
+     * @var string
+     */
+    private $iconEmoji;
+
+    /**
+     * Whether the message should be added to Slack as attachment (plain text otherwise)
+     * @var bool
+     */
+    private $useAttachment;
+
+    /**
+     * Whether the the message that is added to Slack as attachment is in a short style (or not)
+     * @var bool
+     */
+    private $useShortAttachment;
+
+    /**
+     * Whether the attachment should include extra data (or not)
+     * @var bool
+     */
+    private $includeExtra;
+
+    /**
+     * @var LineFormatter
+     */
+    private $lineFormatter;
+
+    /**
+     * @param string      $token         Slack API token
+     * @param string      $channel       Slack channel (encoded ID or name)
+     * @param string      $username      Name of a bot
+     * @param bool        $useAttachment Whether the message should be added to Slack as attachment (plain text otherwise)
+     * @param string|null $iconEmoji     The emoji name to use (or null)
+     * @param int         $level         The minimum logging level at which this handler will be triggered
+     * @param bool        $bubble        Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($token, $channel, $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $level = Logger::CRITICAL, $bubble = true, $useShortAttachment = false, $includeExtra = false)
+    {
+        if (!extension_loaded('openssl')) {
+            throw new MissingExtensionException('The OpenSSL PHP extension is required to use the SlackHandler');
+        }
+
+        parent::__construct('ssl://slack.com:443', $level, $bubble);
+
+        $this->token = $token;
+        $this->channel = $channel;
+        $this->username = $username;
+        $this->iconEmoji = trim($iconEmoji, ':');
+        $this->useAttachment = $useAttachment;
+        $this->useShortAttachment = $useShortAttachment;
+        $this->includeExtra = $includeExtra;
+        if ($this->includeExtra) {
+            $this->lineFormatter = new LineFormatter;
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     *
+     * @param  array  $record
+     * @return string
+     */
+    protected function generateDataStream($record)
+    {
+        $content = $this->buildContent($record);
+
+        return $this->buildHeader($content) . $content;
+    }
+
+    /**
+     * Builds the body of API call
+     *
+     * @param  array  $record
+     * @return string
+     */
+    private function buildContent($record)
+    {
+        $dataArray = array(
+            'token' => $this->token,
+            'channel' => $this->channel,
+            'username' => $this->username,
+            'text' => '',
+            'attachments' => array()
+        );
+
+        if ($this->useAttachment) {
+            $attachment = array(
+                'fallback' => $record['message'],
+                'color' => $this->getAttachmentColor($record['level'])
+            );
+
+            if ($this->useShortAttachment) {
+                $attachment['fields'] = array(
+                    array(
+                        'title' => $record['level_name'],
+                        'value' => $record['message'],
+                        'short' => false
+                    )
+                );
+            } else {
+                $attachment['fields'] = array(
+                    array(
+                        'title' => 'Message',
+                        'value' => $record['message'],
+                        'short' => false
+                    ),
+                    array(
+                        'title' => 'Level',
+                        'value' => $record['level_name'],
+                        'short' => true
+                    )
+                );
+            }
+
+            if ($this->includeExtra) {
+                $extra = '';
+                foreach ($record['extra'] as $var => $val) {
+                    $extra .= $var.': '.$this->lineFormatter->stringify($val)." | ";
+                }
+
+                $extra = rtrim($extra, " |");
+
+                $attachment['fields'][] = array(
+                    'title' => "Extra",
+                    'value' => $extra,
+                    'short' => false
+                );
+            }
+
+            $dataArray['attachments'] = json_encode(array($attachment));
+        } else {
+            $dataArray['text'] = $record['message'];
+        }
+
+        if ($this->iconEmoji) {
+            $dataArray['icon_emoji'] = ":{$this->iconEmoji}:";
+        }
+
+        return http_build_query($dataArray);
+    }
+
+    /**
+     * Builds the header of the API Call
+     *
+     * @param  string $content
+     * @return string
+     */
+    private function buildHeader($content)
+    {
+        $header = "POST /api/chat.postMessage HTTP/1.1\r\n";
+        $header .= "Host: slack.com\r\n";
+        $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+        $header .= "Content-Length: " . strlen($content) . "\r\n";
+        $header .= "\r\n";
+
+        return $header;
+    }
+
+    /**
+     * {@inheritdoc}
+     *
+     * @param array $record
+     */
+    protected function write(array $record)
+    {
+        parent::write($record);
+        $this->closeSocket();
+    }
+
+    /**
+     * Returned a Slack message attachment color associated with
+     * provided level.
+     *
+     * @param  int    $level
+     * @return string
+     */
+    protected function getAttachmentColor($level)
+    {
+        switch (true) {
+            case $level >= Logger::ERROR:
+                return 'danger';
+            case $level >= Logger::WARNING:
+                return 'warning';
+            case $level >= Logger::INFO:
+                return 'good';
+            default:
+                return '#e3e4e6';
+        }
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php
new file mode 100644
index 00000000..ee486f69
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php
@@ -0,0 +1,284 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores to any socket - uses fsockopen() or pfsockopen().
+ *
+ * @author Pablo de Leon Belloc <pablolb@gmail.com>
+ * @see    http://php.net/manual/en/function.fsockopen.php
+ */
+class SocketHandler extends AbstractProcessingHandler
+{
+    private $connectionString;
+    private $connectionTimeout;
+    private $resource;
+    private $timeout = 0;
+    private $persistent = false;
+    private $errno;
+    private $errstr;
+
+    /**
+     * @param string  $connectionString Socket connection string
+     * @param integer $level            The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble           Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($connectionString, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+        $this->connectionString = $connectionString;
+        $this->connectionTimeout = (float) ini_get('default_socket_timeout');
+    }
+
+    /**
+     * Connect (if necessary) and write to the socket
+     *
+     * @param array $record
+     *
+     * @throws \UnexpectedValueException
+     * @throws \RuntimeException
+     */
+    protected function write(array $record)
+    {
+        $this->connectIfNotConnected();
+        $data = $this->generateDataStream($record);
+        $this->writeToSocket($data);
+    }
+
+    /**
+     * We will not close a PersistentSocket instance so it can be reused in other requests.
+     */
+    public function close()
+    {
+        if (!$this->isPersistent()) {
+            $this->closeSocket();
+        }
+    }
+
+    /**
+     * Close socket, if open
+     */
+    public function closeSocket()
+    {
+        if (is_resource($this->resource)) {
+            fclose($this->resource);
+            $this->resource = null;
+        }
+    }
+
+    /**
+     * Set socket connection to nbe persistent. It only has effect before the connection is initiated.
+     *
+     * @param type $boolean
+     */
+    public function setPersistent($boolean)
+    {
+        $this->persistent = (boolean) $boolean;
+    }
+
+    /**
+     * Set connection timeout.  Only has effect before we connect.
+     *
+     * @param float $seconds
+     *
+     * @see http://php.net/manual/en/function.fsockopen.php
+     */
+    public function setConnectionTimeout($seconds)
+    {
+        $this->validateTimeout($seconds);
+        $this->connectionTimeout = (float) $seconds;
+    }
+
+    /**
+     * Set write timeout. Only has effect before we connect.
+     *
+     * @param float $seconds
+     *
+     * @see http://php.net/manual/en/function.stream-set-timeout.php
+     */
+    public function setTimeout($seconds)
+    {
+        $this->validateTimeout($seconds);
+        $this->timeout = (float) $seconds;
+    }
+
+    /**
+     * Get current connection string
+     *
+     * @return string
+     */
+    public function getConnectionString()
+    {
+        return $this->connectionString;
+    }
+
+    /**
+     * Get persistent setting
+     *
+     * @return boolean
+     */
+    public function isPersistent()
+    {
+        return $this->persistent;
+    }
+
+    /**
+     * Get current connection timeout setting
+     *
+     * @return float
+     */
+    public function getConnectionTimeout()
+    {
+        return $this->connectionTimeout;
+    }
+
+    /**
+     * Get current in-transfer timeout
+     *
+     * @return float
+     */
+    public function getTimeout()
+    {
+        return $this->timeout;
+    }
+
+    /**
+     * Check to see if the socket is currently available.
+     *
+     * UDP might appear to be connected but might fail when writing.  See http://php.net/fsockopen for details.
+     *
+     * @return boolean
+     */
+    public function isConnected()
+    {
+        return is_resource($this->resource)
+            && !feof($this->resource);  // on TCP - other party can close connection.
+    }
+
+    /**
+     * Wrapper to allow mocking
+     */
+    protected function pfsockopen()
+    {
+        return @pfsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout);
+    }
+
+    /**
+     * Wrapper to allow mocking
+     */
+    protected function fsockopen()
+    {
+        return @fsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout);
+    }
+
+    /**
+     * Wrapper to allow mocking
+     *
+     * @see http://php.net/manual/en/function.stream-set-timeout.php
+     */
+    protected function streamSetTimeout()
+    {
+        $seconds = floor($this->timeout);
+        $microseconds = round(($this->timeout - $seconds)*1e6);
+
+        return stream_set_timeout($this->resource, $seconds, $microseconds);
+    }
+
+    /**
+     * Wrapper to allow mocking
+     */
+    protected function fwrite($data)
+    {
+        return @fwrite($this->resource, $data);
+    }
+
+    /**
+     * Wrapper to allow mocking
+     */
+    protected function streamGetMetadata()
+    {
+        return stream_get_meta_data($this->resource);
+    }
+
+    private function validateTimeout($value)
+    {
+        $ok = filter_var($value, FILTER_VALIDATE_FLOAT);
+        if ($ok === false || $value < 0) {
+            throw new \InvalidArgumentException("Timeout must be 0 or a positive float (got $value)");
+        }
+    }
+
+    private function connectIfNotConnected()
+    {
+        if ($this->isConnected()) {
+            return;
+        }
+        $this->connect();
+    }
+
+    protected function generateDataStream($record)
+    {
+        return (string) $record['formatted'];
+    }
+
+    private function connect()
+    {
+        $this->createSocketResource();
+        $this->setSocketTimeout();
+    }
+
+    private function createSocketResource()
+    {
+        if ($this->isPersistent()) {
+            $resource = $this->pfsockopen();
+        } else {
+            $resource = $this->fsockopen();
+        }
+        if (!$resource) {
+            throw new \UnexpectedValueException("Failed connecting to $this->connectionString ($this->errno: $this->errstr)");
+        }
+        $this->resource = $resource;
+    }
+
+    private function setSocketTimeout()
+    {
+        if (!$this->streamSetTimeout()) {
+            throw new \UnexpectedValueException("Failed setting timeout with stream_set_timeout()");
+        }
+    }
+
+    private function writeToSocket($data)
+    {
+        $length = strlen($data);
+        $sent = 0;
+        while ($this->isConnected() && $sent < $length) {
+            if (0 == $sent) {
+                $chunk = $this->fwrite($data);
+            } else {
+                $chunk = $this->fwrite(substr($data, $sent));
+            }
+            if ($chunk === false) {
+                throw new \RuntimeException("Could not write to socket");
+            }
+            $sent += $chunk;
+            $socketInfo = $this->streamGetMetadata();
+            if ($socketInfo['timed_out']) {
+                throw new \RuntimeException("Write timed-out");
+            }
+        }
+        if (!$this->isConnected() && $sent < $length) {
+            throw new \RuntimeException("End-of-file reached, probably we got disconnected (sent $sent of $length)");
+        }
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php
new file mode 100644
index 00000000..7965db74
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php
@@ -0,0 +1,104 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores to any stream resource
+ *
+ * Can be used to store into php://stderr, remote and local files, etc.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class StreamHandler extends AbstractProcessingHandler
+{
+    protected $stream;
+    protected $url;
+    private $errorMessage;
+    protected $filePermission;
+    protected $useLocking;
+
+    /**
+     * @param resource|string $stream
+     * @param integer         $level          The minimum logging level at which this handler will be triggered
+     * @param Boolean         $bubble         Whether the messages that are handled can bubble up the stack or not
+     * @param int|null        $filePermission Optional file permissions (default (0644) are only for owner read/write)
+     * @param Boolean         $useLocking     Try to lock log file before doing any writes
+     *
+     * @throws \InvalidArgumentException If stream is not a resource or string
+     */
+    public function __construct($stream, $level = Logger::DEBUG, $bubble = true, $filePermission = null, $useLocking = false)
+    {
+        parent::__construct($level, $bubble);
+        if (is_resource($stream)) {
+            $this->stream = $stream;
+        } elseif (is_string($stream)) {
+            $this->url = $stream;
+        } else {
+            throw new \InvalidArgumentException('A stream must either be a resource or a string.');
+        }
+
+        $this->filePermission = $filePermission;
+        $this->useLocking = $useLocking;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        if (is_resource($this->stream)) {
+            fclose($this->stream);
+        }
+        $this->stream = null;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        if (!is_resource($this->stream)) {
+            if (!$this->url) {
+                throw new \LogicException('Missing stream url, the stream can not be opened. This may be caused by a premature call to close().');
+            }
+            $this->errorMessage = null;
+            set_error_handler(array($this, 'customErrorHandler'));
+            $this->stream = fopen($this->url, 'a');
+            if ($this->filePermission !== null) {
+                @chmod($this->url, $this->filePermission);
+            }
+            restore_error_handler();
+            if (!is_resource($this->stream)) {
+                $this->stream = null;
+                throw new \UnexpectedValueException(sprintf('The stream or file "%s" could not be opened: '.$this->errorMessage, $this->url));
+            }
+        }
+
+        if ($this->useLocking) {
+            // ignoring errors here, there's not much we can do about them
+            flock($this->stream, LOCK_EX);
+        }
+
+        fwrite($this->stream, (string) $record['formatted']);
+
+        if ($this->useLocking) {
+            flock($this->stream, LOCK_UN);
+        }
+    }
+
+    private function customErrorHandler($code, $msg)
+    {
+        $this->errorMessage = preg_replace('{^fopen\(.*?\): }', '', $msg);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php
new file mode 100644
index 00000000..af321db2
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php
@@ -0,0 +1,56 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * SwiftMailerHandler uses Swift_Mailer to send the emails
+ *
+ * @author Gyula Sallai
+ */
+class SwiftMailerHandler extends MailHandler
+{
+    protected $mailer;
+    protected $message;
+
+    /**
+     * @param \Swift_Mailer           $mailer  The mailer to use
+     * @param callable|\Swift_Message $message An example message for real messages, only the body will be replaced
+     * @param integer                 $level   The minimum logging level at which this handler will be triggered
+     * @param Boolean                 $bubble  Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(\Swift_Mailer $mailer, $message, $level = Logger::ERROR, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+        $this->mailer  = $mailer;
+        if (!$message instanceof \Swift_Message && is_callable($message)) {
+            $message = call_user_func($message);
+        }
+        if (!$message instanceof \Swift_Message) {
+            throw new \InvalidArgumentException('You must provide either a Swift_Message instance or a callable returning it');
+        }
+        $this->message = $message;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function send($content, array $records)
+    {
+        $message = clone $this->message;
+        $message->setBody($content);
+        $message->setDate(time());
+
+        $this->mailer->send($message);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php
new file mode 100644
index 00000000..47c73e12
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php
@@ -0,0 +1,67 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Logs to syslog service.
+ *
+ * usage example:
+ *
+ *   $log = new Logger('application');
+ *   $syslog = new SyslogHandler('myfacility', 'local6');
+ *   $formatter = new LineFormatter("%channel%.%level_name%: %message% %extra%");
+ *   $syslog->setFormatter($formatter);
+ *   $log->pushHandler($syslog);
+ *
+ * @author Sven Paulus <sven@karlsruhe.org>
+ */
+class SyslogHandler extends AbstractSyslogHandler
+{
+    protected $ident;
+    protected $logopts;
+
+    /**
+     * @param string  $ident
+     * @param mixed   $facility
+     * @param integer $level    The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble   Whether the messages that are handled can bubble up the stack or not
+     * @param int     $logopts  Option flags for the openlog() call, defaults to LOG_PID
+     */
+    public function __construct($ident, $facility = LOG_USER, $level = Logger::DEBUG, $bubble = true, $logopts = LOG_PID)
+    {
+        parent::__construct($facility, $level, $bubble);
+
+        $this->ident = $ident;
+        $this->logopts = $logopts;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        closelog();
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        if (!openlog($this->ident, $this->logopts, $this->facility)) {
+            throw new \LogicException('Can\'t open syslog for ident "'.$this->ident.'" and facility "'.$this->facility.'"');
+        }
+        syslog($this->logLevels[$record['level']], (string) $record['formatted']);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php
new file mode 100644
index 00000000..dcf3f1f9
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php
@@ -0,0 +1,46 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\SyslogUdp;
+
+class UdpSocket
+{
+    const DATAGRAM_MAX_LENGTH = 65023;
+
+    public function __construct($ip, $port = 514)
+    {
+        $this->ip = $ip;
+        $this->port = $port;
+        $this->socket = socket_create(AF_INET, SOCK_DGRAM, SOL_UDP);
+    }
+
+    public function write($line, $header = "")
+    {
+        $this->send($this->assembleMessage($line, $header));
+    }
+
+    public function close()
+    {
+        socket_close($this->socket);
+    }
+
+    protected function send($chunk)
+    {
+        socket_sendto($this->socket, $chunk, strlen($chunk), $flags = 0, $this->ip, $this->port);
+    }
+
+    protected function assembleMessage($line, $header)
+    {
+        $chunkSize = self::DATAGRAM_MAX_LENGTH - strlen($header);
+
+        return $header . substr($line, 0, $chunkSize);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php
new file mode 100644
index 00000000..aa047c07
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php
@@ -0,0 +1,80 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Handler\SyslogUdp\UdpSocket;
+
+/**
+ * A Handler for logging to a remote syslogd server.
+ *
+ * @author Jesper Skovgaard Nielsen <nulpunkt@gmail.com>
+ */
+class SyslogUdpHandler extends AbstractSyslogHandler
+{
+    /**
+     * @param string  $host
+     * @param int     $port
+     * @param mixed   $facility
+     * @param integer $level    The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble   Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($host, $port = 514, $facility = LOG_USER, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($facility, $level, $bubble);
+
+        $this->socket = new UdpSocket($host, $port ?: 514);
+    }
+
+    protected function write(array $record)
+    {
+        $lines = $this->splitMessageIntoLines($record['formatted']);
+
+        $header = $this->makeCommonSyslogHeader($this->logLevels[$record['level']]);
+
+        foreach ($lines as $line) {
+            $this->socket->write($line, $header);
+        }
+    }
+
+    public function close()
+    {
+        $this->socket->close();
+    }
+
+    private function splitMessageIntoLines($message)
+    {
+        if (is_array($message)) {
+            $message = implode("\n", $message);
+        }
+
+        return preg_split('/$\R?^/m', $message);
+    }
+
+    /**
+     * Make common syslog header (see rfc5424)
+     */
+    protected function makeCommonSyslogHeader($severity)
+    {
+        $priority = $severity + $this->facility;
+
+        return "<$priority>1 ";
+    }
+
+    /**
+     * Inject your own socket, mainly used for testing
+     */
+    public function setSocket($socket)
+    {
+        $this->socket = $socket;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php
new file mode 100644
index 00000000..085d9e17
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php
@@ -0,0 +1,140 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Used for testing purposes.
+ *
+ * It records all records and gives you access to them for verification.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class TestHandler extends AbstractProcessingHandler
+{
+    protected $records = array();
+    protected $recordsByLevel = array();
+
+    public function getRecords()
+    {
+        return $this->records;
+    }
+
+    public function hasEmergency($record)
+    {
+        return $this->hasRecord($record, Logger::EMERGENCY);
+    }
+
+    public function hasAlert($record)
+    {
+        return $this->hasRecord($record, Logger::ALERT);
+    }
+
+    public function hasCritical($record)
+    {
+        return $this->hasRecord($record, Logger::CRITICAL);
+    }
+
+    public function hasError($record)
+    {
+        return $this->hasRecord($record, Logger::ERROR);
+    }
+
+    public function hasWarning($record)
+    {
+        return $this->hasRecord($record, Logger::WARNING);
+    }
+
+    public function hasNotice($record)
+    {
+        return $this->hasRecord($record, Logger::NOTICE);
+    }
+
+    public function hasInfo($record)
+    {
+        return $this->hasRecord($record, Logger::INFO);
+    }
+
+    public function hasDebug($record)
+    {
+        return $this->hasRecord($record, Logger::DEBUG);
+    }
+
+    public function hasEmergencyRecords()
+    {
+        return isset($this->recordsByLevel[Logger::EMERGENCY]);
+    }
+
+    public function hasAlertRecords()
+    {
+        return isset($this->recordsByLevel[Logger::ALERT]);
+    }
+
+    public function hasCriticalRecords()
+    {
+        return isset($this->recordsByLevel[Logger::CRITICAL]);
+    }
+
+    public function hasErrorRecords()
+    {
+        return isset($this->recordsByLevel[Logger::ERROR]);
+    }
+
+    public function hasWarningRecords()
+    {
+        return isset($this->recordsByLevel[Logger::WARNING]);
+    }
+
+    public function hasNoticeRecords()
+    {
+        return isset($this->recordsByLevel[Logger::NOTICE]);
+    }
+
+    public function hasInfoRecords()
+    {
+        return isset($this->recordsByLevel[Logger::INFO]);
+    }
+
+    public function hasDebugRecords()
+    {
+        return isset($this->recordsByLevel[Logger::DEBUG]);
+    }
+
+    protected function hasRecord($record, $level)
+    {
+        if (!isset($this->recordsByLevel[$level])) {
+            return false;
+        }
+
+        if (is_array($record)) {
+            $record = $record['message'];
+        }
+
+        foreach ($this->recordsByLevel[$level] as $rec) {
+            if ($rec['message'] === $record) {
+                return true;
+            }
+        }
+
+        return false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $this->recordsByLevel[$record['level']][] = $record;
+        $this->records[] = $record;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php
new file mode 100644
index 00000000..05a88173
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php
@@ -0,0 +1,57 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Forwards records to multiple handlers suppressing failures of each handler
+ * and continuing through to give every handler a chance to succeed.
+ *
+ * @author Craig D'Amelio <craig@damelio.ca>
+ */
+class WhatFailureGroupHandler extends GroupHandler
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($this->processors) {
+            foreach ($this->processors as $processor) {
+                $record = call_user_func($processor, $record);
+            }
+        }
+
+        foreach ($this->handlers as $handler) {
+            try {
+                $handler->handle($record);
+            } catch (\Exception $e) {
+                // What failure?
+            }
+        }
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        foreach ($this->handlers as $handler) {
+            try {
+                $handler->handleBatch($records);
+            } catch (\Exception $e) {
+                // What failure?
+            }
+        }
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php
new file mode 100644
index 00000000..f22cf218
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php
@@ -0,0 +1,95 @@
+<?php
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\NormalizerFormatter;
+use Monolog\Logger;
+
+/**
+ * Handler sending logs to Zend Monitor
+ *
+ * @author  Christian Bergau <cbergau86@gmail.com>
+ */
+class ZendMonitorHandler extends AbstractProcessingHandler
+{
+    /**
+     * Monolog level / ZendMonitor Custom Event priority map
+     *
+     * @var array
+     */
+    protected $levelMap = array(
+        Logger::DEBUG     => 1,
+        Logger::INFO      => 2,
+        Logger::NOTICE    => 3,
+        Logger::WARNING   => 4,
+        Logger::ERROR     => 5,
+        Logger::CRITICAL  => 6,
+        Logger::ALERT     => 7,
+        Logger::EMERGENCY => 0,
+    );
+
+    /**
+     * Construct
+     *
+     * @param  int                       $level
+     * @param  bool                      $bubble
+     * @throws MissingExtensionException
+     */
+    public function __construct($level = Logger::DEBUG, $bubble = true)
+    {
+        if (!function_exists('zend_monitor_custom_event')) {
+            throw new MissingExtensionException('You must have Zend Server installed in order to use this handler');
+        }
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $this->writeZendMonitorCustomEvent(
+            $this->levelMap[$record['level']],
+            $record['message'],
+            $record['formatted']
+        );
+    }
+
+    /**
+     * Write a record to Zend Monitor
+     *
+     * @param int    $level
+     * @param string $message
+     * @param array  $formatted
+     */
+    protected function writeZendMonitorCustomEvent($level, $message, $formatted)
+    {
+        zend_monitor_custom_event($level, $message, $formatted);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getDefaultFormatter()
+    {
+        return new NormalizerFormatter();
+    }
+
+    /**
+     * Get the level map
+     *
+     * @return array
+     */
+    public function getLevelMap()
+    {
+        return $this->levelMap;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Logger.php b/vendor/monolog/monolog/src/Monolog/Logger.php
new file mode 100644
index 00000000..4a38de7f
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Logger.php
@@ -0,0 +1,615 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\HandlerInterface;
+use Monolog\Handler\StreamHandler;
+use Psr\Log\LoggerInterface;
+use Psr\Log\InvalidArgumentException;
+
+/**
+ * Monolog log channel
+ *
+ * It contains a stack of Handlers and a stack of Processors,
+ * and uses them to store records that are added to it.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class Logger implements LoggerInterface
+{
+    /**
+     * Detailed debug information
+     */
+    const DEBUG = 100;
+
+    /**
+     * Interesting events
+     *
+     * Examples: User logs in, SQL logs.
+     */
+    const INFO = 200;
+
+    /**
+     * Uncommon events
+     */
+    const NOTICE = 250;
+
+    /**
+     * Exceptional occurrences that are not errors
+     *
+     * Examples: Use of deprecated APIs, poor use of an API,
+     * undesirable things that are not necessarily wrong.
+     */
+    const WARNING = 300;
+
+    /**
+     * Runtime errors
+     */
+    const ERROR = 400;
+
+    /**
+     * Critical conditions
+     *
+     * Example: Application component unavailable, unexpected exception.
+     */
+    const CRITICAL = 500;
+
+    /**
+     * Action must be taken immediately
+     *
+     * Example: Entire website down, database unavailable, etc.
+     * This should trigger the SMS alerts and wake you up.
+     */
+    const ALERT = 550;
+
+    /**
+     * Urgent alert.
+     */
+    const EMERGENCY = 600;
+
+    /**
+     * Monolog API version
+     *
+     * This is only bumped when API breaks are done and should
+     * follow the major version of the library
+     *
+     * @var int
+     */
+    const API = 1;
+
+    /**
+     * Logging levels from syslog protocol defined in RFC 5424
+     *
+     * @var array $levels Logging levels
+     */
+    protected static $levels = array(
+        100 => 'DEBUG',
+        200 => 'INFO',
+        250 => 'NOTICE',
+        300 => 'WARNING',
+        400 => 'ERROR',
+        500 => 'CRITICAL',
+        550 => 'ALERT',
+        600 => 'EMERGENCY',
+    );
+
+    /**
+     * @var \DateTimeZone
+     */
+    protected static $timezone;
+
+    /**
+     * @var string
+     */
+    protected $name;
+
+    /**
+     * The handler stack
+     *
+     * @var HandlerInterface[]
+     */
+    protected $handlers;
+
+    /**
+     * Processors that will process all log records
+     *
+     * To process records of a single handler instead, add the processor on that specific handler
+     *
+     * @var callable[]
+     */
+    protected $processors;
+
+    /**
+     * @param string             $name       The logging channel
+     * @param HandlerInterface[] $handlers   Optional stack of handlers, the first one in the array is called first, etc.
+     * @param callable[]         $processors Optional array of processors
+     */
+    public function __construct($name, array $handlers = array(), array $processors = array())
+    {
+        $this->name = $name;
+        $this->handlers = $handlers;
+        $this->processors = $processors;
+    }
+
+    /**
+     * @return string
+     */
+    public function getName()
+    {
+        return $this->name;
+    }
+
+    /**
+     * Pushes a handler on to the stack.
+     *
+     * @param HandlerInterface $handler
+     */
+    public function pushHandler(HandlerInterface $handler)
+    {
+        array_unshift($this->handlers, $handler);
+    }
+
+    /**
+     * Pops a handler from the stack
+     *
+     * @return HandlerInterface
+     */
+    public function popHandler()
+    {
+        if (!$this->handlers) {
+            throw new \LogicException('You tried to pop from an empty handler stack.');
+        }
+
+        return array_shift($this->handlers);
+    }
+
+    /**
+     * @return HandlerInterface[]
+     */
+    public function getHandlers()
+    {
+        return $this->handlers;
+    }
+
+    /**
+     * Adds a processor on to the stack.
+     *
+     * @param callable $callback
+     */
+    public function pushProcessor($callback)
+    {
+        if (!is_callable($callback)) {
+            throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given');
+        }
+        array_unshift($this->processors, $callback);
+    }
+
+    /**
+     * Removes the processor on top of the stack and returns it.
+     *
+     * @return callable
+     */
+    public function popProcessor()
+    {
+        if (!$this->processors) {
+            throw new \LogicException('You tried to pop from an empty processor stack.');
+        }
+
+        return array_shift($this->processors);
+    }
+
+    /**
+     * @return callable[]
+     */
+    public function getProcessors()
+    {
+        return $this->processors;
+    }
+
+    /**
+     * Adds a log record.
+     *
+     * @param  integer $level   The logging level
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addRecord($level, $message, array $context = array())
+    {
+        if (!$this->handlers) {
+            $this->pushHandler(new StreamHandler('php://stderr', static::DEBUG));
+        }
+
+        $levelName = static::getLevelName($level);
+
+        // check if any handler will handle this message so we can return early and save cycles
+        $handlerKey = null;
+        foreach ($this->handlers as $key => $handler) {
+            if ($handler->isHandling(array('level' => $level))) {
+                $handlerKey = $key;
+                break;
+            }
+        }
+
+        if (null === $handlerKey) {
+            return false;
+        }
+
+        if (!static::$timezone) {
+            static::$timezone = new \DateTimeZone(date_default_timezone_get() ?: 'UTC');
+        }
+
+        $record = array(
+            'message' => (string) $message,
+            'context' => $context,
+            'level' => $level,
+            'level_name' => $levelName,
+            'channel' => $this->name,
+            'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true)), static::$timezone)->setTimezone(static::$timezone),
+            'extra' => array(),
+        );
+
+        foreach ($this->processors as $processor) {
+            $record = call_user_func($processor, $record);
+        }
+        while (isset($this->handlers[$handlerKey]) &&
+            false === $this->handlers[$handlerKey]->handle($record)) {
+            $handlerKey++;
+        }
+
+        return true;
+    }
+
+    /**
+     * Adds a log record at the DEBUG level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addDebug($message, array $context = array())
+    {
+        return $this->addRecord(static::DEBUG, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the INFO level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addInfo($message, array $context = array())
+    {
+        return $this->addRecord(static::INFO, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the NOTICE level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addNotice($message, array $context = array())
+    {
+        return $this->addRecord(static::NOTICE, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the WARNING level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addWarning($message, array $context = array())
+    {
+        return $this->addRecord(static::WARNING, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the ERROR level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addError($message, array $context = array())
+    {
+        return $this->addRecord(static::ERROR, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the CRITICAL level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addCritical($message, array $context = array())
+    {
+        return $this->addRecord(static::CRITICAL, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the ALERT level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addAlert($message, array $context = array())
+    {
+        return $this->addRecord(static::ALERT, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the EMERGENCY level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addEmergency($message, array $context = array())
+    {
+        return $this->addRecord(static::EMERGENCY, $message, $context);
+    }
+
+    /**
+     * Gets all supported logging levels.
+     *
+     * @return array Assoc array with human-readable level names => level codes.
+     */
+    public static function getLevels()
+    {
+        return array_flip(static::$levels);
+    }
+
+    /**
+     * Gets the name of the logging level.
+     *
+     * @param  integer $level
+     * @return string
+     */
+    public static function getLevelName($level)
+    {
+        if (!isset(static::$levels[$level])) {
+            throw new InvalidArgumentException('Level "'.$level.'" is not defined, use one of: '.implode(', ', array_keys(static::$levels)));
+        }
+
+        return static::$levels[$level];
+    }
+
+    /**
+     * Converts PSR-3 levels to Monolog ones if necessary
+     *
+     * @param string|int Level number (monolog) or name (PSR-3)
+     * @return int
+     */
+    public static function toMonologLevel($level)
+    {
+        if (is_string($level) && defined(__CLASS__.'::'.strtoupper($level))) {
+            return constant(__CLASS__.'::'.strtoupper($level));
+        }
+
+        return $level;
+    }
+
+    /**
+     * Checks whether the Logger has a handler that listens on the given level
+     *
+     * @param  integer $level
+     * @return Boolean
+     */
+    public function isHandling($level)
+    {
+        $record = array(
+            'level' => $level,
+        );
+
+        foreach ($this->handlers as $handler) {
+            if ($handler->isHandling($record)) {
+                return true;
+            }
+        }
+
+        return false;
+    }
+
+    /**
+     * Adds a log record at an arbitrary level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  mixed   $level   The log level
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function log($level, $message, array $context = array())
+    {
+        if (is_string($level) && defined(__CLASS__.'::'.strtoupper($level))) {
+            $level = constant(__CLASS__.'::'.strtoupper($level));
+        }
+
+        return $this->addRecord($level, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the DEBUG level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function debug($message, array $context = array())
+    {
+        return $this->addRecord(static::DEBUG, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the INFO level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function info($message, array $context = array())
+    {
+        return $this->addRecord(static::INFO, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the NOTICE level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function notice($message, array $context = array())
+    {
+        return $this->addRecord(static::NOTICE, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the WARNING level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function warn($message, array $context = array())
+    {
+        return $this->addRecord(static::WARNING, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the WARNING level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function warning($message, array $context = array())
+    {
+        return $this->addRecord(static::WARNING, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the ERROR level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function err($message, array $context = array())
+    {
+        return $this->addRecord(static::ERROR, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the ERROR level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function error($message, array $context = array())
+    {
+        return $this->addRecord(static::ERROR, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the CRITICAL level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function crit($message, array $context = array())
+    {
+        return $this->addRecord(static::CRITICAL, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the CRITICAL level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function critical($message, array $context = array())
+    {
+        return $this->addRecord(static::CRITICAL, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the ALERT level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function alert($message, array $context = array())
+    {
+        return $this->addRecord(static::ALERT, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the EMERGENCY level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function emerg($message, array $context = array())
+    {
+        return $this->addRecord(static::EMERGENCY, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the EMERGENCY level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function emergency($message, array $context = array())
+    {
+        return $this->addRecord(static::EMERGENCY, $message, $context);
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php
new file mode 100644
index 00000000..1899400d
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php
@@ -0,0 +1,64 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\Logger;
+
+/**
+ * Injects Git branch and Git commit SHA in all records
+ *
+ * @author Nick Otter
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class GitProcessor
+{
+    private $level;
+    private static $cache;
+
+    public function __construct($level = Logger::DEBUG)
+    {
+        $this->level = Logger::toMonologLevel($level);
+    }
+
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        // return if the level is not high enough
+        if ($record['level'] < $this->level) {
+            return $record;
+        }
+
+        $record['extra']['git'] = self::getGitInfo();
+
+        return $record;
+    }
+
+    private static function getGitInfo()
+    {
+        if (self::$cache) {
+            return self::$cache;
+        }
+
+        $branches = `git branch -v --no-abbrev`;
+        if (preg_match('{^\* (.+?)\s+([a-f0-9]{40})(?:\s|$)}m', $branches, $matches)) {
+            return self::$cache = array(
+                'branch' => $matches[1],
+                'commit' => $matches[2],
+            );
+        }
+
+        return self::$cache = array();
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php
new file mode 100644
index 00000000..294a295c
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php
@@ -0,0 +1,82 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\Logger;
+
+/**
+ * Injects line/file:class/function where the log message came from
+ *
+ * Warning: This only works if the handler processes the logs directly.
+ * If you put the processor on a handler that is behind a FingersCrossedHandler
+ * for example, the processor will only be called once the trigger level is reached,
+ * and all the log records will have the same file/line/.. data from the call that
+ * triggered the FingersCrossedHandler.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class IntrospectionProcessor
+{
+    private $level;
+
+    private $skipClassesPartials;
+
+    public function __construct($level = Logger::DEBUG, array $skipClassesPartials = array('Monolog\\'))
+    {
+        $this->level = Logger::toMonologLevel($level);
+        $this->skipClassesPartials = $skipClassesPartials;
+    }
+
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        // return if the level is not high enough
+        if ($record['level'] < $this->level) {
+            return $record;
+        }
+
+        $trace = debug_backtrace();
+
+        // skip first since it's always the current method
+        array_shift($trace);
+        // the call_user_func call is also skipped
+        array_shift($trace);
+
+        $i = 0;
+
+        while (isset($trace[$i]['class'])) {
+            foreach ($this->skipClassesPartials as $part) {
+                if (strpos($trace[$i]['class'], $part) !== false) {
+                    $i++;
+                    continue 2;
+                }
+            }
+            break;
+        }
+
+        // we should have the call source now
+        $record['extra'] = array_merge(
+            $record['extra'],
+            array(
+                'file'      => isset($trace[$i-1]['file']) ? $trace[$i-1]['file'] : null,
+                'line'      => isset($trace[$i-1]['line']) ? $trace[$i-1]['line'] : null,
+                'class'     => isset($trace[$i]['class']) ? $trace[$i]['class'] : null,
+                'function'  => isset($trace[$i]['function']) ? $trace[$i]['function'] : null,
+            )
+        );
+
+        return $record;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php
new file mode 100644
index 00000000..552fd709
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php
@@ -0,0 +1,40 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects memory_get_peak_usage in all records
+ *
+ * @see Monolog\Processor\MemoryProcessor::__construct() for options
+ * @author Rob Jensen
+ */
+class MemoryPeakUsageProcessor extends MemoryProcessor
+{
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        $bytes = memory_get_peak_usage($this->realUsage);
+        $formatted = $this->formatBytes($bytes);
+
+        $record['extra'] = array_merge(
+            $record['extra'],
+            array(
+                'memory_peak_usage' => $formatted,
+            )
+        );
+
+        return $record;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php
new file mode 100644
index 00000000..0820def4
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php
@@ -0,0 +1,63 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Some methods that are common for all memory processors
+ *
+ * @author Rob Jensen
+ */
+abstract class MemoryProcessor
+{
+    /**
+     * @var boolean If true, get the real size of memory allocated from system. Else, only the memory used by emalloc() is reported.
+     */
+    protected $realUsage;
+
+    /**
+     * @var boolean If true, then format memory size to human readable string (MB, KB, B depending on size)
+     */
+    protected $useFormatting;
+
+    /**
+     * @param boolean $realUsage     Set this to true to get the real size of memory allocated from system.
+     * @param boolean $useFormatting If true, then format memory size to human readable string (MB, KB, B depending on size)
+     */
+    public function __construct($realUsage = true, $useFormatting = true)
+    {
+        $this->realUsage = (boolean) $realUsage;
+        $this->useFormatting = (boolean) $useFormatting;
+    }
+
+    /**
+     * Formats bytes into a human readable string if $this->useFormatting is true, otherwise return $bytes as is
+     *
+     * @param  int        $bytes
+     * @return string|int Formatted string if $this->useFormatting is true, otherwise return $bytes as is
+     */
+    protected function formatBytes($bytes)
+    {
+        $bytes = (int) $bytes;
+
+        if (!$this->useFormatting) {
+            return $bytes;
+        }
+
+        if ($bytes > 1024*1024) {
+            return round($bytes/1024/1024, 2).' MB';
+        } elseif ($bytes > 1024) {
+            return round($bytes/1024, 2).' KB';
+        }
+
+        return $bytes . ' B';
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php
new file mode 100644
index 00000000..0c4dd9ab
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php
@@ -0,0 +1,40 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects memory_get_usage in all records
+ *
+ * @see Monolog\Processor\MemoryProcessor::__construct() for options
+ * @author Rob Jensen
+ */
+class MemoryUsageProcessor extends MemoryProcessor
+{
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        $bytes = memory_get_usage($this->realUsage);
+        $formatted = $this->formatBytes($bytes);
+
+        $record['extra'] = array_merge(
+            $record['extra'],
+            array(
+                'memory_usage' => $formatted,
+            )
+        );
+
+        return $record;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php
new file mode 100644
index 00000000..9d3f5590
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php
@@ -0,0 +1,31 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Adds value of getmypid into records
+ *
+ * @author Andreas Hörnicke
+ */
+class ProcessIdProcessor
+{
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        $record['extra']['process_id'] = getmypid();
+
+        return $record;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php
new file mode 100644
index 00000000..c2686ce5
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php
@@ -0,0 +1,48 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Processes a record's message according to PSR-3 rules
+ *
+ * It replaces {foo} with the value from $context['foo']
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class PsrLogMessageProcessor
+{
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        if (false === strpos($record['message'], '{')) {
+            return $record;
+        }
+
+        $replacements = array();
+        foreach ($record['context'] as $key => $val) {
+            if (is_null($val) || is_scalar($val) || (is_object($val) && method_exists($val, "__toString"))) {
+                $replacements['{'.$key.'}'] = $val;
+            } elseif (is_object($val)) {
+                $replacements['{'.$key.'}'] = '[object '.get_class($val).']';
+            } else {
+                $replacements['{'.$key.'}'] = '['.gettype($val).']';
+            }
+        }
+
+        $record['message'] = strtr($record['message'], $replacements);
+
+        return $record;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php
new file mode 100644
index 00000000..2784cef4
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php
@@ -0,0 +1,34 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Adds a tags array into record
+ *
+ * @author Martijn Riemers
+ */
+class TagProcessor
+{
+    private $tags;
+
+    public function __construct(array $tags = array())
+    {
+        $this->tags = $tags;
+    }
+
+    public function __invoke(array $record)
+    {
+        $record['extra']['tags'] = $this->tags;
+
+        return $record;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php
new file mode 100644
index 00000000..80270d08
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php
@@ -0,0 +1,38 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Adds a unique identifier into records
+ *
+ * @author Simon Mönch <sm@webfactory.de>
+ */
+class UidProcessor
+{
+    private $uid;
+
+    public function __construct($length = 7)
+    {
+        if (!is_int($length) || $length > 32 || $length < 1) {
+            throw new \InvalidArgumentException('The uid length must be an integer between 1 and 32');
+        }
+
+        $this->uid = substr(hash('md5', uniqid('', true)), 0, $length);
+    }
+
+    public function __invoke(array $record)
+    {
+        $record['extra']['uid'] = $this->uid;
+
+        return $record;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php
new file mode 100644
index 00000000..21f22a6e
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php
@@ -0,0 +1,105 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects url/method and remote IP of the current web request in all records
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class WebProcessor
+{
+    /**
+     * @var array|\ArrayAccess
+     */
+    protected $serverData;
+
+    /**
+     * @var array
+     */
+    protected $extraFields = array(
+        'url'         => 'REQUEST_URI',
+        'ip'          => 'REMOTE_ADDR',
+        'http_method' => 'REQUEST_METHOD',
+        'server'      => 'SERVER_NAME',
+        'referrer'    => 'HTTP_REFERER',
+    );
+
+    /**
+     * @param array|\ArrayAccess $serverData  Array or object w/ ArrayAccess that provides access to the $_SERVER data
+     * @param array|null         $extraFields Extra field names to be added (all available by default)
+     */
+    public function __construct($serverData = null, array $extraFields = null)
+    {
+        if (null === $serverData) {
+            $this->serverData = &$_SERVER;
+        } elseif (is_array($serverData) || $serverData instanceof \ArrayAccess) {
+            $this->serverData = $serverData;
+        } else {
+            throw new \UnexpectedValueException('$serverData must be an array or object implementing ArrayAccess.');
+        }
+
+        if (null !== $extraFields) {
+            foreach (array_keys($this->extraFields) as $fieldName) {
+                if (!in_array($fieldName, $extraFields)) {
+                    unset($this->extraFields[$fieldName]);
+                }
+            }
+        }
+    }
+
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        // skip processing if for some reason request data
+        // is not present (CLI or wonky SAPIs)
+        if (!isset($this->serverData['REQUEST_URI'])) {
+            return $record;
+        }
+
+        $record['extra'] = $this->appendExtraFields($record['extra']);
+
+        return $record;
+    }
+
+    /**
+     * @param  string $extraName
+     * @param  string $serverName
+     * @return $this
+     */
+    public function addExtraField($extraName, $serverName)
+    {
+        $this->extraFields[$extraName] = $serverName;
+
+        return $this;
+    }
+
+    /**
+     * @param  array $extra
+     * @return array
+     */
+    private function appendExtraFields(array $extra)
+    {
+        foreach ($this->extraFields as $extraName => $serverName) {
+            $extra[$extraName] = isset($this->serverData[$serverName]) ? $this->serverData[$serverName] : null;
+        }
+
+        if (isset($this->serverData['UNIQUE_ID'])) {
+            $extra['unique_id'] = $this->serverData['UNIQUE_ID'];
+        }
+
+        return $extra;
+    }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Registry.php b/vendor/monolog/monolog/src/Monolog/Registry.php
new file mode 100644
index 00000000..a3eba079
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Registry.php
@@ -0,0 +1,118 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use InvalidArgumentException;
+
+/**
+ * Monolog log registry
+ *
+ * Allows to get `Logger` instances in the global scope
+ * via static method calls on this class.
+ *
+ * <code>
+ * $application = new Monolog\Logger('application');
+ * $api = new Monolog\Logger('api');
+ *
+ * Monolog\Registry::addLogger($application);
+ * Monolog\Registry::addLogger($api);
+ *
+ * function testLogger()
+ * {
+ *     Monolog\Registry::api()->addError('Sent to $api Logger instance');
+ *     Monolog\Registry::application()->addError('Sent to $application Logger instance');
+ * }
+ * </code>
+ *
+ * @author Tomas Tatarko <tomas@tatarko.sk>
+ */
+class Registry
+{
+    /**
+     * List of all loggers in the registry (ba named indexes)
+     *
+     * @var Logger[]
+     */
+    private static $loggers = array();
+
+    /**
+     * Adds new logging channel to the registry
+     *
+     * @param  Logger                    $logger    Instance of the logging channel
+     * @param  string|null               $name      Name of the logging channel ($logger->getName() by default)
+     * @param  boolean                   $overwrite Overwrite instance in the registry if the given name already exists?
+     * @throws \InvalidArgumentException If $overwrite set to false and named Logger instance already exists
+     */
+    public static function addLogger(Logger $logger, $name = null, $overwrite = false)
+    {
+        $name = $name ?: $logger->getName();
+
+        if (isset(self::$loggers[$name]) && !$overwrite) {
+            throw new InvalidArgumentException('Logger with the given name already exists');
+        }
+
+        self::$loggers[$name] = $logger;
+    }
+
+    /**
+     * Removes instance from registry by name or instance
+     *
+     * @param string|Logger $logger Name or logger instance
+     */
+    public static function removeLogger($logger)
+    {
+        if ($logger instanceof Logger) {
+            if (false !== ($idx = array_search($logger, self::$loggers, true))) {
+                unset(self::$loggers[$idx]);
+            }
+        } else {
+            unset(self::$loggers[$logger]);
+        }
+    }
+
+    /**
+     * Clears the registry
+     */
+    public static function clear()
+    {
+        self::$loggers = array();
+    }
+
+    /**
+     * Gets Logger instance from the registry
+     *
+     * @param  string                    $name Name of the requested Logger instance
+     * @return Logger                    Requested instance of Logger
+     * @throws \InvalidArgumentException If named Logger instance is not in the registry
+     */
+    public static function getInstance($name)
+    {
+        if (!isset(self::$loggers[$name])) {
+            throw new InvalidArgumentException(sprintf('Requested "%s" logger instance is not in the registry', $name));
+        }
+
+        return self::$loggers[$name];
+    }
+
+    /**
+     * Gets Logger instance from the registry via static method call
+     *
+     * @param  string                    $name      Name of the requested Logger instance
+     * @param  array                     $arguments Arguments passed to static method call
+     * @return Logger                    Requested instance of Logger
+     * @throws \InvalidArgumentException If named Logger instance is not in the registry
+     */
+    public static function __callStatic($name, $arguments)
+    {
+        return self::getInstance($name);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php
new file mode 100644
index 00000000..a9a3f301
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php
@@ -0,0 +1,31 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\TestHandler;
+
+class ErrorHandlerTest extends \PHPUnit_Framework_TestCase
+{
+    public function testHandleError()
+    {
+        $logger = new Logger('test', array($handler = new TestHandler));
+        $errHandler = new ErrorHandler($logger);
+
+        $errHandler->registerErrorHandler(array(E_USER_NOTICE => Logger::EMERGENCY), false);
+        trigger_error('Foo', E_USER_ERROR);
+        $this->assertCount(1, $handler->getRecords());
+        $this->assertTrue($handler->hasErrorRecords());
+        trigger_error('Foo', E_USER_NOTICE);
+        $this->assertCount(2, $handler->getRecords());
+        $this->assertTrue($handler->hasEmergencyRecords());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php
new file mode 100644
index 00000000..e7f7334e
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php
@@ -0,0 +1,158 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class ChromePHPFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::format
+     */
+    public function testDefaultFormat()
+    {
+        $formatter = new ChromePHPFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1'),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'meh',
+                array(
+                    'message' => 'log',
+                    'context' => array('from' => 'logger'),
+                    'extra' => array('ip' => '127.0.0.1'),
+                ),
+                'unknown',
+                'error'
+            ),
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $formatter = new ChromePHPFormatter();
+        $record = array(
+            'level' => Logger::CRITICAL,
+            'level_name' => 'CRITICAL',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'meh',
+                array(
+                    'message' => 'log',
+                    'context' => array('from' => 'logger'),
+                    'extra' => array('ip' => '127.0.0.1'),
+                ),
+                'test : 14',
+                'error'
+            ),
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::format
+     */
+    public function testFormatWithoutContext()
+    {
+        $formatter = new ChromePHPFormatter();
+        $record = array(
+            'level' => Logger::DEBUG,
+            'level_name' => 'DEBUG',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'meh',
+                'log',
+                'unknown',
+                'log'
+            ),
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::formatBatch
+     */
+    public function testBatchFormatThrowException()
+    {
+        $formatter = new ChromePHPFormatter();
+        $records = array(
+            array(
+                'level' => Logger::INFO,
+                'level_name' => 'INFO',
+                'channel' => 'meh',
+                'context' => array(),
+                'datetime' => new \DateTime("@0"),
+                'extra' => array(),
+                'message' => 'log',
+            ),
+            array(
+                'level' => Logger::WARNING,
+                'level_name' => 'WARNING',
+                'channel' => 'foo',
+                'context' => array(),
+                'datetime' => new \DateTime("@0"),
+                'extra' => array(),
+                'message' => 'log2',
+            ),
+        );
+
+        $this->assertEquals(
+            array(
+                array(
+                    'meh',
+                    'log',
+                    'unknown',
+                    'info'
+                ),
+                array(
+                    'foo',
+                    'log2',
+                    'unknown',
+                    'warn'
+                ),
+            ),
+            $formatter->formatBatch($records)
+        );
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php
new file mode 100644
index 00000000..546e5c26
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php
@@ -0,0 +1,79 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class ElasticaFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists("Elastica\Document")) {
+            $this->markTestSkipped("ruflin/elastica not installed");
+        }
+    }
+
+    /**
+     * @covers Monolog\Formatter\ElasticaFormatter::__construct
+     * @covers Monolog\Formatter\ElasticaFormatter::format
+     * @covers Monolog\Formatter\ElasticaFormatter::getDocument
+     */
+    public function testFormat()
+    {
+        // test log message
+        $msg = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        // expected values
+        $expected = $msg;
+        $expected['datetime'] = '1970-01-01T00:00:00+0000';
+        $expected['context'] = array(
+            'class' => '[object] (stdClass: {})',
+            'foo' => 7,
+            0 => 'bar',
+        );
+
+        // format log message
+        $formatter = new ElasticaFormatter('my_index', 'doc_type');
+        $doc = $formatter->format($msg);
+        $this->assertInstanceOf('Elastica\Document', $doc);
+
+        // Document parameters
+        $params = $doc->getParams();
+        $this->assertEquals('my_index', $params['_index']);
+        $this->assertEquals('doc_type', $params['_type']);
+
+        // Document data values
+        $data = $doc->getData();
+        foreach (array_keys($expected) as $key) {
+            $this->assertEquals($expected[$key], $data[$key]);
+        }
+    }
+
+    /**
+     * @covers Monolog\Formatter\ElasticaFormatter::getIndex
+     * @covers Monolog\Formatter\ElasticaFormatter::getType
+     */
+    public function testGetters()
+    {
+        $formatter = new ElasticaFormatter('my_index', 'doc_type');
+        $this->assertEquals('my_index', $formatter->getIndex());
+        $this->assertEquals('doc_type', $formatter->getType());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php
new file mode 100644
index 00000000..1b2fd97a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php
@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class FlowdockFormatterTest extends TestCase
+{
+    /**
+     * @covers Monolog\Formatter\FlowdockFormatter::format
+     */
+    public function testFormat()
+    {
+        $formatter = new FlowdockFormatter('test_source', 'source@test.com');
+        $record = $this->getRecord();
+
+        $expected = array(
+            'source' => 'test_source',
+            'from_address' => 'source@test.com',
+            'subject' => 'in test_source: WARNING - test',
+            'content' => 'test',
+            'tags' => array('#logs', '#warning', '#test'),
+            'project' => 'test_source',
+        );
+        $formatted = $formatter->format($record);
+
+        $this->assertEquals($expected, $formatted['flowdock']);
+    }
+
+    /**
+     * @ covers Monolog\Formatter\FlowdockFormatter::formatBatch
+     */
+    public function testFormatBatch()
+    {
+        $formatter = new FlowdockFormatter('test_source', 'source@test.com');
+        $records = array(
+            $this->getRecord(Logger::WARNING),
+            $this->getRecord(Logger::DEBUG),
+        );
+        $formatted = $formatter->formatBatch($records);
+
+        $this->assertArrayHasKey('flowdock', $formatted[0]);
+        $this->assertArrayHasKey('flowdock', $formatted[1]);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php
new file mode 100644
index 00000000..3f47a09a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php
@@ -0,0 +1,189 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class GelfMessageFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists('\Gelf\Message')) {
+            $this->markTestSkipped("graylog2/gelf-php or mlehner/gelf-php is not installed");
+        }
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testDefaultFormatter()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+        $this->assertEquals(0, $message->getTimestamp());
+        $this->assertEquals('log', $message->getShortMessage());
+        $this->assertEquals('meh', $message->getFacility());
+        $this->assertEquals(null, $message->getLine());
+        $this->assertEquals(null, $message->getFile());
+        $this->assertEquals($this->isLegacy() ? 3 : 'error', $message->getLevel());
+        $this->assertNotEmpty($message->getHost());
+
+        $formatter = new GelfMessageFormatter('mysystem');
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+        $this->assertEquals('mysystem', $message->getHost());
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+        $this->assertEquals('test', $message->getFile());
+        $this->assertEquals(14, $message->getLine());
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithContext()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_ctxt_from', $message_array);
+        $this->assertEquals('logger', $message_array['_ctxt_from']);
+
+        // Test with extraPrefix
+        $formatter = new GelfMessageFormatter(null, null, 'CTX');
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_CTXfrom', $message_array);
+        $this->assertEquals('logger', $message_array['_CTXfrom']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithContextContainingException()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger', 'exception' => array(
+                'class' => '\Exception',
+                'file'  => '/some/file/in/dir.php:56',
+                'trace' => array('/some/file/1.php:23', '/some/file/2.php:3')
+            )),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log'
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $this->assertEquals("/some/file/in/dir.php", $message->getFile());
+        $this->assertEquals("56", $message->getLine());
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithExtra()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_key', $message_array);
+        $this->assertEquals('pair', $message_array['_key']);
+
+        // Test with extraPrefix
+        $formatter = new GelfMessageFormatter(null, 'EXT');
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_EXTkey', $message_array);
+        $this->assertEquals('pair', $message_array['_EXTkey']);
+    }
+
+    private function isLegacy()
+    {
+        return interface_exists('\Gelf\IMessagePublisher');
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php
new file mode 100644
index 00000000..69e20077
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php
@@ -0,0 +1,78 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class JsonFormatterTest extends TestCase
+{
+    /**
+     * @covers Monolog\Formatter\JsonFormatter::__construct
+     * @covers Monolog\Formatter\JsonFormatter::getBatchMode
+     * @covers Monolog\Formatter\JsonFormatter::isAppendingNewlines
+     */
+    public function testConstruct()
+    {
+        $formatter = new JsonFormatter();
+        $this->assertEquals(JsonFormatter::BATCH_MODE_JSON, $formatter->getBatchMode());
+        $this->assertEquals(true, $formatter->isAppendingNewlines());
+        $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES, false);
+        $this->assertEquals(JsonFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode());
+        $this->assertEquals(false, $formatter->isAppendingNewlines());
+    }
+
+    /**
+     * @covers Monolog\Formatter\JsonFormatter::format
+     */
+    public function testFormat()
+    {
+        $formatter = new JsonFormatter();
+        $record = $this->getRecord();
+        $this->assertEquals(json_encode($record)."\n", $formatter->format($record));
+
+        $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false);
+        $record = $this->getRecord();
+        $this->assertEquals(json_encode($record), $formatter->format($record));
+    }
+
+    /**
+     * @covers Monolog\Formatter\JsonFormatter::formatBatch
+     * @covers Monolog\Formatter\JsonFormatter::formatBatchJson
+     */
+    public function testFormatBatch()
+    {
+        $formatter = new JsonFormatter();
+        $records = array(
+            $this->getRecord(Logger::WARNING),
+            $this->getRecord(Logger::DEBUG),
+        );
+        $this->assertEquals(json_encode($records), $formatter->formatBatch($records));
+    }
+
+    /**
+     * @covers Monolog\Formatter\JsonFormatter::formatBatch
+     * @covers Monolog\Formatter\JsonFormatter::formatBatchNewlines
+     */
+    public function testFormatBatchNewlines()
+    {
+        $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES);
+        $records = $expected = array(
+            $this->getRecord(Logger::WARNING),
+            $this->getRecord(Logger::DEBUG),
+        );
+        array_walk($expected, function (&$value, $key) {
+            $value = json_encode($value);
+        });
+        $this->assertEquals(implode("\n", $expected), $formatter->formatBatch($records));
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php
new file mode 100644
index 00000000..89e1ca2e
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php
@@ -0,0 +1,208 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\LineFormatter
+ */
+class LineFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function testDefFormatWithString()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'WARNING',
+            'channel' => 'log',
+            'context' => array(),
+            'message' => 'foo',
+            'datetime' => new \DateTime,
+            'extra' => array(),
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
+    }
+
+    public function testDefFormatWithArrayContext()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'message' => 'foo',
+            'datetime' => new \DateTime,
+            'extra' => array(),
+            'context' => array(
+                'foo' => 'bar',
+                'baz' => 'qux',
+                'bool' => false,
+                'null' => null,
+            )
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foo {"foo":"bar","baz":"qux","bool":false,"null":null} []'."\n", $message);
+    }
+
+    public function testDefFormatExtras()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array('ip' => '127.0.0.1'),
+            'message' => 'log',
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] {"ip":"127.0.0.1"}'."\n", $message);
+    }
+
+    public function testFormatExtras()
+    {
+        $formatter = new LineFormatter("[%datetime%] %channel%.%level_name%: %message% %context% %extra.file% %extra%\n", 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array('ip' => '127.0.0.1', 'file' => 'test'),
+            'message' => 'log',
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] test {"ip":"127.0.0.1"}'."\n", $message);
+    }
+
+    public function testContextAndExtraOptionallyNotShownIfEmpty()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d', false, true);
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array(),
+            'message' => 'log',
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log  '."\n", $message);
+    }
+
+    public function testDefFormatWithObject()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array('foo' => new TestFoo, 'bar' => new TestBar, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+            'message' => 'foobar',
+        ));
+
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foobar [] {"foo":"[object] (Monolog\\\\Formatter\\\\TestFoo: {\\"foo\\":\\"foo\\"})","bar":"[object] (Monolog\\\\Formatter\\\\TestBar: {})","baz":[],"res":"[resource]"}'."\n", $message);
+    }
+
+    public function testDefFormatWithException()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'CRITICAL',
+            'channel' => 'core',
+            'context' => array('exception' => new \RuntimeException('Foo')),
+            'datetime' => new \DateTime,
+            'extra' => array(),
+            'message' => 'foobar',
+        ));
+
+        $path = str_replace('\\/', '/', json_encode(__FILE__));
+
+        $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__-8).')"} []'."\n", $message);
+    }
+
+    public function testDefFormatWithPreviousException()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $previous = new \LogicException('Wut?');
+        $message = $formatter->format(array(
+            'level_name' => 'CRITICAL',
+            'channel' => 'core',
+            'context' => array('exception' => new \RuntimeException('Foo', 0, $previous)),
+            'datetime' => new \DateTime,
+            'extra' => array(),
+            'message' => 'foobar',
+        ));
+
+        $path = str_replace('\\/', '/', json_encode(__FILE__));
+
+        $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__-8).', LogicException(code: 0): Wut? at '.substr($path, 1, -1).':'.(__LINE__-12).')"} []'."\n", $message);
+    }
+
+    public function testBatchFormat()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->formatBatch(array(
+            array(
+                'level_name' => 'CRITICAL',
+                'channel' => 'test',
+                'message' => 'bar',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+            array(
+                'level_name' => 'WARNING',
+                'channel' => 'log',
+                'message' => 'foo',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] test.CRITICAL: bar [] []'."\n".'['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
+    }
+
+    public function testFormatShouldStripInlineLineBreaks()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(
+            array(
+                'message' => "foo\nbar",
+                'context' => array(),
+                'extra' => array(),
+            )
+        );
+
+        $this->assertRegExp('/foo bar/', $message);
+    }
+
+    public function testFormatShouldNotStripInlineLineBreaksWhenFlagIsSet()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d', true);
+        $message = $formatter->format(
+            array(
+                'message' => "foo\nbar",
+                'context' => array(),
+                'extra' => array(),
+            )
+        );
+
+        $this->assertRegExp('/foo\nbar/', $message);
+    }
+}
+
+class TestFoo
+{
+    public $foo = 'foo';
+}
+
+class TestBar
+{
+    public function __toString()
+    {
+        return 'bar';
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php
new file mode 100644
index 00000000..6d59b3f3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php
@@ -0,0 +1,40 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\TestCase;
+
+class LogglyFormatterTest extends TestCase
+{
+    /**
+     * @covers Monolog\Formatter\LogglyFormatter::__construct
+     */
+    public function testConstruct()
+    {
+        $formatter = new LogglyFormatter();
+        $this->assertEquals(LogglyFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode());
+        $formatter = new LogglyFormatter(LogglyFormatter::BATCH_MODE_JSON);
+        $this->assertEquals(LogglyFormatter::BATCH_MODE_JSON, $formatter->getBatchMode());
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogglyFormatter::format
+     */
+    public function testFormat()
+    {
+        $formatter = new LogglyFormatter();
+        $record = $this->getRecord();
+        $formatted_decoded = json_decode($formatter->format($record), true);
+        $this->assertArrayHasKey("timestamp", $formatted_decoded);
+        $this->assertEquals(new \DateTime($formatted_decoded["timestamp"]), $record["datetime"]);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php
new file mode 100644
index 00000000..de4a3c2c
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php
@@ -0,0 +1,289 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class LogstashFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testDefaultFormatter()
+    {
+        $formatter = new LogstashFormatter('test', 'hostname');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
+        $this->assertEquals('log', $message['@message']);
+        $this->assertEquals('meh', $message['@fields']['channel']);
+        $this->assertContains('meh', $message['@tags']);
+        $this->assertEquals(Logger::ERROR, $message['@fields']['level']);
+        $this->assertEquals('test', $message['@type']);
+        $this->assertEquals('hostname', $message['@source']);
+
+        $formatter = new LogstashFormatter('mysystem');
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals('mysystem', $message['@type']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $formatter = new LogstashFormatter('test');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals('test', $message['@fields']['file']);
+        $this->assertEquals(14, $message['@fields']['line']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithContext()
+    {
+        $formatter = new LogstashFormatter('test');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $message_array = $message['@fields'];
+
+        $this->assertArrayHasKey('ctxt_from', $message_array);
+        $this->assertEquals('logger', $message_array['ctxt_from']);
+
+        // Test with extraPrefix
+        $formatter = new LogstashFormatter('test', null, null, 'CTX');
+        $message = json_decode($formatter->format($record), true);
+
+        $message_array = $message['@fields'];
+
+        $this->assertArrayHasKey('CTXfrom', $message_array);
+        $this->assertEquals('logger', $message_array['CTXfrom']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithExtra()
+    {
+        $formatter = new LogstashFormatter('test');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $message_array = $message['@fields'];
+
+        $this->assertArrayHasKey('key', $message_array);
+        $this->assertEquals('pair', $message_array['key']);
+
+        // Test with extraPrefix
+        $formatter = new LogstashFormatter('test', null, 'EXT');
+        $message = json_decode($formatter->format($record), true);
+
+        $message_array = $message['@fields'];
+
+        $this->assertArrayHasKey('EXTkey', $message_array);
+        $this->assertEquals('pair', $message_array['EXTkey']);
+    }
+
+    public function testFormatWithApplicationName()
+    {
+        $formatter = new LogstashFormatter('app', 'test');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('@type', $message);
+        $this->assertEquals('app', $message['@type']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testDefaultFormatterV1()
+    {
+        $formatter = new LogstashFormatter('test', 'hostname', null, 'ctxt_', LogstashFormatter::V1);
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
+        $this->assertEquals("1", $message['@version']);
+        $this->assertEquals('log', $message['message']);
+        $this->assertEquals('meh', $message['channel']);
+        $this->assertEquals('ERROR', $message['level']);
+        $this->assertEquals('test', $message['type']);
+        $this->assertEquals('hostname', $message['host']);
+
+        $formatter = new LogstashFormatter('mysystem', null, null, 'ctxt_', LogstashFormatter::V1);
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals('mysystem', $message['type']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithFileAndLineV1()
+    {
+        $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals('test', $message['file']);
+        $this->assertEquals(14, $message['line']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithContextV1()
+    {
+        $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('ctxt_from', $message);
+        $this->assertEquals('logger', $message['ctxt_from']);
+
+        // Test with extraPrefix
+        $formatter = new LogstashFormatter('test', null, null, 'CTX', LogstashFormatter::V1);
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('CTXfrom', $message);
+        $this->assertEquals('logger', $message['CTXfrom']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithExtraV1()
+    {
+        $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('key', $message);
+        $this->assertEquals('pair', $message['key']);
+
+        // Test with extraPrefix
+        $formatter = new LogstashFormatter('test', null, 'EXT', 'ctxt_', LogstashFormatter::V1);
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('EXTkey', $message);
+        $this->assertEquals('pair', $message['EXTkey']);
+    }
+
+    public function testFormatWithApplicationNameV1()
+    {
+        $formatter = new LogstashFormatter('app', 'test', null, 'ctxt_', LogstashFormatter::V1);
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('type', $message);
+        $this->assertEquals('app', $message['type']);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php
new file mode 100644
index 00000000..1554ef46
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php
@@ -0,0 +1,253 @@
+<?php
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * @author Florian Plattner <me@florianplattner.de>
+ */
+class MongoDBFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists('MongoDate')) {
+            $this->markTestSkipped('mongo extension not installed');
+        }
+    }
+
+    public function constructArgumentProvider()
+    {
+        return array(
+            array(1, true, 1, true),
+            array(0, false, 0, false),
+        );
+    }
+
+    /**
+     * @param $traceDepth
+     * @param $traceAsString
+     * @param $expectedTraceDepth
+     * @param $expectedTraceAsString
+     *
+     * @dataProvider constructArgumentProvider
+     */
+    public function testConstruct($traceDepth, $traceAsString, $expectedTraceDepth, $expectedTraceAsString)
+    {
+        $formatter = new MongoDBFormatter($traceDepth, $traceAsString);
+
+        $reflTrace = new \ReflectionProperty($formatter, 'exceptionTraceAsString');
+        $reflTrace->setAccessible(true);
+        $this->assertEquals($expectedTraceAsString, $reflTrace->getValue($formatter));
+
+        $reflDepth = new\ReflectionProperty($formatter, 'maxNestingLevel');
+        $reflDepth->setAccessible(true);
+        $this->assertEquals($expectedTraceDepth, $reflDepth->getValue($formatter));
+    }
+
+    public function testSimpleFormat()
+    {
+        $record = array(
+            'message' => 'some log message',
+            'context' => array(),
+            'level' => Logger::WARNING,
+            'level_name' => Logger::getLevelName(Logger::WARNING),
+            'channel' => 'test',
+            'datetime' => new \DateTime('2014-02-01 00:00:00'),
+            'extra' => array(),
+        );
+
+        $formatter = new MongoDBFormatter();
+        $formattedRecord = $formatter->format($record);
+
+        $this->assertCount(7, $formattedRecord);
+        $this->assertEquals('some log message', $formattedRecord['message']);
+        $this->assertEquals(array(), $formattedRecord['context']);
+        $this->assertEquals(Logger::WARNING, $formattedRecord['level']);
+        $this->assertEquals(Logger::getLevelName(Logger::WARNING), $formattedRecord['level_name']);
+        $this->assertEquals('test', $formattedRecord['channel']);
+        $this->assertInstanceOf('\MongoDate', $formattedRecord['datetime']);
+        $this->assertEquals('0.00000000 1391212800', $formattedRecord['datetime']->__toString());
+        $this->assertEquals(array(), $formattedRecord['extra']);
+    }
+
+    public function testRecursiveFormat()
+    {
+        $someObject = new \stdClass();
+        $someObject->foo = 'something';
+        $someObject->bar = 'stuff';
+
+        $record = array(
+            'message' => 'some log message',
+            'context' => array(
+                'stuff' => new \DateTime('2014-02-01 02:31:33'),
+                'some_object' => $someObject,
+                'context_string' => 'some string',
+                'context_int' => 123456,
+                'except' => new \Exception('exception message', 987),
+            ),
+            'level' => Logger::WARNING,
+            'level_name' => Logger::getLevelName(Logger::WARNING),
+            'channel' => 'test',
+            'datetime' => new \DateTime('2014-02-01 00:00:00'),
+            'extra' => array(),
+        );
+
+        $formatter = new MongoDBFormatter();
+        $formattedRecord = $formatter->format($record);
+
+        $this->assertCount(5, $formattedRecord['context']);
+        $this->assertInstanceOf('\MongoDate', $formattedRecord['context']['stuff']);
+        $this->assertEquals('0.00000000 1391221893', $formattedRecord['context']['stuff']->__toString());
+        $this->assertEquals(
+            array(
+                'foo' => 'something',
+                'bar' => 'stuff',
+                'class' => 'stdClass',
+            ),
+            $formattedRecord['context']['some_object']
+        );
+        $this->assertEquals('some string', $formattedRecord['context']['context_string']);
+        $this->assertEquals(123456, $formattedRecord['context']['context_int']);
+
+        $this->assertCount(5, $formattedRecord['context']['except']);
+        $this->assertEquals('exception message', $formattedRecord['context']['except']['message']);
+        $this->assertEquals(987, $formattedRecord['context']['except']['code']);
+        $this->assertInternalType('string', $formattedRecord['context']['except']['file']);
+        $this->assertInternalType('integer', $formattedRecord['context']['except']['code']);
+        $this->assertInternalType('string', $formattedRecord['context']['except']['trace']);
+        $this->assertEquals('Exception', $formattedRecord['context']['except']['class']);
+    }
+
+    public function testFormatDepthArray()
+    {
+        $record = array(
+            'message' => 'some log message',
+            'context' => array(
+                'nest2' => array(
+                    'property' => 'anything',
+                    'nest3' => array(
+                        'nest4' => 'value',
+                        'property' => 'nothing'
+                    )
+                )
+            ),
+            'level' => Logger::WARNING,
+            'level_name' => Logger::getLevelName(Logger::WARNING),
+            'channel' => 'test',
+            'datetime' => new \DateTime('2014-02-01 00:00:00'),
+            'extra' => array(),
+        );
+
+        $formatter = new MongoDBFormatter(2);
+        $formattedResult = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'nest2' => array(
+                    'property' => 'anything',
+                    'nest3' => '[...]',
+                )
+            ),
+            $formattedResult['context']
+        );
+    }
+
+    public function testFormatDepthArrayInfiniteNesting()
+    {
+        $record = array(
+            'message' => 'some log message',
+            'context' => array(
+                'nest2' => array(
+                    'property' => 'something',
+                    'nest3' => array(
+                        'property' => 'anything',
+                        'nest4' => array(
+                            'property' => 'nothing',
+                        ),
+                    )
+                )
+            ),
+            'level' => Logger::WARNING,
+            'level_name' => Logger::getLevelName(Logger::WARNING),
+            'channel' => 'test',
+            'datetime' => new \DateTime('2014-02-01 00:00:00'),
+            'extra' => array(),
+        );
+
+        $formatter = new MongoDBFormatter(0);
+        $formattedResult = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'nest2' => array(
+                    'property' => 'something',
+                    'nest3' => array(
+                        'property' => 'anything',
+                        'nest4' => array(
+                            'property' => 'nothing',
+                        )
+                    ),
+                )
+            ),
+            $formattedResult['context']
+        );
+    }
+
+    public function testFormatDepthObjects()
+    {
+        $someObject = new \stdClass();
+        $someObject->property = 'anything';
+        $someObject->nest3 = new \stdClass();
+        $someObject->nest3->property = 'nothing';
+        $someObject->nest3->nest4 = 'invisible';
+
+        $record = array(
+            'message' => 'some log message',
+            'context' => array(
+                'nest2' => $someObject
+            ),
+            'level' => Logger::WARNING,
+            'level_name' => Logger::getLevelName(Logger::WARNING),
+            'channel' => 'test',
+            'datetime' => new \DateTime('2014-02-01 00:00:00'),
+            'extra' => array(),
+        );
+
+        $formatter = new MongoDBFormatter(2, true);
+        $formattedResult = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'nest2' => array(
+                    'property' => 'anything',
+                    'nest3' => '[...]',
+                    'class' => 'stdClass',
+                ),
+            ),
+            $formattedResult['context']
+        );
+    }
+
+    public function testFormatDepthException()
+    {
+        $record = array(
+            'message' => 'some log message',
+            'context' => array(
+                'nest2' => new \Exception('exception message', 987),
+            ),
+            'level' => Logger::WARNING,
+            'level_name' => Logger::getLevelName(Logger::WARNING),
+            'channel' => 'test',
+            'datetime' => new \DateTime('2014-02-01 00:00:00'),
+            'extra' => array(),
+        );
+
+        $formatter = new MongoDBFormatter(2, false);
+        $formattedRecord = $formatter->format($record);
+
+        $this->assertEquals('exception message', $formattedRecord['context']['nest2']['message']);
+        $this->assertEquals(987, $formattedRecord['context']['nest2']['code']);
+        $this->assertEquals('[...]', $formattedRecord['context']['nest2']['trace']);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php
new file mode 100644
index 00000000..00bbb249
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php
@@ -0,0 +1,247 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\NormalizerFormatter
+ */
+class NormalizerFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function testFormat()
+    {
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $formatted = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'message' => 'foo',
+            'datetime' => new \DateTime,
+            'extra' => array('foo' => new TestFooNorm, 'bar' => new TestBarNorm, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+            'context' => array(
+                'foo' => 'bar',
+                'baz' => 'qux',
+            ),
+        ));
+
+        $this->assertEquals(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'message' => 'foo',
+            'datetime' => date('Y-m-d'),
+            'extra' => array(
+                'foo' => '[object] (Monolog\\Formatter\\TestFooNorm: {"foo":"foo"})',
+                'bar' => '[object] (Monolog\\Formatter\\TestBarNorm: {})',
+                'baz' => array(),
+                'res' => '[resource]',
+            ),
+            'context' => array(
+                'foo' => 'bar',
+                'baz' => 'qux',
+            )
+        ), $formatted);
+    }
+
+    public function testFormatExceptions()
+    {
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $e = new \LogicException('bar');
+        $e2 = new \RuntimeException('foo', 0, $e);
+        $formatted = $formatter->format(array(
+            'exception' => $e2,
+        ));
+
+        $this->assertGreaterThan(5, count($formatted['exception']['trace']));
+        $this->assertTrue(isset($formatted['exception']['previous']));
+        unset($formatted['exception']['trace'], $formatted['exception']['previous']);
+
+        $this->assertEquals(array(
+            'exception' => array(
+                'class'   => get_class($e2),
+                'message' => $e2->getMessage(),
+                'code'    => $e2->getCode(),
+                'file'    => $e2->getFile().':'.$e2->getLine(),
+            )
+        ), $formatted);
+    }
+
+    public function testBatchFormat()
+    {
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $formatted = $formatter->formatBatch(array(
+            array(
+                'level_name' => 'CRITICAL',
+                'channel' => 'test',
+                'message' => 'bar',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+            array(
+                'level_name' => 'WARNING',
+                'channel' => 'log',
+                'message' => 'foo',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+        ));
+        $this->assertEquals(array(
+            array(
+                'level_name' => 'CRITICAL',
+                'channel' => 'test',
+                'message' => 'bar',
+                'context' => array(),
+                'datetime' => date('Y-m-d'),
+                'extra' => array(),
+            ),
+            array(
+                'level_name' => 'WARNING',
+                'channel' => 'log',
+                'message' => 'foo',
+                'context' => array(),
+                'datetime' => date('Y-m-d'),
+                'extra' => array(),
+            ),
+        ), $formatted);
+    }
+
+    /**
+     * Test issue #137
+     */
+    public function testIgnoresRecursiveObjectReferences()
+    {
+        // set up the recursion
+        $foo = new \stdClass();
+        $bar = new \stdClass();
+
+        $foo->bar = $bar;
+        $bar->foo = $foo;
+
+        // set an error handler to assert that the error is not raised anymore
+        $that = $this;
+        set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
+            if (error_reporting() & $level) {
+                restore_error_handler();
+                $that->fail("$message should not be raised");
+            }
+        });
+
+        $formatter = new NormalizerFormatter();
+        $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+        $reflMethod->setAccessible(true);
+        $res = $reflMethod->invoke($formatter, array($foo, $bar), true);
+
+        restore_error_handler();
+
+        $this->assertEquals(@json_encode(array($foo, $bar)), $res);
+    }
+
+    public function testIgnoresInvalidTypes()
+    {
+        // set up the recursion
+        $resource = fopen(__FILE__, 'r');
+
+        // set an error handler to assert that the error is not raised anymore
+        $that = $this;
+        set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
+            if (error_reporting() & $level) {
+                restore_error_handler();
+                $that->fail("$message should not be raised");
+            }
+        });
+
+        $formatter = new NormalizerFormatter();
+        $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+        $reflMethod->setAccessible(true);
+        $res = $reflMethod->invoke($formatter, array($resource), true);
+
+        restore_error_handler();
+
+        $this->assertEquals(@json_encode(array($resource)), $res);
+    }
+
+    public function testExceptionTraceWithArgs()
+    {
+        if (defined('HHVM_VERSION')) {
+            $this->markTestSkipped('Not supported in HHVM since it detects errors differently');
+        }
+
+        // This happens i.e. in React promises or Guzzle streams where stream wrappers are registered
+        // and no file or line are included in the trace because it's treated as internal function
+        set_error_handler(function ($errno, $errstr, $errfile, $errline) {
+            throw new \ErrorException($errstr, 0, $errno, $errfile, $errline);
+        });
+
+        try {
+            // This will contain $resource and $wrappedResource as arguments in the trace item
+            $resource = fopen('php://memory', 'rw+');
+            fwrite($resource, 'test_resource');
+            $wrappedResource = new TestStreamFoo($resource);
+            // Just do something stupid with a resource/wrapped resource as argument
+            array_keys($wrappedResource);
+        } catch (\Exception $e) {
+            restore_error_handler();
+        }
+
+        $formatter = new NormalizerFormatter();
+        $record = array('context' => array('exception' => $e));
+        $result = $formatter->format($record);
+
+        $this->assertRegExp(
+            '%"resource":"\[resource\]"%',
+            $result['context']['exception']['trace'][0]
+        );
+
+        if (version_compare(PHP_VERSION, '5.5.0', '>=')) {
+            $pattern = '%"wrappedResource":"\[object\] \(Monolog\\\\\\\\Formatter\\\\\\\\TestStreamFoo: \)"%';
+        } else {
+            $pattern = '%\\\\"resource\\\\":null%';
+        }
+
+        // Tests that the wrapped resource is ignored while encoding, only works for PHP <= 5.4
+        $this->assertRegExp(
+            $pattern,
+            $result['context']['exception']['trace'][0]
+        );
+    }
+}
+
+class TestFooNorm
+{
+    public $foo = 'foo';
+}
+
+class TestBarNorm
+{
+    public function __toString()
+    {
+        return 'bar';
+    }
+}
+
+class TestStreamFoo
+{
+    public $foo;
+    public $resource;
+
+    public function __construct($resource)
+    {
+        $this->resource = $resource;
+        $this->foo = 'BAR';
+    }
+
+    public function __toString()
+    {
+        fseek($this->resource, 0);
+
+        return $this->foo . ' - ' . (string) stream_get_contents($this->resource);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php
new file mode 100644
index 00000000..c5a4ebb5
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php
@@ -0,0 +1,98 @@
+<?php
+namespace Monolog\Formatter;
+
+class ScalarFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function setUp()
+    {
+        $this->formatter = new ScalarFormatter();
+    }
+
+    public function buildTrace(\Exception $e)
+    {
+        $data = array();
+        $trace = $e->getTrace();
+        foreach ($trace as $frame) {
+            if (isset($frame['file'])) {
+                $data[] = $frame['file'].':'.$frame['line'];
+            } else {
+                $data[] = json_encode($frame);
+            }
+        }
+
+        return $data;
+    }
+
+    public function encodeJson($data)
+    {
+        if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+            return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+        }
+
+        return json_encode($data);
+    }
+
+    public function testFormat()
+    {
+        $exception = new \Exception('foo');
+        $formatted = $this->formatter->format(array(
+            'foo' => 'string',
+            'bar' => 1,
+            'baz' => false,
+            'bam' => array(1, 2, 3),
+            'bat' => array('foo' => 'bar'),
+            'bap' => \DateTime::createFromFormat(\DateTime::ISO8601, '1970-01-01T00:00:00+0000'),
+            'ban' => $exception
+        ));
+
+        $this->assertSame(array(
+            'foo' => 'string',
+            'bar' => 1,
+            'baz' => false,
+            'bam' => $this->encodeJson(array(1, 2, 3)),
+            'bat' => $this->encodeJson(array('foo' => 'bar')),
+            'bap' => '1970-01-01 00:00:00',
+            'ban' => $this->encodeJson(array(
+                'class'   => get_class($exception),
+                'message' => $exception->getMessage(),
+                'code'    => $exception->getCode(),
+                'file'    => $exception->getFile() . ':' . $exception->getLine(),
+                'trace'   => $this->buildTrace($exception)
+            ))
+        ), $formatted);
+    }
+
+    public function testFormatWithErrorContext()
+    {
+        $context = array('file' => 'foo', 'line' => 1);
+        $formatted = $this->formatter->format(array(
+            'context' => $context
+        ));
+
+        $this->assertSame(array(
+            'context' => $this->encodeJson($context)
+        ), $formatted);
+    }
+
+    public function testFormatWithExceptionContext()
+    {
+        $exception = new \Exception('foo');
+        $formatted = $this->formatter->format(array(
+            'context' => array(
+                'exception' => $exception
+            )
+        ));
+
+        $this->assertSame(array(
+            'context' => $this->encodeJson(array(
+                'exception' => array(
+                    'class'   => get_class($exception),
+                    'message' => $exception->getMessage(),
+                    'code'    => $exception->getCode(),
+                    'file'    => $exception->getFile() . ':' . $exception->getLine(),
+                    'trace'   => $this->buildTrace($exception)
+                )
+            ))
+        ), $formatted);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php
new file mode 100644
index 00000000..52f15a36
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php
@@ -0,0 +1,142 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class WildfireFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testDefaultFormat()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1'),
+            'message' => 'log',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '125|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},'
+                .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '129|[{"Type":"ERROR","File":"test","Line":14,"Label":"meh"},'
+                .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testFormatWithoutContext()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '58|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},"log"]|',
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::formatBatch
+     * @expectedException BadMethodCallException
+     */
+    public function testBatchFormatThrowException()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $wildfire->formatBatch(array($record));
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testTableFormat()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'table-channel',
+            'context' => array(
+            WildfireFormatter::TABLE => array(
+                    array('col1', 'col2', 'col3'),
+                    array('val1', 'val2', 'val3'),
+                    array('foo1', 'foo2', 'foo3'),
+                    array('bar1', 'bar2', 'bar3'),
+                ),
+            ),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'table-message',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '171|[{"Type":"TABLE","File":"","Line":"","Label":"table-channel: table-message"},[["col1","col2","col3"],["val1","val2","val3"],["foo1","foo2","foo3"],["bar1","bar2","bar3"]]]|',
+            $message
+        );
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Functional/Handler/FirePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Functional/Handler/FirePHPHandlerTest.php
new file mode 100644
index 00000000..7e4e7eb5
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Functional/Handler/FirePHPHandlerTest.php
@@ -0,0 +1,32 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+spl_autoload_register(function ($class) {
+    $file = __DIR__.'/../../../../src/'.strtr($class, '\\', '/').'.php';
+    if (file_exists($file)) {
+        require $file;
+
+        return true;
+    }
+});
+
+use Monolog\Logger;
+use Monolog\Handler\FirePHPHandler;
+use Monolog\Handler\ChromePHPHandler;
+
+$logger = new Logger('firephp');
+$logger->pushHandler(new FirePHPHandler);
+$logger->pushHandler(new ChromePHPHandler());
+
+$logger->addDebug('Debug');
+$logger->addInfo('Info');
+$logger->addWarning('Warning');
+$logger->addError('Error');
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php
new file mode 100644
index 00000000..568eb9da
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php
@@ -0,0 +1,115 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Processor\WebProcessor;
+
+class AbstractHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\AbstractHandler::__construct
+     * @covers Monolog\Handler\AbstractHandler::getLevel
+     * @covers Monolog\Handler\AbstractHandler::setLevel
+     * @covers Monolog\Handler\AbstractHandler::getBubble
+     * @covers Monolog\Handler\AbstractHandler::setBubble
+     * @covers Monolog\Handler\AbstractHandler::getFormatter
+     * @covers Monolog\Handler\AbstractHandler::setFormatter
+     */
+    public function testConstructAndGetSet()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+        $this->assertEquals(Logger::WARNING, $handler->getLevel());
+        $this->assertEquals(false, $handler->getBubble());
+
+        $handler->setLevel(Logger::ERROR);
+        $handler->setBubble(true);
+        $handler->setFormatter($formatter = new LineFormatter);
+        $this->assertEquals(Logger::ERROR, $handler->getLevel());
+        $this->assertEquals(true, $handler->getBubble());
+        $this->assertSame($formatter, $handler->getFormatter());
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+        $handler->expects($this->exactly(2))
+            ->method('handle');
+        $handler->handleBatch(array($this->getRecord(), $this->getRecord()));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::isHandling
+     */
+    public function testIsHandling()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+        $this->assertTrue($handler->isHandling($this->getRecord()));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::__construct
+     */
+    public function testHandlesPsrStyleLevels()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array('warning', false));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+        $handler->setLevel('debug');
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::getFormatter
+     * @covers Monolog\Handler\AbstractHandler::getDefaultFormatter
+     */
+    public function testGetFormatterInitializesDefault()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+        $this->assertInstanceOf('Monolog\Formatter\LineFormatter', $handler->getFormatter());
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::pushProcessor
+     * @covers Monolog\Handler\AbstractHandler::popProcessor
+     * @expectedException LogicException
+     */
+    public function testPushPopProcessor()
+    {
+        $logger = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+        $processor1 = new WebProcessor;
+        $processor2 = new WebProcessor;
+
+        $logger->pushProcessor($processor1);
+        $logger->pushProcessor($processor2);
+
+        $this->assertEquals($processor2, $logger->popProcessor());
+        $this->assertEquals($processor1, $logger->popProcessor());
+        $logger->popProcessor();
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::pushProcessor
+     * @expectedException InvalidArgumentException
+     */
+    public function testPushProcessorWithNonCallable()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+
+        $handler->pushProcessor(new \stdClass());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php
new file mode 100644
index 00000000..24d4f63c
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php
@@ -0,0 +1,80 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Processor\WebProcessor;
+
+class AbstractProcessingHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleLowerLevelMessage()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, true));
+        $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleBubbling()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, true));
+        $this->assertFalse($handler->handle($this->getRecord()));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleNotBubbling()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, false));
+        $this->assertTrue($handler->handle($this->getRecord()));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleIsFalseWhenNotHandled()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, false));
+        $this->assertTrue($handler->handle($this->getRecord()));
+        $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::processRecord
+     */
+    public function testProcessRecord()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler');
+        $handler->pushProcessor(new WebProcessor(array(
+            'REQUEST_URI' => '',
+            'REQUEST_METHOD' => '',
+            'REMOTE_ADDR' => '',
+            'SERVER_NAME' => '',
+            'UNIQUE_ID' => '',
+        )));
+        $handledRecord = null;
+        $handler->expects($this->once())
+            ->method('write')
+            ->will($this->returnCallback(function ($record) use (&$handledRecord) {
+                $handledRecord = $record;
+            }))
+        ;
+        $handler->handle($this->getRecord());
+        $this->assertEquals(6, count($handledRecord['extra']));
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php
new file mode 100644
index 00000000..074d50c6
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php
@@ -0,0 +1,137 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use PhpAmqpLib\Message\AMQPMessage;
+use PhpAmqpLib\Channel\AMQPChannel;
+use PhpAmqpLib\Connection\AMQPConnection;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class AmqpHandlerTest extends TestCase
+{
+    public function testHandleAmqpExt()
+    {
+        if (!class_exists('AMQPConnection') || !class_exists('AMQPExchange')) {
+            $this->markTestSkipped("amqp-php not installed");
+        }
+
+        if (!class_exists('AMQPChannel')) {
+            $this->markTestSkipped("Please update AMQP to version >= 1.0");
+        }
+
+        $messages = array();
+
+        $exchange = $this->getMock('AMQPExchange', array('publish', 'setName'), array(), '', false);
+        $exchange->expects($this->once())
+            ->method('setName')
+            ->with('log')
+        ;
+        $exchange->expects($this->any())
+            ->method('publish')
+            ->will($this->returnCallback(function ($message, $routing_key, $flags = 0, $attributes = array()) use (&$messages) {
+                $messages[] = array($message, $routing_key, $flags, $attributes);
+            }))
+        ;
+
+        $handler = new AmqpHandler($exchange, 'log');
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            array(
+                'message' => 'test',
+                'context' => array(
+                    'data' => array(),
+                    'foo' => 34,
+                ),
+                'level' => 300,
+                'level_name' => 'WARNING',
+                'channel' => 'test',
+                'extra' => array(),
+            ),
+            'warn.test',
+            0,
+            array(
+                'delivery_mode' => 2,
+                'Content-type' => 'application/json'
+            )
+        );
+
+        $handler->handle($record);
+
+        $this->assertCount(1, $messages);
+        $messages[0][0] = json_decode($messages[0][0], true);
+        unset($messages[0][0]['datetime']);
+        $this->assertEquals($expected, $messages[0]);
+    }
+
+    public function testHandlePhpAmqpLib()
+    {
+        if (!class_exists('PhpAmqpLib\Connection\AMQPConnection')) {
+            $this->markTestSkipped("php-amqplib not installed");
+        }
+
+        $messages = array();
+
+        $exchange = $this->getMock('PhpAmqpLib\Channel\AMQPChannel', array('basic_publish', '__destruct'), array(), '', false);
+
+        $exchange->expects($this->any())
+            ->method('basic_publish')
+            ->will($this->returnCallback(function (AMQPMessage $msg, $exchange = "", $routing_key = "", $mandatory = false, $immediate = false, $ticket = null) use (&$messages) {
+                $messages[] = array($msg, $exchange, $routing_key, $mandatory, $immediate, $ticket);
+            }))
+        ;
+
+        $handler = new AmqpHandler($exchange, 'log');
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            array(
+                'message' => 'test',
+                'context' => array(
+                    'data' => array(),
+                    'foo' => 34,
+                ),
+                'level' => 300,
+                'level_name' => 'WARNING',
+                'channel' => 'test',
+                'extra' => array(),
+            ),
+            'log',
+            'warn.test',
+            false,
+            false,
+            null,
+            array(
+                'delivery_mode' => 2,
+                'content_type' => 'application/json'
+            )
+        );
+
+        $handler->handle($record);
+
+        $this->assertCount(1, $messages);
+
+        /* @var $msg AMQPMessage */
+        $msg = $messages[0][0];
+        $messages[0][0] = json_decode($msg->body, true);
+        $messages[0][] = $msg->get_properties();
+        unset($messages[0][0]['datetime']);
+
+        $this->assertEquals($expected, $messages[0]);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php
new file mode 100644
index 00000000..ffb1d746
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php
@@ -0,0 +1,130 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\BrowserConsoleHandlerTest
+ */
+class BrowserConsoleHandlerTest extends TestCase
+{
+    protected function setUp()
+    {
+        BrowserConsoleHandler::reset();
+    }
+
+    protected function generateScript()
+    {
+        $reflMethod = new \ReflectionMethod('Monolog\Handler\BrowserConsoleHandler', 'generateScript');
+        $reflMethod->setAccessible(true);
+
+        return $reflMethod->invoke(null);
+    }
+
+    public function testStyling()
+    {
+        $handler = new BrowserConsoleHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+
+        $handler->handle($this->getRecord(Logger::DEBUG, 'foo[[bar]]{color: red}'));
+
+        $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%cfoo%cbar%c", "font-weight: normal", "color: red", "font-weight: normal");
+}})(console);
+EOF;
+
+        $this->assertEquals($expected, $this->generateScript());
+    }
+
+    public function testEscaping()
+    {
+        $handler = new BrowserConsoleHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+
+        $handler->handle($this->getRecord(Logger::DEBUG, "[foo] [[\"bar\n[baz]\"]]{color: red}"));
+
+        $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%c[foo] %c\"bar\\n[baz]\"%c", "font-weight: normal", "color: red", "font-weight: normal");
+}})(console);
+EOF;
+
+        $this->assertEquals($expected, $this->generateScript());
+    }
+
+    public function testAutolabel()
+    {
+        $handler = new BrowserConsoleHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+
+        $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}'));
+        $handler->handle($this->getRecord(Logger::DEBUG, '[[bar]]{macro: autolabel}'));
+        $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}'));
+
+        $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%c%cfoo%c", "font-weight: normal", "background-color: blue; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal");
+c.log("%c%cbar%c", "font-weight: normal", "background-color: green; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal");
+c.log("%c%cfoo%c", "font-weight: normal", "background-color: blue; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal");
+}})(console);
+EOF;
+
+        $this->assertEquals($expected, $this->generateScript());
+    }
+
+    public function testContext()
+    {
+        $handler = new BrowserConsoleHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+
+        $handler->handle($this->getRecord(Logger::DEBUG, 'test', array('foo' => 'bar')));
+
+        $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.groupCollapsed("%ctest", "font-weight: normal");
+c.log("%c%s", "font-weight: bold", "Context");
+c.log("%s: %o", "foo", "bar");
+c.groupEnd();
+}})(console);
+EOF;
+
+        $this->assertEquals($expected, $this->generateScript());
+    }
+
+    public function testConcurrentHandlers()
+    {
+        $handler1 = new BrowserConsoleHandler();
+        $handler1->setFormatter($this->getIdentityFormatter());
+
+        $handler2 = new BrowserConsoleHandler();
+        $handler2->setFormatter($this->getIdentityFormatter());
+
+        $handler1->handle($this->getRecord(Logger::DEBUG, 'test1'));
+        $handler2->handle($this->getRecord(Logger::DEBUG, 'test2'));
+        $handler1->handle($this->getRecord(Logger::DEBUG, 'test3'));
+        $handler2->handle($this->getRecord(Logger::DEBUG, 'test4'));
+
+        $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%ctest1", "font-weight: normal");
+c.log("%ctest2", "font-weight: normal");
+c.log("%ctest3", "font-weight: normal");
+c.log("%ctest4", "font-weight: normal");
+}})(console);
+EOF;
+
+        $this->assertEquals($expected, $this->generateScript());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php
new file mode 100644
index 00000000..da8b3c39
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php
@@ -0,0 +1,158 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class BufferHandlerTest extends TestCase
+{
+    private $shutdownCheckHandler;
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::__construct
+     * @covers Monolog\Handler\BufferHandler::handle
+     * @covers Monolog\Handler\BufferHandler::close
+     */
+    public function testHandleBuffers()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+        $handler->close();
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue(count($test->getRecords()) === 2);
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::close
+     * @covers Monolog\Handler\BufferHandler::flush
+     */
+    public function testPropagatesRecordsAtEndOfRequest()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test);
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->shutdownCheckHandler = $test;
+        register_shutdown_function(array($this, 'checkPropagation'));
+    }
+
+    public function checkPropagation()
+    {
+        if (!$this->shutdownCheckHandler->hasWarningRecords() || !$this->shutdownCheckHandler->hasDebugRecords()) {
+            echo '!!! BufferHandlerTest::testPropagatesRecordsAtEndOfRequest failed to verify that the messages have been propagated' . PHP_EOL;
+            exit(1);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleBufferLimit()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 2);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertFalse($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleBufferLimitWithFlushOnOverflow()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 3, Logger::DEBUG, true, true);
+
+        // send two records
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertCount(0, $test->getRecords());
+
+        // overflow
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertCount(3, $test->getRecords());
+
+        // should buffer again
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertCount(3, $test->getRecords());
+
+        $handler->close();
+        $this->assertCount(5, $test->getRecords());
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleLevel()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 0, Logger::INFO);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertFalse($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::flush
+     */
+    public function testFlush()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 0);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->flush();
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertFalse($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test);
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->flush();
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php
new file mode 100644
index 00000000..2f55faf8
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php
@@ -0,0 +1,141 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\ChromePHPHandler
+ */
+class ChromePHPHandlerTest extends TestCase
+{
+    protected function setUp()
+    {
+        TestChromePHPHandler::reset();
+        $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; Chrome/1.0';
+    }
+
+    public function testHeaders()
+    {
+        $handler = new TestChromePHPHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-ChromeLogger-Data'   => base64_encode(utf8_encode(json_encode(array(
+                'version' => ChromePHPHandler::VERSION,
+                'columns' => array('label', 'log', 'backtrace', 'type'),
+                'rows' => array(
+                    'test',
+                    'test',
+                ),
+                'request_uri' => '',
+            ))))
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+    }
+
+    public function testHeadersOverflow()
+    {
+        $handler = new TestChromePHPHandler();
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 150*1024)));
+
+        // overflow chrome headers limit
+        $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 100*1024)));
+
+        $expected = array(
+            'X-ChromeLogger-Data'   => base64_encode(utf8_encode(json_encode(array(
+                'version' => ChromePHPHandler::VERSION,
+                'columns' => array('label', 'log', 'backtrace', 'type'),
+                'rows' => array(
+                    array(
+                        'test',
+                        'test',
+                        'unknown',
+                        'log',
+                    ),
+                    array(
+                        'test',
+                        str_repeat('a', 150*1024),
+                        'unknown',
+                        'warn',
+                    ),
+                    array(
+                        'monolog',
+                        'Incomplete logs, chrome header size limit reached',
+                        'unknown',
+                        'warn',
+                    ),
+                ),
+                'request_uri' => '',
+            ))))
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+    }
+
+    public function testConcurrentHandlers()
+    {
+        $handler = new TestChromePHPHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $handler2 = new TestChromePHPHandler();
+        $handler2->setFormatter($this->getIdentityFormatter());
+        $handler2->handle($this->getRecord(Logger::DEBUG));
+        $handler2->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-ChromeLogger-Data'   => base64_encode(utf8_encode(json_encode(array(
+                'version' => ChromePHPHandler::VERSION,
+                'columns' => array('label', 'log', 'backtrace', 'type'),
+                'rows' => array(
+                    'test',
+                    'test',
+                    'test',
+                    'test',
+                ),
+                'request_uri' => '',
+            ))))
+        );
+
+        $this->assertEquals($expected, $handler2->getHeaders());
+    }
+}
+
+class TestChromePHPHandler extends ChromePHPHandler
+{
+    protected $headers = array();
+
+    public static function reset()
+    {
+        self::$initialized = false;
+        self::$overflowed = false;
+        self::$sendHeaders = true;
+        self::$json['rows'] = array();
+    }
+
+    protected function sendHeader($header, $content)
+    {
+        $this->headers[$header] = $content;
+    }
+
+    public function getHeaders()
+    {
+        return $this->headers;
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php
new file mode 100644
index 00000000..78a1d15c
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php
@@ -0,0 +1,41 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class CouchDBHandlerTest extends TestCase
+{
+    public function testHandle()
+    {
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            'message' => 'test',
+            'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
+            'level' => Logger::WARNING,
+            'level_name' => 'WARNING',
+            'channel' => 'test',
+            'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
+            'extra' => array(),
+        );
+
+        $handler = new CouchDBHandler();
+
+        try {
+            $handler->handle($record);
+        } catch (\RuntimeException $e) {
+            $this->markTestSkipped('Could not connect to couchdb server on http://localhost:5984');
+        }
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php
new file mode 100644
index 00000000..d67da90a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php
@@ -0,0 +1,52 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class DoctrineCouchDBHandlerTest extends TestCase
+{
+    protected function setup()
+    {
+        if (!class_exists('Doctrine\CouchDB\CouchDBClient')) {
+            $this->markTestSkipped('The "doctrine/couchdb" package is not installed');
+        }
+    }
+
+    public function testHandle()
+    {
+        $client = $this->getMockBuilder('Doctrine\\CouchDB\\CouchDBClient')
+            ->setMethods(array('postDocument'))
+            ->disableOriginalConstructor()
+            ->getMock();
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            'message' => 'test',
+            'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
+            'level' => Logger::WARNING,
+            'level_name' => 'WARNING',
+            'channel' => 'test',
+            'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
+            'extra' => array(),
+        );
+
+        $client->expects($this->once())
+            ->method('postDocument')
+            ->with($expected);
+
+        $handler = new DoctrineCouchDBHandler($client);
+        $handler->handle($record);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php
new file mode 100644
index 00000000..a38a8cb7
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php
@@ -0,0 +1,73 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+class DynamoDbHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists('Aws\DynamoDb\DynamoDbClient')) {
+            $this->markTestSkipped('aws/aws-sdk-php not installed');
+        }
+
+        $this->client = $this->getMockBuilder('Aws\DynamoDb\DynamoDbClient')
+            ->setMethods(array('formatAttributes', '__call'))
+            ->disableOriginalConstructor()->getMock();
+    }
+
+    public function testConstruct()
+    {
+        $this->assertInstanceOf('Monolog\Handler\DynamoDbHandler', new DynamoDbHandler($this->client, 'foo'));
+    }
+
+    public function testInterface()
+    {
+        $this->assertInstanceOf('Monolog\Handler\HandlerInterface', new DynamoDbHandler($this->client, 'foo'));
+    }
+
+    public function testGetFormatter()
+    {
+        $handler = new DynamoDbHandler($this->client, 'foo');
+        $this->assertInstanceOf('Monolog\Formatter\ScalarFormatter', $handler->getFormatter());
+    }
+
+    public function testHandle()
+    {
+        $record = $this->getRecord();
+        $formatter = $this->getMock('Monolog\Formatter\FormatterInterface');
+        $formatted = array('foo' => 1, 'bar' => 2);
+        $handler = new DynamoDbHandler($this->client, 'foo');
+        $handler->setFormatter($formatter);
+
+        $formatter
+             ->expects($this->once())
+             ->method('format')
+             ->with($record)
+             ->will($this->returnValue($formatted));
+        $this->client
+             ->expects($this->once())
+             ->method('formatAttributes')
+             ->with($this->isType('array'))
+             ->will($this->returnValue($formatted));
+        $this->client
+             ->expects($this->once())
+             ->method('__call')
+             ->with('putItem', array(array(
+                 'TableName' => 'foo',
+                 'Item' => $formatted
+             )));
+
+        $handler->handle($record);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php
new file mode 100644
index 00000000..1687074b
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php
@@ -0,0 +1,239 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\ElasticaFormatter;
+use Monolog\Formatter\NormalizerFormatter;
+use Monolog\TestCase;
+use Monolog\Logger;
+use Elastica\Client;
+use Elastica\Request;
+use Elastica\Response;
+
+class ElasticSearchHandlerTest extends TestCase
+{
+    /**
+     * @var Client mock
+     */
+    protected $client;
+
+    /**
+     * @var array Default handler options
+     */
+    protected $options = array(
+        'index' => 'my_index',
+        'type'  => 'doc_type',
+    );
+
+    public function setUp()
+    {
+        // Elastica lib required
+        if (!class_exists("Elastica\Client")) {
+            $this->markTestSkipped("ruflin/elastica not installed");
+        }
+
+        // base mock Elastica Client object
+        $this->client = $this->getMockBuilder('Elastica\Client')
+            ->setMethods(array('addDocuments'))
+            ->disableOriginalConstructor()
+            ->getMock();
+    }
+
+    /**
+     * @covers Monolog\Handler\ElasticSearchHandler::write
+     * @covers Monolog\Handler\ElasticSearchHandler::handleBatch
+     * @covers Monolog\Handler\ElasticSearchHandler::bulkSend
+     * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter
+     */
+    public function testHandle()
+    {
+        // log message
+        $msg = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        // format expected result
+        $formatter = new ElasticaFormatter($this->options['index'], $this->options['type']);
+        $expected = array($formatter->format($msg));
+
+        // setup ES client mock
+        $this->client->expects($this->any())
+            ->method('addDocuments')
+            ->with($expected);
+
+        // perform tests
+        $handler = new ElasticSearchHandler($this->client, $this->options);
+        $handler->handle($msg);
+        $handler->handleBatch(array($msg));
+    }
+
+    /**
+     * @covers Monolog\Handler\ElasticSearchHandler::setFormatter
+     */
+    public function testSetFormatter()
+    {
+        $handler = new ElasticSearchHandler($this->client);
+        $formatter = new ElasticaFormatter('index_new', 'type_new');
+        $handler->setFormatter($formatter);
+        $this->assertInstanceOf('Monolog\Formatter\ElasticaFormatter', $handler->getFormatter());
+        $this->assertEquals('index_new', $handler->getFormatter()->getIndex());
+        $this->assertEquals('type_new', $handler->getFormatter()->getType());
+    }
+
+    /**
+     * @covers                   Monolog\Handler\ElasticSearchHandler::setFormatter
+     * @expectedException        InvalidArgumentException
+     * @expectedExceptionMessage ElasticSearchHandler is only compatible with ElasticaFormatter
+     */
+    public function testSetFormatterInvalid()
+    {
+        $handler = new ElasticSearchHandler($this->client);
+        $formatter = new NormalizerFormatter();
+        $handler->setFormatter($formatter);
+    }
+
+    /**
+     * @covers Monolog\Handler\ElasticSearchHandler::__construct
+     * @covers Monolog\Handler\ElasticSearchHandler::getOptions
+     */
+    public function testOptions()
+    {
+        $expected = array(
+            'index' => $this->options['index'],
+            'type' => $this->options['type'],
+            'ignore_error' => false,
+        );
+        $handler = new ElasticSearchHandler($this->client, $this->options);
+        $this->assertEquals($expected, $handler->getOptions());
+    }
+
+    /**
+     * @covers       Monolog\Handler\ElasticSearchHandler::bulkSend
+     * @dataProvider providerTestConnectionErrors
+     */
+    public function testConnectionErrors($ignore, $expectedError)
+    {
+        $clientOpts = array('host' => '127.0.0.1', 'port' => 1);
+        $client = new Client($clientOpts);
+        $handlerOpts = array('ignore_error' => $ignore);
+        $handler = new ElasticSearchHandler($client, $handlerOpts);
+
+        if ($expectedError) {
+            $this->setExpectedException($expectedError[0], $expectedError[1]);
+            $handler->handle($this->getRecord());
+        } else {
+            $this->assertFalse($handler->handle($this->getRecord()));
+        }
+    }
+
+    /**
+     * @return array
+     */
+    public function providerTestConnectionErrors()
+    {
+        return array(
+            array(false, array('RuntimeException', 'Error sending messages to Elasticsearch')),
+            array(true, false),
+        );
+    }
+
+    /**
+     * Integration test using localhost Elastic Search server
+     *
+     * @covers Monolog\Handler\ElasticSearchHandler::__construct
+     * @covers Monolog\Handler\ElasticSearchHandler::handleBatch
+     * @covers Monolog\Handler\ElasticSearchHandler::bulkSend
+     * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter
+     */
+    public function testHandleIntegration()
+    {
+        $msg = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $expected = $msg;
+        $expected['datetime'] = $msg['datetime']->format(\DateTime::ISO8601);
+        $expected['context'] = array(
+            'class' => '[object] (stdClass: {})',
+            'foo' => 7,
+            0 => 'bar',
+        );
+
+        $client = new Client();
+        $handler = new ElasticSearchHandler($client, $this->options);
+        try {
+            $handler->handleBatch(array($msg));
+        } catch (\RuntimeException $e) {
+            $this->markTestSkipped("Cannot connect to Elastic Search server on localhost");
+        }
+
+        // check document id from ES server response
+        $documentId = $this->getCreatedDocId($client->getLastResponse());
+        $this->assertNotEmpty($documentId, 'No elastic document id received');
+
+        // retrieve document source from ES and validate
+        $document = $this->getDocSourceFromElastic(
+            $client,
+            $this->options['index'],
+            $this->options['type'],
+            $documentId
+        );
+        $this->assertEquals($expected, $document);
+
+        // remove test index from ES
+        $client->request("/{$this->options['index']}", Request::DELETE);
+    }
+
+    /**
+     * Return last created document id from ES response
+     * @param  Response    $response Elastica Response object
+     * @return string|null
+     */
+    protected function getCreatedDocId(Response $response)
+    {
+        $data = $response->getData();
+        if (!empty($data['items'][0]['create']['_id'])) {
+            return $data['items'][0]['create']['_id'];
+        }
+    }
+
+    /**
+     * Retrieve document by id from Elasticsearch
+     * @param  Client $client     Elastica client
+     * @param  string $index
+     * @param  string $type
+     * @param  string $documentId
+     * @return array
+     */
+    protected function getDocSourceFromElastic(Client $client, $index, $type, $documentId)
+    {
+        $resp = $client->request("/{$index}/{$type}/{$documentId}", Request::GET);
+        $data = $resp->getData();
+        if (!empty($data['_source'])) {
+            return $data['_source'];
+        }
+
+        return array();
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php
new file mode 100644
index 00000000..99785cbb
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php
@@ -0,0 +1,66 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+function error_log()
+{
+    $GLOBALS['error_log'][] = func_get_args();
+}
+
+class ErrorLogHandlerTest extends TestCase
+{
+    protected function setUp()
+    {
+        $GLOBALS['error_log'] = array();
+    }
+
+    /**
+     * @covers Monolog\Handler\ErrorLogHandler::__construct
+     * @expectedException InvalidArgumentException
+     * @expectedExceptionMessage The given message type "42" is not supported
+     */
+    public function testShouldNotAcceptAnInvalidTypeOnContructor()
+    {
+        new ErrorLogHandler(42);
+    }
+
+    /**
+     * @covers Monolog\Handler\ErrorLogHandler::write
+     */
+    public function testShouldLogMessagesUsingErrorLogFuncion()
+    {
+        $type = ErrorLogHandler::OPERATING_SYSTEM;
+        $handler = new ErrorLogHandler($type);
+        $handler->setFormatter(new LineFormatter('%channel%.%level_name%: %message% %context% %extra%', null, true));
+        $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
+
+        $this->assertSame("test.ERROR: Foo\nBar\r\n\r\nBaz [] []", $GLOBALS['error_log'][0][0]);
+        $this->assertSame($GLOBALS['error_log'][0][1], $type);
+
+        $handler = new ErrorLogHandler($type, Logger::DEBUG, true, true);
+        $handler->setFormatter(new LineFormatter(null, null, true));
+        $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
+
+        $this->assertStringMatchesFormat('[%s] test.ERROR: Foo', $GLOBALS['error_log'][1][0]);
+        $this->assertSame($GLOBALS['error_log'][1][1], $type);
+
+        $this->assertStringMatchesFormat('Bar', $GLOBALS['error_log'][2][0]);
+        $this->assertSame($GLOBALS['error_log'][2][1], $type);
+
+        $this->assertStringMatchesFormat('Baz [] []', $GLOBALS['error_log'][3][0]);
+        $this->assertSame($GLOBALS['error_log'][3][1], $type);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php
new file mode 100644
index 00000000..31b7686a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php
@@ -0,0 +1,170 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class FilterHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\FilterHandler::isHandling
+     */
+    public function testIsHandling()
+    {
+        $test    = new TestHandler();
+        $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE);
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::INFO)));
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::NOTICE)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::WARNING)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::ERROR)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::CRITICAL)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::ALERT)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::EMERGENCY)));
+    }
+
+    /**
+     * @covers Monolog\Handler\FilterHandler::handle
+     * @covers Monolog\Handler\FilterHandler::setAcceptedLevels
+     * @covers Monolog\Handler\FilterHandler::isHandling
+     */
+    public function testHandleProcessOnlyNeededLevels()
+    {
+        $test    = new TestHandler();
+        $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE);
+
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertTrue($test->hasInfoRecords());
+        $handler->handle($this->getRecord(Logger::NOTICE));
+        $this->assertTrue($test->hasNoticeRecords());
+
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertFalse($test->hasWarningRecords());
+        $handler->handle($this->getRecord(Logger::ERROR));
+        $this->assertFalse($test->hasErrorRecords());
+        $handler->handle($this->getRecord(Logger::CRITICAL));
+        $this->assertFalse($test->hasCriticalRecords());
+        $handler->handle($this->getRecord(Logger::ALERT));
+        $this->assertFalse($test->hasAlertRecords());
+        $handler->handle($this->getRecord(Logger::EMERGENCY));
+        $this->assertFalse($test->hasEmergencyRecords());
+
+        $test    = new TestHandler();
+        $handler = new FilterHandler($test, array(Logger::INFO, Logger::ERROR));
+
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertTrue($test->hasInfoRecords());
+        $handler->handle($this->getRecord(Logger::NOTICE));
+        $this->assertFalse($test->hasNoticeRecords());
+        $handler->handle($this->getRecord(Logger::ERROR));
+        $this->assertTrue($test->hasErrorRecords());
+        $handler->handle($this->getRecord(Logger::CRITICAL));
+        $this->assertFalse($test->hasCriticalRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FilterHandler::setAcceptedLevels
+     * @covers Monolog\Handler\FilterHandler::getAcceptedLevels
+     */
+    public function testAcceptedLevelApi()
+    {
+        $test    = new TestHandler();
+        $handler = new FilterHandler($test);
+
+        $levels = array(Logger::INFO, Logger::ERROR);
+        $handler->setAcceptedLevels($levels);
+        $this->assertSame($levels, $handler->getAcceptedLevels());
+
+        $handler->setAcceptedLevels(array('info', 'error'));
+        $this->assertSame($levels, $handler->getAcceptedLevels());
+
+        $levels = array(Logger::CRITICAL, Logger::ALERT, Logger::EMERGENCY);
+        $handler->setAcceptedLevels(Logger::CRITICAL, Logger::EMERGENCY);
+        $this->assertSame($levels, $handler->getAcceptedLevels());
+
+        $handler->setAcceptedLevels('critical', 'emergency');
+        $this->assertSame($levels, $handler->getAcceptedLevels());
+    }
+
+    /**
+     * @covers Monolog\Handler\FilterHandler::handle
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test    = new TestHandler();
+        $handler = new FilterHandler($test, Logger::DEBUG, Logger::EMERGENCY);
+        $handler->pushProcessor(
+            function ($record) {
+                $record['extra']['foo'] = true;
+
+                return $record;
+            }
+        );
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+
+    /**
+     * @covers Monolog\Handler\FilterHandler::handle
+     */
+    public function testHandleRespectsBubble()
+    {
+        $test = new TestHandler();
+
+        $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, false);
+        $this->assertTrue($handler->handle($this->getRecord(Logger::INFO)));
+        $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING)));
+
+        $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, true);
+        $this->assertFalse($handler->handle($this->getRecord(Logger::INFO)));
+        $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING)));
+    }
+
+    /**
+     * @covers Monolog\Handler\FilterHandler::handle
+     */
+    public function testHandleWithCallback()
+    {
+        $test    = new TestHandler();
+        $handler = new FilterHandler(
+            function ($record, $handler) use ($test) {
+                return $test;
+            }, Logger::INFO, Logger::NOTICE, false
+        );
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertTrue($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FilterHandler::handle
+     * @expectedException \RuntimeException
+     */
+    public function testHandleWithBadCallbackThrowsException()
+    {
+        $handler = new FilterHandler(
+            function ($record, $handler) {
+                return 'foo';
+            }
+        );
+        $handler->handle($this->getRecord(Logger::WARNING));
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php
new file mode 100644
index 00000000..a3d350d5
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php
@@ -0,0 +1,240 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy;
+use Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy;
+
+class FingersCrossedHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::__construct
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleBuffers()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->close();
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue(count($test->getRecords()) === 3);
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleStopsBufferingAfterTrigger()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test);
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @covers Monolog\Handler\FingersCrossedHandler::reset
+     */
+    public function testHandleRestartBufferingAfterReset()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test);
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->reset();
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleRestartBufferingAfterBeingTriggeredWhenStopBufferingIsDisabled()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::WARNING, 0, false, false);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleBufferLimit()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::WARNING, 2);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertFalse($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleWithCallback()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler(function ($record, $handler) use ($test) {
+                    return $test;
+                });
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue(count($test->getRecords()) === 3);
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @expectedException RuntimeException
+     */
+    public function testHandleWithBadCallbackThrowsException()
+    {
+        $handler = new FingersCrossedHandler(function ($record, $handler) {
+                    return 'foo';
+                });
+        $handler->handle($this->getRecord(Logger::WARNING));
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::isHandling
+     */
+    public function testIsHandlingAlways()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::ERROR);
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::__construct
+     * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct
+     * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated
+     */
+    public function testErrorLevelActivationStrategy()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertTrue($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::__construct
+     * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct
+     * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated
+     */
+    public function testErrorLevelActivationStrategyWithPsrLevel()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy('warning'));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertTrue($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct
+     * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated
+     */
+    public function testChannelLevelActivationStrategy()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy(Logger::ERROR, array('othertest' => Logger::DEBUG)));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertFalse($test->hasWarningRecords());
+        $record = $this->getRecord(Logger::DEBUG);
+        $record['channel'] = 'othertest';
+        $handler->handle($record);
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertTrue($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct
+     * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated
+     */
+    public function testChannelLevelActivationStrategyWithPsrLevels()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy('error', array('othertest' => 'debug')));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertFalse($test->hasWarningRecords());
+        $record = $this->getRecord(Logger::DEBUG);
+        $record['channel'] = 'othertest';
+        $handler->handle($record);
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertTrue($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::INFO);
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::close
+     */
+    public function testPassthruOnClose()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, Logger::INFO);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->close();
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertTrue($test->hasInfoRecords());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php
new file mode 100644
index 00000000..0eb10a63
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php
@@ -0,0 +1,96 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\FirePHPHandler
+ */
+class FirePHPHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        TestFirePHPHandler::reset();
+        $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; FirePHP/1.0';
+    }
+
+    public function testHeaders()
+    {
+        $handler = new TestFirePHPHandler;
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-Wf-Protocol-1'    => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
+            'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
+            'X-Wf-1-Plugin-1'    => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
+            'X-Wf-1-1-1-1'       => 'test',
+            'X-Wf-1-1-1-2'       => 'test',
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+    }
+
+    public function testConcurrentHandlers()
+    {
+        $handler = new TestFirePHPHandler;
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $handler2 = new TestFirePHPHandler;
+        $handler2->setFormatter($this->getIdentityFormatter());
+        $handler2->handle($this->getRecord(Logger::DEBUG));
+        $handler2->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-Wf-Protocol-1'    => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
+            'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
+            'X-Wf-1-Plugin-1'    => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
+            'X-Wf-1-1-1-1'       => 'test',
+            'X-Wf-1-1-1-2'       => 'test',
+        );
+
+        $expected2 = array(
+            'X-Wf-1-1-1-3'       => 'test',
+            'X-Wf-1-1-1-4'       => 'test',
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+        $this->assertEquals($expected2, $handler2->getHeaders());
+    }
+}
+
+class TestFirePHPHandler extends FirePHPHandler
+{
+    protected $headers = array();
+
+    public static function reset()
+    {
+        self::$initialized = false;
+        self::$sendHeaders = true;
+        self::$messageIndex = 1;
+    }
+
+    protected function sendHeader($header, $content)
+    {
+        $this->headers[$header] = $content;
+    }
+
+    public function getHeaders()
+    {
+        return $this->headers;
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php
new file mode 100644
index 00000000..91cdd312
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php
@@ -0,0 +1,85 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Logger;
+use Monolog\TestCase;
+
+/**
+ * @coversDefaultClass \Monolog\Handler\FleepHookHandler
+ */
+class FleepHookHandlerTest extends TestCase
+{
+    /**
+     * Default token to use in tests
+     */
+    const TOKEN = '123abc';
+
+    /**
+     * @var FleepHookHandler
+     */
+    private $handler;
+
+    public function setUp()
+    {
+        parent::setUp();
+
+        if (!extension_loaded('openssl')) {
+            $this->markTestSkipped('This test requires openssl extension to run');
+        }
+
+        // Create instances of the handler and logger for convenience
+        $this->handler = new FleepHookHandler(self::TOKEN);
+    }
+
+    /**
+     * @covers ::__construct
+     */
+    public function testConstructorSetsExpectedDefaults()
+    {
+        $this->assertEquals(Logger::DEBUG, $this->handler->getLevel());
+        $this->assertEquals(true, $this->handler->getBubble());
+    }
+
+    /**
+     * @covers ::getDefaultFormatter
+     */
+    public function testHandlerUsesLineFormatterWhichIgnoresEmptyArrays()
+    {
+        $record = array(
+            'message' => 'msg',
+            'context' => array(),
+            'level' => Logger::DEBUG,
+            'level_name' => Logger::getLevelName(Logger::DEBUG),
+            'channel' => 'channel',
+            'datetime' => new \DateTime(),
+            'extra' => array(),
+        );
+
+        $expectedFormatter = new LineFormatter(null, null, true, true);
+        $expected = $expectedFormatter->format($record);
+
+        $handlerFormatter = $this->handler->getFormatter();
+        $actual = $handlerFormatter->format($record);
+
+        $this->assertEquals($expected, $actual, 'Empty context and extra arrays should not be rendered');
+    }
+
+    /**
+     * @covers ::__construct
+     */
+    public function testConnectionStringisConstructedCorrectly()
+    {
+        $this->assertEquals('ssl://' . FleepHookHandler::FLEEP_HOST . ':443', $this->handler->getConnectionString());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php
new file mode 100644
index 00000000..4b120d51
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php
@@ -0,0 +1,88 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FlowdockFormatter;
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Dominik Liebler <liebler.dominik@gmail.com>
+ * @see    https://www.hipchat.com/docs/api
+ */
+class FlowdockHandlerTest extends TestCase
+{
+    /**
+     * @var resource
+     */
+    private $res;
+
+    /**
+     * @var FlowdockHandler
+     */
+    private $handler;
+
+    public function setUp()
+    {
+        if (!extension_loaded('openssl')) {
+            $this->markTestSkipped('This test requires openssl to run');
+        }
+    }
+
+    public function testWriteHeader()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/v1\/messages\/team_inbox\/.* HTTP\/1.1\\r\\nHost: api.flowdock.com\\r\\nContent-Type: application\/json\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+        return $content;
+    }
+
+    /**
+     * @depends testWriteHeader
+     */
+    public function testWriteContent($content)
+    {
+        $this->assertRegexp('/"source":"test_source"/', $content);
+        $this->assertRegexp('/"from_address":"source@test\.com"/', $content);
+    }
+
+    private function createHandler($token = 'myToken')
+    {
+        $constructorArgs = array($token, Logger::DEBUG);
+        $this->res = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\FlowdockHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $constructorArgs
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->res));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+
+        $this->handler->setFormatter(new FlowdockFormatter('test_source', 'source@test.com'));
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php
new file mode 100644
index 00000000..d60a6db3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php
@@ -0,0 +1,93 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\Message;
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+class GelfHandlerLegacyTest extends TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists('Gelf\MessagePublisher') || !class_exists('Gelf\Message')) {
+            $this->markTestSkipped("mlehner/gelf-php not installed");
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\GelfHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new GelfHandler($this->getMessagePublisher());
+        $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler);
+    }
+
+    protected function getHandler($messagePublisher)
+    {
+        $handler = new GelfHandler($messagePublisher);
+
+        return $handler;
+    }
+
+    protected function getMessagePublisher()
+    {
+        return new MockMessagePublisher('localhost');
+    }
+
+    public function testDebug()
+    {
+        $messagePublisher = $this->getMessagePublisher();
+        $handler = $this->getHandler($messagePublisher);
+
+        $record = $this->getRecord(Logger::DEBUG, "A test debug message");
+        $handler->handle($record);
+
+        $this->assertEquals(7, $messagePublisher->lastMessage->getLevel());
+        $this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
+        $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage());
+        $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
+    }
+
+    public function testWarning()
+    {
+        $messagePublisher = $this->getMessagePublisher();
+        $handler = $this->getHandler($messagePublisher);
+
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $handler->handle($record);
+
+        $this->assertEquals(4, $messagePublisher->lastMessage->getLevel());
+        $this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
+        $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage());
+        $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
+    }
+
+    public function testInjectedGelfMessageFormatter()
+    {
+        $messagePublisher = $this->getMessagePublisher();
+        $handler = $this->getHandler($messagePublisher);
+
+        $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX'));
+
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $record['extra']['blarg'] = 'yep';
+        $record['context']['from'] = 'logger';
+        $handler->handle($record);
+
+        $this->assertEquals('mysystem', $messagePublisher->lastMessage->getHost());
+        $this->assertArrayHasKey('_EXTblarg', $messagePublisher->lastMessage->toArray());
+        $this->assertArrayHasKey('_CTXfrom', $messagePublisher->lastMessage->toArray());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php
new file mode 100644
index 00000000..8cdd64f4
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php
@@ -0,0 +1,117 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\Message;
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+class GelfHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists('Gelf\Publisher') || !class_exists('Gelf\Message')) {
+            $this->markTestSkipped("graylog2/gelf-php not installed");
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\GelfHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new GelfHandler($this->getMessagePublisher());
+        $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler);
+    }
+
+    protected function getHandler($messagePublisher)
+    {
+        $handler = new GelfHandler($messagePublisher);
+
+        return $handler;
+    }
+
+    protected function getMessagePublisher()
+    {
+        return $this->getMock('Gelf\Publisher', array('publish'), array(), '', false);
+    }
+
+    public function testDebug()
+    {
+        $record = $this->getRecord(Logger::DEBUG, "A test debug message");
+        $expectedMessage = new Message();
+        $expectedMessage
+            ->setLevel(7)
+            ->setFacility("test")
+            ->setShortMessage($record['message'])
+            ->setTimestamp($record['datetime'])
+        ;
+
+        $messagePublisher = $this->getMessagePublisher();
+        $messagePublisher->expects($this->once())
+            ->method('publish')
+            ->with($expectedMessage);
+
+        $handler = $this->getHandler($messagePublisher);
+
+        $handler->handle($record);
+    }
+
+    public function testWarning()
+    {
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $expectedMessage = new Message();
+        $expectedMessage
+            ->setLevel(4)
+            ->setFacility("test")
+            ->setShortMessage($record['message'])
+            ->setTimestamp($record['datetime'])
+        ;
+
+        $messagePublisher = $this->getMessagePublisher();
+        $messagePublisher->expects($this->once())
+            ->method('publish')
+            ->with($expectedMessage);
+
+        $handler = $this->getHandler($messagePublisher);
+
+        $handler->handle($record);
+    }
+
+    public function testInjectedGelfMessageFormatter()
+    {
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $record['extra']['blarg'] = 'yep';
+        $record['context']['from'] = 'logger';
+
+        $expectedMessage = new Message();
+        $expectedMessage
+            ->setLevel(4)
+            ->setFacility("test")
+            ->setHost("mysystem")
+            ->setShortMessage($record['message'])
+            ->setTimestamp($record['datetime'])
+            ->setAdditional("EXTblarg", 'yep')
+            ->setAdditional("CTXfrom", 'logger')
+        ;
+
+        $messagePublisher = $this->getMessagePublisher();
+        $messagePublisher->expects($this->once())
+            ->method('publish')
+            ->with($expectedMessage);
+
+        $handler = $this->getHandler($messagePublisher);
+        $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX'));
+        $handler->handle($record);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php
new file mode 100644
index 00000000..c6298a6e
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php
@@ -0,0 +1,89 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class GroupHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\GroupHandler::__construct
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorOnlyTakesHandler()
+    {
+        new GroupHandler(array(new TestHandler(), "foo"));
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::__construct
+     * @covers Monolog\Handler\GroupHandler::handle
+     */
+    public function testHandle()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new GroupHandler($testHandlers);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new GroupHandler($testHandlers);
+        $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::isHandling
+     */
+    public function testIsHandling()
+    {
+        $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING));
+        $handler = new GroupHandler($testHandlers);
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR)));
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::handle
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test = new TestHandler();
+        $handler = new GroupHandler(array($test));
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php
new file mode 100644
index 00000000..d58386a1
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php
@@ -0,0 +1,166 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Rafael Dohms <rafael@doh.ms>
+ * @see    https://www.hipchat.com/docs/api
+ */
+class HipChatHandlerTest extends TestCase
+{
+    private $res;
+    private $handler;
+
+    public function testWriteHeader()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: api.hipchat.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+        return $content;
+    }
+
+    /**
+     * @depends testWriteHeader
+     */
+    public function testWriteContent($content)
+    {
+        $this->assertRegexp('/from=Monolog&room_id=room1&notify=0&message=test1&message_format=text&color=red$/', $content);
+    }
+
+    public function testWriteWithComplexMessage()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content);
+    }
+
+    /**
+     * @dataProvider provideLevelColors
+     */
+    public function testWriteWithErrorLevelsAndColors($level, $expectedColor)
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord($level, 'Backup of database "example" finished in 16 minutes.'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/color='.$expectedColor.'/', $content);
+    }
+
+    public function provideLevelColors()
+    {
+        return array(
+            array(Logger::DEBUG,    'gray'),
+            array(Logger::INFO,     'green'),
+            array(Logger::WARNING,  'yellow'),
+            array(Logger::ERROR,    'red'),
+            array(Logger::CRITICAL, 'red'),
+            array(Logger::ALERT,    'red'),
+            array(Logger::EMERGENCY,'red'),
+            array(Logger::NOTICE,   'green'),
+        );
+    }
+
+    /**
+     * @dataProvider provideBatchRecords
+     */
+    public function testHandleBatch($records, $expectedColor)
+    {
+        $this->createHandler();
+
+        $this->handler->handleBatch($records);
+
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/color='.$expectedColor.'/', $content);
+    }
+
+    public function provideBatchRecords()
+    {
+        return array(
+            array(
+                array(
+                    array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()),
+                    array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
+                    array('level' => Logger::CRITICAL, 'message' => 'Everything is broken!', 'level_name' => 'critical', 'datetime' => new \DateTime())
+                ),
+                'red',
+            ),
+            array(
+                array(
+                    array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()),
+                    array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
+                ),
+                'yellow',
+            ),
+            array(
+                array(
+                    array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()),
+                    array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
+                ),
+                'green',
+            ),
+            array(
+                array(
+                    array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()),
+                ),
+                'gray',
+            ),
+        );
+    }
+
+    private function createHandler($token = 'myToken', $room = 'room1', $name = 'Monolog', $notify = false)
+    {
+        $constructorArgs = array($token, $room, $name, $notify, Logger::DEBUG);
+        $this->res = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\HipChatHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $constructorArgs
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->res));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testCreateWithTooLongName()
+    {
+        $hipChatHandler = new \Monolog\Handler\HipChatHandler('token', 'room', 'SixteenCharsHere');
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php
new file mode 100644
index 00000000..7af60be8
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php
@@ -0,0 +1,84 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Robert Kaufmann III <rok3@rok3.me>
+ */
+class LogEntriesHandlerTest extends TestCase
+{
+    /**
+     * @var resource
+     */
+    private $res;
+
+    /**
+     * @var LogEntriesHandler
+     */
+    private $handler;
+
+    public function testWriteContent()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Critical write test'));
+
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] test.CRITICAL: Critical write test/', $content);
+    }
+
+    public function testWriteBatchContent()
+    {
+        $records = array(
+            $this->getRecord(),
+            $this->getRecord(),
+            $this->getRecord()
+        );
+        $this->createHandler();
+        $this->handler->handleBatch($records);
+
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/(testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] .* \[\] \[\]\n){3}/', $content);
+    }
+
+    private function createHandler()
+    {
+        $useSSL = extension_loaded('openssl');
+        $args = array('testToken', $useSSL, Logger::DEBUG, true);
+        $this->res = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\LogEntriesHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $args
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->res));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php
new file mode 100644
index 00000000..6754f3d6
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php
@@ -0,0 +1,75 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class MailHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\MailHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter->expects($this->once())
+            ->method('formatBatch'); // Each record is formatted
+
+        $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+        $handler->expects($this->once())
+            ->method('send');
+        $handler->expects($this->never())
+            ->method('write'); // write is for individual records
+
+        $handler->setFormatter($formatter);
+
+        $handler->handleBatch($this->getMultipleRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\MailHandler::handleBatch
+     */
+    public function testHandleBatchNotSendsMailIfMessagesAreBelowLevel()
+    {
+        $records = array(
+            $this->getRecord(Logger::DEBUG, 'debug message 1'),
+            $this->getRecord(Logger::DEBUG, 'debug message 2'),
+            $this->getRecord(Logger::INFO, 'information'),
+        );
+
+        $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+        $handler->expects($this->never())
+            ->method('send');
+        $handler->setLevel(Logger::ERROR);
+
+        $handler->handleBatch($records);
+    }
+
+    /**
+     * @covers Monolog\Handler\MailHandler::write
+     */
+    public function testHandle()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+
+        $record = $this->getRecord();
+        $records = array($record);
+        $records[0]['formatted'] = '['.$record['datetime']->format('Y-m-d H:i:s').'] test.WARNING: test [] []'."\n";
+
+        $handler->expects($this->once())
+            ->method('send')
+            ->with($records[0]['formatted'], $records);
+
+        $handler->handle($record);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php b/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php
new file mode 100644
index 00000000..fbaab9bc
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php
@@ -0,0 +1,26 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Raven_Client;
+
+class MockRavenClient extends Raven_Client
+{
+    public function capture($data, $stack, $vars = null)
+    {
+        $this->lastData = $data;
+        $this->lastStack = $stack;
+    }
+
+    public $lastData;
+    public $lastStack;
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php
new file mode 100644
index 00000000..0fdef63a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php
@@ -0,0 +1,65 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class MongoDBHandlerTest extends TestCase
+{
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorShouldThrowExceptionForInvalidMongo()
+    {
+        new MongoDBHandler(new \stdClass(), 'DB', 'Collection');
+    }
+
+    public function testHandle()
+    {
+        $mongo = $this->getMock('Mongo', array('selectCollection'), array(), '', false);
+        $collection = $this->getMock('stdClass', array('save'));
+
+        $mongo->expects($this->once())
+            ->method('selectCollection')
+            ->with('DB', 'Collection')
+            ->will($this->returnValue($collection));
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            'message' => 'test',
+            'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
+            'level' => Logger::WARNING,
+            'level_name' => 'WARNING',
+            'channel' => 'test',
+            'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
+            'extra' => array(),
+        );
+
+        $collection->expects($this->once())
+            ->method('save')
+            ->with($expected);
+
+        $handler = new MongoDBHandler($mongo, 'DB', 'Collection');
+        $handler->handle($record);
+    }
+}
+
+if (!class_exists('Mongo')) {
+    class Mongo
+    {
+        public function selectCollection()
+        {
+        }
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php
new file mode 100644
index 00000000..c2553ee4
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php
@@ -0,0 +1,61 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+class NativeMailerHandlerTest extends TestCase
+{
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorHeaderInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', "receiver@example.org\r\nFrom: faked@attacker.org");
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testSetterHeaderInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+        $mailer->addHeader("Content-Type: text/html\r\nFrom: faked@attacker.org");
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testSetterArrayHeaderInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+        $mailer->addHeader(array("Content-Type: text/html\r\nFrom: faked@attacker.org"));
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testSetterContentTypeInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+        $mailer->setContentType("text/html\r\nFrom: faked@attacker.org");
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testSetterEncodingInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+        $mailer->setEncoding("utf-8\r\nFrom: faked@attacker.org");
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php
new file mode 100644
index 00000000..22014908
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php
@@ -0,0 +1,192 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class NewRelicHandlerTest extends TestCase
+{
+    public static $appname;
+    public static $customParameters;
+    public static $transactionName;
+
+    public function setUp()
+    {
+        self::$appname = null;
+        self::$customParameters = array();
+        self::$transactionName = null;
+    }
+
+    /**
+     * @expectedException Monolog\Handler\MissingExtensionException
+     */
+    public function testThehandlerThrowsAnExceptionIfTheNRExtensionIsNotLoaded()
+    {
+        $handler = new StubNewRelicHandlerWithoutExtension();
+        $handler->handle($this->getRecord(Logger::ERROR));
+    }
+
+    public function testThehandlerCanHandleTheRecord()
+    {
+        $handler = new StubNewRelicHandler();
+        $handler->handle($this->getRecord(Logger::ERROR));
+    }
+
+    public function testThehandlerCanAddContextParamsToTheNewRelicTrace()
+    {
+        $handler = new StubNewRelicHandler();
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('a' => 'b')));
+        $this->assertEquals(array('context_a' => 'b'), self::$customParameters);
+    }
+
+    public function testThehandlerCanAddExplodedContextParamsToTheNewRelicTrace()
+    {
+        $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true);
+        $handler->handle($this->getRecord(
+            Logger::ERROR,
+            'log message',
+            array('a' => array('key1' => 'value1', 'key2' => 'value2'))
+        ));
+        $this->assertEquals(
+            array('context_a_key1' => 'value1', 'context_a_key2' => 'value2'),
+            self::$customParameters
+        );
+    }
+
+    public function testThehandlerCanAddExtraParamsToTheNewRelicTrace()
+    {
+        $record = $this->getRecord(Logger::ERROR, 'log message');
+        $record['extra'] = array('c' => 'd');
+
+        $handler = new StubNewRelicHandler();
+        $handler->handle($record);
+
+        $this->assertEquals(array('extra_c' => 'd'), self::$customParameters);
+    }
+
+    public function testThehandlerCanAddExplodedExtraParamsToTheNewRelicTrace()
+    {
+        $record = $this->getRecord(Logger::ERROR, 'log message');
+        $record['extra'] = array('c' => array('key1' => 'value1', 'key2' => 'value2'));
+
+        $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true);
+        $handler->handle($record);
+
+        $this->assertEquals(
+            array('extra_c_key1' => 'value1', 'extra_c_key2' => 'value2'),
+            self::$customParameters
+        );
+    }
+
+    public function testThehandlerCanAddExtraContextAndParamsToTheNewRelicTrace()
+    {
+        $record = $this->getRecord(Logger::ERROR, 'log message', array('a' => 'b'));
+        $record['extra'] = array('c' => 'd');
+
+        $handler = new StubNewRelicHandler();
+        $handler->handle($record);
+
+        $expected = array(
+            'context_a' => 'b',
+            'extra_c' => 'd',
+        );
+
+        $this->assertEquals($expected, self::$customParameters);
+    }
+
+    public function testTheAppNameIsNullByDefault()
+    {
+        $handler = new StubNewRelicHandler();
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+        $this->assertEquals(null, self::$appname);
+    }
+
+    public function testTheAppNameCanBeInjectedFromtheConstructor()
+    {
+        $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName');
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+        $this->assertEquals('myAppName', self::$appname);
+    }
+
+    public function testTheAppNameCanBeOverriddenFromEachLog()
+    {
+        $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName');
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('appname' => 'logAppName')));
+
+        $this->assertEquals('logAppName', self::$appname);
+    }
+
+    public function testTheTransactionNameIsNullByDefault()
+    {
+        $handler = new StubNewRelicHandler();
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+        $this->assertEquals(null, self::$transactionName);
+    }
+
+    public function testTheTransactionNameCanBeInjectedFromtheConstructor()
+    {
+        $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction');
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+        $this->assertEquals('myTransaction', self::$transactionName);
+    }
+
+    public function testTheTransactionNameCanBeOverriddenFromEachLog()
+    {
+        $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction');
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('transaction_name' => 'logTransactName')));
+
+        $this->assertEquals('logTransactName', self::$transactionName);
+    }
+}
+
+class StubNewRelicHandlerWithoutExtension extends NewRelicHandler
+{
+    protected function isNewRelicEnabled()
+    {
+        return false;
+    }
+}
+
+class StubNewRelicHandler extends NewRelicHandler
+{
+    protected function isNewRelicEnabled()
+    {
+        return true;
+    }
+}
+
+function newrelic_notice_error()
+{
+    return true;
+}
+
+function newrelic_set_appname($appname)
+{
+    return NewRelicHandlerTest::$appname = $appname;
+}
+
+function newrelic_name_transaction($transactionName)
+{
+    return NewRelicHandlerTest::$transactionName = $transactionName;
+}
+
+function newrelic_add_custom_parameter($key, $value)
+{
+    NewRelicHandlerTest::$customParameters[$key] = $value;
+
+    return true;
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php
new file mode 100644
index 00000000..292df78c
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php
@@ -0,0 +1,33 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\NullHandler::handle
+ */
+class NullHandlerTest extends TestCase
+{
+    public function testHandle()
+    {
+        $handler = new NullHandler();
+        $this->assertTrue($handler->handle($this->getRecord()));
+    }
+
+    public function testHandleLowerLevelRecord()
+    {
+        $handler = new NullHandler(Logger::WARNING);
+        $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php
new file mode 100644
index 00000000..64eaab16
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php
@@ -0,0 +1,50 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\PsrHandler::handle
+ */
+class PsrHandlerTest extends TestCase
+{
+    public function logLevelProvider()
+    {
+        $levels = array();
+        $monologLogger = new Logger('');
+
+        foreach ($monologLogger->getLevels() as $levelName => $level) {
+            $levels[] = array($levelName, $level);
+        }
+
+        return $levels;
+    }
+
+    /**
+     * @dataProvider logLevelProvider
+     */
+    public function testHandlesAllLevels($levelName, $level)
+    {
+        $message = 'Hello, world! ' . $level;
+        $context = array('foo' => 'bar', 'level' => $level);
+
+        $psrLogger = $this->getMock('Psr\Log\NullLogger');
+        $psrLogger->expects($this->once())
+            ->method('log')
+            ->with(strtolower($levelName), $message, $context);
+
+        $handler = new PsrHandler($psrLogger);
+        $handler->handle(array('level' => $level, 'level_name' => $levelName, 'message' => $message, 'context' => $context));
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php
new file mode 100644
index 00000000..89408236
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php
@@ -0,0 +1,141 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * Almost all examples (expected header, titles, messages) taken from
+ * https://www.pushover.net/api
+ * @author Sebastian Göttschkes <sebastian.goettschkes@googlemail.com>
+ * @see https://www.pushover.net/api
+ */
+class PushoverHandlerTest extends TestCase
+{
+    private $res;
+    private $handler;
+
+    public function testWriteHeader()
+    {
+        $this->createHandler();
+        $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/1\/messages.json HTTP\/1.1\\r\\nHost: api.pushover.net\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+        return $content;
+    }
+
+    /**
+     * @depends testWriteHeader
+     */
+    public function testWriteContent($content)
+    {
+        $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog&timestamp=\d{10}$/', $content);
+    }
+
+    public function testWriteWithComplexTitle()
+    {
+        $this->createHandler('myToken', 'myUser', 'Backup finished - SQL1', Logger::EMERGENCY);
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/title=Backup\+finished\+-\+SQL1/', $content);
+    }
+
+    public function testWriteWithComplexMessage()
+    {
+        $this->createHandler();
+        $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content);
+    }
+
+    public function testWriteWithTooLongMessage()
+    {
+        $message = str_pad('test', 520, 'a');
+        $this->createHandler();
+        $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, $message));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $expectedMessage = substr($message, 0, 505);
+
+        $this->assertRegexp('/message=' . $expectedMessage . '&title/', $content);
+    }
+
+    public function testWriteWithHighPriority()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog&timestamp=\d{10}&priority=1$/', $content);
+    }
+
+    public function testWriteWithEmergencyPriority()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog&timestamp=\d{10}&priority=2&retry=30&expire=25200$/', $content);
+    }
+
+    public function testWriteToMultipleUsers()
+    {
+        $this->createHandler('myToken', array('userA', 'userB'));
+        $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/token=myToken&user=userA&message=test1&title=Monolog&timestamp=\d{10}&priority=2&retry=30&expire=25200POST/', $content);
+        $this->assertRegexp('/token=myToken&user=userB&message=test1&title=Monolog&timestamp=\d{10}&priority=2&retry=30&expire=25200$/', $content);
+    }
+
+    private function createHandler($token = 'myToken', $user = 'myUser', $title = 'Monolog')
+    {
+        $constructorArgs = array($token, $user, $title);
+        $this->res = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\PushoverHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $constructorArgs
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->res));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php
new file mode 100644
index 00000000..8fe86961
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php
@@ -0,0 +1,150 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+class RavenHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists("Raven_Client")) {
+            $this->markTestSkipped("raven/raven not installed");
+        }
+
+        require_once __DIR__ . '/MockRavenClient.php';
+    }
+
+    /**
+     * @covers Monolog\Handler\RavenHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new RavenHandler($this->getRavenClient());
+        $this->assertInstanceOf('Monolog\Handler\RavenHandler', $handler);
+    }
+
+    protected function getHandler($ravenClient)
+    {
+        $handler = new RavenHandler($ravenClient);
+
+        return $handler;
+    }
+
+    protected function getRavenClient()
+    {
+        $dsn = 'http://43f6017361224d098402974103bfc53d:a6a0538fc2934ba2bed32e08741b2cd3@marca.python.live.cheggnet.com:9000/1';
+
+        return new MockRavenClient($dsn);
+    }
+
+    public function testDebug()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $record = $this->getRecord(Logger::DEBUG, "A test debug message");
+        $handler->handle($record);
+
+        $this->assertEquals($ravenClient::DEBUG, $ravenClient->lastData['level']);
+        $this->assertContains($record['message'], $ravenClient->lastData['message']);
+    }
+
+    public function testWarning()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $handler->handle($record);
+
+        $this->assertEquals($ravenClient::WARNING, $ravenClient->lastData['level']);
+        $this->assertContains($record['message'], $ravenClient->lastData['message']);
+    }
+
+    public function testTag()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $tags = array(1, 2, 'foo');
+        $record = $this->getRecord(Logger::INFO, "test", array('tags' => $tags));
+        $handler->handle($record);
+
+        $this->assertEquals($tags, $ravenClient->lastData['tags']);
+    }
+
+    public function testException()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        try {
+            $this->methodThatThrowsAnException();
+        } catch (\Exception $e) {
+            $record = $this->getRecord(Logger::ERROR, $e->getMessage(), array('exception' => $e));
+            $handler->handle($record);
+        }
+
+        $this->assertEquals($record['message'], $ravenClient->lastData['message']);
+    }
+
+    public function testHandleBatch()
+    {
+        $records = $this->getMultipleRecords();
+        $records[] = $this->getRecord(Logger::WARNING, 'warning');
+        $records[] = $this->getRecord(Logger::WARNING, 'warning');
+
+        $logFormatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $logFormatter->expects($this->once())->method('formatBatch');
+
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter->expects($this->once())->method('format')->with($this->callback(function ($record) {
+            return $record['level'] == 400;
+        }));
+
+        $handler = $this->getHandler($this->getRavenClient());
+        $handler->setBatchFormatter($logFormatter);
+        $handler->setFormatter($formatter);
+        $handler->handleBatch($records);
+    }
+
+    public function testHandleBatchDoNothingIfRecordsAreBelowLevel()
+    {
+        $records = array(
+            $this->getRecord(Logger::DEBUG, 'debug message 1'),
+            $this->getRecord(Logger::DEBUG, 'debug message 2'),
+            $this->getRecord(Logger::INFO, 'information'),
+        );
+
+        $handler = $this->getMock('Monolog\Handler\RavenHandler', null, array($this->getRavenClient()));
+        $handler->expects($this->never())->method('handle');
+        $handler->setLevel(Logger::ERROR);
+        $handler->handleBatch($records);
+    }
+
+    public function testGetSetBatchFormatter()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $handler->setBatchFormatter($formatter = new LineFormatter());
+        $this->assertSame($formatter, $handler->getBatchFormatter());
+    }
+
+    private function methodThatThrowsAnException()
+    {
+        throw new \Exception('This is an exception');
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php
new file mode 100644
index 00000000..3629f8a2
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php
@@ -0,0 +1,71 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+class RedisHandlerTest extends TestCase
+{
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorShouldThrowExceptionForInvalidRedis()
+    {
+        new RedisHandler(new \stdClass(), 'key');
+    }
+
+    public function testConstructorShouldWorkWithPredis()
+    {
+        $redis = $this->getMock('Predis\Client');
+        $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key'));
+    }
+
+    public function testConstructorShouldWorkWithRedis()
+    {
+        $redis = $this->getMock('Redis');
+        $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key'));
+    }
+
+    public function testPredisHandle()
+    {
+        $redis = $this->getMock('Predis\Client', array('rpush'));
+
+        // Predis\Client uses rpush
+        $redis->expects($this->once())
+            ->method('rpush')
+            ->with('key', 'test');
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $handler = new RedisHandler($redis, 'key');
+        $handler->setFormatter(new LineFormatter("%message%"));
+        $handler->handle($record);
+    }
+
+    public function testRedisHandle()
+    {
+        $redis = $this->getMock('Redis', array('rpush'));
+
+        // Redis uses rPush
+        $redis->expects($this->once())
+            ->method('rPush')
+            ->with('key', 'test');
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $handler = new RedisHandler($redis, 'key');
+        $handler->setFormatter(new LineFormatter("%message%"));
+        $handler->handle($record);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php
new file mode 100644
index 00000000..f4cefda1
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php
@@ -0,0 +1,99 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class RotatingFileHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        $dir = __DIR__.'/Fixtures';
+        chmod($dir, 0777);
+        if (!is_writable($dir)) {
+            $this->markTestSkipped($dir.' must be writeable to test the RotatingFileHandler.');
+        }
+    }
+
+    public function testRotationCreatesNewFile()
+    {
+        touch(__DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot');
+
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord());
+
+        $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+        $this->assertTrue(file_exists($log));
+        $this->assertEquals('test', file_get_contents($log));
+    }
+
+    /**
+     * @dataProvider rotationTests
+     */
+    public function testRotation($createFile)
+    {
+        touch($old1 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot');
+        touch($old2 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 2).'.rot');
+        touch($old3 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 3).'.rot');
+        touch($old4 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 4).'.rot');
+
+        $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+
+        if ($createFile) {
+            touch($log);
+        }
+
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2);
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord());
+
+        $handler->close();
+
+        $this->assertTrue(file_exists($log));
+        $this->assertTrue(file_exists($old1));
+        $this->assertEquals($createFile, file_exists($old2));
+        $this->assertEquals($createFile, file_exists($old3));
+        $this->assertEquals($createFile, file_exists($old4));
+        $this->assertEquals('test', file_get_contents($log));
+    }
+
+    public function rotationTests()
+    {
+        return array(
+            'Rotation is triggered when the file of the current day is not present'
+                => array(true),
+            'Rotation is not triggered when the file is already present'
+                => array(false),
+        );
+    }
+
+    public function testReuseCurrentFile()
+    {
+        $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+        file_put_contents($log, "foo");
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord());
+        $this->assertEquals('footest', file_get_contents($log));
+    }
+
+    public function tearDown()
+    {
+        foreach (glob(__DIR__.'/Fixtures/*.rot') as $file) {
+            unlink($file);
+        }
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php
new file mode 100644
index 00000000..b354cee1
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php
@@ -0,0 +1,33 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @covers Monolog\Handler\SamplingHandler::handle
+ */
+class SamplingHandlerTest extends TestCase
+{
+    public function testHandle()
+    {
+        $testHandler = new TestHandler();
+        $handler = new SamplingHandler($testHandler, 2);
+        for ($i = 0; $i < 10000; $i++) {
+            $handler->handle($this->getRecord());
+        }
+        $count = count($testHandler->getRecords());
+        // $count should be half of 10k, so between 4k and 6k
+        $this->assertLessThan(6000, $count);
+        $this->assertGreaterThan(4000, $count);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php
new file mode 100644
index 00000000..d657fae3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php
@@ -0,0 +1,133 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Greg Kedzierski <greg@gregkedzierski.com>
+ * @see    https://api.slack.com/
+ */
+class SlackHandlerTest extends TestCase
+{
+    /**
+     * @var resource
+     */
+    private $res;
+
+    /**
+     * @var SlackHandler
+     */
+    private $handler;
+
+    public function setUp()
+    {
+        if (!extension_loaded('openssl')) {
+            $this->markTestSkipped('This test requires openssl to run');
+        }
+    }
+
+    public function testWriteHeader()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/api\/chat.postMessage HTTP\/1.1\\r\\nHost: slack.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+    }
+
+    public function testWriteContent()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/token=myToken&channel=channel1&username=Monolog&text=&attachments=.*$/', $content);
+    }
+
+    public function testWriteContentWithEmoji()
+    {
+        $this->createHandler('myToken', 'channel1', 'Monolog', true, 'alien');
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/icon_emoji=%3Aalien%3A$/', $content);
+    }
+
+    /**
+     * @dataProvider provideLevelColors
+     */
+    public function testWriteContentWithColors($level, $expectedColor)
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord($level, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/color%22%3A%22'.$expectedColor.'/', $content);
+    }
+
+    public function testWriteContentWithPlainTextMessage()
+    {
+        $this->createHandler('myToken', 'channel1', 'Monolog', false);
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/text=test1/', $content);
+    }
+
+    public function provideLevelColors()
+    {
+        return array(
+            array(Logger::DEBUG,    '%23e3e4e6'),   // escaped #e3e4e6
+            array(Logger::INFO,     'good'),
+            array(Logger::NOTICE,   'good'),
+            array(Logger::WARNING,  'warning'),
+            array(Logger::ERROR,    'danger'),
+            array(Logger::CRITICAL, 'danger'),
+            array(Logger::ALERT,    'danger'),
+            array(Logger::EMERGENCY,'danger'),
+        );
+    }
+
+    private function createHandler($token = 'myToken', $channel = 'channel1', $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $useShortAttachment = false, $includeExtra = false)
+    {
+        $constructorArgs = array($token, $channel, $username, $useAttachment, $iconEmoji, Logger::DEBUG, true, $useShortAttachment, $includeExtra);
+        $this->res = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\SlackHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $constructorArgs
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->res));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php
new file mode 100644
index 00000000..2e3d504a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php
@@ -0,0 +1,282 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Pablo de Leon Belloc <pablolb@gmail.com>
+ */
+class SocketHandlerTest extends TestCase
+{
+    /**
+     * @var Monolog\Handler\SocketHandler
+     */
+    private $handler;
+
+    /**
+     * @var resource
+     */
+    private $res;
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testInvalidHostname()
+    {
+        $this->createHandler('garbage://here');
+        $this->writeRecord('data');
+    }
+
+    /**
+     * @expectedException \InvalidArgumentException
+     */
+    public function testBadConnectionTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setConnectionTimeout(-1);
+    }
+
+    public function testSetConnectionTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setConnectionTimeout(10.1);
+        $this->assertEquals(10.1, $this->handler->getConnectionTimeout());
+    }
+
+    /**
+     * @expectedException \InvalidArgumentException
+     */
+    public function testBadTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setTimeout(-1);
+    }
+
+    public function testSetTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setTimeout(10.25);
+        $this->assertEquals(10.25, $this->handler->getTimeout());
+    }
+
+    public function testSetConnectionString()
+    {
+        $this->createHandler('tcp://localhost:9090');
+        $this->assertEquals('tcp://localhost:9090', $this->handler->getConnectionString());
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownOnFsockopenError()
+    {
+        $this->setMockHandler(array('fsockopen'));
+        $this->handler->expects($this->once())
+            ->method('fsockopen')
+            ->will($this->returnValue(false));
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownOnPfsockopenError()
+    {
+        $this->setMockHandler(array('pfsockopen'));
+        $this->handler->expects($this->once())
+            ->method('pfsockopen')
+            ->will($this->returnValue(false));
+        $this->handler->setPersistent(true);
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownIfCannotSetTimeout()
+    {
+        $this->setMockHandler(array('streamSetTimeout'));
+        $this->handler->expects($this->once())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(false));
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testWriteFailsOnIfFwriteReturnsFalse()
+    {
+        $this->setMockHandler(array('fwrite'));
+
+        $callback = function ($arg) {
+            $map = array(
+                'Hello world' => 6,
+                'world' => false,
+            );
+
+            return $map[$arg];
+        };
+
+        $this->handler->expects($this->exactly(2))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testWriteFailsIfStreamTimesOut()
+    {
+        $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+        $callback = function ($arg) {
+            $map = array(
+                'Hello world' => 6,
+                'world' => 5,
+            );
+
+            return $map[$arg];
+        };
+
+        $this->handler->expects($this->exactly(1))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+        $this->handler->expects($this->exactly(1))
+            ->method('streamGetMetadata')
+            ->will($this->returnValue(array('timed_out' => true)));
+
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testWriteFailsOnIncompleteWrite()
+    {
+        $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+        $res = $this->res;
+        $callback = function ($string) use ($res) {
+            fclose($res);
+
+            return strlen('Hello');
+        };
+
+        $this->handler->expects($this->exactly(1))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+        $this->handler->expects($this->exactly(1))
+            ->method('streamGetMetadata')
+            ->will($this->returnValue(array('timed_out' => false)));
+
+        $this->writeRecord('Hello world');
+    }
+
+    public function testWriteWithMemoryFile()
+    {
+        $this->setMockHandler();
+        $this->writeRecord('test1');
+        $this->writeRecord('test2');
+        $this->writeRecord('test3');
+        fseek($this->res, 0);
+        $this->assertEquals('test1test2test3', fread($this->res, 1024));
+    }
+
+    public function testWriteWithMock()
+    {
+        $this->setMockHandler(array('fwrite'));
+
+        $callback = function ($arg) {
+            $map = array(
+                'Hello world' => 6,
+                'world' => 5,
+            );
+
+            return $map[$arg];
+        };
+
+        $this->handler->expects($this->exactly(2))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+
+        $this->writeRecord('Hello world');
+    }
+
+    public function testClose()
+    {
+        $this->setMockHandler();
+        $this->writeRecord('Hello world');
+        $this->assertInternalType('resource', $this->res);
+        $this->handler->close();
+        $this->assertFalse(is_resource($this->res), "Expected resource to be closed after closing handler");
+    }
+
+    public function testCloseDoesNotClosePersistentSocket()
+    {
+        $this->setMockHandler();
+        $this->handler->setPersistent(true);
+        $this->writeRecord('Hello world');
+        $this->assertTrue(is_resource($this->res));
+        $this->handler->close();
+        $this->assertTrue(is_resource($this->res));
+    }
+
+    private function createHandler($connectionString)
+    {
+        $this->handler = new SocketHandler($connectionString);
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+
+    private function writeRecord($string)
+    {
+        $this->handler->handle($this->getRecord(Logger::WARNING, $string));
+    }
+
+    private function setMockHandler(array $methods = array())
+    {
+        $this->res = fopen('php://memory', 'a');
+
+        $defaultMethods = array('fsockopen', 'pfsockopen', 'streamSetTimeout');
+        $newMethods = array_diff($methods, $defaultMethods);
+
+        $finalMethods = array_merge($defaultMethods, $newMethods);
+
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\SocketHandler', $finalMethods, array('localhost:1234')
+        );
+
+        if (!in_array('fsockopen', $methods)) {
+            $this->handler->expects($this->any())
+                ->method('fsockopen')
+                ->will($this->returnValue($this->res));
+        }
+
+        if (!in_array('pfsockopen', $methods)) {
+            $this->handler->expects($this->any())
+                ->method('pfsockopen')
+                ->will($this->returnValue($this->res));
+        }
+
+        if (!in_array('streamSetTimeout', $methods)) {
+            $this->handler->expects($this->any())
+                ->method('streamSetTimeout')
+                ->will($this->returnValue(true));
+        }
+
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php
new file mode 100644
index 00000000..44d3d9f1
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php
@@ -0,0 +1,118 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class StreamHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWrite()
+    {
+        $handle = fopen('php://memory', 'a+');
+        $handler = new StreamHandler($handle);
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::WARNING, 'test'));
+        $handler->handle($this->getRecord(Logger::WARNING, 'test2'));
+        $handler->handle($this->getRecord(Logger::WARNING, 'test3'));
+        fseek($handle, 0);
+        $this->assertEquals('testtest2test3', fread($handle, 100));
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::close
+     */
+    public function testClose()
+    {
+        $handle = fopen('php://memory', 'a+');
+        $handler = new StreamHandler($handle);
+        $this->assertTrue(is_resource($handle));
+        $handler->close();
+        $this->assertFalse(is_resource($handle));
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteCreatesTheStreamResource()
+    {
+        $handler = new StreamHandler('php://memory');
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteLocking()
+    {
+        $temp = sys_get_temp_dir() . DIRECTORY_SEPARATOR . 'monolog_locked_log';
+        $handler = new StreamHandler($temp, Logger::DEBUG, true, null, true);
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @expectedException LogicException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteMissingResource()
+    {
+        $handler = new StreamHandler(null);
+        $handler->handle($this->getRecord());
+    }
+
+    public function invalidArgumentProvider()
+    {
+        return array(
+            array(1),
+            array(array()),
+            array(array('bogus://url')),
+        );
+    }
+
+    /**
+     * @dataProvider invalidArgumentProvider
+     * @expectedException InvalidArgumentException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     */
+    public function testWriteInvalidArgument($invalidArgument)
+    {
+        $handler = new StreamHandler($invalidArgument);
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteInvalidResource()
+    {
+        $handler = new StreamHandler('bogus://url');
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteNonExistingResource()
+    {
+        $handler = new StreamHandler('/foo/bar/baz/'.rand(0, 10000));
+        $handler->handle($this->getRecord());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php
new file mode 100644
index 00000000..8f9e46bf
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php
@@ -0,0 +1,44 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+class SyslogHandlerTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Handler\SyslogHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new SyslogHandler('test');
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+        $handler = new SyslogHandler('test', LOG_USER);
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+        $handler = new SyslogHandler('test', 'user');
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+        $handler = new SyslogHandler('test', LOG_USER, Logger::DEBUG, true, LOG_PERROR);
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+    }
+
+    /**
+     * @covers Monolog\Handler\SyslogHandler::__construct
+     */
+    public function testConstructInvalidFacility()
+    {
+        $this->setExpectedException('UnexpectedValueException');
+        $handler = new SyslogHandler('test', 'unknown');
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php
new file mode 100644
index 00000000..497812b3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php
@@ -0,0 +1,49 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * @requires extension sockets
+ */
+class SyslogUdpHandlerTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testWeValidateFacilities()
+    {
+        $handler = new SyslogUdpHandler("ip", null, "invalidFacility");
+    }
+
+    public function testWeSplitIntoLines()
+    {
+        $handler = new SyslogUdpHandler("127.0.0.1", 514, "authpriv");
+        $handler->setFormatter(new \Monolog\Formatter\ChromePHPFormatter());
+
+        $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('write'), array('lol', 'lol'));
+        $socket->expects($this->at(0))
+            ->method('write')
+            ->with("lol", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 ");
+        $socket->expects($this->at(1))
+            ->method('write')
+            ->with("hej", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 ");
+
+        $handler->setSocket($socket);
+
+        $handler->handle($this->getRecordWithMessage("hej\nlol"));
+    }
+
+    protected function getRecordWithMessage($msg)
+    {
+        return array('message' => $msg, 'level' => \Monolog\Logger::WARNING, 'context' => null, 'extra' => array(), 'channel' => 'lol');
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php
new file mode 100644
index 00000000..801d80a9
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php
@@ -0,0 +1,56 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\TestHandler
+ */
+class TestHandlerTest extends TestCase
+{
+    /**
+     * @dataProvider methodProvider
+     */
+    public function testHandler($method, $level)
+    {
+        $handler = new TestHandler;
+        $record = $this->getRecord($level, 'test'.$method);
+        $this->assertFalse($handler->{'has'.$method}($record));
+        $this->assertFalse($handler->{'has'.$method.'Records'}());
+        $handler->handle($record);
+
+        $this->assertFalse($handler->{'has'.$method}('bar'));
+        $this->assertTrue($handler->{'has'.$method}($record));
+        $this->assertTrue($handler->{'has'.$method}('test'.$method));
+        $this->assertTrue($handler->{'has'.$method.'Records'}());
+
+        $records = $handler->getRecords();
+        unset($records[0]['formatted']);
+        $this->assertEquals(array($record), $records);
+    }
+
+    public function methodProvider()
+    {
+        return array(
+            array('Emergency', Logger::EMERGENCY),
+            array('Alert'    , Logger::ALERT),
+            array('Critical' , Logger::CRITICAL),
+            array('Error'    , Logger::ERROR),
+            array('Warning'  , Logger::WARNING),
+            array('Info'     , Logger::INFO),
+            array('Notice'   , Logger::NOTICE),
+            array('Debug'    , Logger::DEBUG),
+        );
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php
new file mode 100644
index 00000000..bcaf52b3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php
@@ -0,0 +1,46 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @requires extension sockets
+ */
+class UdpSocketTest extends TestCase
+{
+    public function testWeDoNotTruncateShortMessages()
+    {
+        $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol'));
+
+        $socket->expects($this->at(0))
+            ->method('send')
+            ->with("HEADER: The quick brown fox jumps over the lazy dog");
+
+        $socket->write("The quick brown fox jumps over the lazy dog", "HEADER: ");
+    }
+
+    public function testLongMessagesAreTruncated()
+    {
+        $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol'));
+
+        $truncatedString = str_repeat("derp", 16254).'d';
+
+        $socket->expects($this->exactly(1))
+            ->method('send')
+            ->with("HEADER" . $truncatedString);
+
+        $longString = str_repeat("derp", 20000);
+
+        $socket->write($longString, "HEADER");
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php
new file mode 100644
index 00000000..8d37a1fc
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php
@@ -0,0 +1,121 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class WhatFailureGroupHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::__construct
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorOnlyTakesHandler()
+    {
+        new WhatFailureGroupHandler(array(new TestHandler(), "foo"));
+    }
+
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::__construct
+     * @covers Monolog\Handler\WhatFailureGroupHandler::handle
+     */
+    public function testHandle()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new WhatFailureGroupHandler($testHandlers);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new WhatFailureGroupHandler($testHandlers);
+        $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::isHandling
+     */
+    public function testIsHandling()
+    {
+        $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING));
+        $handler = new WhatFailureGroupHandler($testHandlers);
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR)));
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::handle
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test = new TestHandler();
+        $handler = new WhatFailureGroupHandler(array($test));
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::handle
+     */
+    public function testHandleException()
+    {
+        $test = new TestHandler();
+        $exception = new ExceptionTestHandler();
+        $handler = new WhatFailureGroupHandler(array($exception, $test, $exception));
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+}
+
+class ExceptionTestHandler extends TestHandler
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        parent::handle($record);
+
+        throw new \Exception("ExceptionTestHandler::handle");
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php
new file mode 100644
index 00000000..416039e6
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php
@@ -0,0 +1,69 @@
+<?php
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+class ZendMonitorHandlerTest extends TestCase
+{
+    protected $zendMonitorHandler;
+
+    public function setUp()
+    {
+        if (!function_exists('zend_monitor_custom_event')) {
+            $this->markTestSkipped('ZendServer is not installed');
+        }
+    }
+
+    /**
+     * @covers  Monolog\Handler\ZendMonitorHandler::write
+     */
+    public function testWrite()
+    {
+        $record = $this->getRecord();
+        $formatterResult = array(
+            'message' => $record['message']
+        );
+
+        $zendMonitor = $this->getMockBuilder('Monolog\Handler\ZendMonitorHandler')
+            ->setMethods(array('writeZendMonitorCustomEvent', 'getDefaultFormatter'))
+            ->getMock();
+
+        $formatterMock = $this->getMockBuilder('Monolog\Formatter\NormalizerFormatter')
+            ->disableOriginalConstructor()
+            ->getMock();
+
+        $formatterMock->expects($this->once())
+            ->method('format')
+            ->will($this->returnValue($formatterResult));
+
+        $zendMonitor->expects($this->once())
+            ->method('getDefaultFormatter')
+            ->will($this->returnValue($formatterMock));
+
+        $levelMap = $zendMonitor->getLevelMap();
+
+        $zendMonitor->expects($this->once())
+            ->method('writeZendMonitorCustomEvent')
+            ->with($levelMap[$record['level']], $record['message'], $formatterResult);
+
+        $zendMonitor->handle($record);
+    }
+
+    /**
+     * @covers Monolog\Handler\ZendMonitorHandler::getDefaultFormatter
+     */
+    public function testGetDefaultFormatterReturnsNormalizerFormatter()
+    {
+        $zendMonitor = new ZendMonitorHandler();
+        $this->assertInstanceOf('Monolog\Formatter\NormalizerFormatter', $zendMonitor->getDefaultFormatter());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/LoggerTest.php b/vendor/monolog/monolog/tests/Monolog/LoggerTest.php
new file mode 100644
index 00000000..7a19c0b4
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/LoggerTest.php
@@ -0,0 +1,409 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Processor\WebProcessor;
+use Monolog\Handler\TestHandler;
+
+class LoggerTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Logger::getName
+     */
+    public function testGetName()
+    {
+        $logger = new Logger('foo');
+        $this->assertEquals('foo', $logger->getName());
+    }
+
+    /**
+     * @covers Monolog\Logger::getLevelName
+     */
+    public function testGetLevelName()
+    {
+        $this->assertEquals('ERROR', Logger::getLevelName(Logger::ERROR));
+    }
+
+    /**
+     * @covers Monolog\Logger::getLevelName
+     * @expectedException InvalidArgumentException
+     */
+    public function testGetLevelNameThrows()
+    {
+        Logger::getLevelName(5);
+    }
+
+    /**
+     * @covers Monolog\Logger::__construct
+     */
+    public function testChannel()
+    {
+        $logger = new Logger('foo');
+        $handler = new TestHandler;
+        $logger->pushHandler($handler);
+        $logger->addWarning('test');
+        list($record) = $handler->getRecords();
+        $this->assertEquals('foo', $record['channel']);
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testLog()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'));
+        $handler->expects($this->once())
+            ->method('handle');
+        $logger->pushHandler($handler);
+
+        $this->assertTrue($logger->addWarning('test'));
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testLogNotHandled()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'), array(Logger::ERROR));
+        $handler->expects($this->never())
+            ->method('handle');
+        $logger->pushHandler($handler);
+
+        $this->assertFalse($logger->addWarning('test'));
+    }
+
+    public function testHandlersInCtor()
+    {
+        $handler1 = new TestHandler;
+        $handler2 = new TestHandler;
+        $logger = new Logger(__METHOD__, array($handler1, $handler2));
+
+        $this->assertEquals($handler1, $logger->popHandler());
+        $this->assertEquals($handler2, $logger->popHandler());
+    }
+
+    public function testProcessorsInCtor()
+    {
+        $processor1 = new WebProcessor;
+        $processor2 = new WebProcessor;
+        $logger = new Logger(__METHOD__, array(), array($processor1, $processor2));
+
+        $this->assertEquals($processor1, $logger->popProcessor());
+        $this->assertEquals($processor2, $logger->popProcessor());
+    }
+
+    /**
+     * @covers Monolog\Logger::pushHandler
+     * @covers Monolog\Logger::popHandler
+     * @expectedException LogicException
+     */
+    public function testPushPopHandler()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler1 = new TestHandler;
+        $handler2 = new TestHandler;
+
+        $logger->pushHandler($handler1);
+        $logger->pushHandler($handler2);
+
+        $this->assertEquals($handler2, $logger->popHandler());
+        $this->assertEquals($handler1, $logger->popHandler());
+        $logger->popHandler();
+    }
+
+    /**
+     * @covers Monolog\Logger::pushProcessor
+     * @covers Monolog\Logger::popProcessor
+     * @expectedException LogicException
+     */
+    public function testPushPopProcessor()
+    {
+        $logger = new Logger(__METHOD__);
+        $processor1 = new WebProcessor;
+        $processor2 = new WebProcessor;
+
+        $logger->pushProcessor($processor1);
+        $logger->pushProcessor($processor2);
+
+        $this->assertEquals($processor2, $logger->popProcessor());
+        $this->assertEquals($processor1, $logger->popProcessor());
+        $logger->popProcessor();
+    }
+
+    /**
+     * @covers Monolog\Logger::pushProcessor
+     * @expectedException InvalidArgumentException
+     */
+    public function testPushProcessorWithNonCallable()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $logger->pushProcessor(new \stdClass());
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testProcessorsAreExecuted()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler = new TestHandler;
+        $logger->pushHandler($handler);
+        $logger->pushProcessor(function ($record) {
+            $record['extra']['win'] = true;
+
+            return $record;
+        });
+        $logger->addError('test');
+        list($record) = $handler->getRecords();
+        $this->assertTrue($record['extra']['win']);
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testProcessorsAreCalledOnlyOnce()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler->expects($this->any())
+            ->method('handle')
+            ->will($this->returnValue(true))
+        ;
+        $logger->pushHandler($handler);
+
+        $processor = $this->getMockBuilder('Monolog\Processor\WebProcessor')
+            ->disableOriginalConstructor()
+            ->setMethods(array('__invoke'))
+            ->getMock()
+        ;
+        $processor->expects($this->once())
+            ->method('__invoke')
+            ->will($this->returnArgument(0))
+        ;
+        $logger->pushProcessor($processor);
+
+        $logger->addError('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testProcessorsNotCalledWhenNotHandled()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler->expects($this->once())
+            ->method('isHandling')
+            ->will($this->returnValue(false))
+        ;
+        $logger->pushHandler($handler);
+        $that = $this;
+        $logger->pushProcessor(function ($record) use ($that) {
+            $that->fail('The processor should not be called');
+        });
+        $logger->addAlert('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testHandlersNotCalledBeforeFirstHandling()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler1->expects($this->never())
+            ->method('isHandling')
+            ->will($this->returnValue(false))
+        ;
+        $handler1->expects($this->once())
+            ->method('handle')
+            ->will($this->returnValue(false))
+        ;
+        $logger->pushHandler($handler1);
+
+        $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler2->expects($this->once())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler2->expects($this->once())
+            ->method('handle')
+            ->will($this->returnValue(false))
+        ;
+        $logger->pushHandler($handler2);
+
+        $handler3 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler3->expects($this->once())
+            ->method('isHandling')
+            ->will($this->returnValue(false))
+        ;
+        $handler3->expects($this->never())
+            ->method('handle')
+        ;
+        $logger->pushHandler($handler3);
+
+        $logger->debug('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testBubblingWhenTheHandlerReturnsFalse()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler1->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler1->expects($this->once())
+            ->method('handle')
+            ->will($this->returnValue(false))
+        ;
+        $logger->pushHandler($handler1);
+
+        $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler2->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler2->expects($this->once())
+            ->method('handle')
+            ->will($this->returnValue(false))
+        ;
+        $logger->pushHandler($handler2);
+
+        $logger->debug('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testNotBubblingWhenTheHandlerReturnsTrue()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler1->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler1->expects($this->never())
+            ->method('handle')
+        ;
+        $logger->pushHandler($handler1);
+
+        $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler2->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler2->expects($this->once())
+            ->method('handle')
+            ->will($this->returnValue(true))
+        ;
+        $logger->pushHandler($handler2);
+
+        $logger->debug('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::isHandling
+     */
+    public function testIsHandling()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler1->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(false))
+        ;
+
+        $logger->pushHandler($handler1);
+        $this->assertFalse($logger->isHandling(Logger::DEBUG));
+
+        $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler2->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+
+        $logger->pushHandler($handler2);
+        $this->assertTrue($logger->isHandling(Logger::DEBUG));
+    }
+
+    /**
+     * @dataProvider logMethodProvider
+     * @covers Monolog\Logger::addDebug
+     * @covers Monolog\Logger::addInfo
+     * @covers Monolog\Logger::addNotice
+     * @covers Monolog\Logger::addWarning
+     * @covers Monolog\Logger::addError
+     * @covers Monolog\Logger::addCritical
+     * @covers Monolog\Logger::addAlert
+     * @covers Monolog\Logger::addEmergency
+     * @covers Monolog\Logger::debug
+     * @covers Monolog\Logger::info
+     * @covers Monolog\Logger::notice
+     * @covers Monolog\Logger::warn
+     * @covers Monolog\Logger::err
+     * @covers Monolog\Logger::crit
+     * @covers Monolog\Logger::alert
+     * @covers Monolog\Logger::emerg
+     */
+    public function testLogMethods($method, $expectedLevel)
+    {
+        $logger = new Logger('foo');
+        $handler = new TestHandler;
+        $logger->pushHandler($handler);
+        $logger->{$method}('test');
+        list($record) = $handler->getRecords();
+        $this->assertEquals($expectedLevel, $record['level']);
+    }
+
+    public function logMethodProvider()
+    {
+        return array(
+            // monolog methods
+            array('addDebug',     Logger::DEBUG),
+            array('addInfo',      Logger::INFO),
+            array('addNotice',    Logger::NOTICE),
+            array('addWarning',   Logger::WARNING),
+            array('addError',     Logger::ERROR),
+            array('addCritical',  Logger::CRITICAL),
+            array('addAlert',     Logger::ALERT),
+            array('addEmergency', Logger::EMERGENCY),
+
+            // ZF/Sf2 compat methods
+            array('debug',  Logger::DEBUG),
+            array('info',   Logger::INFO),
+            array('notice', Logger::NOTICE),
+            array('warn',   Logger::WARNING),
+            array('err',    Logger::ERROR),
+            array('crit',   Logger::CRITICAL),
+            array('alert',  Logger::ALERT),
+            array('emerg',  Logger::EMERGENCY),
+        );
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php
new file mode 100644
index 00000000..5adb505d
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php
@@ -0,0 +1,29 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class GitProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\GitProcessor::__invoke
+     */
+    public function testProcessor()
+    {
+        $processor = new GitProcessor();
+        $record = $processor($this->getRecord());
+
+        $this->assertArrayHasKey('git', $record['extra']);
+        $this->assertTrue(!is_array($record['extra']['git']['branch']));
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php
new file mode 100644
index 00000000..0dd411d7
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php
@@ -0,0 +1,123 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Acme;
+
+class Tester
+{
+    public function test($handler, $record)
+    {
+        $handler->handle($record);
+    }
+}
+
+function tester($handler, $record)
+{
+    $handler->handle($record);
+}
+
+namespace Monolog\Processor;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+use Monolog\Handler\TestHandler;
+
+class IntrospectionProcessorTest extends TestCase
+{
+    public function getHandler()
+    {
+        $processor = new IntrospectionProcessor();
+        $handler = new TestHandler();
+        $handler->pushProcessor($processor);
+
+        return $handler;
+    }
+
+    public function testProcessorFromClass()
+    {
+        $handler = $this->getHandler();
+        $tester = new \Acme\Tester;
+        $tester->test($handler, $this->getRecord());
+        list($record) = $handler->getRecords();
+        $this->assertEquals(__FILE__, $record['extra']['file']);
+        $this->assertEquals(18, $record['extra']['line']);
+        $this->assertEquals('Acme\Tester', $record['extra']['class']);
+        $this->assertEquals('test', $record['extra']['function']);
+    }
+
+    public function testProcessorFromFunc()
+    {
+        $handler = $this->getHandler();
+        \Acme\tester($handler, $this->getRecord());
+        list($record) = $handler->getRecords();
+        $this->assertEquals(__FILE__, $record['extra']['file']);
+        $this->assertEquals(24, $record['extra']['line']);
+        $this->assertEquals(null, $record['extra']['class']);
+        $this->assertEquals('Acme\tester', $record['extra']['function']);
+    }
+
+    public function testLevelTooLow()
+    {
+        $input = array(
+            'level' => Logger::DEBUG,
+            'extra' => array(),
+        );
+
+        $expected = $input;
+
+        $processor = new IntrospectionProcessor(Logger::CRITICAL);
+        $actual = $processor($input);
+
+        $this->assertEquals($expected, $actual);
+    }
+
+    public function testLevelEqual()
+    {
+        $input = array(
+            'level' => Logger::CRITICAL,
+            'extra' => array(),
+        );
+
+        $expected = $input;
+        $expected['extra'] = array(
+            'file' => null,
+            'line' => null,
+            'class' => 'ReflectionMethod',
+            'function' => 'invokeArgs',
+        );
+
+        $processor = new IntrospectionProcessor(Logger::CRITICAL);
+        $actual = $processor($input);
+
+        $this->assertEquals($expected, $actual);
+    }
+
+    public function testLevelHigher()
+    {
+        $input = array(
+            'level' => Logger::EMERGENCY,
+            'extra' => array(),
+        );
+
+        $expected = $input;
+        $expected['extra'] = array(
+            'file' => null,
+            'line' => null,
+            'class' => 'ReflectionMethod',
+            'function' => 'invokeArgs',
+        );
+
+        $processor = new IntrospectionProcessor(Logger::CRITICAL);
+        $actual = $processor($input);
+
+        $this->assertEquals($expected, $actual);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php
new file mode 100644
index 00000000..eb666144
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php
@@ -0,0 +1,42 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class MemoryPeakUsageProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke
+     * @covers Monolog\Processor\MemoryProcessor::formatBytes
+     */
+    public function testProcessor()
+    {
+        $processor = new MemoryPeakUsageProcessor();
+        $record = $processor($this->getRecord());
+        $this->assertArrayHasKey('memory_peak_usage', $record['extra']);
+        $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_peak_usage']);
+    }
+
+    /**
+     * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke
+     * @covers Monolog\Processor\MemoryProcessor::formatBytes
+     */
+    public function testProcessorWithoutFormatting()
+    {
+        $processor = new MemoryPeakUsageProcessor(true, false);
+        $record = $processor($this->getRecord());
+        $this->assertArrayHasKey('memory_peak_usage', $record['extra']);
+        $this->assertInternalType('int', $record['extra']['memory_peak_usage']);
+        $this->assertGreaterThan(0, $record['extra']['memory_peak_usage']);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php
new file mode 100644
index 00000000..4692dbfc
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php
@@ -0,0 +1,42 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class MemoryUsageProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\MemoryUsageProcessor::__invoke
+     * @covers Monolog\Processor\MemoryProcessor::formatBytes
+     */
+    public function testProcessor()
+    {
+        $processor = new MemoryUsageProcessor();
+        $record = $processor($this->getRecord());
+        $this->assertArrayHasKey('memory_usage', $record['extra']);
+        $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_usage']);
+    }
+
+    /**
+     * @covers Monolog\Processor\MemoryUsageProcessor::__invoke
+     * @covers Monolog\Processor\MemoryProcessor::formatBytes
+     */
+    public function testProcessorWithoutFormatting()
+    {
+        $processor = new MemoryUsageProcessor(true, false);
+        $record = $processor($this->getRecord());
+        $this->assertArrayHasKey('memory_usage', $record['extra']);
+        $this->assertInternalType('int', $record['extra']['memory_usage']);
+        $this->assertGreaterThan(0, $record['extra']['memory_usage']);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php
new file mode 100644
index 00000000..458d2a33
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php
@@ -0,0 +1,30 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class ProcessIdProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\ProcessIdProcessor::__invoke
+     */
+    public function testProcessor()
+    {
+        $processor = new ProcessIdProcessor();
+        $record = $processor($this->getRecord());
+        $this->assertArrayHasKey('process_id', $record['extra']);
+        $this->assertInternalType('int', $record['extra']['process_id']);
+        $this->assertGreaterThan(0, $record['extra']['process_id']);
+        $this->assertEquals(getmypid(), $record['extra']['process_id']);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php
new file mode 100644
index 00000000..81bfbdc3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php
@@ -0,0 +1,43 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+class PsrLogMessageProcessorTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @dataProvider getPairs
+     */
+    public function testReplacement($val, $expected)
+    {
+        $proc = new PsrLogMessageProcessor;
+
+        $message = $proc(array(
+            'message' => '{foo}',
+            'context' => array('foo' => $val)
+        ));
+        $this->assertEquals($expected, $message['message']);
+    }
+
+    public function getPairs()
+    {
+        return array(
+            array('foo',    'foo'),
+            array('3',      '3'),
+            array(3,        '3'),
+            array(null,     ''),
+            array(true,     '1'),
+            array(false,    ''),
+            array(new \stdClass, '[object stdClass]'),
+            array(array(), '[array]'),
+        );
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php
new file mode 100644
index 00000000..851a9dc2
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php
@@ -0,0 +1,29 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class TagProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\TagProcessor::__invoke
+     */
+    public function testProcessor()
+    {
+        $tags = array(1, 2, 3);
+        $processor = new TagProcessor($tags);
+        $record = $processor($this->getRecord());
+
+        $this->assertEquals($tags, $record['extra']['tags']);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php
new file mode 100644
index 00000000..7ced62ca
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php
@@ -0,0 +1,27 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class UidProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\UidProcessor::__invoke
+     */
+    public function testProcessor()
+    {
+        $processor = new UidProcessor();
+        $record = $processor($this->getRecord());
+        $this->assertArrayHasKey('uid', $record['extra']);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php
new file mode 100644
index 00000000..dba89412
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php
@@ -0,0 +1,98 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class WebProcessorTest extends TestCase
+{
+    public function testProcessor()
+    {
+        $server = array(
+            'REQUEST_URI'    => 'A',
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+            'HTTP_REFERER'   => 'D',
+            'SERVER_NAME'    => 'F',
+            'UNIQUE_ID'      => 'G',
+        );
+
+        $processor = new WebProcessor($server);
+        $record = $processor($this->getRecord());
+        $this->assertEquals($server['REQUEST_URI'], $record['extra']['url']);
+        $this->assertEquals($server['REMOTE_ADDR'], $record['extra']['ip']);
+        $this->assertEquals($server['REQUEST_METHOD'], $record['extra']['http_method']);
+        $this->assertEquals($server['HTTP_REFERER'], $record['extra']['referrer']);
+        $this->assertEquals($server['SERVER_NAME'], $record['extra']['server']);
+        $this->assertEquals($server['UNIQUE_ID'], $record['extra']['unique_id']);
+    }
+
+    public function testProcessorDoNothingIfNoRequestUri()
+    {
+        $server = array(
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+        );
+        $processor = new WebProcessor($server);
+        $record = $processor($this->getRecord());
+        $this->assertEmpty($record['extra']);
+    }
+
+    public function testProcessorReturnNullIfNoHttpReferer()
+    {
+        $server = array(
+            'REQUEST_URI'    => 'A',
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+            'SERVER_NAME'    => 'F',
+        );
+        $processor = new WebProcessor($server);
+        $record = $processor($this->getRecord());
+        $this->assertNull($record['extra']['referrer']);
+    }
+
+    public function testProcessorDoesNotAddUniqueIdIfNotPresent()
+    {
+        $server = array(
+            'REQUEST_URI'    => 'A',
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+            'SERVER_NAME'    => 'F',
+        );
+        $processor = new WebProcessor($server);
+        $record = $processor($this->getRecord());
+        $this->assertFalse(isset($record['extra']['unique_id']));
+    }
+
+    public function testProcessorAddsOnlyRequestedExtraFields()
+    {
+        $server = array(
+            'REQUEST_URI'    => 'A',
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+            'SERVER_NAME'    => 'F',
+        );
+
+        $processor = new WebProcessor($server, array('url', 'http_method'));
+        $record = $processor($this->getRecord());
+
+        $this->assertSame(array('url' => 'A', 'http_method' => 'C'), $record['extra']);
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testInvalidData()
+    {
+        new WebProcessor(new \stdClass);
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php b/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php
new file mode 100644
index 00000000..ab899449
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php
@@ -0,0 +1,47 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\TestHandler;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Processor\PsrLogMessageProcessor;
+use Psr\Log\Test\LoggerInterfaceTest;
+
+class PsrLogCompatTest extends LoggerInterfaceTest
+{
+    private $handler;
+
+    public function getLogger()
+    {
+        $logger = new Logger('foo');
+        $logger->pushHandler($handler = new TestHandler);
+        $logger->pushProcessor(new PsrLogMessageProcessor);
+        $handler->setFormatter(new LineFormatter('%level_name% %message%'));
+
+        $this->handler = $handler;
+
+        return $logger;
+    }
+
+    public function getLogs()
+    {
+        $convert = function ($record) {
+            $lower = function ($match) {
+                return strtolower($match[0]);
+            };
+
+            return preg_replace_callback('{^[A-Z]+}', $lower, $record['formatted']);
+        };
+
+        return array_map($convert, $this->handler->getRecords());
+    }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/TestCase.php b/vendor/monolog/monolog/tests/Monolog/TestCase.php
new file mode 100644
index 00000000..cae79340
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/TestCase.php
@@ -0,0 +1,58 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+class TestCase extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @return array Record
+     */
+    protected function getRecord($level = Logger::WARNING, $message = 'test', $context = array())
+    {
+        return array(
+            'message' => $message,
+            'context' => $context,
+            'level' => $level,
+            'level_name' => Logger::getLevelName($level),
+            'channel' => 'test',
+            'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true))),
+            'extra' => array(),
+        );
+    }
+
+    /**
+     * @return array
+     */
+    protected function getMultipleRecords()
+    {
+        return array(
+            $this->getRecord(Logger::DEBUG, 'debug message 1'),
+            $this->getRecord(Logger::DEBUG, 'debug message 2'),
+            $this->getRecord(Logger::INFO, 'information'),
+            $this->getRecord(Logger::WARNING, 'warning'),
+            $this->getRecord(Logger::ERROR, 'error')
+        );
+    }
+
+    /**
+     * @return Monolog\Formatter\FormatterInterface
+     */
+    protected function getIdentityFormatter()
+    {
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter->expects($this->any())
+            ->method('format')
+            ->will($this->returnCallback(function ($record) { return $record['message']; }));
+
+        return $formatter;
+    }
+}
diff --git a/vendor/monolog/monolog/tests/bootstrap.php b/vendor/monolog/monolog/tests/bootstrap.php
new file mode 100644
index 00000000..b78740e2
--- /dev/null
+++ b/vendor/monolog/monolog/tests/bootstrap.php
@@ -0,0 +1,15 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+$loader = require __DIR__ . "/../vendor/autoload.php";
+$loader->addPsr4('Monolog\\', __DIR__.'/Monolog');
+
+date_default_timezone_set('UTC');