summaryrefslogtreecommitdiff
path: root/vendor
diff options
context:
space:
mode:
authorPierre Schmitz <pierre@archlinux.de>2015-08-16 08:22:05 +0200
committerPierre Schmitz <pierre@archlinux.de>2015-08-16 08:22:05 +0200
commit1a365e77dfb8825136626202b1df462731b42060 (patch)
tree1dc4468eaabf070e051e790a9e67a9a9a2c63d99 /vendor
parenta72fd280f7acb4d2a1ba579a0f1b2b2ae8958530 (diff)
Update to MediaWiki 1.25.2
Diffstat (limited to 'vendor')
-rw-r--r--vendor/README.md28
-rw-r--r--vendor/autoload.php2
-rw-r--r--vendor/composer.json25
-rw-r--r--vendor/composer.lock525
-rw-r--r--vendor/composer/ClassLoader.php8
-rw-r--r--vendor/composer/autoload_classmap.php260
-rw-r--r--vendor/composer/autoload_namespaces.php5
-rw-r--r--vendor/composer/autoload_psr4.php3
-rw-r--r--vendor/composer/autoload_real.php9
-rw-r--r--vendor/composer/installed.json381
-rw-r--r--vendor/monolog/monolog/CHANGELOG.mdown202
-rw-r--r--vendor/monolog/monolog/LICENSE19
-rw-r--r--vendor/monolog/monolog/README.mdown283
-rw-r--r--vendor/monolog/monolog/composer.json50
-rw-r--r--vendor/monolog/monolog/doc/extending.md76
-rw-r--r--vendor/monolog/monolog/doc/sockets.md37
-rw-r--r--vendor/monolog/monolog/doc/usage.md162
-rw-r--r--vendor/monolog/monolog/phpunit.xml.dist15
-rw-r--r--vendor/monolog/monolog/src/Monolog/ErrorHandler.php208
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php79
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/ElasticaFormatter.php87
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/FlowdockFormatter.php104
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php36
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php101
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/HtmlFormatter.php140
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php116
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php159
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php47
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php165
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php105
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php141
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php48
-rw-r--r--vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php113
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php184
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php66
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php92
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php98
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php184
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php117
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php204
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php72
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php145
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php45
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php89
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php128
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php82
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php140
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php28
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php59
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php34
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php150
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php195
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php126
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php103
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php72
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php80
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php90
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php300
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php55
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php98
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php55
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php69
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php21
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php55
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php155
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php174
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php45
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php56
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php172
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php181
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php58
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php73
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php153
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php83
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php234
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php284
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php104
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php56
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php67
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php46
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php80
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php140
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php57
-rw-r--r--vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php95
-rw-r--r--vendor/monolog/monolog/src/Monolog/Logger.php615
-rw-r--r--vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php64
-rw-r--r--vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php82
-rw-r--r--vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php40
-rw-r--r--vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php63
-rw-r--r--vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php40
-rw-r--r--vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php31
-rw-r--r--vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php48
-rw-r--r--vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php34
-rw-r--r--vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php38
-rw-r--r--vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php105
-rw-r--r--vendor/monolog/monolog/src/Monolog/Registry.php118
-rw-r--r--vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php31
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php158
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php79
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php55
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php189
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php78
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php208
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php40
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php289
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php253
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php247
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php98
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php142
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Functional/Handler/FirePHPHandlerTest.php32
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php115
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php80
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php137
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php130
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php158
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php141
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php41
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php52
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php73
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php239
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php66
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php170
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php240
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php96
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php85
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php88
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php93
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php117
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php89
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php166
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php84
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php75
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php26
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php65
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php61
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php192
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php33
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php50
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php141
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php150
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php71
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php99
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php33
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php133
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php282
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php118
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php44
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php49
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php56
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php46
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php121
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php69
-rw-r--r--vendor/monolog/monolog/tests/Monolog/LoggerTest.php409
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php29
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php123
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php42
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php42
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php30
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php43
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php29
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php27
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php98
-rw-r--r--vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php47
-rw-r--r--vendor/monolog/monolog/tests/Monolog/TestCase.php58
-rw-r--r--vendor/monolog/monolog/tests/bootstrap.php15
-rw-r--r--vendor/oojs/oojs-ui/.mailmap18
-rw-r--r--vendor/psr/log/Psr/Log/LoggerAwareTrait.php22
-rw-r--r--vendor/psr/log/Psr/Log/LoggerTrait.php131
-rw-r--r--vendor/ruflin/elastica/LICENSE.txt21
-rw-r--r--vendor/ruflin/elastica/README.markdown29
-rw-r--r--vendor/ruflin/elastica/Vagrantfile14
-rw-r--r--vendor/ruflin/elastica/build.xml232
-rw-r--r--vendor/ruflin/elastica/changes.txt797
-rw-r--r--vendor/ruflin/elastica/composer.json40
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/AbstractUpdateAction.php544
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/AbstractAggregation.php88
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/AbstractSimpleAggregation.php33
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/Avg.php14
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/Cardinality.php14
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/DateHistogram.php82
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/DateRange.php21
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/ExtendedStats.php13
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/Filter.php41
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/GeoDistance.php90
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/GeohashGrid.php61
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/GlobalAggregation.php13
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/Histogram.php55
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/IpRange.php66
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/Max.php13
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/Min.php13
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/Missing.php31
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/Nested.php31
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/Range.php45
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/ReverseNested.php50
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/Stats.php13
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/Sum.php13
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/Terms.php97
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Aggregation/ValueCount.php31
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Bulk.php423
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Bulk/Action.php219
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Bulk/Action/AbstractDocument.php162
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Bulk/Action/CreateDocument.php11
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Bulk/Action/DeleteDocument.php33
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Bulk/Action/IndexDocument.php52
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Bulk/Action/UpdateDocument.php69
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Bulk/Response.php47
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Bulk/ResponseSet.php142
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Client.php691
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Cluster.php181
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Cluster/Health.php189
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Cluster/Health/Index.php142
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Cluster/Health/Shard.php107
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Cluster/Settings.php197
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Connection.php274
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Document.php334
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/Bulk/Response/ActionException.php66
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/Bulk/ResponseException.php103
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/Bulk/UdpException.php9
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/BulkException.php7
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/ClientException.php14
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/Connection/GuzzleException.php51
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/Connection/HttpException.php88
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/Connection/ThriftException.php51
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/ConnectionException.php65
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/ElasticsearchException.php99
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/ExceptionInterface.php14
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/InvalidException.php14
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/JSONParseException.php12
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/NotFoundException.php14
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/NotImplementedException.php16
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/PartialShardFailureException.php33
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/ResponseException.php76
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Exception/RuntimeException.php14
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Facet/AbstractFacet.php141
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Facet/DateHistogram.php44
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Facet/Filter.php27
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Facet/GeoCluster.php54
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Facet/GeoDistance.php66
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Facet/Histogram.php90
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Facet/Query.php27
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Facet/Range.php138
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Facet/Statistical.php61
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Facet/Terms.php129
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Facet/TermsStats.php103
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/AbstractFilter.php57
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/AbstractGeoDistance.php190
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/AbstractGeoShape.php50
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/AbstractMulti.php77
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Bool.php146
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/BoolAnd.php22
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/BoolNot.php43
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/BoolOr.php22
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Exists.php35
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/GeoBoundingBox.php49
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/GeoDistance.php73
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/GeoDistanceRange.php101
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/GeoPolygon.php59
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/GeoShapePreIndexed.php85
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/GeoShapeProvided.php74
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/GeohashCell.php45
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/HasChild.php78
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/HasParent.php77
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Ids.php92
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Indices.php51
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Limit.php36
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/MatchAll.php22
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Missing.php37
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Nested.php60
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/NumericRange.php15
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Prefix.php79
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Query.php90
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Range.php61
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Regexp.php80
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Script.php49
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Term.php47
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Terms.php132
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Filter/Type.php60
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Index.php462
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Index/Settings.php318
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Index/Stats.php109
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Index/Status.php144
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/JSON.php67
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Log.php84
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Multi/ResultSet.php208
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Multi/Search.php198
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Node.php130
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Node/Info.php196
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Node/Stats.php115
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Param.php162
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Percolator.php132
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query.php420
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/AbstractQuery.php15
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Bool.php92
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Boosting.php44
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Builder.php933
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Common.php150
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/ConstantScore.php68
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/DisMax.php59
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Filtered.php95
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/FunctionScore.php201
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Fuzzy.php84
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/FuzzyLikeThis.php215
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/HasChild.php63
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/HasParent.php62
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Ids.php117
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Match.php198
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/MatchAll.php22
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/MoreLikeThis.php162
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/MultiMatch.php180
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Nested.php47
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Prefix.php48
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/QueryString.php267
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Range.php39
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Simple.php55
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/SimpleQueryString.php65
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Term.php49
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Terms.php103
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/TopChildren.php52
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Query/Wildcard.php41
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Request.php200
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Rescore/AbstractRescore.php36
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Rescore/Query.php90
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Response.php299
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Result.php216
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/ResultSet.php383
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/ScanAndScroll.php150
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Script.php148
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/ScriptFields.php63
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Search.php514
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/SearchableInterface.php52
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Snapshot.php155
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Status.php179
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Suggest.php62
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Suggest/AbstractSuggest.php92
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Suggest/CandidateGenerator/AbstractCandidateGenerator.php11
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Suggest/CandidateGenerator/DirectGenerator.php127
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Suggest/Phrase.php148
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Suggest/Term.php115
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Transport/AbstractTransport.php109
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Transport/Guzzle.php179
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Transport/Http.php188
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Transport/Https.php30
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Transport/Memcache.php82
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Transport/Null.php44
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Transport/Thrift.php173
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Type.php537
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Type/AbstractType.php200
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Type/Mapping.php280
-rw-r--r--vendor/ruflin/elastica/lib/Elastica/Util.php171
-rw-r--r--vendor/ruflin/elastica/phpdoc.dist.xml13
-rw-r--r--vendor/ruflin/elastica/test/benchmark/BulkMemoryUsageTest.php46
-rw-r--r--vendor/ruflin/elastica/test/benchmark/ClientTest.php31
-rw-r--r--vendor/ruflin/elastica/test/benchmark/TransportTest.php252
-rw-r--r--vendor/ruflin/elastica/test/benchmark/phpunit.benchmark.xml10
-rw-r--r--vendor/ruflin/elastica/test/benchmark/phpunit.xhprof.xml39
-rw-r--r--vendor/ruflin/elastica/test/bin/install_php_memcache.sh8
-rw-r--r--vendor/ruflin/elastica/test/bin/run_elasticsearch.sh56
-rw-r--r--vendor/ruflin/elastica/test/bin/run_proxy.sh15
-rw-r--r--vendor/ruflin/elastica/test/bin/show_logs.sh3
-rw-r--r--vendor/ruflin/elastica/test/bootstrap.php5
-rw-r--r--vendor/ruflin/elastica/test/data/test.docbin0 -> 22016 bytes
-rw-r--r--vendor/ruflin/elastica/test/data/test.docxbin0 -> 25890 bytes
-rw-r--r--vendor/ruflin/elastica/test/data/test.pdfbin0 -> 16107 bytes
-rw-r--r--vendor/ruflin/elastica/test/data/test.txt1
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/AvgTest.php38
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/BaseAggregationTest.php28
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/CardinalityTest.php38
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/DateHistogramTest.php43
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/DateRangeTest.php51
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/ExtendedStatsTest.php43
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/FilterTest.php78
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/GeoDistanceTest.php45
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/GeohashGridTest.php45
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/GlobalAggregationTest.php27
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/HistogramTest.php45
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/IpRangeTest.php56
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/MaxTest.php72
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/MinTest.php38
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/MissingTest.php37
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/NestedTest.php62
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/RangeTest.php41
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/ReverseNestedTest.php124
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/StatsTest.php42
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/SumTest.php38
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/TermsTest.php39
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Aggregation/ValueCountTest.php38
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Base.php31
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Bulk/ActionTest.php69
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Bulk/ResponseSetTest.php188
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/BulkTest.php711
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/ClientTest.php1008
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Cluster/Health/IndexTest.php113
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Cluster/Health/ShardTest.php63
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Cluster/HealthTest.php113
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Cluster/SettingsTest.php110
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/ClusterTest.php89
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/ConnectionTest.php103
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/DocumentTest.php309
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/ExampleTest.php58
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Exception/NotImplementedTest.php23
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Exception/PartialShardFailureExceptionTest.php55
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Exception/ResponseExceptionTest.php60
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Facet/DateHistogramTest.php59
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Facet/FilterTest.php40
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Facet/GeoClusterTest.php49
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Facet/QueryTest.php40
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Facet/StatisticalTest.php82
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Facet/TermsStatsTest.php105
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Facet/TermsTest.php69
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/AbstractTest.php69
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/BoolAndTest.php65
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/BoolNotTest.php25
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/BoolOrTest.php42
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/BoolTest.php107
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/ExistsTests.php31
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/GeoDistanceRangeTest.php218
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/GeoDistanceTest.php129
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/GeoPolygonTest.php65
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/GeoShapePreIndexedTest.php90
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/GeoShapeProvidedTest.php88
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/GeohashCellTest.php60
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/HasChildTest.php166
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/HasParentTest.php139
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/IdsTest.php201
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/IndicesTest.php93
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/MatchAllTest.php18
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/MultiTest.php95
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/NestedFilterWithSetFilterTest.php121
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/NestedTest.php121
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/NumericRangeTest.php32
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/PrefixTest.php149
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/QueryTest.php46
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/RangeTest.php32
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/RegexpTest.php137
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/ScriptTest.php52
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/TermTest.php23
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/TermsTest.php54
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Filter/TypeTest.php27
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Index/SettingsTest.php300
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Index/StatsTest.php23
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Index/StatusTest.php66
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/IndexTest.php696
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/LogTest.php153
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Multi/SearchTest.php549
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Node/InfoTest.php42
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/NodeTest.php84
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/ParamTest.php97
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/PercolatorTest.php224
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/BoolTest.php114
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/BoostingTest.php99
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/BuilderTest.php270
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/CommonTest.php59
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/ConstantScoreTest.php158
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/DisMaxTest.php83
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/FilteredTest.php112
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/FunctionScoreTest.php210
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/FuzzyLikeThisTest.php228
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/FuzzyTest.php129
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/HasChildTest.php107
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/HasParentTest.php50
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/HighlightTest.php49
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/IdsTest.php165
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/MatchAllTest.php44
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/MatchTest.php187
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/MoreLikeThisTest.php176
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/MultiMatchTest.php187
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/NestedTest.php28
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/PostFilterTest.php83
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/PrefixTest.php26
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/QueryStringTest.php126
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/RangeTest.php73
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/RescoreTest.php165
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/SimpleQueryStringTest.php73
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/SimpleTest.php17
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/TermTest.php26
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/TermsTest.php62
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Query/WildcardTest.php101
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/QueryTest.php194
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/RequestTest.php87
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/ResponseTest.php94
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/ResultSetTest.php93
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/ResultTest.php121
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/ScanAndScrollTest.php115
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/ScriptFieldsTest.php95
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/ScriptTest.php129
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/SearchTest.php500
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/SnapshotTest.php112
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/StatusTest.php116
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Suggest/PhraseTest.php85
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Suggest/TermTest.php104
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Transport/AbstractTransportTest.php77
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Transport/GuzzleTest.php163
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Transport/HttpTest.php227
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Transport/MemcacheTest.php51
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Transport/NullTest.php59
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Transport/ThriftTest.php132
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/Type/MappingTest.php304
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/TypeTest.php823
-rw-r--r--vendor/ruflin/elastica/test/lib/Elastica/Test/UtilTest.php77
-rw-r--r--vendor/ruflin/elastica/test/nginx/nginx.conf24
-rw-r--r--vendor/ruflin/elastica/test/phpunit.xml.dist32
-rw-r--r--vendor/zordius/lightncandy/build/gen_doc6
-rw-r--r--vendor/zordius/lightncandy/build/gen_test.php64
-rw-r--r--vendor/zordius/lightncandy/build/push_ghpage12
-rw-r--r--vendor/zordius/lightncandy/build/runphp2
-rw-r--r--vendor/zordius/lightncandy/build/travis_push60
506 files changed, 55538 insertions, 454 deletions
diff --git a/vendor/README.md b/vendor/README.md
new file mode 100644
index 00000000..247d4df5
--- /dev/null
+++ b/vendor/README.md
@@ -0,0 +1,28 @@
+MediaWiki-Core-Vendor
+=====================
+
+[Composer] managed libraries required or recommended for use with [MediaWiki].
+This repository is maintained for use on the Wikimedia Foundation production
+and testing clusters, but may be useful for anyone wishing to avoid directly
+managing MediaWiki dependencies with Composer.
+
+
+Usage
+-----
+
+Checkout this library into $IP/vendor using `git clone <URL>` or add the
+repository as a git submodule using `git submodule add <URL> vendor` followed
+by `git submodule update --init`.
+
+
+Adding or updating libraries
+----------------------------
+
+1. Edit the composer.json file
+2. Run `composer update` to download files and update the autoloader files.
+3. Add and commit changes as a gerrit patch.
+4. Review and merge changes.
+
+
+[Composer]: https://getcomposer.org/
+[MediaWiki]: https://www.mediawiki.org/wiki/MediaWiki
diff --git a/vendor/autoload.php b/vendor/autoload.php
index 69e72b37..9bcfa9fe 100644
--- a/vendor/autoload.php
+++ b/vendor/autoload.php
@@ -4,4 +4,4 @@
require_once __DIR__ . '/composer' . '/autoload_real.php';
-return ComposerAutoloaderInit9b10cc5cf6896d6e4a31983fc3498786::getLoader();
+return ComposerAutoloaderInit_mediawiki_vendor::getLoader();
diff --git a/vendor/composer.json b/vendor/composer.json
new file mode 100644
index 00000000..0cee8f3c
--- /dev/null
+++ b/vendor/composer.json
@@ -0,0 +1,25 @@
+{
+ "require": {
+ "cssjanus/cssjanus": "1.1.1",
+ "leafo/lessphp": "0.5.0",
+ "liuggio/statsd-php-client": "1.0.12",
+ "php": ">=5.3.3",
+ "psr/log": "1.0.0",
+ "monolog/monolog": "1.12.0",
+ "ruflin/elastica": "1.3.0.0",
+ "oojs/oojs-ui": "0.11.3",
+ "wikimedia/cdb": "1.0.1",
+ "wikimedia/composer-merge-plugin": "1.0.0",
+ "wikimedia/utfnormal": "1.0.2",
+ "zordius/lightncandy": "0.18"
+ },
+ "prefer-stable": true,
+ "config": {
+ "autoloader-suffix": "_mediawiki_vendor",
+ "classmap-authoritative": true,
+ "preferred-install": "dist",
+ "vendor-dir": ".",
+ "prepend-autoloader": false,
+ "optimize-autoloader": true
+ }
+}
diff --git a/vendor/composer.lock b/vendor/composer.lock
new file mode 100644
index 00000000..e238ed8a
--- /dev/null
+++ b/vendor/composer.lock
@@ -0,0 +1,525 @@
+{
+ "_readme": [
+ "This file locks the dependencies of your project to a known state",
+ "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#composer-lock-the-lock-file",
+ "This file is @generated automatically"
+ ],
+ "hash": "99d794be1df1caf0b238fd68d2a37058",
+ "packages": [
+ {
+ "name": "cssjanus/cssjanus",
+ "version": "v1.1.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/cssjanus/php-cssjanus.git",
+ "reference": "62a9c32e6e140de09082b40a6e99d868ad14d4e0"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/cssjanus/php-cssjanus/zipball/62a9c32e6e140de09082b40a6e99d868ad14d4e0",
+ "reference": "62a9c32e6e140de09082b40a6e99d868ad14d4e0",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.3.3"
+ },
+ "require-dev": {
+ "jakub-onderka/php-parallel-lint": "0.8.*",
+ "phpunit/phpunit": "3.7.*",
+ "squizlabs/php_codesniffer": "1.*"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-0": {
+ "": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "Apache-2.0"
+ ],
+ "description": "Convert CSS stylesheets between left-to-right and right-to-left.",
+ "time": "2014-11-14 20:00:50"
+ },
+ {
+ "name": "leafo/lessphp",
+ "version": "v0.5.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/leafo/lessphp.git",
+ "reference": "0f5a7f5545d2bcf4e9fad9a228c8ad89cc9aa283"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/leafo/lessphp/zipball/0f5a7f5545d2bcf4e9fad9a228c8ad89cc9aa283",
+ "reference": "0f5a7f5545d2bcf4e9fad9a228c8ad89cc9aa283",
+ "shasum": ""
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "0.4.x-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "lessc.inc.php"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT",
+ "GPL-3.0"
+ ],
+ "authors": [
+ {
+ "name": "Leaf Corcoran",
+ "email": "leafot@gmail.com",
+ "homepage": "http://leafo.net"
+ }
+ ],
+ "description": "lessphp is a compiler for LESS written in PHP.",
+ "homepage": "http://leafo.net/lessphp/",
+ "time": "2014-11-24 18:39:20"
+ },
+ {
+ "name": "liuggio/statsd-php-client",
+ "version": "v1.0.12",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/liuggio/statsd-php-client.git",
+ "reference": "a8c9ccd2a3af6cc49c7fc4f5f689d7b148ab19d7"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/liuggio/statsd-php-client/zipball/a8c9ccd2a3af6cc49c7fc4f5f689d7b148ab19d7",
+ "reference": "a8c9ccd2a3af6cc49c7fc4f5f689d7b148ab19d7",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.2"
+ },
+ "require-dev": {
+ "monolog/monolog": ">=1.2.0"
+ },
+ "suggest": {
+ "monolog/monolog": "Monolog, in order to do generate statistic from log >=1.2.0)"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-0": {
+ "Liuggio": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Giulio De Donato",
+ "email": "liuggio@gmail.com"
+ }
+ ],
+ "description": "Statsd (Object Oriented) client library for PHP",
+ "homepage": "https://github.com/liuggio/statsd-php-client/",
+ "keywords": [
+ "etsy",
+ "monitoring",
+ "php",
+ "statsd"
+ ],
+ "time": "2014-09-17 21:37:49"
+ },
+ {
+ "name": "monolog/monolog",
+ "version": "1.12.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/Seldaek/monolog.git",
+ "reference": "1fbe8c2641f2b163addf49cc5e18f144bec6b19f"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/Seldaek/monolog/zipball/1fbe8c2641f2b163addf49cc5e18f144bec6b19f",
+ "reference": "1fbe8c2641f2b163addf49cc5e18f144bec6b19f",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.3.0",
+ "psr/log": "~1.0"
+ },
+ "provide": {
+ "psr/log-implementation": "1.0.0"
+ },
+ "require-dev": {
+ "aws/aws-sdk-php": "~2.4, >2.4.8",
+ "doctrine/couchdb": "~1.0@dev",
+ "graylog2/gelf-php": "~1.0",
+ "phpunit/phpunit": "~4.0",
+ "raven/raven": "~0.5",
+ "ruflin/elastica": "0.90.*",
+ "videlalvaro/php-amqplib": "~2.4"
+ },
+ "suggest": {
+ "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB",
+ "doctrine/couchdb": "Allow sending log messages to a CouchDB server",
+ "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+ "ext-mongo": "Allow sending log messages to a MongoDB server",
+ "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server",
+ "raven/raven": "Allow sending log messages to a Sentry server",
+ "rollbar/rollbar": "Allow sending log messages to Rollbar",
+ "ruflin/elastica": "Allow sending log messages to an Elastic Search server",
+ "videlalvaro/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.12.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Monolog\\": "src/Monolog"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Jordi Boggiano",
+ "email": "j.boggiano@seld.be",
+ "homepage": "http://seld.be"
+ }
+ ],
+ "description": "Sends your logs to files, sockets, inboxes, databases and various web services",
+ "homepage": "http://github.com/Seldaek/monolog",
+ "keywords": [
+ "log",
+ "logging",
+ "psr-3"
+ ],
+ "time": "2014-12-29 21:29:35"
+ },
+ {
+ "name": "oojs/oojs-ui",
+ "version": "v0.11.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/wikimedia/oojs-ui.git",
+ "reference": "a03de5681e28e4fad1e27f8cccab32a2c5b484e5"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/wikimedia/oojs-ui/zipball/a03de5681e28e4fad1e27f8cccab32a2c5b484e5",
+ "reference": "a03de5681e28e4fad1e27f8cccab32a2c5b484e5",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.3.3"
+ },
+ "require-dev": {
+ "jakub-onderka/php-parallel-lint": "0.8.*",
+ "mediawiki/mediawiki-codesniffer": "0.1.0",
+ "squizlabs/php_codesniffer": "2.1.*"
+ },
+ "type": "library",
+ "autoload": {
+ "classmap": [
+ "php/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "Provides library of common widgets, layouts, and windows.",
+ "homepage": "https://www.mediawiki.org/wiki/OOjs_UI",
+ "time": "2015-05-12 11:58:55"
+ },
+ {
+ "name": "psr/log",
+ "version": "1.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/log.git",
+ "reference": "fe0936ee26643249e916849d48e3a51d5f5e278b"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/log/zipball/fe0936ee26643249e916849d48e3a51d5f5e278b",
+ "reference": "fe0936ee26643249e916849d48e3a51d5f5e278b",
+ "shasum": ""
+ },
+ "type": "library",
+ "autoload": {
+ "psr-0": {
+ "Psr\\Log\\": ""
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "http://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interface for logging libraries",
+ "keywords": [
+ "log",
+ "psr",
+ "psr-3"
+ ],
+ "time": "2012-12-21 11:40:51"
+ },
+ {
+ "name": "ruflin/elastica",
+ "version": "v1.3.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/ruflin/Elastica.git",
+ "reference": "92155a36c94ebe15b09661ae804acbe4bdd4ad6b"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/ruflin/Elastica/zipball/92155a36c94ebe15b09661ae804acbe4bdd4ad6b",
+ "reference": "92155a36c94ebe15b09661ae804acbe4bdd4ad6b",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.3.3"
+ },
+ "require-dev": {
+ "munkie/elasticsearch-thrift-php": "1.4.*",
+ "phpunit/phpunit": "4.1.*",
+ "psr/log": "~1.0",
+ "satooshi/php-coveralls": "dev-master"
+ },
+ "suggest": {
+ "guzzlehttp/guzzle": "Allow using guzzle 4.x as the http transport (requires php 5.4)",
+ "monolog/monolog": "Logging request",
+ "munkie/elasticsearch-thrift-php": "Allow using thrift transport",
+ "psr/log": "for logging"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.2.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-0": {
+ "Elastica": "lib/",
+ "Elastica\\Test": "test/lib/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "Apache 2.0"
+ ],
+ "authors": [
+ {
+ "name": "Nicolas Ruflin",
+ "homepage": "http://ruflin.com/"
+ }
+ ],
+ "description": "Elasticsearch Client",
+ "homepage": "http://elastica.io/",
+ "keywords": [
+ "client",
+ "search"
+ ],
+ "time": "2014-07-27 13:45:09"
+ },
+ {
+ "name": "wikimedia/cdb",
+ "version": "1.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/wikimedia/cdb.git",
+ "reference": "3b7d5366c88eccf2517ebac57c59eb557c82f46c"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/wikimedia/cdb/zipball/3b7d5366c88eccf2517ebac57c59eb557c82f46c",
+ "reference": "3b7d5366c88eccf2517ebac57c59eb557c82f46c",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.3.2"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "*"
+ },
+ "type": "library",
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "GPL-2.0"
+ ],
+ "authors": [
+ {
+ "name": "Tim Starling",
+ "email": "tstarling@wikimedia.org"
+ },
+ {
+ "name": "Chad Horohoe",
+ "email": "chad@wikimedia.org"
+ }
+ ],
+ "description": "Constant Database (CDB) wrapper library for PHP. Provides pure-PHP fallback when dba_* functions are absent.",
+ "homepage": "https://www.mediawiki.org/wiki/CDB",
+ "time": "2014-12-08 19:26:44"
+ },
+ {
+ "name": "wikimedia/composer-merge-plugin",
+ "version": "v1.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/wikimedia/composer-merge-plugin.git",
+ "reference": "ed426b785f9f786b33be4fd78584e43f4e962356"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/wikimedia/composer-merge-plugin/zipball/ed426b785f9f786b33be4fd78584e43f4e962356",
+ "reference": "ed426b785f9f786b33be4fd78584e43f4e962356",
+ "shasum": ""
+ },
+ "require": {
+ "composer-plugin-api": "1.0.0",
+ "php": ">=5.3.2"
+ },
+ "require-dev": {
+ "composer/composer": "1.0.*@dev",
+ "jakub-onderka/php-parallel-lint": "~0.8",
+ "phpspec/prophecy-phpunit": "~1.0",
+ "phpunit/phpunit": "~4.0",
+ "squizlabs/php_codesniffer": "~2.1.0"
+ },
+ "type": "composer-plugin",
+ "extra": {
+ "class": "Wikimedia\\Composer\\MergePlugin"
+ },
+ "autoload": {
+ "psr-4": {
+ "Wikimedia\\Composer\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "Composer plugin to merge multiple composer.json files",
+ "time": "2015-02-21 00:57:13"
+ },
+ {
+ "name": "wikimedia/utfnormal",
+ "version": "v1.0.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/wikimedia/utfnormal.git",
+ "reference": "bb892a53a76116ad0982445a849043687cb6e778"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/wikimedia/utfnormal/zipball/bb892a53a76116ad0982445a849043687cb6e778",
+ "reference": "bb892a53a76116ad0982445a849043687cb6e778",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.3.3"
+ },
+ "require-dev": {
+ "ext-mbstring": "*",
+ "jakub-onderka/php-parallel-lint": "0.8.*",
+ "mediawiki/mediawiki-codesniffer": "0.1.0",
+ "phpunit/phpunit": "4.4.*",
+ "squizlabs/php_codesniffer": "2.1.*"
+ },
+ "type": "library",
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "GPL-2.0+"
+ ],
+ "authors": [
+ {
+ "name": "Brion Vibber",
+ "email": "bvibber@wikimedia.org"
+ }
+ ],
+ "homepage": "https://www.mediawiki.org/wiki/utfnormal",
+ "time": "2015-03-12 01:54:47"
+ },
+ {
+ "name": "zordius/lightncandy",
+ "version": "v0.18",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/zordius/lightncandy.git",
+ "reference": "24be6909c37391f4648ce1fdf19036b11bd56d05"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/zordius/lightncandy/zipball/24be6909c37391f4648ce1fdf19036b11bd56d05",
+ "reference": "24be6909c37391f4648ce1fdf19036b11bd56d05",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.3.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "4.0.17"
+ },
+ "type": "library",
+ "autoload": {
+ "classmap": [
+ "src/lightncandy.php"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Zordius Chen",
+ "email": "zordius@yahoo-inc.com"
+ }
+ ],
+ "description": "An extremely fast PHP implementation of handlebars ( http://handlebarsjs.com/ ) and mustache ( http://mustache.github.io/ ).",
+ "homepage": "https://github.com/zordius/lightncandy",
+ "keywords": [
+ "handlebars",
+ "logicless",
+ "mustache",
+ "php",
+ "template"
+ ],
+ "time": "2015-01-01 04:37:19"
+ }
+ ],
+ "packages-dev": [],
+ "aliases": [],
+ "minimum-stability": "stable",
+ "stability-flags": [],
+ "prefer-stable": true,
+ "prefer-lowest": false,
+ "platform": {
+ "php": ">=5.3.3"
+ },
+ "platform-dev": []
+}
diff --git a/vendor/composer/ClassLoader.php b/vendor/composer/ClassLoader.php
index 5e1469e8..4e05d3b1 100644
--- a/vendor/composer/ClassLoader.php
+++ b/vendor/composer/ClassLoader.php
@@ -351,7 +351,7 @@ class ClassLoader
foreach ($this->prefixLengthsPsr4[$first] as $prefix => $length) {
if (0 === strpos($class, $prefix)) {
foreach ($this->prefixDirsPsr4[$prefix] as $dir) {
- if (file_exists($file = $dir . DIRECTORY_SEPARATOR . substr($logicalPathPsr4, $length))) {
+ if (is_file($file = $dir . DIRECTORY_SEPARATOR . substr($logicalPathPsr4, $length))) {
return $file;
}
}
@@ -361,7 +361,7 @@ class ClassLoader
// PSR-4 fallback dirs
foreach ($this->fallbackDirsPsr4 as $dir) {
- if (file_exists($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr4)) {
+ if (is_file($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr4)) {
return $file;
}
}
@@ -380,7 +380,7 @@ class ClassLoader
foreach ($this->prefixesPsr0[$first] as $prefix => $dirs) {
if (0 === strpos($class, $prefix)) {
foreach ($dirs as $dir) {
- if (file_exists($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr0)) {
+ if (is_file($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr0)) {
return $file;
}
}
@@ -390,7 +390,7 @@ class ClassLoader
// PSR-0 fallback dirs
foreach ($this->fallbackDirsPsr0 as $dir) {
- if (file_exists($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr0)) {
+ if (is_file($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr0)) {
return $file;
}
}
diff --git a/vendor/composer/autoload_classmap.php b/vendor/composer/autoload_classmap.php
index 79053ea1..7455d6e6 100644
--- a/vendor/composer/autoload_classmap.php
+++ b/vendor/composer/autoload_classmap.php
@@ -3,7 +3,7 @@
// autoload_classmap.php @generated by Composer
$vendorDir = dirname(dirname(__FILE__));
-$baseDir = dirname($vendorDir);
+$baseDir = $vendorDir;
return array(
'CSSJanus' => $vendorDir . '/cssjanus/cssjanus/src/CSSJanus.php',
@@ -16,7 +16,183 @@ return array(
'Cdb\\Writer' => $vendorDir . '/wikimedia/cdb/src/Writer.php',
'Cdb\\Writer\\DBA' => $vendorDir . '/wikimedia/cdb/src/Writer/DBA.php',
'Cdb\\Writer\\PHP' => $vendorDir . '/wikimedia/cdb/src/Writer/PHP.php',
- 'ComposerHookHandler' => $baseDir . '/includes/composer/ComposerHookHandler.php',
+ 'Elastica\\AbstractUpdateAction' => $vendorDir . '/ruflin/elastica/lib/Elastica/AbstractUpdateAction.php',
+ 'Elastica\\Aggregation\\AbstractAggregation' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/AbstractAggregation.php',
+ 'Elastica\\Aggregation\\AbstractSimpleAggregation' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/AbstractSimpleAggregation.php',
+ 'Elastica\\Aggregation\\Avg' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/Avg.php',
+ 'Elastica\\Aggregation\\Cardinality' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/Cardinality.php',
+ 'Elastica\\Aggregation\\DateHistogram' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/DateHistogram.php',
+ 'Elastica\\Aggregation\\DateRange' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/DateRange.php',
+ 'Elastica\\Aggregation\\ExtendedStats' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/ExtendedStats.php',
+ 'Elastica\\Aggregation\\Filter' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/Filter.php',
+ 'Elastica\\Aggregation\\GeoDistance' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/GeoDistance.php',
+ 'Elastica\\Aggregation\\GeohashGrid' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/GeohashGrid.php',
+ 'Elastica\\Aggregation\\GlobalAggregation' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/GlobalAggregation.php',
+ 'Elastica\\Aggregation\\Histogram' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/Histogram.php',
+ 'Elastica\\Aggregation\\IpRange' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/IpRange.php',
+ 'Elastica\\Aggregation\\Max' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/Max.php',
+ 'Elastica\\Aggregation\\Min' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/Min.php',
+ 'Elastica\\Aggregation\\Missing' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/Missing.php',
+ 'Elastica\\Aggregation\\Nested' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/Nested.php',
+ 'Elastica\\Aggregation\\Range' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/Range.php',
+ 'Elastica\\Aggregation\\ReverseNested' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/ReverseNested.php',
+ 'Elastica\\Aggregation\\Stats' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/Stats.php',
+ 'Elastica\\Aggregation\\Sum' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/Sum.php',
+ 'Elastica\\Aggregation\\Terms' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/Terms.php',
+ 'Elastica\\Aggregation\\ValueCount' => $vendorDir . '/ruflin/elastica/lib/Elastica/Aggregation/ValueCount.php',
+ 'Elastica\\Bulk' => $vendorDir . '/ruflin/elastica/lib/Elastica/Bulk.php',
+ 'Elastica\\Bulk\\Action' => $vendorDir . '/ruflin/elastica/lib/Elastica/Bulk/Action.php',
+ 'Elastica\\Bulk\\Action\\AbstractDocument' => $vendorDir . '/ruflin/elastica/lib/Elastica/Bulk/Action/AbstractDocument.php',
+ 'Elastica\\Bulk\\Action\\CreateDocument' => $vendorDir . '/ruflin/elastica/lib/Elastica/Bulk/Action/CreateDocument.php',
+ 'Elastica\\Bulk\\Action\\DeleteDocument' => $vendorDir . '/ruflin/elastica/lib/Elastica/Bulk/Action/DeleteDocument.php',
+ 'Elastica\\Bulk\\Action\\IndexDocument' => $vendorDir . '/ruflin/elastica/lib/Elastica/Bulk/Action/IndexDocument.php',
+ 'Elastica\\Bulk\\Action\\UpdateDocument' => $vendorDir . '/ruflin/elastica/lib/Elastica/Bulk/Action/UpdateDocument.php',
+ 'Elastica\\Bulk\\Response' => $vendorDir . '/ruflin/elastica/lib/Elastica/Bulk/Response.php',
+ 'Elastica\\Bulk\\ResponseSet' => $vendorDir . '/ruflin/elastica/lib/Elastica/Bulk/ResponseSet.php',
+ 'Elastica\\Client' => $vendorDir . '/ruflin/elastica/lib/Elastica/Client.php',
+ 'Elastica\\Cluster' => $vendorDir . '/ruflin/elastica/lib/Elastica/Cluster.php',
+ 'Elastica\\Cluster\\Health' => $vendorDir . '/ruflin/elastica/lib/Elastica/Cluster/Health.php',
+ 'Elastica\\Cluster\\Health\\Index' => $vendorDir . '/ruflin/elastica/lib/Elastica/Cluster/Health/Index.php',
+ 'Elastica\\Cluster\\Health\\Shard' => $vendorDir . '/ruflin/elastica/lib/Elastica/Cluster/Health/Shard.php',
+ 'Elastica\\Cluster\\Settings' => $vendorDir . '/ruflin/elastica/lib/Elastica/Cluster/Settings.php',
+ 'Elastica\\Connection' => $vendorDir . '/ruflin/elastica/lib/Elastica/Connection.php',
+ 'Elastica\\Document' => $vendorDir . '/ruflin/elastica/lib/Elastica/Document.php',
+ 'Elastica\\Exception\\BulkException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/BulkException.php',
+ 'Elastica\\Exception\\Bulk\\ResponseException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/Bulk/ResponseException.php',
+ 'Elastica\\Exception\\Bulk\\Response\\ActionException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/Bulk/Response/ActionException.php',
+ 'Elastica\\Exception\\Bulk\\UdpException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/Bulk/UdpException.php',
+ 'Elastica\\Exception\\ClientException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/ClientException.php',
+ 'Elastica\\Exception\\ConnectionException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/ConnectionException.php',
+ 'Elastica\\Exception\\Connection\\GuzzleException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/Connection/GuzzleException.php',
+ 'Elastica\\Exception\\Connection\\HttpException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/Connection/HttpException.php',
+ 'Elastica\\Exception\\Connection\\ThriftException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/Connection/ThriftException.php',
+ 'Elastica\\Exception\\ElasticsearchException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/ElasticsearchException.php',
+ 'Elastica\\Exception\\ExceptionInterface' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/ExceptionInterface.php',
+ 'Elastica\\Exception\\InvalidException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/InvalidException.php',
+ 'Elastica\\Exception\\JSONParseException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/JSONParseException.php',
+ 'Elastica\\Exception\\NotFoundException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/NotFoundException.php',
+ 'Elastica\\Exception\\NotImplementedException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/NotImplementedException.php',
+ 'Elastica\\Exception\\PartialShardFailureException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/PartialShardFailureException.php',
+ 'Elastica\\Exception\\ResponseException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/ResponseException.php',
+ 'Elastica\\Exception\\RuntimeException' => $vendorDir . '/ruflin/elastica/lib/Elastica/Exception/RuntimeException.php',
+ 'Elastica\\Facet\\AbstractFacet' => $vendorDir . '/ruflin/elastica/lib/Elastica/Facet/AbstractFacet.php',
+ 'Elastica\\Facet\\DateHistogram' => $vendorDir . '/ruflin/elastica/lib/Elastica/Facet/DateHistogram.php',
+ 'Elastica\\Facet\\Filter' => $vendorDir . '/ruflin/elastica/lib/Elastica/Facet/Filter.php',
+ 'Elastica\\Facet\\GeoCluster' => $vendorDir . '/ruflin/elastica/lib/Elastica/Facet/GeoCluster.php',
+ 'Elastica\\Facet\\GeoDistance' => $vendorDir . '/ruflin/elastica/lib/Elastica/Facet/GeoDistance.php',
+ 'Elastica\\Facet\\Histogram' => $vendorDir . '/ruflin/elastica/lib/Elastica/Facet/Histogram.php',
+ 'Elastica\\Facet\\Query' => $vendorDir . '/ruflin/elastica/lib/Elastica/Facet/Query.php',
+ 'Elastica\\Facet\\Range' => $vendorDir . '/ruflin/elastica/lib/Elastica/Facet/Range.php',
+ 'Elastica\\Facet\\Statistical' => $vendorDir . '/ruflin/elastica/lib/Elastica/Facet/Statistical.php',
+ 'Elastica\\Facet\\Terms' => $vendorDir . '/ruflin/elastica/lib/Elastica/Facet/Terms.php',
+ 'Elastica\\Facet\\TermsStats' => $vendorDir . '/ruflin/elastica/lib/Elastica/Facet/TermsStats.php',
+ 'Elastica\\Filter\\AbstractFilter' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/AbstractFilter.php',
+ 'Elastica\\Filter\\AbstractGeoDistance' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/AbstractGeoDistance.php',
+ 'Elastica\\Filter\\AbstractGeoShape' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/AbstractGeoShape.php',
+ 'Elastica\\Filter\\AbstractMulti' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/AbstractMulti.php',
+ 'Elastica\\Filter\\Bool' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Bool.php',
+ 'Elastica\\Filter\\BoolAnd' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/BoolAnd.php',
+ 'Elastica\\Filter\\BoolNot' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/BoolNot.php',
+ 'Elastica\\Filter\\BoolOr' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/BoolOr.php',
+ 'Elastica\\Filter\\Exists' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Exists.php',
+ 'Elastica\\Filter\\GeoBoundingBox' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/GeoBoundingBox.php',
+ 'Elastica\\Filter\\GeoDistance' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/GeoDistance.php',
+ 'Elastica\\Filter\\GeoDistanceRange' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/GeoDistanceRange.php',
+ 'Elastica\\Filter\\GeoPolygon' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/GeoPolygon.php',
+ 'Elastica\\Filter\\GeoShapePreIndexed' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/GeoShapePreIndexed.php',
+ 'Elastica\\Filter\\GeoShapeProvided' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/GeoShapeProvided.php',
+ 'Elastica\\Filter\\GeohashCell' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/GeohashCell.php',
+ 'Elastica\\Filter\\HasChild' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/HasChild.php',
+ 'Elastica\\Filter\\HasParent' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/HasParent.php',
+ 'Elastica\\Filter\\Ids' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Ids.php',
+ 'Elastica\\Filter\\Indices' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Indices.php',
+ 'Elastica\\Filter\\Limit' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Limit.php',
+ 'Elastica\\Filter\\MatchAll' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/MatchAll.php',
+ 'Elastica\\Filter\\Missing' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Missing.php',
+ 'Elastica\\Filter\\Nested' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Nested.php',
+ 'Elastica\\Filter\\NumericRange' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/NumericRange.php',
+ 'Elastica\\Filter\\Prefix' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Prefix.php',
+ 'Elastica\\Filter\\Query' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Query.php',
+ 'Elastica\\Filter\\Range' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Range.php',
+ 'Elastica\\Filter\\Regexp' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Regexp.php',
+ 'Elastica\\Filter\\Script' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Script.php',
+ 'Elastica\\Filter\\Term' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Term.php',
+ 'Elastica\\Filter\\Terms' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Terms.php',
+ 'Elastica\\Filter\\Type' => $vendorDir . '/ruflin/elastica/lib/Elastica/Filter/Type.php',
+ 'Elastica\\Index' => $vendorDir . '/ruflin/elastica/lib/Elastica/Index.php',
+ 'Elastica\\Index\\Settings' => $vendorDir . '/ruflin/elastica/lib/Elastica/Index/Settings.php',
+ 'Elastica\\Index\\Stats' => $vendorDir . '/ruflin/elastica/lib/Elastica/Index/Stats.php',
+ 'Elastica\\Index\\Status' => $vendorDir . '/ruflin/elastica/lib/Elastica/Index/Status.php',
+ 'Elastica\\JSON' => $vendorDir . '/ruflin/elastica/lib/Elastica/JSON.php',
+ 'Elastica\\Log' => $vendorDir . '/ruflin/elastica/lib/Elastica/Log.php',
+ 'Elastica\\Multi\\ResultSet' => $vendorDir . '/ruflin/elastica/lib/Elastica/Multi/ResultSet.php',
+ 'Elastica\\Multi\\Search' => $vendorDir . '/ruflin/elastica/lib/Elastica/Multi/Search.php',
+ 'Elastica\\Node' => $vendorDir . '/ruflin/elastica/lib/Elastica/Node.php',
+ 'Elastica\\Node\\Info' => $vendorDir . '/ruflin/elastica/lib/Elastica/Node/Info.php',
+ 'Elastica\\Node\\Stats' => $vendorDir . '/ruflin/elastica/lib/Elastica/Node/Stats.php',
+ 'Elastica\\Param' => $vendorDir . '/ruflin/elastica/lib/Elastica/Param.php',
+ 'Elastica\\Percolator' => $vendorDir . '/ruflin/elastica/lib/Elastica/Percolator.php',
+ 'Elastica\\Query' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query.php',
+ 'Elastica\\Query\\AbstractQuery' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/AbstractQuery.php',
+ 'Elastica\\Query\\Bool' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Bool.php',
+ 'Elastica\\Query\\Boosting' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Boosting.php',
+ 'Elastica\\Query\\Builder' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Builder.php',
+ 'Elastica\\Query\\Common' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Common.php',
+ 'Elastica\\Query\\ConstantScore' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/ConstantScore.php',
+ 'Elastica\\Query\\DisMax' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/DisMax.php',
+ 'Elastica\\Query\\Filtered' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Filtered.php',
+ 'Elastica\\Query\\FunctionScore' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/FunctionScore.php',
+ 'Elastica\\Query\\Fuzzy' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Fuzzy.php',
+ 'Elastica\\Query\\FuzzyLikeThis' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/FuzzyLikeThis.php',
+ 'Elastica\\Query\\HasChild' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/HasChild.php',
+ 'Elastica\\Query\\HasParent' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/HasParent.php',
+ 'Elastica\\Query\\Ids' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Ids.php',
+ 'Elastica\\Query\\Match' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Match.php',
+ 'Elastica\\Query\\MatchAll' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/MatchAll.php',
+ 'Elastica\\Query\\MoreLikeThis' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/MoreLikeThis.php',
+ 'Elastica\\Query\\MultiMatch' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/MultiMatch.php',
+ 'Elastica\\Query\\Nested' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Nested.php',
+ 'Elastica\\Query\\Prefix' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Prefix.php',
+ 'Elastica\\Query\\QueryString' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/QueryString.php',
+ 'Elastica\\Query\\Range' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Range.php',
+ 'Elastica\\Query\\Simple' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Simple.php',
+ 'Elastica\\Query\\SimpleQueryString' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/SimpleQueryString.php',
+ 'Elastica\\Query\\Term' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Term.php',
+ 'Elastica\\Query\\Terms' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Terms.php',
+ 'Elastica\\Query\\TopChildren' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/TopChildren.php',
+ 'Elastica\\Query\\Wildcard' => $vendorDir . '/ruflin/elastica/lib/Elastica/Query/Wildcard.php',
+ 'Elastica\\Request' => $vendorDir . '/ruflin/elastica/lib/Elastica/Request.php',
+ 'Elastica\\Rescore\\AbstractRescore' => $vendorDir . '/ruflin/elastica/lib/Elastica/Rescore/AbstractRescore.php',
+ 'Elastica\\Rescore\\Query' => $vendorDir . '/ruflin/elastica/lib/Elastica/Rescore/Query.php',
+ 'Elastica\\Response' => $vendorDir . '/ruflin/elastica/lib/Elastica/Response.php',
+ 'Elastica\\Result' => $vendorDir . '/ruflin/elastica/lib/Elastica/Result.php',
+ 'Elastica\\ResultSet' => $vendorDir . '/ruflin/elastica/lib/Elastica/ResultSet.php',
+ 'Elastica\\ScanAndScroll' => $vendorDir . '/ruflin/elastica/lib/Elastica/ScanAndScroll.php',
+ 'Elastica\\Script' => $vendorDir . '/ruflin/elastica/lib/Elastica/Script.php',
+ 'Elastica\\ScriptFields' => $vendorDir . '/ruflin/elastica/lib/Elastica/ScriptFields.php',
+ 'Elastica\\Search' => $vendorDir . '/ruflin/elastica/lib/Elastica/Search.php',
+ 'Elastica\\SearchableInterface' => $vendorDir . '/ruflin/elastica/lib/Elastica/SearchableInterface.php',
+ 'Elastica\\Snapshot' => $vendorDir . '/ruflin/elastica/lib/Elastica/Snapshot.php',
+ 'Elastica\\Status' => $vendorDir . '/ruflin/elastica/lib/Elastica/Status.php',
+ 'Elastica\\Suggest' => $vendorDir . '/ruflin/elastica/lib/Elastica/Suggest.php',
+ 'Elastica\\Suggest\\AbstractSuggest' => $vendorDir . '/ruflin/elastica/lib/Elastica/Suggest/AbstractSuggest.php',
+ 'Elastica\\Suggest\\CandidateGenerator\\AbstractCandidateGenerator' => $vendorDir . '/ruflin/elastica/lib/Elastica/Suggest/CandidateGenerator/AbstractCandidateGenerator.php',
+ 'Elastica\\Suggest\\CandidateGenerator\\DirectGenerator' => $vendorDir . '/ruflin/elastica/lib/Elastica/Suggest/CandidateGenerator/DirectGenerator.php',
+ 'Elastica\\Suggest\\Phrase' => $vendorDir . '/ruflin/elastica/lib/Elastica/Suggest/Phrase.php',
+ 'Elastica\\Suggest\\Term' => $vendorDir . '/ruflin/elastica/lib/Elastica/Suggest/Term.php',
+ 'Elastica\\Test\\Base' => $vendorDir . '/ruflin/elastica/test/lib/Elastica/Test/Base.php',
+ 'Elastica\\Test\\Filter\\ExistsTest' => $vendorDir . '/ruflin/elastica/test/lib/Elastica/Test/Filter/ExistsTests.php',
+ 'Elastica\\Transport\\AbstractTransport' => $vendorDir . '/ruflin/elastica/lib/Elastica/Transport/AbstractTransport.php',
+ 'Elastica\\Transport\\Guzzle' => $vendorDir . '/ruflin/elastica/lib/Elastica/Transport/Guzzle.php',
+ 'Elastica\\Transport\\Http' => $vendorDir . '/ruflin/elastica/lib/Elastica/Transport/Http.php',
+ 'Elastica\\Transport\\Https' => $vendorDir . '/ruflin/elastica/lib/Elastica/Transport/Https.php',
+ 'Elastica\\Transport\\Memcache' => $vendorDir . '/ruflin/elastica/lib/Elastica/Transport/Memcache.php',
+ 'Elastica\\Transport\\Null' => $vendorDir . '/ruflin/elastica/lib/Elastica/Transport/Null.php',
+ 'Elastica\\Transport\\Thrift' => $vendorDir . '/ruflin/elastica/lib/Elastica/Transport/Thrift.php',
+ 'Elastica\\Type' => $vendorDir . '/ruflin/elastica/lib/Elastica/Type.php',
+ 'Elastica\\Type\\AbstractType' => $vendorDir . '/ruflin/elastica/lib/Elastica/Type/AbstractType.php',
+ 'Elastica\\Type\\Mapping' => $vendorDir . '/ruflin/elastica/lib/Elastica/Type/Mapping.php',
+ 'Elastica\\Util' => $vendorDir . '/ruflin/elastica/lib/Elastica/Util.php',
'LCRun3' => $vendorDir . '/zordius/lightncandy/src/lightncandy.php',
'LightnCandy' => $vendorDir . '/zordius/lightncandy/src/lightncandy.php',
'Liuggio\\StatsdClient\\Entity\\StatsdData' => $vendorDir . '/liuggio/statsd-php-client/src/Liuggio/StatsdClient/Entity/StatsdData.php',
@@ -32,6 +208,84 @@ return array(
'Liuggio\\StatsdClient\\Sender\\SysLogSender' => $vendorDir . '/liuggio/statsd-php-client/src/Liuggio/StatsdClient/Sender/SysLogSender.php',
'Liuggio\\StatsdClient\\StatsdClient' => $vendorDir . '/liuggio/statsd-php-client/src/Liuggio/StatsdClient/StatsdClient.php',
'Liuggio\\StatsdClient\\StatsdClientInterface' => $vendorDir . '/liuggio/statsd-php-client/src/Liuggio/StatsdClient/StatsdClientInterface.php',
+ 'Monolog\\ErrorHandler' => $vendorDir . '/monolog/monolog/src/Monolog/ErrorHandler.php',
+ 'Monolog\\Formatter\\ChromePHPFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php',
+ 'Monolog\\Formatter\\ElasticaFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/ElasticaFormatter.php',
+ 'Monolog\\Formatter\\FlowdockFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/FlowdockFormatter.php',
+ 'Monolog\\Formatter\\FormatterInterface' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php',
+ 'Monolog\\Formatter\\GelfMessageFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php',
+ 'Monolog\\Formatter\\HtmlFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/HtmlFormatter.php',
+ 'Monolog\\Formatter\\JsonFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php',
+ 'Monolog\\Formatter\\LineFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/LineFormatter.php',
+ 'Monolog\\Formatter\\LogglyFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php',
+ 'Monolog\\Formatter\\LogstashFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php',
+ 'Monolog\\Formatter\\MongoDBFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php',
+ 'Monolog\\Formatter\\NormalizerFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php',
+ 'Monolog\\Formatter\\ScalarFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php',
+ 'Monolog\\Formatter\\WildfireFormatter' => $vendorDir . '/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php',
+ 'Monolog\\Handler\\AbstractHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/AbstractHandler.php',
+ 'Monolog\\Handler\\AbstractProcessingHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php',
+ 'Monolog\\Handler\\AbstractSyslogHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php',
+ 'Monolog\\Handler\\AmqpHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/AmqpHandler.php',
+ 'Monolog\\Handler\\BrowserConsoleHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php',
+ 'Monolog\\Handler\\BufferHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/BufferHandler.php',
+ 'Monolog\\Handler\\ChromePHPHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php',
+ 'Monolog\\Handler\\CouchDBHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php',
+ 'Monolog\\Handler\\CubeHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/CubeHandler.php',
+ 'Monolog\\Handler\\DoctrineCouchDBHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php',
+ 'Monolog\\Handler\\DynamoDbHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php',
+ 'Monolog\\Handler\\ElasticSearchHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php',
+ 'Monolog\\Handler\\ErrorLogHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php',
+ 'Monolog\\Handler\\FilterHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/FilterHandler.php',
+ 'Monolog\\Handler\\FingersCrossedHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php',
+ 'Monolog\\Handler\\FingersCrossed\\ActivationStrategyInterface' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php',
+ 'Monolog\\Handler\\FingersCrossed\\ChannelLevelActivationStrategy' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php',
+ 'Monolog\\Handler\\FingersCrossed\\ErrorLevelActivationStrategy' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php',
+ 'Monolog\\Handler\\FirePHPHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php',
+ 'Monolog\\Handler\\FleepHookHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php',
+ 'Monolog\\Handler\\FlowdockHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php',
+ 'Monolog\\Handler\\GelfHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/GelfHandler.php',
+ 'Monolog\\Handler\\GroupHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/GroupHandler.php',
+ 'Monolog\\Handler\\HandlerInterface' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/HandlerInterface.php',
+ 'Monolog\\Handler\\HipChatHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/HipChatHandler.php',
+ 'Monolog\\Handler\\LogEntriesHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php',
+ 'Monolog\\Handler\\LogglyHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/LogglyHandler.php',
+ 'Monolog\\Handler\\MailHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/MailHandler.php',
+ 'Monolog\\Handler\\MandrillHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/MandrillHandler.php',
+ 'Monolog\\Handler\\MissingExtensionException' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php',
+ 'Monolog\\Handler\\MongoDBHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php',
+ 'Monolog\\Handler\\NativeMailerHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php',
+ 'Monolog\\Handler\\NewRelicHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php',
+ 'Monolog\\Handler\\NullHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/NullHandler.php',
+ 'Monolog\\Handler\\PsrHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/PsrHandler.php',
+ 'Monolog\\Handler\\PushoverHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/PushoverHandler.php',
+ 'Monolog\\Handler\\RavenHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/RavenHandler.php',
+ 'Monolog\\Handler\\RedisHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/RedisHandler.php',
+ 'Monolog\\Handler\\RollbarHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/RollbarHandler.php',
+ 'Monolog\\Handler\\RotatingFileHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php',
+ 'Monolog\\Handler\\SamplingHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/SamplingHandler.php',
+ 'Monolog\\Handler\\SlackHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/SlackHandler.php',
+ 'Monolog\\Handler\\SocketHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/SocketHandler.php',
+ 'Monolog\\Handler\\StreamHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/StreamHandler.php',
+ 'Monolog\\Handler\\SwiftMailerHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php',
+ 'Monolog\\Handler\\SyslogHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/SyslogHandler.php',
+ 'Monolog\\Handler\\SyslogUdpHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php',
+ 'Monolog\\Handler\\SyslogUdp\\UdpSocket' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php',
+ 'Monolog\\Handler\\TestHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/TestHandler.php',
+ 'Monolog\\Handler\\WhatFailureGroupHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php',
+ 'Monolog\\Handler\\ZendMonitorHandler' => $vendorDir . '/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php',
+ 'Monolog\\Logger' => $vendorDir . '/monolog/monolog/src/Monolog/Logger.php',
+ 'Monolog\\Processor\\GitProcessor' => $vendorDir . '/monolog/monolog/src/Monolog/Processor/GitProcessor.php',
+ 'Monolog\\Processor\\IntrospectionProcessor' => $vendorDir . '/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php',
+ 'Monolog\\Processor\\MemoryPeakUsageProcessor' => $vendorDir . '/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php',
+ 'Monolog\\Processor\\MemoryProcessor' => $vendorDir . '/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php',
+ 'Monolog\\Processor\\MemoryUsageProcessor' => $vendorDir . '/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php',
+ 'Monolog\\Processor\\ProcessIdProcessor' => $vendorDir . '/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php',
+ 'Monolog\\Processor\\PsrLogMessageProcessor' => $vendorDir . '/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php',
+ 'Monolog\\Processor\\TagProcessor' => $vendorDir . '/monolog/monolog/src/Monolog/Processor/TagProcessor.php',
+ 'Monolog\\Processor\\UidProcessor' => $vendorDir . '/monolog/monolog/src/Monolog/Processor/UidProcessor.php',
+ 'Monolog\\Processor\\WebProcessor' => $vendorDir . '/monolog/monolog/src/Monolog/Processor/WebProcessor.php',
+ 'Monolog\\Registry' => $vendorDir . '/monolog/monolog/src/Monolog/Registry.php',
'OOUI\\ApexTheme' => $vendorDir . '/oojs/oojs-ui/php/themes/ApexTheme.php',
'OOUI\\ButtonElement' => $vendorDir . '/oojs/oojs-ui/php/elements/ButtonElement.php',
'OOUI\\ButtonGroupWidget' => $vendorDir . '/oojs/oojs-ui/php/widgets/ButtonGroupWidget.php',
@@ -69,9 +323,7 @@ return array(
'Psr\\Log\\InvalidArgumentException' => $vendorDir . '/psr/log/Psr/Log/InvalidArgumentException.php',
'Psr\\Log\\LogLevel' => $vendorDir . '/psr/log/Psr/Log/LogLevel.php',
'Psr\\Log\\LoggerAwareInterface' => $vendorDir . '/psr/log/Psr/Log/LoggerAwareInterface.php',
- 'Psr\\Log\\LoggerAwareTrait' => $vendorDir . '/psr/log/Psr/Log/LoggerAwareTrait.php',
'Psr\\Log\\LoggerInterface' => $vendorDir . '/psr/log/Psr/Log/LoggerInterface.php',
- 'Psr\\Log\\LoggerTrait' => $vendorDir . '/psr/log/Psr/Log/LoggerTrait.php',
'Psr\\Log\\NullLogger' => $vendorDir . '/psr/log/Psr/Log/NullLogger.php',
'UtfNormal\\Constants' => $vendorDir . '/wikimedia/utfnormal/src/Constants.php',
'UtfNormal\\Utils' => $vendorDir . '/wikimedia/utfnormal/src/Util.php',
diff --git a/vendor/composer/autoload_namespaces.php b/vendor/composer/autoload_namespaces.php
index a0f180fa..fd316bf5 100644
--- a/vendor/composer/autoload_namespaces.php
+++ b/vendor/composer/autoload_namespaces.php
@@ -3,11 +3,12 @@
// autoload_namespaces.php @generated by Composer
$vendorDir = dirname(dirname(__FILE__));
-$baseDir = dirname($vendorDir);
+$baseDir = $vendorDir;
return array(
'Psr\\Log\\' => array($vendorDir . '/psr/log'),
'Liuggio' => array($vendorDir . '/liuggio/statsd-php-client/src'),
- 'ComposerHookHandler' => array($baseDir . '/includes/composer'),
+ 'Elastica\\Test' => array($vendorDir . '/ruflin/elastica/test/lib'),
+ 'Elastica' => array($vendorDir . '/ruflin/elastica/lib'),
'' => array($vendorDir . '/cssjanus/cssjanus/src'),
);
diff --git a/vendor/composer/autoload_psr4.php b/vendor/composer/autoload_psr4.php
index 74a09133..abd6ba84 100644
--- a/vendor/composer/autoload_psr4.php
+++ b/vendor/composer/autoload_psr4.php
@@ -3,8 +3,9 @@
// autoload_psr4.php @generated by Composer
$vendorDir = dirname(dirname(__FILE__));
-$baseDir = dirname($vendorDir);
+$baseDir = $vendorDir;
return array(
'Wikimedia\\Composer\\' => array($vendorDir . '/wikimedia/composer-merge-plugin/src'),
+ 'Monolog\\' => array($vendorDir . '/monolog/monolog/src/Monolog'),
);
diff --git a/vendor/composer/autoload_real.php b/vendor/composer/autoload_real.php
index 3e640297..10158fed 100644
--- a/vendor/composer/autoload_real.php
+++ b/vendor/composer/autoload_real.php
@@ -2,7 +2,7 @@
// autoload_real.php @generated by Composer
-class ComposerAutoloaderInit9b10cc5cf6896d6e4a31983fc3498786
+class ComposerAutoloaderInit_mediawiki_vendor
{
private static $loader;
@@ -19,9 +19,9 @@ class ComposerAutoloaderInit9b10cc5cf6896d6e4a31983fc3498786
return self::$loader;
}
- spl_autoload_register(array('ComposerAutoloaderInit9b10cc5cf6896d6e4a31983fc3498786', 'loadClassLoader'), true, false);
+ spl_autoload_register(array('ComposerAutoloaderInit_mediawiki_vendor', 'loadClassLoader'), true, false);
self::$loader = $loader = new \Composer\Autoload\ClassLoader();
- spl_autoload_unregister(array('ComposerAutoloaderInit9b10cc5cf6896d6e4a31983fc3498786', 'loadClassLoader'));
+ spl_autoload_unregister(array('ComposerAutoloaderInit_mediawiki_vendor', 'loadClassLoader'));
$map = require __DIR__ . '/autoload_namespaces.php';
foreach ($map as $namespace => $path) {
@@ -38,13 +38,14 @@ class ComposerAutoloaderInit9b10cc5cf6896d6e4a31983fc3498786
$loader->addClassMap($classMap);
}
+ $loader->setClassMapAuthoritative(true);
$loader->register(false);
return $loader;
}
}
-function composerRequire9b10cc5cf6896d6e4a31983fc3498786($file)
+function composerRequire_mediawiki_vendor($file)
{
require $file;
}
diff --git a/vendor/composer/installed.json b/vendor/composer/installed.json
index e882cda4..20564c68 100644
--- a/vendor/composer/installed.json
+++ b/vendor/composer/installed.json
@@ -1,46 +1,104 @@
[
{
- "name": "wikimedia/composer-merge-plugin",
- "version": "v1.0.0",
+ "name": "psr/log",
+ "version": "1.0.0",
"version_normalized": "1.0.0.0",
"source": {
"type": "git",
- "url": "https://github.com/wikimedia/composer-merge-plugin.git",
- "reference": "ed426b785f9f786b33be4fd78584e43f4e962356"
+ "url": "https://github.com/php-fig/log.git",
+ "reference": "fe0936ee26643249e916849d48e3a51d5f5e278b"
},
"dist": {
"type": "zip",
- "url": "https://api.github.com/repos/wikimedia/composer-merge-plugin/zipball/ed426b785f9f786b33be4fd78584e43f4e962356",
- "reference": "ed426b785f9f786b33be4fd78584e43f4e962356",
+ "url": "https://api.github.com/repos/php-fig/log/zipball/fe0936ee26643249e916849d48e3a51d5f5e278b",
+ "reference": "fe0936ee26643249e916849d48e3a51d5f5e278b",
+ "shasum": ""
+ },
+ "time": "2012-12-21 11:40:51",
+ "type": "library",
+ "installation-source": "dist",
+ "autoload": {
+ "psr-0": {
+ "Psr\\Log\\": ""
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "http://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interface for logging libraries",
+ "keywords": [
+ "log",
+ "psr",
+ "psr-3"
+ ]
+ },
+ {
+ "name": "ruflin/elastica",
+ "version": "v1.3.0.0",
+ "version_normalized": "1.3.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/ruflin/Elastica.git",
+ "reference": "92155a36c94ebe15b09661ae804acbe4bdd4ad6b"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/ruflin/Elastica/zipball/92155a36c94ebe15b09661ae804acbe4bdd4ad6b",
+ "reference": "92155a36c94ebe15b09661ae804acbe4bdd4ad6b",
"shasum": ""
},
"require": {
- "composer-plugin-api": "1.0.0",
- "php": ">=5.3.2"
+ "php": ">=5.3.3"
},
"require-dev": {
- "composer/composer": "1.0.*@dev",
- "jakub-onderka/php-parallel-lint": "~0.8",
- "phpspec/prophecy-phpunit": "~1.0",
- "phpunit/phpunit": "~4.0",
- "squizlabs/php_codesniffer": "~2.1.0"
+ "munkie/elasticsearch-thrift-php": "1.4.*",
+ "phpunit/phpunit": "4.1.*",
+ "psr/log": "~1.0",
+ "satooshi/php-coveralls": "dev-master"
},
- "time": "2015-02-21 00:57:13",
- "type": "composer-plugin",
+ "suggest": {
+ "guzzlehttp/guzzle": "Allow using guzzle 4.x as the http transport (requires php 5.4)",
+ "monolog/monolog": "Logging request",
+ "munkie/elasticsearch-thrift-php": "Allow using thrift transport",
+ "psr/log": "for logging"
+ },
+ "time": "2014-07-27 13:45:09",
+ "type": "library",
"extra": {
- "class": "Wikimedia\\Composer\\MergePlugin"
+ "branch-alias": {
+ "dev-master": "1.2.x-dev"
+ }
},
"installation-source": "dist",
"autoload": {
- "psr-4": {
- "Wikimedia\\Composer\\": "src/"
+ "psr-0": {
+ "Elastica": "lib/",
+ "Elastica\\Test": "test/lib/"
}
},
"notification-url": "https://packagist.org/downloads/",
"license": [
- "MIT"
+ "Apache 2.0"
],
- "description": "Composer plugin to merge multiple composer.json files"
+ "authors": [
+ {
+ "name": "Nicolas Ruflin",
+ "homepage": "http://ruflin.com/"
+ }
+ ],
+ "description": "Elasticsearch Client",
+ "homepage": "http://elastica.io/",
+ "keywords": [
+ "client",
+ "search"
+ ]
},
{
"name": "cssjanus/cssjanus",
@@ -123,115 +181,153 @@
"homepage": "http://leafo.net/lessphp/"
},
{
- "name": "liuggio/statsd-php-client",
- "version": "v1.0.12",
- "version_normalized": "1.0.12.0",
+ "name": "wikimedia/cdb",
+ "version": "1.0.1",
+ "version_normalized": "1.0.1.0",
"source": {
"type": "git",
- "url": "https://github.com/liuggio/statsd-php-client.git",
- "reference": "a8c9ccd2a3af6cc49c7fc4f5f689d7b148ab19d7"
+ "url": "https://github.com/wikimedia/cdb.git",
+ "reference": "3b7d5366c88eccf2517ebac57c59eb557c82f46c"
},
"dist": {
"type": "zip",
- "url": "https://api.github.com/repos/liuggio/statsd-php-client/zipball/a8c9ccd2a3af6cc49c7fc4f5f689d7b148ab19d7",
- "reference": "a8c9ccd2a3af6cc49c7fc4f5f689d7b148ab19d7",
+ "url": "https://api.github.com/repos/wikimedia/cdb/zipball/3b7d5366c88eccf2517ebac57c59eb557c82f46c",
+ "reference": "3b7d5366c88eccf2517ebac57c59eb557c82f46c",
"shasum": ""
},
"require": {
- "php": ">=5.2"
+ "php": ">=5.3.2"
},
"require-dev": {
- "monolog/monolog": ">=1.2.0"
- },
- "suggest": {
- "monolog/monolog": "Monolog, in order to do generate statistic from log >=1.2.0)"
+ "phpunit/phpunit": "*"
},
- "time": "2014-09-17 21:37:49",
+ "time": "2014-12-08 19:26:44",
"type": "library",
"installation-source": "dist",
"autoload": {
- "psr-0": {
- "Liuggio": "src/"
- }
+ "classmap": [
+ "src/"
+ ]
},
"notification-url": "https://packagist.org/downloads/",
"license": [
- "MIT"
+ "GPL-2.0"
],
"authors": [
{
- "name": "Giulio De Donato",
- "email": "liuggio@gmail.com"
+ "name": "Tim Starling",
+ "email": "tstarling@wikimedia.org"
+ },
+ {
+ "name": "Chad Horohoe",
+ "email": "chad@wikimedia.org"
}
],
- "description": "Statsd (Object Oriented) client library for PHP",
- "homepage": "https://github.com/liuggio/statsd-php-client/",
- "keywords": [
- "etsy",
- "monitoring",
- "php",
- "statsd"
- ]
+ "description": "Constant Database (CDB) wrapper library for PHP. Provides pure-PHP fallback when dba_* functions are absent.",
+ "homepage": "https://www.mediawiki.org/wiki/CDB"
},
{
- "name": "oojs/oojs-ui",
- "version": "v0.11.3",
- "version_normalized": "0.11.3.0",
+ "name": "zordius/lightncandy",
+ "version": "v0.18",
+ "version_normalized": "0.18.0.0",
"source": {
"type": "git",
- "url": "https://github.com/wikimedia/oojs-ui.git",
- "reference": "a03de5681e28e4fad1e27f8cccab32a2c5b484e5"
+ "url": "https://github.com/zordius/lightncandy.git",
+ "reference": "24be6909c37391f4648ce1fdf19036b11bd56d05"
},
"dist": {
"type": "zip",
- "url": "https://api.github.com/repos/wikimedia/oojs-ui/zipball/a03de5681e28e4fad1e27f8cccab32a2c5b484e5",
- "reference": "a03de5681e28e4fad1e27f8cccab32a2c5b484e5",
+ "url": "https://api.github.com/repos/zordius/lightncandy/zipball/24be6909c37391f4648ce1fdf19036b11bd56d05",
+ "reference": "24be6909c37391f4648ce1fdf19036b11bd56d05",
"shasum": ""
},
"require": {
- "php": ">=5.3.3"
+ "php": ">=5.3.0"
},
"require-dev": {
- "jakub-onderka/php-parallel-lint": "0.8.*",
- "mediawiki/mediawiki-codesniffer": "0.1.0",
- "squizlabs/php_codesniffer": "2.1.*"
+ "phpunit/phpunit": "4.0.17"
},
- "time": "2015-05-12 11:58:55",
+ "time": "2015-01-01 04:37:19",
"type": "library",
"installation-source": "dist",
"autoload": {
"classmap": [
- "php/"
+ "src/lightncandy.php"
]
},
"notification-url": "https://packagist.org/downloads/",
"license": [
"MIT"
],
- "description": "Provides library of common widgets, layouts, and windows.",
- "homepage": "https://www.mediawiki.org/wiki/OOjs_UI"
+ "authors": [
+ {
+ "name": "Zordius Chen",
+ "email": "zordius@yahoo-inc.com"
+ }
+ ],
+ "description": "An extremely fast PHP implementation of handlebars ( http://handlebarsjs.com/ ) and mustache ( http://mustache.github.io/ ).",
+ "homepage": "https://github.com/zordius/lightncandy",
+ "keywords": [
+ "handlebars",
+ "logicless",
+ "mustache",
+ "php",
+ "template"
+ ]
},
{
- "name": "psr/log",
- "version": "1.0.0",
- "version_normalized": "1.0.0.0",
+ "name": "monolog/monolog",
+ "version": "1.12.0",
+ "version_normalized": "1.12.0.0",
"source": {
"type": "git",
- "url": "https://github.com/php-fig/log.git",
- "reference": "fe0936ee26643249e916849d48e3a51d5f5e278b"
+ "url": "https://github.com/Seldaek/monolog.git",
+ "reference": "1fbe8c2641f2b163addf49cc5e18f144bec6b19f"
},
"dist": {
"type": "zip",
- "url": "https://api.github.com/repos/php-fig/log/zipball/fe0936ee26643249e916849d48e3a51d5f5e278b",
- "reference": "fe0936ee26643249e916849d48e3a51d5f5e278b",
+ "url": "https://api.github.com/repos/Seldaek/monolog/zipball/1fbe8c2641f2b163addf49cc5e18f144bec6b19f",
+ "reference": "1fbe8c2641f2b163addf49cc5e18f144bec6b19f",
"shasum": ""
},
- "time": "2012-12-21 11:40:51",
+ "require": {
+ "php": ">=5.3.0",
+ "psr/log": "~1.0"
+ },
+ "provide": {
+ "psr/log-implementation": "1.0.0"
+ },
+ "require-dev": {
+ "aws/aws-sdk-php": "~2.4, >2.4.8",
+ "doctrine/couchdb": "~1.0@dev",
+ "graylog2/gelf-php": "~1.0",
+ "phpunit/phpunit": "~4.0",
+ "raven/raven": "~0.5",
+ "ruflin/elastica": "0.90.*",
+ "videlalvaro/php-amqplib": "~2.4"
+ },
+ "suggest": {
+ "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB",
+ "doctrine/couchdb": "Allow sending log messages to a CouchDB server",
+ "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+ "ext-mongo": "Allow sending log messages to a MongoDB server",
+ "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server",
+ "raven/raven": "Allow sending log messages to a Sentry server",
+ "rollbar/rollbar": "Allow sending log messages to Rollbar",
+ "ruflin/elastica": "Allow sending log messages to an Elastic Search server",
+ "videlalvaro/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib"
+ },
+ "time": "2014-12-29 21:29:35",
"type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.12.x-dev"
+ }
+ },
"installation-source": "dist",
"autoload": {
- "psr-0": {
- "Psr\\Log\\": ""
+ "psr-4": {
+ "Monolog\\": "src/Monolog"
}
},
"notification-url": "https://packagist.org/downloads/",
@@ -240,62 +336,112 @@
],
"authors": [
{
- "name": "PHP-FIG",
- "homepage": "http://www.php-fig.org/"
+ "name": "Jordi Boggiano",
+ "email": "j.boggiano@seld.be",
+ "homepage": "http://seld.be"
}
],
- "description": "Common interface for logging libraries",
+ "description": "Sends your logs to files, sockets, inboxes, databases and various web services",
+ "homepage": "http://github.com/Seldaek/monolog",
"keywords": [
"log",
- "psr",
+ "logging",
"psr-3"
]
},
{
- "name": "wikimedia/cdb",
- "version": "1.0.1",
- "version_normalized": "1.0.1.0",
+ "name": "wikimedia/composer-merge-plugin",
+ "version": "v1.0.0",
+ "version_normalized": "1.0.0.0",
"source": {
"type": "git",
- "url": "https://github.com/wikimedia/cdb.git",
- "reference": "3b7d5366c88eccf2517ebac57c59eb557c82f46c"
+ "url": "https://github.com/wikimedia/composer-merge-plugin.git",
+ "reference": "ed426b785f9f786b33be4fd78584e43f4e962356"
},
"dist": {
"type": "zip",
- "url": "https://api.github.com/repos/wikimedia/cdb/zipball/3b7d5366c88eccf2517ebac57c59eb557c82f46c",
- "reference": "3b7d5366c88eccf2517ebac57c59eb557c82f46c",
+ "url": "https://api.github.com/repos/wikimedia/composer-merge-plugin/zipball/ed426b785f9f786b33be4fd78584e43f4e962356",
+ "reference": "ed426b785f9f786b33be4fd78584e43f4e962356",
"shasum": ""
},
"require": {
+ "composer-plugin-api": "1.0.0",
"php": ">=5.3.2"
},
"require-dev": {
- "phpunit/phpunit": "*"
+ "composer/composer": "1.0.*@dev",
+ "jakub-onderka/php-parallel-lint": "~0.8",
+ "phpspec/prophecy-phpunit": "~1.0",
+ "phpunit/phpunit": "~4.0",
+ "squizlabs/php_codesniffer": "~2.1.0"
},
- "time": "2014-12-08 19:26:44",
+ "time": "2015-02-21 00:57:13",
+ "type": "composer-plugin",
+ "extra": {
+ "class": "Wikimedia\\Composer\\MergePlugin"
+ },
+ "installation-source": "dist",
+ "autoload": {
+ "psr-4": {
+ "Wikimedia\\Composer\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "Composer plugin to merge multiple composer.json files"
+ },
+ {
+ "name": "liuggio/statsd-php-client",
+ "version": "v1.0.12",
+ "version_normalized": "1.0.12.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/liuggio/statsd-php-client.git",
+ "reference": "a8c9ccd2a3af6cc49c7fc4f5f689d7b148ab19d7"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/liuggio/statsd-php-client/zipball/a8c9ccd2a3af6cc49c7fc4f5f689d7b148ab19d7",
+ "reference": "a8c9ccd2a3af6cc49c7fc4f5f689d7b148ab19d7",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.2"
+ },
+ "require-dev": {
+ "monolog/monolog": ">=1.2.0"
+ },
+ "suggest": {
+ "monolog/monolog": "Monolog, in order to do generate statistic from log >=1.2.0)"
+ },
+ "time": "2014-09-17 21:37:49",
"type": "library",
"installation-source": "dist",
"autoload": {
- "classmap": [
- "src/"
- ]
+ "psr-0": {
+ "Liuggio": "src/"
+ }
},
"notification-url": "https://packagist.org/downloads/",
"license": [
- "GPL-2.0"
+ "MIT"
],
"authors": [
{
- "name": "Tim Starling",
- "email": "tstarling@wikimedia.org"
- },
- {
- "name": "Chad Horohoe",
- "email": "chad@wikimedia.org"
+ "name": "Giulio De Donato",
+ "email": "liuggio@gmail.com"
}
],
- "description": "Constant Database (CDB) wrapper library for PHP. Provides pure-PHP fallback when dba_* functions are absent.",
- "homepage": "https://www.mediawiki.org/wiki/CDB"
+ "description": "Statsd (Object Oriented) client library for PHP",
+ "homepage": "https://github.com/liuggio/statsd-php-client/",
+ "keywords": [
+ "etsy",
+ "monitoring",
+ "php",
+ "statsd"
+ ]
},
{
"name": "wikimedia/utfnormal",
@@ -343,52 +489,41 @@
"homepage": "https://www.mediawiki.org/wiki/utfnormal"
},
{
- "name": "zordius/lightncandy",
- "version": "v0.18",
- "version_normalized": "0.18.0.0",
+ "name": "oojs/oojs-ui",
+ "version": "v0.11.3",
+ "version_normalized": "0.11.3.0",
"source": {
"type": "git",
- "url": "https://github.com/zordius/lightncandy.git",
- "reference": "24be6909c37391f4648ce1fdf19036b11bd56d05"
+ "url": "https://github.com/wikimedia/oojs-ui.git",
+ "reference": "a03de5681e28e4fad1e27f8cccab32a2c5b484e5"
},
"dist": {
"type": "zip",
- "url": "https://api.github.com/repos/zordius/lightncandy/zipball/24be6909c37391f4648ce1fdf19036b11bd56d05",
- "reference": "24be6909c37391f4648ce1fdf19036b11bd56d05",
+ "url": "https://api.github.com/repos/wikimedia/oojs-ui/zipball/a03de5681e28e4fad1e27f8cccab32a2c5b484e5",
+ "reference": "a03de5681e28e4fad1e27f8cccab32a2c5b484e5",
"shasum": ""
},
"require": {
- "php": ">=5.3.0"
+ "php": ">=5.3.3"
},
"require-dev": {
- "phpunit/phpunit": "4.0.17"
+ "jakub-onderka/php-parallel-lint": "0.8.*",
+ "mediawiki/mediawiki-codesniffer": "0.1.0",
+ "squizlabs/php_codesniffer": "2.1.*"
},
- "time": "2015-01-01 04:37:19",
+ "time": "2015-05-12 11:58:55",
"type": "library",
"installation-source": "dist",
"autoload": {
"classmap": [
- "src/lightncandy.php"
+ "php/"
]
},
"notification-url": "https://packagist.org/downloads/",
"license": [
"MIT"
],
- "authors": [
- {
- "name": "Zordius Chen",
- "email": "zordius@yahoo-inc.com"
- }
- ],
- "description": "An extremely fast PHP implementation of handlebars ( http://handlebarsjs.com/ ) and mustache ( http://mustache.github.io/ ).",
- "homepage": "https://github.com/zordius/lightncandy",
- "keywords": [
- "handlebars",
- "logicless",
- "mustache",
- "php",
- "template"
- ]
+ "description": "Provides library of common widgets, layouts, and windows.",
+ "homepage": "https://www.mediawiki.org/wiki/OOjs_UI"
}
]
diff --git a/vendor/monolog/monolog/CHANGELOG.mdown b/vendor/monolog/monolog/CHANGELOG.mdown
new file mode 100644
index 00000000..47042c73
--- /dev/null
+++ b/vendor/monolog/monolog/CHANGELOG.mdown
@@ -0,0 +1,202 @@
+### 1.12.0 (2014-12-29)
+
+ * Break: HandlerInterface::isHandling now receives a partial record containing only a level key. This was always the intent and does not break any Monolog handler but is strictly speaking a BC break and you should check if you relied on any other field in your own handlers.
+ * Added PsrHandler to forward records to another PSR-3 logger
+ * Added SamplingHandler to wrap around a handler and include only every Nth record
+ * Added MongoDBFormatter to support better storage with MongoDBHandler (it must be enabled manually for now)
+ * Added exception codes in the output of most formatters
+ * Added LineFormatter::includeStacktraces to enable exception stack traces in logs (uses more than one line)
+ * Added $useShortAttachment to SlackHandler to minify attachment size and $includeExtra to append extra data
+ * Added $host to HipChatHandler for users of private instances
+ * Added $transactionName to NewRelicHandler and support for a transaction_name context value
+ * Fixed MandrillHandler to avoid outputing API call responses
+ * Fixed some non-standard behaviors in SyslogUdpHandler
+
+### 1.11.0 (2014-09-30)
+
+ * Break: The NewRelicHandler extra and context data are now prefixed with extra_ and context_ to avoid clashes. Watch out if you have scripts reading those from the API and rely on names
+ * Added WhatFailureGroupHandler to suppress any exception coming from the wrapped handlers and avoid chain failures if a logging service fails
+ * Added MandrillHandler to send emails via the Mandrillapp.com API
+ * Added SlackHandler to log records to a Slack.com account
+ * Added FleepHookHandler to log records to a Fleep.io account
+ * Added LogglyHandler::addTag to allow adding tags to an existing handler
+ * Added $ignoreEmptyContextAndExtra to LineFormatter to avoid empty [] at the end
+ * Added $useLocking to StreamHandler and RotatingFileHandler to enable flock() while writing
+ * Added support for PhpAmqpLib in the AmqpHandler
+ * Added FingersCrossedHandler::clear and BufferHandler::clear to reset them between batches in long running jobs
+ * Added support for adding extra fields from $_SERVER in the WebProcessor
+ * Fixed support for non-string values in PrsLogMessageProcessor
+ * Fixed SwiftMailer messages being sent with the wrong date in long running scripts
+ * Fixed minor PHP 5.6 compatibility issues
+ * Fixed BufferHandler::close being called twice
+
+### 1.10.0 (2014-06-04)
+
+ * Added Logger::getHandlers() and Logger::getProcessors() methods
+ * Added $passthruLevel argument to FingersCrossedHandler to let it always pass some records through even if the trigger level is not reached
+ * Added support for extra data in NewRelicHandler
+ * Added $expandNewlines flag to the ErrorLogHandler to create multiple log entries when a message has multiple lines
+
+### 1.9.1 (2014-04-24)
+
+ * Fixed regression in RotatingFileHandler file permissions
+ * Fixed initialization of the BufferHandler to make sure it gets flushed after receiving records
+ * Fixed ChromePHPHandler and FirePHPHandler's activation strategies to be more conservative
+
+### 1.9.0 (2014-04-20)
+
+ * Added LogEntriesHandler to send logs to a LogEntries account
+ * Added $filePermissions to tweak file mode on StreamHandler and RotatingFileHandler
+ * Added $useFormatting flag to MemoryProcessor to make it send raw data in bytes
+ * Added support for table formatting in FirePHPHandler via the table context key
+ * Added a TagProcessor to add tags to records, and support for tags in RavenHandler
+ * Added $appendNewline flag to the JsonFormatter to enable using it when logging to files
+ * Added sound support to the PushoverHandler
+ * Fixed multi-threading support in StreamHandler
+ * Fixed empty headers issue when ChromePHPHandler received no records
+ * Fixed default format of the ErrorLogHandler
+
+### 1.8.0 (2014-03-23)
+
+ * Break: the LineFormatter now strips newlines by default because this was a bug, set $allowInlineLineBreaks to true if you need them
+ * Added BrowserConsoleHandler to send logs to any browser's console via console.log() injection in the output
+ * Added FilterHandler to filter records and only allow those of a given list of levels through to the wrapped handler
+ * Added FlowdockHandler to send logs to a Flowdock account
+ * Added RollbarHandler to send logs to a Rollbar account
+ * Added HtmlFormatter to send prettier log emails with colors for each log level
+ * Added GitProcessor to add the current branch/commit to extra record data
+ * Added a Monolog\Registry class to allow easier global access to pre-configured loggers
+ * Added support for the new official graylog2/gelf-php lib for GelfHandler, upgrade if you can by replacing the mlehner/gelf-php requirement
+ * Added support for HHVM
+ * Added support for Loggly batch uploads
+ * Added support for tweaking the content type and encoding in NativeMailerHandler
+ * Added $skipClassesPartials to tweak the ignored classes in the IntrospectionProcessor
+ * Fixed batch request support in GelfHandler
+
+### 1.7.0 (2013-11-14)
+
+ * Added ElasticSearchHandler to send logs to an Elastic Search server
+ * Added DynamoDbHandler and ScalarFormatter to send logs to Amazon's Dynamo DB
+ * Added SyslogUdpHandler to send logs to a remote syslogd server
+ * Added LogglyHandler to send logs to a Loggly account
+ * Added $level to IntrospectionProcessor so it only adds backtraces when needed
+ * Added $version to LogstashFormatter to allow using the new v1 Logstash format
+ * Added $appName to NewRelicHandler
+ * Added configuration of Pushover notification retries/expiry
+ * Added $maxColumnWidth to NativeMailerHandler to change the 70 chars default
+ * Added chainability to most setters for all handlers
+ * Fixed RavenHandler batch processing so it takes the message from the record with highest priority
+ * Fixed HipChatHandler batch processing so it sends all messages at once
+ * Fixed issues with eAccelerator
+ * Fixed and improved many small things
+
+### 1.6.0 (2013-07-29)
+
+ * Added HipChatHandler to send logs to a HipChat chat room
+ * Added ErrorLogHandler to send logs to PHP's error_log function
+ * Added NewRelicHandler to send logs to NewRelic's service
+ * Added Monolog\ErrorHandler helper class to register a Logger as exception/error/fatal handler
+ * Added ChannelLevelActivationStrategy for the FingersCrossedHandler to customize levels by channel
+ * Added stack traces output when normalizing exceptions (json output & co)
+ * Added Monolog\Logger::API constant (currently 1)
+ * Added support for ChromePHP's v4.0 extension
+ * Added support for message priorities in PushoverHandler, see $highPriorityLevel and $emergencyLevel
+ * Added support for sending messages to multiple users at once with the PushoverHandler
+ * Fixed RavenHandler's support for batch sending of messages (when behind a Buffer or FingersCrossedHandler)
+ * Fixed normalization of Traversables with very large data sets, only the first 1000 items are shown now
+ * Fixed issue in RotatingFileHandler when an open_basedir restriction is active
+ * Fixed minor issues in RavenHandler and bumped the API to Raven 0.5.0
+ * Fixed SyslogHandler issue when many were used concurrently with different facilities
+
+### 1.5.0 (2013-04-23)
+
+ * Added ProcessIdProcessor to inject the PID in log records
+ * Added UidProcessor to inject a unique identifier to all log records of one request/run
+ * Added support for previous exceptions in the LineFormatter exception serialization
+ * Added Monolog\Logger::getLevels() to get all available levels
+ * Fixed ChromePHPHandler so it avoids sending headers larger than Chrome can handle
+
+### 1.4.1 (2013-04-01)
+
+ * Fixed exception formatting in the LineFormatter to be more minimalistic
+ * Fixed RavenHandler's handling of context/extra data, requires Raven client >0.1.0
+ * Fixed log rotation in RotatingFileHandler to work with long running scripts spanning multiple days
+ * Fixed WebProcessor array access so it checks for data presence
+ * Fixed Buffer, Group and FingersCrossed handlers to make use of their processors
+
+### 1.4.0 (2013-02-13)
+
+ * Added RedisHandler to log to Redis via the Predis library or the phpredis extension
+ * Added ZendMonitorHandler to log to the Zend Server monitor
+ * Added the possibility to pass arrays of handlers and processors directly in the Logger constructor
+ * Added `$useSSL` option to the PushoverHandler which is enabled by default
+ * Fixed ChromePHPHandler and FirePHPHandler issue when multiple instances are used simultaneously
+ * Fixed header injection capability in the NativeMailHandler
+
+### 1.3.1 (2013-01-11)
+
+ * Fixed LogstashFormatter to be usable with stream handlers
+ * Fixed GelfMessageFormatter levels on Windows
+
+### 1.3.0 (2013-01-08)
+
+ * Added PSR-3 compliance, the `Monolog\Logger` class is now an instance of `Psr\Log\LoggerInterface`
+ * Added PsrLogMessageProcessor that you can selectively enable for full PSR-3 compliance
+ * Added LogstashFormatter (combine with SocketHandler or StreamHandler to send logs to Logstash)
+ * Added PushoverHandler to send mobile notifications
+ * Added CouchDBHandler and DoctrineCouchDBHandler
+ * Added RavenHandler to send data to Sentry servers
+ * Added support for the new MongoClient class in MongoDBHandler
+ * Added microsecond precision to log records' timestamps
+ * Added `$flushOnOverflow` param to BufferHandler to flush by batches instead of losing
+ the oldest entries
+ * Fixed normalization of objects with cyclic references
+
+### 1.2.1 (2012-08-29)
+
+ * Added new $logopts arg to SyslogHandler to provide custom openlog options
+ * Fixed fatal error in SyslogHandler
+
+### 1.2.0 (2012-08-18)
+
+ * Added AmqpHandler (for use with AMQP servers)
+ * Added CubeHandler
+ * Added NativeMailerHandler::addHeader() to send custom headers in mails
+ * Added the possibility to specify more than one recipient in NativeMailerHandler
+ * Added the possibility to specify float timeouts in SocketHandler
+ * Added NOTICE and EMERGENCY levels to conform with RFC 5424
+ * Fixed the log records to use the php default timezone instead of UTC
+ * Fixed BufferHandler not being flushed properly on PHP fatal errors
+ * Fixed normalization of exotic resource types
+ * Fixed the default format of the SyslogHandler to avoid duplicating datetimes in syslog
+
+### 1.1.0 (2012-04-23)
+
+ * Added Monolog\Logger::isHandling() to check if a handler will
+ handle the given log level
+ * Added ChromePHPHandler
+ * Added MongoDBHandler
+ * Added GelfHandler (for use with Graylog2 servers)
+ * Added SocketHandler (for use with syslog-ng for example)
+ * Added NormalizerFormatter
+ * Added the possibility to change the activation strategy of the FingersCrossedHandler
+ * Added possibility to show microseconds in logs
+ * Added `server` and `referer` to WebProcessor output
+
+### 1.0.2 (2011-10-24)
+
+ * Fixed bug in IE with large response headers and FirePHPHandler
+
+### 1.0.1 (2011-08-25)
+
+ * Added MemoryPeakUsageProcessor and MemoryUsageProcessor
+ * Added Monolog\Logger::getName() to get a logger's channel name
+
+### 1.0.0 (2011-07-06)
+
+ * Added IntrospectionProcessor to get info from where the logger was called
+ * Fixed WebProcessor in CLI
+
+### 1.0.0-RC1 (2011-07-01)
+
+ * Initial release
diff --git a/vendor/monolog/monolog/LICENSE b/vendor/monolog/monolog/LICENSE
new file mode 100644
index 00000000..35727045
--- /dev/null
+++ b/vendor/monolog/monolog/LICENSE
@@ -0,0 +1,19 @@
+Copyright (c) 2011-2014 Jordi Boggiano
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is furnished
+to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/vendor/monolog/monolog/README.mdown b/vendor/monolog/monolog/README.mdown
new file mode 100644
index 00000000..add476a8
--- /dev/null
+++ b/vendor/monolog/monolog/README.mdown
@@ -0,0 +1,283 @@
+Monolog - Logging for PHP 5.3+ [![Build Status](https://secure.travis-ci.org/Seldaek/monolog.png)](http://travis-ci.org/Seldaek/monolog)
+==============================
+
+[![Total Downloads](https://poser.pugx.org/monolog/monolog/downloads.png)](https://packagist.org/packages/monolog/monolog)
+[![Latest Stable Version](https://poser.pugx.org/monolog/monolog/v/stable.png)](https://packagist.org/packages/monolog/monolog)
+[![Reference Status](https://www.versioneye.com/php/monolog:monolog/reference_badge.svg)](https://www.versioneye.com/php/monolog:monolog/references)
+
+
+Monolog sends your logs to files, sockets, inboxes, databases and various
+web services. See the complete list of handlers below. Special handlers
+allow you to build advanced logging strategies.
+
+This library implements the [PSR-3](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-3-logger-interface.md)
+interface that you can type-hint against in your own libraries to keep
+a maximum of interoperability. You can also use it in your applications to
+make sure you can always use another compatible logger at a later time.
+As of 1.11.0 Monolog public APIs will also accept PSR-3 log levels.
+Internally Monolog still uses its own level scheme since it predates PSR-3.
+
+Usage
+-----
+
+Install the latest version with `composer require monolog/monolog`
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+
+// create a log channel
+$log = new Logger('name');
+$log->pushHandler(new StreamHandler('path/to/your.log', Logger::WARNING));
+
+// add records to the log
+$log->addWarning('Foo');
+$log->addError('Bar');
+```
+
+Core Concepts
+-------------
+
+Every `Logger` instance has a channel (name) and a stack of handlers. Whenever
+you add a record to the logger, it traverses the handler stack. Each handler
+decides whether it fully handled the record, and if so, the propagation of the
+record ends there.
+
+This allows for flexible logging setups, for example having a `StreamHandler` at
+the bottom of the stack that will log anything to disk, and on top of that add
+a `MailHandler` that will send emails only when an error message is logged.
+Handlers also have a `$bubble` property which defines whether they block the
+record or not if they handled it. In this example, setting the `MailHandler`'s
+`$bubble` argument to false means that records handled by the `MailHandler` will
+not propagate to the `StreamHandler` anymore.
+
+You can create many `Logger`s, each defining a channel (e.g.: db, request,
+router, ..) and each of them combining various handlers, which can be shared
+or not. The channel is reflected in the logs and allows you to easily see or
+filter records.
+
+Each Handler also has a Formatter, a default one with settings that make sense
+will be created if you don't set one. The formatters normalize and format
+incoming records so that they can be used by the handlers to output useful
+information.
+
+Custom severity levels are not available. Only the eight
+[RFC 5424](http://tools.ietf.org/html/rfc5424) levels (debug, info, notice,
+warning, error, critical, alert, emergency) are present for basic filtering
+purposes, but for sorting and other use cases that would require
+flexibility, you should add Processors to the Logger that can add extra
+information (tags, user ip, ..) to the records before they are handled.
+
+Log Levels
+----------
+
+Monolog supports the logging levels described by [RFC 5424](http://tools.ietf.org/html/rfc5424).
+
+- **DEBUG** (100): Detailed debug information.
+
+- **INFO** (200): Interesting events. Examples: User logs in, SQL logs.
+
+- **NOTICE** (250): Normal but significant events.
+
+- **WARNING** (300): Exceptional occurrences that are not errors. Examples:
+ Use of deprecated APIs, poor use of an API, undesirable things that are not
+ necessarily wrong.
+
+- **ERROR** (400): Runtime errors that do not require immediate action but
+ should typically be logged and monitored.
+
+- **CRITICAL** (500): Critical conditions. Example: Application component
+ unavailable, unexpected exception.
+
+- **ALERT** (550): Action must be taken immediately. Example: Entire website
+ down, database unavailable, etc. This should trigger the SMS alerts and wake
+ you up.
+
+- **EMERGENCY** (600): Emergency: system is unusable.
+
+Docs
+====
+
+**See the `doc` directory for more detailed documentation.
+The following is only a list of all parts that come with Monolog.**
+
+Handlers
+--------
+
+### Log to files and syslog
+
+- _StreamHandler_: Logs records into any PHP stream, use this for log files.
+- _RotatingFileHandler_: Logs records to a file and creates one logfile per day.
+ It will also delete files older than `$maxFiles`. You should use
+ [logrotate](http://linuxcommand.org/man_pages/logrotate8.html) for high profile
+ setups though, this is just meant as a quick and dirty solution.
+- _SyslogHandler_: Logs records to the syslog.
+- _ErrorLogHandler_: Logs records to PHP's
+ [`error_log()`](http://docs.php.net/manual/en/function.error-log.php) function.
+
+### Send alerts and emails
+
+- _NativeMailerHandler_: Sends emails using PHP's
+ [`mail()`](http://php.net/manual/en/function.mail.php) function.
+- _SwiftMailerHandler_: Sends emails using a [`Swift_Mailer`](http://swiftmailer.org/) instance.
+- _PushoverHandler_: Sends mobile notifications via the [Pushover](https://www.pushover.net/) API.
+- _HipChatHandler_: Logs records to a [HipChat](http://hipchat.com) chat room using its API.
+- _FlowdockHandler_: Logs records to a [Flowdock](https://www.flowdock.com/) account.
+- _SlackHandler_: Logs records to a [Slack](https://www.slack.com/) account.
+- _MandrillHandler_: Sends emails via the Mandrill API using a [`Swift_Message`](http://swiftmailer.org/) instance.
+- _FleepHookHandler_: Logs records to a [Fleep](https://fleep.io/) conversation using Webhooks.
+
+### Log specific servers and networked logging
+
+- _SocketHandler_: Logs records to [sockets](http://php.net/fsockopen), use this
+ for UNIX and TCP sockets. See an [example](https://github.com/Seldaek/monolog/blob/master/doc/sockets.md).
+- _AmqpHandler_: Logs records to an [amqp](http://www.amqp.org/) compatible
+ server. Requires the [php-amqp](http://pecl.php.net/package/amqp) extension (1.0+).
+- _GelfHandler_: Logs records to a [Graylog2](http://www.graylog2.org) server.
+- _CubeHandler_: Logs records to a [Cube](http://square.github.com/cube/) server.
+- _RavenHandler_: Logs records to a [Sentry](http://getsentry.com/) server using
+ [raven](https://packagist.org/packages/raven/raven).
+- _ZendMonitorHandler_: Logs records to the Zend Monitor present in Zend Server.
+- _NewRelicHandler_: Logs records to a [NewRelic](http://newrelic.com/) application.
+- _LogglyHandler_: Logs records to a [Loggly](http://www.loggly.com/) account.
+- _RollbarHandler_: Logs records to a [Rollbar](https://rollbar.com/) account.
+- _SyslogUdpHandler_: Logs records to a remote [Syslogd](http://www.rsyslog.com/) server.
+- _LogEntriesHandler_: Logs records to a [LogEntries](http://logentries.com/) account.
+
+### Logging in development
+
+- _FirePHPHandler_: Handler for [FirePHP](http://www.firephp.org/), providing
+ inline `console` messages within [FireBug](http://getfirebug.com/).
+- _ChromePHPHandler_: Handler for [ChromePHP](http://www.chromephp.com/), providing
+ inline `console` messages within Chrome.
+- _BrowserConsoleHandler_: Handler to send logs to browser's Javascript `console` with
+ no browser extension required. Most browsers supporting `console` API are supported.
+
+### Log to databases
+
+- _RedisHandler_: Logs records to a [redis](http://redis.io) server.
+- _MongoDBHandler_: Handler to write records in MongoDB via a
+ [Mongo](http://pecl.php.net/package/mongo) extension connection.
+- _CouchDBHandler_: Logs records to a CouchDB server.
+- _DoctrineCouchDBHandler_: Logs records to a CouchDB server via the Doctrine CouchDB ODM.
+- _ElasticSearchHandler_: Logs records to an Elastic Search server.
+- _DynamoDbHandler_: Logs records to a DynamoDB table with the [AWS SDK](https://github.com/aws/aws-sdk-php).
+
+### Wrappers / Special Handlers
+
+- _FingersCrossedHandler_: A very interesting wrapper. It takes a logger as
+ parameter and will accumulate log records of all levels until a record
+ exceeds the defined severity level. At which point it delivers all records,
+ including those of lower severity, to the handler it wraps. This means that
+ until an error actually happens you will not see anything in your logs, but
+ when it happens you will have the full information, including debug and info
+ records. This provides you with all the information you need, but only when
+ you need it.
+- _WhatFailureGroupHandler_: This handler extends the _GroupHandler_ ignoring
+ exceptions raised by each child handler. This allows you to ignore issues
+ where a remote tcp connection may have died but you do not want your entire
+ application to crash and may wish to continue to log to other handlers.
+- _BufferHandler_: This handler will buffer all the log records it receives
+ until `close()` is called at which point it will call `handleBatch()` on the
+ handler it wraps with all the log messages at once. This is very useful to
+ send an email with all records at once for example instead of having one mail
+ for every log record.
+- _GroupHandler_: This handler groups other handlers. Every record received is
+ sent to all the handlers it is configured with.
+- _FilterHandler_: This handler only lets records of the given levels through
+ to the wrapped handler.
+- _SamplingHandler_: Wraps around another handler and lets you sample records
+ if you only want to store some of them.
+- _NullHandler_: Any record it can handle will be thrown away. This can be used
+ to put on top of an existing handler stack to disable it temporarily.
+- _PsrHandler_: Can be used to forward log records to an existing PSR-3 logger
+- _TestHandler_: Used for testing, it records everything that is sent to it and
+ has accessors to read out the information.
+
+Formatters
+----------
+
+- _LineFormatter_: Formats a log record into a one-line string.
+- _HtmlFormatter_: Used to format log records into a human readable html table, mainly suitable for emails.
+- _NormalizerFormatter_: Normalizes objects/resources down to strings so a record can easily be serialized/encoded.
+- _ScalarFormatter_: Used to format log records into an associative array of scalar values.
+- _JsonFormatter_: Encodes a log record into json.
+- _WildfireFormatter_: Used to format log records into the Wildfire/FirePHP protocol, only useful for the FirePHPHandler.
+- _ChromePHPFormatter_: Used to format log records into the ChromePHP format, only useful for the ChromePHPHandler.
+- _GelfMessageFormatter_: Used to format log records into Gelf message instances, only useful for the GelfHandler.
+- _LogstashFormatter_: Used to format log records into [logstash](http://logstash.net/) event json, useful for any handler listed under inputs [here](http://logstash.net/docs/latest).
+- _ElasticaFormatter_: Used to format log records into an Elastica\Document object, only useful for the ElasticSearchHandler.
+- _LogglyFormatter_: Used to format log records into Loggly messages, only useful for the LogglyHandler.
+- _FlowdockFormatter_: Used to format log records into Flowdock messages, only useful for the FlowdockHandler.
+- _MongoDBFormatter_: Converts \DateTime instances to \MongoDate and objects recursively to arrays, only useful with the MongoDBHandler.
+
+Processors
+----------
+
+- _IntrospectionProcessor_: Adds the line/file/class/method from which the log call originated.
+- _WebProcessor_: Adds the current request URI, request method and client IP to a log record.
+- _MemoryUsageProcessor_: Adds the current memory usage to a log record.
+- _MemoryPeakUsageProcessor_: Adds the peak memory usage to a log record.
+- _ProcessIdProcessor_: Adds the process id to a log record.
+- _UidProcessor_: Adds a unique identifier to a log record.
+- _GitProcessor_: Adds the current git branch and commit to a log record.
+- _TagProcessor_: Adds an array of predefined tags to a log record.
+
+Utilities
+---------
+
+- _Registry_: The `Monolog\Registry` class lets you configure global loggers that you
+ can then statically access from anywhere. It is not really a best practice but can
+ help in some older codebases or for ease of use.
+- _ErrorHandler_: The `Monolog\ErrorHandler` class allows you to easily register
+ a Logger instance as an exception handler, error handler or fatal error handler.
+- _ErrorLevelActivationStrategy_: Activates a FingersCrossedHandler when a certain log
+ level is reached.
+- _ChannelLevelActivationStrategy_: Activates a FingersCrossedHandler when a certain
+ log level is reached, depending on which channel received the log record.
+
+About
+=====
+
+Requirements
+------------
+
+- Monolog works with PHP 5.3 or above, and is also tested to work with HHVM.
+
+Submitting bugs and feature requests
+------------------------------------
+
+Bugs and feature request are tracked on [GitHub](https://github.com/Seldaek/monolog/issues)
+
+Frameworks Integration
+----------------------
+
+- Frameworks and libraries using [PSR-3](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-3-logger-interface.md)
+ can be used very easily with Monolog since it implements the interface.
+- [Symfony2](http://symfony.com) comes out of the box with Monolog.
+- [Silex](http://silex.sensiolabs.org/) comes out of the box with Monolog.
+- [Laravel 4](http://laravel.com/) comes out of the box with Monolog.
+- [PPI](http://www.ppi.io/) comes out of the box with Monolog.
+- [CakePHP](http://cakephp.org/) is usable with Monolog via the [cakephp-monolog](https://github.com/jadb/cakephp-monolog) plugin.
+- [Slim](http://www.slimframework.com/) is usable with Monolog via the [Slim-Monolog](https://github.com/Flynsarmy/Slim-Monolog) log writer.
+- [XOOPS 2.6](http://xoops.org/) comes out of the box with Monolog.
+- [Aura.Web_Project](https://github.com/auraphp/Aura.Web_Project) comes out of the box with Monolog.
+
+Author
+------
+
+Jordi Boggiano - <j.boggiano@seld.be> - <http://twitter.com/seldaek><br />
+See also the list of [contributors](https://github.com/Seldaek/monolog/contributors) which participated in this project.
+
+License
+-------
+
+Monolog is licensed under the MIT License - see the `LICENSE` file for details
+
+Acknowledgements
+----------------
+
+This library is heavily inspired by Python's [Logbook](http://packages.python.org/Logbook/)
+library, although most concepts have been adjusted to fit to the PHP world.
diff --git a/vendor/monolog/monolog/composer.json b/vendor/monolog/monolog/composer.json
new file mode 100644
index 00000000..43704236
--- /dev/null
+++ b/vendor/monolog/monolog/composer.json
@@ -0,0 +1,50 @@
+{
+ "name": "monolog/monolog",
+ "description": "Sends your logs to files, sockets, inboxes, databases and various web services",
+ "keywords": ["log", "logging", "psr-3"],
+ "homepage": "http://github.com/Seldaek/monolog",
+ "type": "library",
+ "license": "MIT",
+ "authors": [
+ {
+ "name": "Jordi Boggiano",
+ "email": "j.boggiano@seld.be",
+ "homepage": "http://seld.be"
+ }
+ ],
+ "require": {
+ "php": ">=5.3.0",
+ "psr/log": "~1.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "~4.0",
+ "graylog2/gelf-php": "~1.0",
+ "raven/raven": "~0.5",
+ "ruflin/elastica": "0.90.*",
+ "doctrine/couchdb": "~1.0@dev",
+ "aws/aws-sdk-php": "~2.4, >2.4.8",
+ "videlalvaro/php-amqplib": "~2.4"
+ },
+ "suggest": {
+ "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server",
+ "raven/raven": "Allow sending log messages to a Sentry server",
+ "doctrine/couchdb": "Allow sending log messages to a CouchDB server",
+ "ruflin/elastica": "Allow sending log messages to an Elastic Search server",
+ "videlalvaro/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib",
+ "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+ "ext-mongo": "Allow sending log messages to a MongoDB server",
+ "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB",
+ "rollbar/rollbar": "Allow sending log messages to Rollbar"
+ },
+ "autoload": {
+ "psr-4": {"Monolog\\": "src/Monolog"}
+ },
+ "provide": {
+ "psr/log-implementation": "1.0.0"
+ },
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.12.x-dev"
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/doc/extending.md b/vendor/monolog/monolog/doc/extending.md
new file mode 100644
index 00000000..bb39ddcf
--- /dev/null
+++ b/vendor/monolog/monolog/doc/extending.md
@@ -0,0 +1,76 @@
+Extending Monolog
+=================
+
+Monolog is fully extensible, allowing you to adapt your logger to your needs.
+
+Writing your own handler
+------------------------
+
+Monolog provides many built-in handlers. But if the one you need does not
+exist, you can write it and use it in your logger. The only requirement is
+to implement `Monolog\Handler\HandlerInterface`.
+
+Let's write a PDOHandler to log records to a database. We will extend the
+abstract class provided by Monolog to keep things DRY.
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\AbstractProcessingHandler;
+
+class PDOHandler extends AbstractProcessingHandler
+{
+ private $initialized = false;
+ private $pdo;
+ private $statement;
+
+ public function __construct(PDO $pdo, $level = Logger::DEBUG, $bubble = true)
+ {
+ $this->pdo = $pdo;
+ parent::__construct($level, $bubble);
+ }
+
+ protected function write(array $record)
+ {
+ if (!$this->initialized) {
+ $this->initialize();
+ }
+
+ $this->statement->execute(array(
+ 'channel' => $record['channel'],
+ 'level' => $record['level'],
+ 'message' => $record['formatted'],
+ 'time' => $record['datetime']->format('U'),
+ ));
+ }
+
+ private function initialize()
+ {
+ $this->pdo->exec(
+ 'CREATE TABLE IF NOT EXISTS monolog '
+ .'(channel VARCHAR(255), level INTEGER, message LONGTEXT, time INTEGER UNSIGNED)'
+ );
+ $this->statement = $this->pdo->prepare(
+ 'INSERT INTO monolog (channel, level, message, time) VALUES (:channel, :level, :message, :time)'
+ );
+
+ $this->initialized = true;
+ }
+}
+```
+
+You can now use this handler in your logger:
+
+```php
+<?php
+
+$logger->pushHandler(new PDOHandler(new PDO('sqlite:logs.sqlite')));
+
+// You can now use your logger
+$logger->addInfo('My logger is now ready');
+```
+
+The `Monolog\Handler\AbstractProcessingHandler` class provides most of the
+logic needed for the handler, including the use of processors and the formatting
+of the record (which is why we use ``$record['formatted']`` instead of ``$record['message']``).
diff --git a/vendor/monolog/monolog/doc/sockets.md b/vendor/monolog/monolog/doc/sockets.md
new file mode 100644
index 00000000..fad30a9f
--- /dev/null
+++ b/vendor/monolog/monolog/doc/sockets.md
@@ -0,0 +1,37 @@
+Sockets Handler
+===============
+
+This handler allows you to write your logs to sockets using [fsockopen](http://php.net/fsockopen)
+or [pfsockopen](http://php.net/pfsockopen).
+
+Persistent sockets are mainly useful in web environments where you gain some performance not closing/opening
+the connections between requests.
+
+Basic Example
+-------------
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\SocketHandler;
+
+// Create the logger
+$logger = new Logger('my_logger');
+
+// Create the handler
+$handler = new SocketHandler('unix:///var/log/httpd_app_log.socket');
+$handler->setPersistent(true);
+
+// Now add the handler
+$logger->pushHandler($handler, Logger::DEBUG);
+
+// You can now use your logger
+$logger->addInfo('My logger is now ready');
+
+```
+
+In this example, using syslog-ng, you should see the log on the log server:
+
+ cweb1 [2012-02-26 00:12:03] my_logger.INFO: My logger is now ready [] []
+
diff --git a/vendor/monolog/monolog/doc/usage.md b/vendor/monolog/monolog/doc/usage.md
new file mode 100644
index 00000000..7585fa2a
--- /dev/null
+++ b/vendor/monolog/monolog/doc/usage.md
@@ -0,0 +1,162 @@
+Using Monolog
+=============
+
+Installation
+------------
+
+Monolog is available on Packagist ([monolog/monolog](http://packagist.org/packages/monolog/monolog))
+and as such installable via [Composer](http://getcomposer.org/).
+
+```bash
+php composer.phar require monolog/monolog
+```
+
+If you do not use Composer, you can grab the code from GitHub, and use any
+PSR-0 compatible autoloader (e.g. the [Symfony2 ClassLoader component](https://github.com/symfony/ClassLoader))
+to load Monolog classes.
+
+Configuring a logger
+--------------------
+
+Here is a basic setup to log to a file and to firephp on the DEBUG level:
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+use Monolog\Handler\FirePHPHandler;
+
+// Create the logger
+$logger = new Logger('my_logger');
+// Now add some handlers
+$logger->pushHandler(new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG));
+$logger->pushHandler(new FirePHPHandler());
+
+// You can now use your logger
+$logger->addInfo('My logger is now ready');
+```
+
+Let's explain it. The first step is to create the logger instance which will
+be used in your code. The argument is a channel name, which is useful when
+you use several loggers (see below for more details about it).
+
+The logger itself does not know how to handle a record. It delegates it to
+some handlers. The code above registers two handlers in the stack to allow
+handling records in two different ways.
+
+Note that the FirePHPHandler is called first as it is added on top of the
+stack. This allows you to temporarily add a logger with bubbling disabled if
+you want to override other configured loggers.
+
+Adding extra data in the records
+--------------------------------
+
+Monolog provides two different ways to add extra informations along the simple
+textual message.
+
+### Using the logging context
+
+The first way is the context, allowing to pass an array of data along the
+record:
+
+```php
+<?php
+
+$logger->addInfo('Adding a new user', array('username' => 'Seldaek'));
+```
+
+Simple handlers (like the StreamHandler for instance) will simply format
+the array to a string but richer handlers can take advantage of the context
+(FirePHP is able to display arrays in pretty way for instance).
+
+### Using processors
+
+The second way is to add extra data for all records by using a processor.
+Processors can be any callable. They will get the record as parameter and
+must return it after having eventually changed the `extra` part of it. Let's
+write a processor adding some dummy data in the record:
+
+```php
+<?php
+
+$logger->pushProcessor(function ($record) {
+ $record['extra']['dummy'] = 'Hello world!';
+
+ return $record;
+});
+```
+
+Monolog provides some built-in processors that can be used in your project.
+Look at the [README file](https://github.com/Seldaek/monolog/blob/master/README.mdown) for the list.
+
+> Tip: processors can also be registered on a specific handler instead of
+ the logger to apply only for this handler.
+
+Leveraging channels
+-------------------
+
+Channels are a great way to identify to which part of the application a record
+is related. This is useful in big applications (and is leveraged by
+MonologBundle in Symfony2).
+
+Picture two loggers sharing a handler that writes to a single log file.
+Channels would allow you to identify the logger that issued every record.
+You can easily grep through the log files filtering this or that channel.
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+use Monolog\Handler\FirePHPHandler;
+
+// Create some handlers
+$stream = new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG);
+$firephp = new FirePHPHandler();
+
+// Create the main logger of the app
+$logger = new Logger('my_logger');
+$logger->pushHandler($stream);
+$logger->pushHandler($firephp);
+
+// Create a logger for the security-related stuff with a different channel
+$securityLogger = new Logger('security');
+$securityLogger->pushHandler($stream);
+$securityLogger->pushHandler($firephp);
+```
+
+Customizing log format
+----------------------
+
+In Monolog it's easy to customize the format of the logs written into files,
+sockets, mails, databases and other handlers. Most of the handlers use the
+
+```php
+$record['formatted']
+```
+
+value to be automatically put into the log device. This value depends on the
+formatter settings. You can choose between predefined formatter classes or
+write your own (e.g. a multiline text file for human-readable output).
+
+To configure a predefined formatter class, just set it as the handler's field:
+
+```php
+// the default date format is "Y-m-d H:i:s"
+$dateFormat = "Y n j, g:i a";
+// the default output format is "[%datetime%] %channel%.%level_name%: %message% %context% %extra%\n"
+$output = "%datetime% > %level_name% > %message% %context% %extra%\n";
+// finally, create a formatter
+$formatter = new LineFormatter($output, $dateFormat);
+
+// Create a handler
+$stream = new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG);
+$stream->setFormatter($formatter);
+// bind it to a logger object
+$securityLogger = new Logger('security');
+$securityLogger->pushHandler($stream);
+```
+
+You may also reuse the same formatter between multiple handlers and share those
+handlers between multiple loggers.
diff --git a/vendor/monolog/monolog/phpunit.xml.dist b/vendor/monolog/monolog/phpunit.xml.dist
new file mode 100644
index 00000000..17545707
--- /dev/null
+++ b/vendor/monolog/monolog/phpunit.xml.dist
@@ -0,0 +1,15 @@
+<?xml version="1.0" encoding="UTF-8"?>
+
+<phpunit bootstrap="tests/bootstrap.php" colors="true">
+ <testsuites>
+ <testsuite name="Monolog Test Suite">
+ <directory>tests/Monolog/</directory>
+ </testsuite>
+ </testsuites>
+
+ <filter>
+ <whitelist>
+ <directory suffix=".php">src/Monolog/</directory>
+ </whitelist>
+ </filter>
+</phpunit>
diff --git a/vendor/monolog/monolog/src/Monolog/ErrorHandler.php b/vendor/monolog/monolog/src/Monolog/ErrorHandler.php
new file mode 100644
index 00000000..c8923354
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/ErrorHandler.php
@@ -0,0 +1,208 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Psr\Log\LoggerInterface;
+use Psr\Log\LogLevel;
+
+/**
+ * Monolog error handler
+ *
+ * A facility to enable logging of runtime errors, exceptions and fatal errors.
+ *
+ * Quick setup: <code>ErrorHandler::register($logger);</code>
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class ErrorHandler
+{
+ private $logger;
+
+ private $previousExceptionHandler;
+ private $uncaughtExceptionLevel;
+
+ private $previousErrorHandler;
+ private $errorLevelMap;
+
+ private $fatalLevel;
+ private $reservedMemory;
+ private static $fatalErrors = array(E_ERROR, E_PARSE, E_CORE_ERROR, E_COMPILE_ERROR, E_USER_ERROR);
+
+ public function __construct(LoggerInterface $logger)
+ {
+ $this->logger = $logger;
+ }
+
+ /**
+ * Registers a new ErrorHandler for a given Logger
+ *
+ * By default it will handle errors, exceptions and fatal errors
+ *
+ * @param LoggerInterface $logger
+ * @param array|false $errorLevelMap an array of E_* constant to LogLevel::* constant mapping, or false to disable error handling
+ * @param int|false $exceptionLevel a LogLevel::* constant, or false to disable exception handling
+ * @param int|false $fatalLevel a LogLevel::* constant, or false to disable fatal error handling
+ * @return ErrorHandler
+ */
+ public static function register(LoggerInterface $logger, $errorLevelMap = array(), $exceptionLevel = null, $fatalLevel = null)
+ {
+ $handler = new static($logger);
+ if ($errorLevelMap !== false) {
+ $handler->registerErrorHandler($errorLevelMap);
+ }
+ if ($exceptionLevel !== false) {
+ $handler->registerExceptionHandler($exceptionLevel);
+ }
+ if ($fatalLevel !== false) {
+ $handler->registerFatalHandler($fatalLevel);
+ }
+
+ return $handler;
+ }
+
+ public function registerExceptionHandler($level = null, $callPrevious = true)
+ {
+ $prev = set_exception_handler(array($this, 'handleException'));
+ $this->uncaughtExceptionLevel = $level;
+ if ($callPrevious && $prev) {
+ $this->previousExceptionHandler = $prev;
+ }
+ }
+
+ public function registerErrorHandler(array $levelMap = array(), $callPrevious = true, $errorTypes = -1)
+ {
+ $prev = set_error_handler(array($this, 'handleError'), $errorTypes);
+ $this->errorLevelMap = array_replace($this->defaultErrorLevelMap(), $levelMap);
+ if ($callPrevious) {
+ $this->previousErrorHandler = $prev ?: true;
+ }
+ }
+
+ public function registerFatalHandler($level = null, $reservedMemorySize = 20)
+ {
+ register_shutdown_function(array($this, 'handleFatalError'));
+
+ $this->reservedMemory = str_repeat(' ', 1024 * $reservedMemorySize);
+ $this->fatalLevel = $level;
+ }
+
+ protected function defaultErrorLevelMap()
+ {
+ return array(
+ E_ERROR => LogLevel::CRITICAL,
+ E_WARNING => LogLevel::WARNING,
+ E_PARSE => LogLevel::ALERT,
+ E_NOTICE => LogLevel::NOTICE,
+ E_CORE_ERROR => LogLevel::CRITICAL,
+ E_CORE_WARNING => LogLevel::WARNING,
+ E_COMPILE_ERROR => LogLevel::ALERT,
+ E_COMPILE_WARNING => LogLevel::WARNING,
+ E_USER_ERROR => LogLevel::ERROR,
+ E_USER_WARNING => LogLevel::WARNING,
+ E_USER_NOTICE => LogLevel::NOTICE,
+ E_STRICT => LogLevel::NOTICE,
+ E_RECOVERABLE_ERROR => LogLevel::ERROR,
+ E_DEPRECATED => LogLevel::NOTICE,
+ E_USER_DEPRECATED => LogLevel::NOTICE,
+ );
+ }
+
+ /**
+ * @private
+ */
+ public function handleException(\Exception $e)
+ {
+ $this->logger->log(
+ $this->uncaughtExceptionLevel === null ? LogLevel::ERROR : $this->uncaughtExceptionLevel,
+ sprintf('Uncaught Exception %s: "%s" at %s line %s', get_class($e), $e->getMessage(), $e->getFile(), $e->getLine()),
+ array('exception' => $e)
+ );
+
+ if ($this->previousExceptionHandler) {
+ call_user_func($this->previousExceptionHandler, $e);
+ }
+ }
+
+ /**
+ * @private
+ */
+ public function handleError($code, $message, $file = '', $line = 0, $context = array())
+ {
+ if (!(error_reporting() & $code)) {
+ return;
+ }
+
+ $level = isset($this->errorLevelMap[$code]) ? $this->errorLevelMap[$code] : LogLevel::CRITICAL;
+ $this->logger->log($level, self::codeToString($code).': '.$message, array('code' => $code, 'message' => $message, 'file' => $file, 'line' => $line));
+
+ if ($this->previousErrorHandler === true) {
+ return false;
+ } elseif ($this->previousErrorHandler) {
+ return call_user_func($this->previousErrorHandler, $code, $message, $file, $line, $context);
+ }
+ }
+
+ /**
+ * @private
+ */
+ public function handleFatalError()
+ {
+ $this->reservedMemory = null;
+
+ $lastError = error_get_last();
+ if ($lastError && in_array($lastError['type'], self::$fatalErrors)) {
+ $this->logger->log(
+ $this->fatalLevel === null ? LogLevel::ALERT : $this->fatalLevel,
+ 'Fatal Error ('.self::codeToString($lastError['type']).'): '.$lastError['message'],
+ array('code' => $lastError['type'], 'message' => $lastError['message'], 'file' => $lastError['file'], 'line' => $lastError['line'])
+ );
+ }
+ }
+
+ private static function codeToString($code)
+ {
+ switch ($code) {
+ case E_ERROR:
+ return 'E_ERROR';
+ case E_WARNING:
+ return 'E_WARNING';
+ case E_PARSE:
+ return 'E_PARSE';
+ case E_NOTICE:
+ return 'E_NOTICE';
+ case E_CORE_ERROR:
+ return 'E_CORE_ERROR';
+ case E_CORE_WARNING:
+ return 'E_CORE_WARNING';
+ case E_COMPILE_ERROR:
+ return 'E_COMPILE_ERROR';
+ case E_COMPILE_WARNING:
+ return 'E_COMPILE_WARNING';
+ case E_USER_ERROR:
+ return 'E_USER_ERROR';
+ case E_USER_WARNING:
+ return 'E_USER_WARNING';
+ case E_USER_NOTICE:
+ return 'E_USER_NOTICE';
+ case E_STRICT:
+ return 'E_STRICT';
+ case E_RECOVERABLE_ERROR:
+ return 'E_RECOVERABLE_ERROR';
+ case E_DEPRECATED:
+ return 'E_DEPRECATED';
+ case E_USER_DEPRECATED:
+ return 'E_USER_DEPRECATED';
+ }
+
+ return 'Unknown PHP error';
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php
new file mode 100644
index 00000000..56d3e278
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php
@@ -0,0 +1,79 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * Formats a log message according to the ChromePHP array format
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class ChromePHPFormatter implements FormatterInterface
+{
+ /**
+ * Translates Monolog log levels to Wildfire levels.
+ */
+ private $logLevels = array(
+ Logger::DEBUG => 'log',
+ Logger::INFO => 'info',
+ Logger::NOTICE => 'info',
+ Logger::WARNING => 'warn',
+ Logger::ERROR => 'error',
+ Logger::CRITICAL => 'error',
+ Logger::ALERT => 'error',
+ Logger::EMERGENCY => 'error',
+ );
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ // Retrieve the line and file if set and remove them from the formatted extra
+ $backtrace = 'unknown';
+ if (isset($record['extra']['file']) && isset($record['extra']['line'])) {
+ $backtrace = $record['extra']['file'].' : '.$record['extra']['line'];
+ unset($record['extra']['file']);
+ unset($record['extra']['line']);
+ }
+
+ $message = array('message' => $record['message']);
+ if ($record['context']) {
+ $message['context'] = $record['context'];
+ }
+ if ($record['extra']) {
+ $message['extra'] = $record['extra'];
+ }
+ if (count($message) === 1) {
+ $message = reset($message);
+ }
+
+ return array(
+ $record['channel'],
+ $message,
+ $backtrace,
+ $this->logLevels[$record['level']],
+ );
+ }
+
+ public function formatBatch(array $records)
+ {
+ $formatted = array();
+
+ foreach ($records as $record) {
+ $formatted[] = $this->format($record);
+ }
+
+ return $formatted;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/ElasticaFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/ElasticaFormatter.php
new file mode 100644
index 00000000..b0b0cf06
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/ElasticaFormatter.php
@@ -0,0 +1,87 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Elastica\Document;
+
+/**
+ * Format a log message into an Elastica Document
+ *
+ * @author Jelle Vink <jelle.vink@gmail.com>
+ */
+class ElasticaFormatter extends NormalizerFormatter
+{
+ /**
+ * @var string Elastic search index name
+ */
+ protected $index;
+
+ /**
+ * @var string Elastic search document type
+ */
+ protected $type;
+
+ /**
+ * @param string $index Elastic Search index name
+ * @param string $type Elastic Search document type
+ */
+ public function __construct($index, $type)
+ {
+ parent::__construct(\DateTime::ISO8601);
+ $this->index = $index;
+ $this->type = $type;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ $record = parent::format($record);
+
+ return $this->getDocument($record);
+ }
+
+ /**
+ * Getter index
+ * @return string
+ */
+ public function getIndex()
+ {
+ return $this->index;
+ }
+
+ /**
+ * Getter type
+ * @return string
+ */
+ public function getType()
+ {
+ return $this->type;
+ }
+
+ /**
+ * Convert a log message into an Elastica Document
+ *
+ * @param array $record Log message
+ * @return Document
+ */
+ protected function getDocument($record)
+ {
+ $document = new Document();
+ $document->setData($record);
+ $document->setType($this->type);
+ $document->setIndex($this->index);
+
+ return $document;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/FlowdockFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/FlowdockFormatter.php
new file mode 100644
index 00000000..af63d011
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/FlowdockFormatter.php
@@ -0,0 +1,104 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * formats the record to be used in the FlowdockHandler
+ *
+ * @author Dominik Liebler <liebler.dominik@gmail.com>
+ */
+class FlowdockFormatter implements FormatterInterface
+{
+ /**
+ * @var string
+ */
+ private $source;
+
+ /**
+ * @var string
+ */
+ private $sourceEmail;
+
+ /**
+ * @param string $source
+ * @param string $sourceEmail
+ */
+ public function __construct($source, $sourceEmail)
+ {
+ $this->source = $source;
+ $this->sourceEmail = $sourceEmail;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ $tags = array(
+ '#logs',
+ '#' . strtolower($record['level_name']),
+ '#' . $record['channel'],
+ );
+
+ foreach ($record['extra'] as $value) {
+ $tags[] = '#' . $value;
+ }
+
+ $subject = sprintf(
+ 'in %s: %s - %s',
+ $this->source,
+ $record['level_name'],
+ $this->getShortMessage($record['message'])
+ );
+
+ $record['flowdock'] = array(
+ 'source' => $this->source,
+ 'from_address' => $this->sourceEmail,
+ 'subject' => $subject,
+ 'content' => $record['message'],
+ 'tags' => $tags,
+ 'project' => $this->source,
+ );
+
+ return $record;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function formatBatch(array $records)
+ {
+ $formatted = array();
+
+ foreach ($records as $record) {
+ $formatted[] = $this->format($record);
+ }
+
+ return $formatted;
+ }
+
+ /**
+ * @param string $message
+ *
+ * @return string
+ */
+ public function getShortMessage($message)
+ {
+ $maxLength = 45;
+
+ if (strlen($message) > $maxLength) {
+ $message = substr($message, 0, $maxLength - 4) . ' ...';
+ }
+
+ return $message;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php b/vendor/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php
new file mode 100644
index 00000000..b5de7511
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php
@@ -0,0 +1,36 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Interface for formatters
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+interface FormatterInterface
+{
+ /**
+ * Formats a log record.
+ *
+ * @param array $record A record to format
+ * @return mixed The formatted record
+ */
+ public function format(array $record);
+
+ /**
+ * Formats a set of log records.
+ *
+ * @param array $records A set of records to format
+ * @return mixed The formatted set of records
+ */
+ public function formatBatch(array $records);
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php
new file mode 100644
index 00000000..8d01c64c
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php
@@ -0,0 +1,101 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Gelf\Message;
+
+/**
+ * Serializes a log message to GELF
+ * @see http://www.graylog2.org/about/gelf
+ *
+ * @author Matt Lehner <mlehner@gmail.com>
+ */
+class GelfMessageFormatter extends NormalizerFormatter
+{
+ /**
+ * @var string the name of the system for the Gelf log message
+ */
+ protected $systemName;
+
+ /**
+ * @var string a prefix for 'extra' fields from the Monolog record (optional)
+ */
+ protected $extraPrefix;
+
+ /**
+ * @var string a prefix for 'context' fields from the Monolog record (optional)
+ */
+ protected $contextPrefix;
+
+ /**
+ * Translates Monolog log levels to Graylog2 log priorities.
+ */
+ private $logLevels = array(
+ Logger::DEBUG => 7,
+ Logger::INFO => 6,
+ Logger::NOTICE => 5,
+ Logger::WARNING => 4,
+ Logger::ERROR => 3,
+ Logger::CRITICAL => 2,
+ Logger::ALERT => 1,
+ Logger::EMERGENCY => 0,
+ );
+
+ public function __construct($systemName = null, $extraPrefix = null, $contextPrefix = 'ctxt_')
+ {
+ parent::__construct('U.u');
+
+ $this->systemName = $systemName ?: gethostname();
+
+ $this->extraPrefix = $extraPrefix;
+ $this->contextPrefix = $contextPrefix;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ $record = parent::format($record);
+ $message = new Message();
+ $message
+ ->setTimestamp($record['datetime'])
+ ->setShortMessage((string) $record['message'])
+ ->setFacility($record['channel'])
+ ->setHost($this->systemName)
+ ->setLine(isset($record['extra']['line']) ? $record['extra']['line'] : null)
+ ->setFile(isset($record['extra']['file']) ? $record['extra']['file'] : null)
+ ->setLevel($this->logLevels[$record['level']]);
+
+ // Do not duplicate these values in the additional fields
+ unset($record['extra']['line']);
+ unset($record['extra']['file']);
+
+ foreach ($record['extra'] as $key => $val) {
+ $message->setAdditional($this->extraPrefix . $key, is_scalar($val) ? $val : $this->toJson($val));
+ }
+
+ foreach ($record['context'] as $key => $val) {
+ $message->setAdditional($this->contextPrefix . $key, is_scalar($val) ? $val : $this->toJson($val));
+ }
+
+ if (null === $message->getFile() && isset($record['context']['exception']['file'])) {
+ if (preg_match("/^(.+):([0-9]+)$/", $record['context']['exception']['file'], $matches)) {
+ $message->setFile($matches[1]);
+ $message->setLine($matches[2]);
+ }
+ }
+
+ return $message;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/HtmlFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/HtmlFormatter.php
new file mode 100644
index 00000000..255d2887
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/HtmlFormatter.php
@@ -0,0 +1,140 @@
+<?php
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * Formats incoming records into an HTML table
+ *
+ * This is especially useful for html email logging
+ *
+ * @author Tiago Brito <tlfbrito@gmail.com>
+ */
+class HtmlFormatter extends NormalizerFormatter
+{
+ /**
+ * Translates Monolog log levels to html color priorities.
+ */
+ private $logLevels = array(
+ Logger::DEBUG => '#cccccc',
+ Logger::INFO => '#468847',
+ Logger::NOTICE => '#3a87ad',
+ Logger::WARNING => '#c09853',
+ Logger::ERROR => '#f0ad4e',
+ Logger::CRITICAL => '#FF7708',
+ Logger::ALERT => '#C12A19',
+ Logger::EMERGENCY => '#000000',
+ );
+
+ /**
+ * @param string $dateFormat The format of the timestamp: one supported by DateTime::format
+ */
+ public function __construct($dateFormat = null)
+ {
+ parent::__construct($dateFormat);
+ }
+
+ /**
+ * Creates an HTML table row
+ *
+ * @param string $th Row header content
+ * @param string $td Row standard cell content
+ * @param bool $escapeTd false if td content must not be html escaped
+ * @return string
+ */
+ private function addRow($th, $td = ' ', $escapeTd = true)
+ {
+ $th = htmlspecialchars($th, ENT_NOQUOTES, 'UTF-8');
+ if ($escapeTd) {
+ $td = '<pre>'.htmlspecialchars($td, ENT_NOQUOTES, 'UTF-8').'</pre>';
+ }
+
+ return "<tr style=\"padding: 4px;spacing: 0;text-align: left;\">\n<th style=\"background: #cccccc\" width=\"100px\">$th:</th>\n<td style=\"padding: 4px;spacing: 0;text-align: left;background: #eeeeee\">".$td."</td>\n</tr>";
+ }
+
+ /**
+ * Create a HTML h1 tag
+ *
+ * @param string $title Text to be in the h1
+ * @param integer $level Error level
+ * @return string
+ */
+ private function addTitle($title, $level)
+ {
+ $title = htmlspecialchars($title, ENT_NOQUOTES, 'UTF-8');
+
+ return '<h1 style="background: '.$this->logLevels[$level].';color: #ffffff;padding: 5px;" class="monolog-output">'.$title.'</h1>';
+ }
+ /**
+ * Formats a log record.
+ *
+ * @param array $record A record to format
+ * @return mixed The formatted record
+ */
+ public function format(array $record)
+ {
+ $output = $this->addTitle($record['level_name'], $record['level']);
+ $output .= '<table cellspacing="1" width="100%" class="monolog-output">';
+
+ $output .= $this->addRow('Message', (string) $record['message']);
+ $output .= $this->addRow('Time', $record['datetime']->format($this->dateFormat));
+ $output .= $this->addRow('Channel', $record['channel']);
+ if ($record['context']) {
+ $embeddedTable = '<table cellspacing="1" width="100%">';
+ foreach ($record['context'] as $key => $value) {
+ $embeddedTable .= $this->addRow($key, $this->convertToString($value));
+ }
+ $embeddedTable .= '</table>';
+ $output .= $this->addRow('Context', $embeddedTable, false);
+ }
+ if ($record['extra']) {
+ $embeddedTable = '<table cellspacing="1" width="100%">';
+ foreach ($record['extra'] as $key => $value) {
+ $embeddedTable .= $this->addRow($key, $this->convertToString($value));
+ }
+ $embeddedTable .= '</table>';
+ $output .= $this->addRow('Extra', $embeddedTable, false);
+ }
+
+ return $output.'</table>';
+ }
+
+ /**
+ * Formats a set of log records.
+ *
+ * @param array $records A set of records to format
+ * @return mixed The formatted set of records
+ */
+ public function formatBatch(array $records)
+ {
+ $message = '';
+ foreach ($records as $record) {
+ $message .= $this->format($record);
+ }
+
+ return $message;
+ }
+
+ protected function convertToString($data)
+ {
+ if (null === $data || is_scalar($data)) {
+ return (string) $data;
+ }
+
+ $data = $this->normalize($data);
+ if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+ return json_encode($data, JSON_PRETTY_PRINT | JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+ }
+
+ return str_replace('\\/', '/', json_encode($data));
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php
new file mode 100644
index 00000000..7963dbf1
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php
@@ -0,0 +1,116 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Encodes whatever record data is passed to it as json
+ *
+ * This can be useful to log to databases or remote APIs
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class JsonFormatter implements FormatterInterface
+{
+ const BATCH_MODE_JSON = 1;
+ const BATCH_MODE_NEWLINES = 2;
+
+ protected $batchMode;
+ protected $appendNewline;
+
+ /**
+ * @param int $batchMode
+ */
+ public function __construct($batchMode = self::BATCH_MODE_JSON, $appendNewline = true)
+ {
+ $this->batchMode = $batchMode;
+ $this->appendNewline = $appendNewline;
+ }
+
+ /**
+ * The batch mode option configures the formatting style for
+ * multiple records. By default, multiple records will be
+ * formatted as a JSON-encoded array. However, for
+ * compatibility with some API endpoints, alternive styles
+ * are available.
+ *
+ * @return int
+ */
+ public function getBatchMode()
+ {
+ return $this->batchMode;
+ }
+
+ /**
+ * True if newlines are appended to every formatted record
+ *
+ * @return bool
+ */
+ public function isAppendingNewlines()
+ {
+ return $this->appendNewline;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ return json_encode($record) . ($this->appendNewline ? "\n" : '');
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function formatBatch(array $records)
+ {
+ switch ($this->batchMode) {
+ case static::BATCH_MODE_NEWLINES:
+ return $this->formatBatchNewlines($records);
+
+ case static::BATCH_MODE_JSON:
+ default:
+ return $this->formatBatchJson($records);
+ }
+ }
+
+ /**
+ * Return a JSON-encoded array of records.
+ *
+ * @param array $records
+ * @return string
+ */
+ protected function formatBatchJson(array $records)
+ {
+ return json_encode($records);
+ }
+
+ /**
+ * Use new lines to separate records instead of a
+ * JSON-encoded array.
+ *
+ * @param array $records
+ * @return string
+ */
+ protected function formatBatchNewlines(array $records)
+ {
+ $instance = $this;
+
+ $oldNewline = $this->appendNewline;
+ $this->appendNewline = false;
+ array_walk($records, function (&$value, $key) use ($instance) {
+ $value = $instance->format($value);
+ });
+ $this->appendNewline = $oldNewline;
+
+ return implode("\n", $records);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php
new file mode 100644
index 00000000..6983d1a5
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php
@@ -0,0 +1,159 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Exception;
+
+/**
+ * Formats incoming records into a one-line string
+ *
+ * This is especially useful for logging to files
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class LineFormatter extends NormalizerFormatter
+{
+ const SIMPLE_FORMAT = "[%datetime%] %channel%.%level_name%: %message% %context% %extra%\n";
+
+ protected $format;
+ protected $allowInlineLineBreaks;
+ protected $ignoreEmptyContextAndExtra;
+ protected $includeStacktraces;
+
+ /**
+ * @param string $format The format of the message
+ * @param string $dateFormat The format of the timestamp: one supported by DateTime::format
+ * @param bool $allowInlineLineBreaks Whether to allow inline line breaks in log entries
+ * @param bool $ignoreEmptyContextAndExtra
+ */
+ public function __construct($format = null, $dateFormat = null, $allowInlineLineBreaks = false, $ignoreEmptyContextAndExtra = false)
+ {
+ $this->format = $format ?: static::SIMPLE_FORMAT;
+ $this->allowInlineLineBreaks = $allowInlineLineBreaks;
+ $this->ignoreEmptyContextAndExtra = $ignoreEmptyContextAndExtra;
+ parent::__construct($dateFormat);
+ }
+
+ public function includeStacktraces($include = true)
+ {
+ $this->includeStacktraces = $include;
+ if ($this->includeStacktraces) {
+ $this->allowInlineLineBreaks = true;
+ }
+ }
+
+ public function allowInlineLineBreaks($allow = true)
+ {
+ $this->allowInlineLineBreaks = $allow;
+ }
+
+ public function ignoreEmptyContextAndExtra($ignore = true)
+ {
+ $this->ignoreEmptyContextAndExtra = $ignore;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ $vars = parent::format($record);
+
+ $output = $this->format;
+
+ foreach ($vars['extra'] as $var => $val) {
+ if (false !== strpos($output, '%extra.'.$var.'%')) {
+ $output = str_replace('%extra.'.$var.'%', $this->stringify($val), $output);
+ unset($vars['extra'][$var]);
+ }
+ }
+
+ if ($this->ignoreEmptyContextAndExtra) {
+ if (empty($vars['context'])) {
+ unset($vars['context']);
+ $output = str_replace('%context%', '', $output);
+ }
+
+ if (empty($vars['extra'])) {
+ unset($vars['extra']);
+ $output = str_replace('%extra%', '', $output);
+ }
+ }
+
+ foreach ($vars as $var => $val) {
+ if (false !== strpos($output, '%'.$var.'%')) {
+ $output = str_replace('%'.$var.'%', $this->stringify($val), $output);
+ }
+ }
+
+ return $output;
+ }
+
+ public function formatBatch(array $records)
+ {
+ $message = '';
+ foreach ($records as $record) {
+ $message .= $this->format($record);
+ }
+
+ return $message;
+ }
+
+ public function stringify($value)
+ {
+ return $this->replaceNewlines($this->convertToString($value));
+ }
+
+ protected function normalizeException(Exception $e)
+ {
+ $previousText = '';
+ if ($previous = $e->getPrevious()) {
+ do {
+ $previousText .= ', '.get_class($previous).'(code: '.$previous->getCode().'): '.$previous->getMessage().' at '.$previous->getFile().':'.$previous->getLine();
+ } while ($previous = $previous->getPrevious());
+ }
+
+ $str = '[object] ('.get_class($e).'(code: '.$e->getCode().'): '.$e->getMessage().' at '.$e->getFile().':'.$e->getLine().$previousText.')';
+ if ($this->includeStacktraces) {
+ $str .= "\n[stacktrace]\n".$e->getTraceAsString();
+ }
+
+ return $str;
+ }
+
+ protected function convertToString($data)
+ {
+ if (null === $data || is_bool($data)) {
+ return var_export($data, true);
+ }
+
+ if (is_scalar($data)) {
+ return (string) $data;
+ }
+
+ if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+ return $this->toJson($data, true);
+ }
+
+ return str_replace('\\/', '/', @json_encode($data));
+ }
+
+ protected function replaceNewlines($str)
+ {
+ if ($this->allowInlineLineBreaks) {
+ return $str;
+ }
+
+ return strtr($str, array("\r\n" => ' ', "\r" => ' ', "\n" => ' '));
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php
new file mode 100644
index 00000000..f02bceb0
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php
@@ -0,0 +1,47 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Encodes message information into JSON in a format compatible with Loggly.
+ *
+ * @author Adam Pancutt <adam@pancutt.com>
+ */
+class LogglyFormatter extends JsonFormatter
+{
+ /**
+ * Overrides the default batch mode to new lines for compatibility with the
+ * Loggly bulk API.
+ *
+ * @param integer $batchMode
+ */
+ public function __construct($batchMode = self::BATCH_MODE_NEWLINES, $appendNewline = false)
+ {
+ parent::__construct($batchMode, $appendNewline);
+ }
+
+ /**
+ * Appends the 'timestamp' parameter for indexing by Loggly.
+ *
+ * @see https://www.loggly.com/docs/automated-parsing/#json
+ * @see \Monolog\Formatter\JsonFormatter::format()
+ */
+ public function format(array $record)
+ {
+ if (isset($record["datetime"]) && ($record["datetime"] instanceof \DateTime)) {
+ $record["timestamp"] = $record["datetime"]->format("Y-m-d\TH:i:s.uO");
+ // TODO 2.0 unset the 'datetime' parameter, retained for BC
+ }
+
+ return parent::format($record);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php
new file mode 100644
index 00000000..7a7b3b3c
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php
@@ -0,0 +1,165 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Serializes a log message to Logstash Event Format
+ *
+ * @see http://logstash.net/
+ * @see https://github.com/logstash/logstash/blob/master/lib/logstash/event.rb
+ *
+ * @author Tim Mower <timothy.mower@gmail.com>
+ */
+class LogstashFormatter extends NormalizerFormatter
+{
+ const V0 = 0;
+ const V1 = 1;
+
+ /**
+ * @var string the name of the system for the Logstash log message, used to fill the @source field
+ */
+ protected $systemName;
+
+ /**
+ * @var string an application name for the Logstash log message, used to fill the @type field
+ */
+ protected $applicationName;
+
+ /**
+ * @var string a prefix for 'extra' fields from the Monolog record (optional)
+ */
+ protected $extraPrefix;
+
+ /**
+ * @var string a prefix for 'context' fields from the Monolog record (optional)
+ */
+ protected $contextPrefix;
+
+ /**
+ * @var integer logstash format version to use
+ */
+ protected $version;
+
+ /**
+ * @param string $applicationName the application that sends the data, used as the "type" field of logstash
+ * @param string $systemName the system/machine name, used as the "source" field of logstash, defaults to the hostname of the machine
+ * @param string $extraPrefix prefix for extra keys inside logstash "fields"
+ * @param string $contextPrefix prefix for context keys inside logstash "fields", defaults to ctxt_
+ */
+ public function __construct($applicationName, $systemName = null, $extraPrefix = null, $contextPrefix = 'ctxt_', $version = self::V0)
+ {
+ // logstash requires a ISO 8601 format date with optional millisecond precision.
+ parent::__construct('Y-m-d\TH:i:s.uP');
+
+ $this->systemName = $systemName ?: gethostname();
+ $this->applicationName = $applicationName;
+ $this->extraPrefix = $extraPrefix;
+ $this->contextPrefix = $contextPrefix;
+ $this->version = $version;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ $record = parent::format($record);
+
+ if ($this->version === self::V1) {
+ $message = $this->formatV1($record);
+ } else {
+ $message = $this->formatV0($record);
+ }
+
+ return $this->toJson($message) . "\n";
+ }
+
+ protected function formatV0(array $record)
+ {
+ if (empty($record['datetime'])) {
+ $record['datetime'] = gmdate('c');
+ }
+ $message = array(
+ '@timestamp' => $record['datetime'],
+ '@source' => $this->systemName,
+ '@fields' => array()
+ );
+ if (isset($record['message'])) {
+ $message['@message'] = $record['message'];
+ }
+ if (isset($record['channel'])) {
+ $message['@tags'] = array($record['channel']);
+ $message['@fields']['channel'] = $record['channel'];
+ }
+ if (isset($record['level'])) {
+ $message['@fields']['level'] = $record['level'];
+ }
+ if ($this->applicationName) {
+ $message['@type'] = $this->applicationName;
+ }
+ if (isset($record['extra']['server'])) {
+ $message['@source_host'] = $record['extra']['server'];
+ }
+ if (isset($record['extra']['url'])) {
+ $message['@source_path'] = $record['extra']['url'];
+ }
+ if (!empty($record['extra'])) {
+ foreach ($record['extra'] as $key => $val) {
+ $message['@fields'][$this->extraPrefix . $key] = $val;
+ }
+ }
+ if (!empty($record['context'])) {
+ foreach ($record['context'] as $key => $val) {
+ $message['@fields'][$this->contextPrefix . $key] = $val;
+ }
+ }
+
+ return $message;
+ }
+
+ protected function formatV1(array $record)
+ {
+ if (empty($record['datetime'])) {
+ $record['datetime'] = gmdate('c');
+ }
+ $message = array(
+ '@timestamp' => $record['datetime'],
+ '@version' => 1,
+ 'host' => $this->systemName,
+ );
+ if (isset($record['message'])) {
+ $message['message'] = $record['message'];
+ }
+ if (isset($record['channel'])) {
+ $message['type'] = $record['channel'];
+ $message['channel'] = $record['channel'];
+ }
+ if (isset($record['level_name'])) {
+ $message['level'] = $record['level_name'];
+ }
+ if ($this->applicationName) {
+ $message['type'] = $this->applicationName;
+ }
+ if (!empty($record['extra'])) {
+ foreach ($record['extra'] as $key => $val) {
+ $message[$this->extraPrefix . $key] = $val;
+ }
+ }
+ if (!empty($record['context'])) {
+ foreach ($record['context'] as $key => $val) {
+ $message[$this->contextPrefix . $key] = $val;
+ }
+ }
+
+ return $message;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php
new file mode 100644
index 00000000..eb067bb7
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php
@@ -0,0 +1,105 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Formats a record for use with the MongoDBHandler.
+ *
+ * @author Florian Plattner <me@florianplattner.de>
+ */
+class MongoDBFormatter implements FormatterInterface
+{
+ private $exceptionTraceAsString;
+ private $maxNestingLevel;
+
+ /**
+ * @param int $maxNestingLevel 0 means infinite nesting, the $record itself is level 1, $record['context'] is 2
+ * @param bool $exceptionTraceAsString set to false to log exception traces as a sub documents instead of strings
+ */
+ public function __construct($maxNestingLevel = 3, $exceptionTraceAsString = true)
+ {
+ $this->maxNestingLevel = max($maxNestingLevel, 0);
+ $this->exceptionTraceAsString = (bool) $exceptionTraceAsString;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public function format(array $record)
+ {
+ return $this->formatArray($record);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public function formatBatch(array $records)
+ {
+ foreach ($records as $key => $record) {
+ $records[$key] = $this->format($record);
+ }
+
+ return $records;
+ }
+
+ protected function formatArray(array $record, $nestingLevel = 0)
+ {
+ if ($this->maxNestingLevel == 0 || $nestingLevel <= $this->maxNestingLevel) {
+ foreach ($record as $name => $value) {
+ if ($value instanceof \DateTime) {
+ $record[$name] = $this->formatDate($value, $nestingLevel + 1);
+ } elseif ($value instanceof \Exception) {
+ $record[$name] = $this->formatException($value, $nestingLevel + 1);
+ } elseif (is_array($value)) {
+ $record[$name] = $this->formatArray($value, $nestingLevel + 1);
+ } elseif (is_object($value)) {
+ $record[$name] = $this->formatObject($value, $nestingLevel + 1);
+ }
+ }
+ } else {
+ $record = '[...]';
+ }
+
+ return $record;
+ }
+
+ protected function formatObject($value, $nestingLevel)
+ {
+ $objectVars = get_object_vars($value);
+ $objectVars['class'] = get_class($value);
+
+ return $this->formatArray($objectVars, $nestingLevel);
+ }
+
+ protected function formatException(\Exception $exception, $nestingLevel)
+ {
+ $formattedException = array(
+ 'class' => get_class($exception),
+ 'message' => $exception->getMessage(),
+ 'code' => $exception->getCode(),
+ 'file' => $exception->getFile() . ':' . $exception->getLine(),
+ );
+
+ if ($this->exceptionTraceAsString === true) {
+ $formattedException['trace'] = $exception->getTraceAsString();
+ } else {
+ $formattedException['trace'] = $exception->getTrace();
+ }
+
+ return $this->formatArray($formattedException, $nestingLevel);
+ }
+
+ protected function formatDate(\DateTime $value, $nestingLevel)
+ {
+ return new \MongoDate($value->getTimestamp());
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php
new file mode 100644
index 00000000..beafea64
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php
@@ -0,0 +1,141 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Exception;
+
+/**
+ * Normalizes incoming records to remove objects/resources so it's easier to dump to various targets
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class NormalizerFormatter implements FormatterInterface
+{
+ const SIMPLE_DATE = "Y-m-d H:i:s";
+
+ protected $dateFormat;
+
+ /**
+ * @param string $dateFormat The format of the timestamp: one supported by DateTime::format
+ */
+ public function __construct($dateFormat = null)
+ {
+ $this->dateFormat = $dateFormat ?: static::SIMPLE_DATE;
+ if (!function_exists('json_encode')) {
+ throw new \RuntimeException('PHP\'s json extension is required to use Monolog\'s NormalizerFormatter');
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ return $this->normalize($record);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function formatBatch(array $records)
+ {
+ foreach ($records as $key => $record) {
+ $records[$key] = $this->format($record);
+ }
+
+ return $records;
+ }
+
+ protected function normalize($data)
+ {
+ if (null === $data || is_scalar($data)) {
+ return $data;
+ }
+
+ if (is_array($data) || $data instanceof \Traversable) {
+ $normalized = array();
+
+ $count = 1;
+ foreach ($data as $key => $value) {
+ if ($count++ >= 1000) {
+ $normalized['...'] = 'Over 1000 items, aborting normalization';
+ break;
+ }
+ $normalized[$key] = $this->normalize($value);
+ }
+
+ return $normalized;
+ }
+
+ if ($data instanceof \DateTime) {
+ return $data->format($this->dateFormat);
+ }
+
+ if (is_object($data)) {
+ if ($data instanceof Exception) {
+ return $this->normalizeException($data);
+ }
+
+ return sprintf("[object] (%s: %s)", get_class($data), $this->toJson($data, true));
+ }
+
+ if (is_resource($data)) {
+ return '[resource]';
+ }
+
+ return '[unknown('.gettype($data).')]';
+ }
+
+ protected function normalizeException(Exception $e)
+ {
+ $data = array(
+ 'class' => get_class($e),
+ 'message' => $e->getMessage(),
+ 'code' => $e->getCode(),
+ 'file' => $e->getFile().':'.$e->getLine(),
+ );
+
+ $trace = $e->getTrace();
+ foreach ($trace as $frame) {
+ if (isset($frame['file'])) {
+ $data['trace'][] = $frame['file'].':'.$frame['line'];
+ } else {
+ // We should again normalize the frames, because it might contain invalid items
+ $data['trace'][] = $this->toJson($this->normalize($frame), true);
+ }
+ }
+
+ if ($previous = $e->getPrevious()) {
+ $data['previous'] = $this->normalizeException($previous);
+ }
+
+ return $data;
+ }
+
+ protected function toJson($data, $ignoreErrors = false)
+ {
+ // suppress json_encode errors since it's twitchy with some inputs
+ if ($ignoreErrors) {
+ if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+ return @json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+ }
+
+ return @json_encode($data);
+ }
+
+ if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+ return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+ }
+
+ return json_encode($data);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php
new file mode 100644
index 00000000..5d345d53
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php
@@ -0,0 +1,48 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Formats data into an associative array of scalar values.
+ * Objects and arrays will be JSON encoded.
+ *
+ * @author Andrew Lawson <adlawson@gmail.com>
+ */
+class ScalarFormatter extends NormalizerFormatter
+{
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ foreach ($record as $key => $value) {
+ $record[$key] = $this->normalizeValue($value);
+ }
+
+ return $record;
+ }
+
+ /**
+ * @param mixed $value
+ * @return mixed
+ */
+ protected function normalizeValue($value)
+ {
+ $normalized = $this->normalize($value);
+
+ if (is_array($normalized) || is_object($normalized)) {
+ return $this->toJson($normalized, true);
+ }
+
+ return $normalized;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php
new file mode 100644
index 00000000..654710a8
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php
@@ -0,0 +1,113 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * Serializes a log message according to Wildfire's header requirements
+ *
+ * @author Eric Clemmons (@ericclemmons) <eric@uxdriven.com>
+ * @author Christophe Coevoet <stof@notk.org>
+ * @author Kirill chEbba Chebunin <iam@chebba.org>
+ */
+class WildfireFormatter extends NormalizerFormatter
+{
+ const TABLE = 'table';
+
+ /**
+ * Translates Monolog log levels to Wildfire levels.
+ */
+ private $logLevels = array(
+ Logger::DEBUG => 'LOG',
+ Logger::INFO => 'INFO',
+ Logger::NOTICE => 'INFO',
+ Logger::WARNING => 'WARN',
+ Logger::ERROR => 'ERROR',
+ Logger::CRITICAL => 'ERROR',
+ Logger::ALERT => 'ERROR',
+ Logger::EMERGENCY => 'ERROR',
+ );
+
+ /**
+ * {@inheritdoc}
+ */
+ public function format(array $record)
+ {
+ // Retrieve the line and file if set and remove them from the formatted extra
+ $file = $line = '';
+ if (isset($record['extra']['file'])) {
+ $file = $record['extra']['file'];
+ unset($record['extra']['file']);
+ }
+ if (isset($record['extra']['line'])) {
+ $line = $record['extra']['line'];
+ unset($record['extra']['line']);
+ }
+
+ $record = $this->normalize($record);
+ $message = array('message' => $record['message']);
+ $handleError = false;
+ if ($record['context']) {
+ $message['context'] = $record['context'];
+ $handleError = true;
+ }
+ if ($record['extra']) {
+ $message['extra'] = $record['extra'];
+ $handleError = true;
+ }
+ if (count($message) === 1) {
+ $message = reset($message);
+ }
+
+ if (isset($record['context'][self::TABLE])) {
+ $type = 'TABLE';
+ $label = $record['channel'] .': '. $record['message'];
+ $message = $record['context'][self::TABLE];
+ } else {
+ $type = $this->logLevels[$record['level']];
+ $label = $record['channel'];
+ }
+
+ // Create JSON object describing the appearance of the message in the console
+ $json = $this->toJson(array(
+ array(
+ 'Type' => $type,
+ 'File' => $file,
+ 'Line' => $line,
+ 'Label' => $label,
+ ),
+ $message,
+ ), $handleError);
+
+ // The message itself is a serialization of the above JSON object + it's length
+ return sprintf(
+ '%s|%s|',
+ strlen($json),
+ $json
+ );
+ }
+
+ public function formatBatch(array $records)
+ {
+ throw new \BadMethodCallException('Batch formatting does not make sense for the WildfireFormatter');
+ }
+
+ protected function normalize($data)
+ {
+ if (is_object($data) && !$data instanceof \DateTime) {
+ return $data;
+ }
+
+ return parent::normalize($data);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php
new file mode 100644
index 00000000..69ede49a
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php
@@ -0,0 +1,184 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\FormatterInterface;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Base Handler class providing the Handler structure
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+abstract class AbstractHandler implements HandlerInterface
+{
+ protected $level = Logger::DEBUG;
+ protected $bubble = true;
+
+ /**
+ * @var FormatterInterface
+ */
+ protected $formatter;
+ protected $processors = array();
+
+ /**
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($level = Logger::DEBUG, $bubble = true)
+ {
+ $this->setLevel($level);
+ $this->bubble = $bubble;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function isHandling(array $record)
+ {
+ return $record['level'] >= $this->level;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ foreach ($records as $record) {
+ $this->handle($record);
+ }
+ }
+
+ /**
+ * Closes the handler.
+ *
+ * This will be called automatically when the object is destroyed
+ */
+ public function close()
+ {
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function pushProcessor($callback)
+ {
+ if (!is_callable($callback)) {
+ throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given');
+ }
+ array_unshift($this->processors, $callback);
+
+ return $this;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function popProcessor()
+ {
+ if (!$this->processors) {
+ throw new \LogicException('You tried to pop from an empty processor stack.');
+ }
+
+ return array_shift($this->processors);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function setFormatter(FormatterInterface $formatter)
+ {
+ $this->formatter = $formatter;
+
+ return $this;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function getFormatter()
+ {
+ if (!$this->formatter) {
+ $this->formatter = $this->getDefaultFormatter();
+ }
+
+ return $this->formatter;
+ }
+
+ /**
+ * Sets minimum logging level at which this handler will be triggered.
+ *
+ * @param integer $level
+ * @return self
+ */
+ public function setLevel($level)
+ {
+ $this->level = Logger::toMonologLevel($level);
+
+ return $this;
+ }
+
+ /**
+ * Gets minimum logging level at which this handler will be triggered.
+ *
+ * @return integer
+ */
+ public function getLevel()
+ {
+ return $this->level;
+ }
+
+ /**
+ * Sets the bubbling behavior.
+ *
+ * @param Boolean $bubble true means that this handler allows bubbling.
+ * false means that bubbling is not permitted.
+ * @return self
+ */
+ public function setBubble($bubble)
+ {
+ $this->bubble = $bubble;
+
+ return $this;
+ }
+
+ /**
+ * Gets the bubbling behavior.
+ *
+ * @return Boolean true means that this handler allows bubbling.
+ * false means that bubbling is not permitted.
+ */
+ public function getBubble()
+ {
+ return $this->bubble;
+ }
+
+ public function __destruct()
+ {
+ try {
+ $this->close();
+ } catch (\Exception $e) {
+ // do nothing
+ }
+ }
+
+ /**
+ * Gets the default formatter.
+ *
+ * @return FormatterInterface
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php
new file mode 100644
index 00000000..6f18f72e
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php
@@ -0,0 +1,66 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Base Handler class providing the Handler structure
+ *
+ * Classes extending it should (in most cases) only implement write($record)
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+abstract class AbstractProcessingHandler extends AbstractHandler
+{
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if (!$this->isHandling($record)) {
+ return false;
+ }
+
+ $record = $this->processRecord($record);
+
+ $record['formatted'] = $this->getFormatter()->format($record);
+
+ $this->write($record);
+
+ return false === $this->bubble;
+ }
+
+ /**
+ * Writes the record down to the log of the implementing handler
+ *
+ * @param array $record
+ * @return void
+ */
+ abstract protected function write(array $record);
+
+ /**
+ * Processes a record.
+ *
+ * @param array $record
+ * @return array
+ */
+ protected function processRecord(array $record)
+ {
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php
new file mode 100644
index 00000000..3eb83bd4
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php
@@ -0,0 +1,92 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Common syslog functionality
+ */
+abstract class AbstractSyslogHandler extends AbstractProcessingHandler
+{
+ protected $facility;
+
+ /**
+ * Translates Monolog log levels to syslog log priorities.
+ */
+ protected $logLevels = array(
+ Logger::DEBUG => LOG_DEBUG,
+ Logger::INFO => LOG_INFO,
+ Logger::NOTICE => LOG_NOTICE,
+ Logger::WARNING => LOG_WARNING,
+ Logger::ERROR => LOG_ERR,
+ Logger::CRITICAL => LOG_CRIT,
+ Logger::ALERT => LOG_ALERT,
+ Logger::EMERGENCY => LOG_EMERG,
+ );
+
+ /**
+ * List of valid log facility names.
+ */
+ protected $facilities = array(
+ 'auth' => LOG_AUTH,
+ 'authpriv' => LOG_AUTHPRIV,
+ 'cron' => LOG_CRON,
+ 'daemon' => LOG_DAEMON,
+ 'kern' => LOG_KERN,
+ 'lpr' => LOG_LPR,
+ 'mail' => LOG_MAIL,
+ 'news' => LOG_NEWS,
+ 'syslog' => LOG_SYSLOG,
+ 'user' => LOG_USER,
+ 'uucp' => LOG_UUCP,
+ );
+
+ /**
+ * @param mixed $facility
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($facility = LOG_USER, $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+
+ if (!defined('PHP_WINDOWS_VERSION_BUILD')) {
+ $this->facilities['local0'] = LOG_LOCAL0;
+ $this->facilities['local1'] = LOG_LOCAL1;
+ $this->facilities['local2'] = LOG_LOCAL2;
+ $this->facilities['local3'] = LOG_LOCAL3;
+ $this->facilities['local4'] = LOG_LOCAL4;
+ $this->facilities['local5'] = LOG_LOCAL5;
+ $this->facilities['local6'] = LOG_LOCAL6;
+ $this->facilities['local7'] = LOG_LOCAL7;
+ }
+
+ // convert textual description of facility to syslog constant
+ if (array_key_exists(strtolower($facility), $this->facilities)) {
+ $facility = $this->facilities[strtolower($facility)];
+ } elseif (!in_array($facility, array_values($this->facilities), true)) {
+ throw new \UnexpectedValueException('Unknown facility value "'.$facility.'" given');
+ }
+
+ $this->facility = $facility;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter('%channel%.%level_name%: %message% %context% %extra%');
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php
new file mode 100644
index 00000000..a28ba02a
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php
@@ -0,0 +1,98 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\JsonFormatter;
+use PhpAmqpLib\Message\AMQPMessage;
+use PhpAmqpLib\Channel\AMQPChannel;
+use AMQPExchange;
+
+class AmqpHandler extends AbstractProcessingHandler
+{
+ /**
+ * @var AMQPExchange|AMQPChannel $exchange
+ */
+ protected $exchange;
+
+ /**
+ * @var string
+ */
+ protected $exchangeName;
+
+ /**
+ * @param AMQPExchange|AMQPChannel $exchange AMQPExchange (php AMQP ext) or PHP AMQP lib channel, ready for use
+ * @param string $exchangeName
+ * @param int $level
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($exchange, $exchangeName = 'log', $level = Logger::DEBUG, $bubble = true)
+ {
+ if ($exchange instanceof AMQPExchange) {
+ $exchange->setName($exchangeName);
+ } elseif ($exchange instanceof AMQPChannel) {
+ $this->exchangeName = $exchangeName;
+ } else {
+ throw new \InvalidArgumentException('PhpAmqpLib\Channel\AMQPChannel or AMQPExchange instance required');
+ }
+ $this->exchange = $exchange;
+
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ $data = $record["formatted"];
+
+ $routingKey = sprintf(
+ '%s.%s',
+ // TODO 2.0 remove substr call
+ substr($record['level_name'], 0, 4),
+ $record['channel']
+ );
+
+ if ($this->exchange instanceof AMQPExchange) {
+ $this->exchange->publish(
+ $data,
+ strtolower($routingKey),
+ 0,
+ array(
+ 'delivery_mode' => 2,
+ 'Content-type' => 'application/json'
+ )
+ );
+ } else {
+ $this->exchange->basic_publish(
+ new AMQPMessage(
+ (string) $data,
+ array(
+ 'delivery_mode' => 2,
+ 'content_type' => 'application/json'
+ )
+ ),
+ $this->exchangeName,
+ strtolower($routingKey)
+ );
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php
new file mode 100644
index 00000000..43190b92
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php
@@ -0,0 +1,184 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Handler sending logs to browser's javascript console with no browser extension required
+ *
+ * @author Olivier Poitrey <rs@dailymotion.com>
+ */
+class BrowserConsoleHandler extends AbstractProcessingHandler
+{
+ protected static $initialized = false;
+ protected static $records = array();
+
+ /**
+ * {@inheritDoc}
+ *
+ * Formatted output may contain some formatting markers to be transfered to `console.log` using the %c format.
+ *
+ * Example of formatted string:
+ *
+ * You can do [[blue text]]{color: blue} or [[green background]]{background-color: green; color: white}
+ *
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter('[[%channel%]]{macro: autolabel} [[%level_name%]]{font-weight: bold} %message%');
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ // Accumulate records
+ self::$records[] = $record;
+
+ // Register shutdown handler if not already done
+ if (PHP_SAPI !== 'cli' && !self::$initialized) {
+ self::$initialized = true;
+ register_shutdown_function(array('Monolog\Handler\BrowserConsoleHandler', 'send'));
+ }
+ }
+
+ /**
+ * Convert records to javascript console commands and send it to the browser.
+ * This method is automatically called on PHP shutdown if output is HTML.
+ */
+ public static function send()
+ {
+ // Check content type
+ foreach (headers_list() as $header) {
+ if (stripos($header, 'content-type:') === 0) {
+ if (stripos($header, 'text/html') === false) {
+ // This handler only works with HTML outputs
+ return;
+ }
+ break;
+ }
+ }
+
+ if (count(self::$records)) {
+ echo '<script>' . self::generateScript() . '</script>';
+ self::reset();
+ }
+ }
+
+ /**
+ * Forget all logged records
+ */
+ public static function reset()
+ {
+ self::$records = array();
+ }
+
+ private static function generateScript()
+ {
+ $script = array();
+ foreach (self::$records as $record) {
+ $context = self::dump('Context', $record['context']);
+ $extra = self::dump('Extra', $record['extra']);
+
+ if (empty($context) && empty($extra)) {
+ $script[] = self::call_array('log', self::handleStyles($record['formatted']));
+ } else {
+ $script = array_merge($script,
+ array(self::call_array('groupCollapsed', self::handleStyles($record['formatted']))),
+ $context,
+ $extra,
+ array(self::call('groupEnd'))
+ );
+ }
+ }
+
+ return "(function (c) {if (c && c.groupCollapsed) {\n" . implode("\n", $script) . "\n}})(console);";
+ }
+
+ private static function handleStyles($formatted)
+ {
+ $args = array(self::quote('font-weight: normal'));
+ $format = '%c' . $formatted;
+ preg_match_all('/\[\[(.*?)\]\]\{([^}]*)\}/s', $format, $matches, PREG_OFFSET_CAPTURE | PREG_SET_ORDER);
+
+ foreach (array_reverse($matches) as $match) {
+ $args[] = self::quote(self::handleCustomStyles($match[2][0], $match[1][0]));
+ $args[] = '"font-weight: normal"';
+
+ $pos = $match[0][1];
+ $format = substr($format, 0, $pos) . '%c' . $match[1][0] . '%c' . substr($format, $pos + strlen($match[0][0]));
+ }
+
+ array_unshift($args, self::quote($format));
+
+ return $args;
+ }
+
+ private static function handleCustomStyles($style, $string)
+ {
+ static $colors = array('blue', 'green', 'red', 'magenta', 'orange', 'black', 'grey');
+ static $labels = array();
+
+ return preg_replace_callback('/macro\s*:(.*?)(?:;|$)/', function ($m) use ($string, &$colors, &$labels) {
+ if (trim($m[1]) === 'autolabel') {
+ // Format the string as a label with consistent auto assigned background color
+ if (!isset($labels[$string])) {
+ $labels[$string] = $colors[count($labels) % count($colors)];
+ }
+ $color = $labels[$string];
+
+ return "background-color: $color; color: white; border-radius: 3px; padding: 0 2px 0 2px";
+ }
+
+ return $m[1];
+ }, $style);
+ }
+
+ private static function dump($title, array $dict)
+ {
+ $script = array();
+ $dict = array_filter($dict);
+ if (empty($dict)) {
+ return $script;
+ }
+ $script[] = self::call('log', self::quote('%c%s'), self::quote('font-weight: bold'), self::quote($title));
+ foreach ($dict as $key => $value) {
+ $value = json_encode($value);
+ if (empty($value)) {
+ $value = self::quote('');
+ }
+ $script[] = self::call('log', self::quote('%s: %o'), self::quote($key), $value);
+ }
+
+ return $script;
+ }
+
+ private static function quote($arg)
+ {
+ return '"' . addcslashes($arg, "\"\n") . '"';
+ }
+
+ private static function call()
+ {
+ $args = func_get_args();
+ $method = array_shift($args);
+
+ return self::call_array($method, $args);
+ }
+
+ private static function call_array($method, array $args)
+ {
+ return 'c.' . $method . '(' . implode(', ', $args) . ');';
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php
new file mode 100644
index 00000000..6d8136f7
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php
@@ -0,0 +1,117 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Buffers all records until closing the handler and then pass them as batch.
+ *
+ * This is useful for a MailHandler to send only one mail per request instead of
+ * sending one per log message.
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class BufferHandler extends AbstractHandler
+{
+ protected $handler;
+ protected $bufferSize = 0;
+ protected $bufferLimit;
+ protected $flushOnOverflow;
+ protected $buffer = array();
+ protected $initialized = false;
+
+ /**
+ * @param HandlerInterface $handler Handler.
+ * @param integer $bufferLimit How many entries should be buffered at most, beyond that the oldest items are removed from the buffer.
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param Boolean $flushOnOverflow If true, the buffer is flushed when the max size has been reached, by default oldest entries are discarded
+ */
+ public function __construct(HandlerInterface $handler, $bufferLimit = 0, $level = Logger::DEBUG, $bubble = true, $flushOnOverflow = false)
+ {
+ parent::__construct($level, $bubble);
+ $this->handler = $handler;
+ $this->bufferLimit = (int) $bufferLimit;
+ $this->flushOnOverflow = $flushOnOverflow;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if ($record['level'] < $this->level) {
+ return false;
+ }
+
+ if (!$this->initialized) {
+ // __destructor() doesn't get called on Fatal errors
+ register_shutdown_function(array($this, 'close'));
+ $this->initialized = true;
+ }
+
+ if ($this->bufferLimit > 0 && $this->bufferSize === $this->bufferLimit) {
+ if ($this->flushOnOverflow) {
+ $this->flush();
+ } else {
+ array_shift($this->buffer);
+ $this->bufferSize--;
+ }
+ }
+
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ $this->buffer[] = $record;
+ $this->bufferSize++;
+
+ return false === $this->bubble;
+ }
+
+ public function flush()
+ {
+ if ($this->bufferSize === 0) {
+ return;
+ }
+
+ $this->handler->handleBatch($this->buffer);
+ $this->clear();
+ }
+
+ public function __destruct()
+ {
+ // suppress the parent behavior since we already have register_shutdown_function()
+ // to call close(), and the reference contained there will prevent this from being
+ // GC'd until the end of the request
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ $this->flush();
+ }
+
+ /**
+ * Clears the buffer without flushing any messages down to the wrapped handler.
+ */
+ public function clear()
+ {
+ $this->bufferSize = 0;
+ $this->buffer = array();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php
new file mode 100644
index 00000000..bc659349
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php
@@ -0,0 +1,204 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\ChromePHPFormatter;
+use Monolog\Logger;
+
+/**
+ * Handler sending logs to the ChromePHP extension (http://www.chromephp.com/)
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class ChromePHPHandler extends AbstractProcessingHandler
+{
+ /**
+ * Version of the extension
+ */
+ const VERSION = '4.0';
+
+ /**
+ * Header name
+ */
+ const HEADER_NAME = 'X-ChromeLogger-Data';
+
+ protected static $initialized = false;
+
+ /**
+ * Tracks whether we sent too much data
+ *
+ * Chrome limits the headers to 256KB, so when we sent 240KB we stop sending
+ *
+ * @var Boolean
+ */
+ protected static $overflowed = false;
+
+ protected static $json = array(
+ 'version' => self::VERSION,
+ 'columns' => array('label', 'log', 'backtrace', 'type'),
+ 'rows' => array(),
+ );
+
+ protected static $sendHeaders = true;
+
+ /**
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+ if (!function_exists('json_encode')) {
+ throw new \RuntimeException('PHP\'s json extension is required to use Monolog\'s ChromePHPHandler');
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ $messages = array();
+
+ foreach ($records as $record) {
+ if ($record['level'] < $this->level) {
+ continue;
+ }
+ $messages[] = $this->processRecord($record);
+ }
+
+ if (!empty($messages)) {
+ $messages = $this->getFormatter()->formatBatch($messages);
+ self::$json['rows'] = array_merge(self::$json['rows'], $messages);
+ $this->send();
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new ChromePHPFormatter();
+ }
+
+ /**
+ * Creates & sends header for a record
+ *
+ * @see sendHeader()
+ * @see send()
+ * @param array $record
+ */
+ protected function write(array $record)
+ {
+ self::$json['rows'][] = $record['formatted'];
+
+ $this->send();
+ }
+
+ /**
+ * Sends the log header
+ *
+ * @see sendHeader()
+ */
+ protected function send()
+ {
+ if (self::$overflowed || !self::$sendHeaders) {
+ return;
+ }
+
+ if (!self::$initialized) {
+ self::$initialized = true;
+
+ self::$sendHeaders = $this->headersAccepted();
+ if (!self::$sendHeaders) {
+ return;
+ }
+
+ self::$json['request_uri'] = isset($_SERVER['REQUEST_URI']) ? $_SERVER['REQUEST_URI'] : '';
+ }
+
+ $json = @json_encode(self::$json);
+ $data = base64_encode(utf8_encode($json));
+ if (strlen($data) > 240*1024) {
+ self::$overflowed = true;
+
+ $record = array(
+ 'message' => 'Incomplete logs, chrome header size limit reached',
+ 'context' => array(),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'monolog',
+ 'datetime' => new \DateTime(),
+ 'extra' => array(),
+ );
+ self::$json['rows'][count(self::$json['rows']) - 1] = $this->getFormatter()->format($record);
+ $json = @json_encode(self::$json);
+ $data = base64_encode(utf8_encode($json));
+ }
+
+ if (trim($data) !== '') {
+ $this->sendHeader(self::HEADER_NAME, $data);
+ }
+ }
+
+ /**
+ * Send header string to the client
+ *
+ * @param string $header
+ * @param string $content
+ */
+ protected function sendHeader($header, $content)
+ {
+ if (!headers_sent() && self::$sendHeaders) {
+ header(sprintf('%s: %s', $header, $content));
+ }
+ }
+
+ /**
+ * Verifies if the headers are accepted by the current user agent
+ *
+ * @return Boolean
+ */
+ protected function headersAccepted()
+ {
+ if (empty($_SERVER['HTTP_USER_AGENT'])) {
+ return false;
+ }
+
+ return preg_match('{\bChrome/\d+[\.\d+]*\b}', $_SERVER['HTTP_USER_AGENT']);
+ }
+
+ /**
+ * BC getter for the sendHeaders property that has been made static
+ */
+ public function __get($property)
+ {
+ if ('sendHeaders' !== $property) {
+ throw new \InvalidArgumentException('Undefined property '.$property);
+ }
+
+ return static::$sendHeaders;
+ }
+
+ /**
+ * BC setter for the sendHeaders property that has been made static
+ */
+ public function __set($property, $value)
+ {
+ if ('sendHeaders' !== $property) {
+ throw new \InvalidArgumentException('Undefined property '.$property);
+ }
+
+ static::$sendHeaders = $value;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php
new file mode 100644
index 00000000..b3687c3d
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php
@@ -0,0 +1,72 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\JsonFormatter;
+use Monolog\Logger;
+
+/**
+ * CouchDB handler
+ *
+ * @author Markus Bachmann <markus.bachmann@bachi.biz>
+ */
+class CouchDBHandler extends AbstractProcessingHandler
+{
+ private $options;
+
+ public function __construct(array $options = array(), $level = Logger::DEBUG, $bubble = true)
+ {
+ $this->options = array_merge(array(
+ 'host' => 'localhost',
+ 'port' => 5984,
+ 'dbname' => 'logger',
+ 'username' => null,
+ 'password' => null,
+ ), $options);
+
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ $basicAuth = null;
+ if ($this->options['username']) {
+ $basicAuth = sprintf('%s:%s@', $this->options['username'], $this->options['password']);
+ }
+
+ $url = 'http://'.$basicAuth.$this->options['host'].':'.$this->options['port'].'/'.$this->options['dbname'];
+ $context = stream_context_create(array(
+ 'http' => array(
+ 'method' => 'POST',
+ 'content' => $record['formatted'],
+ 'ignore_errors' => true,
+ 'max_redirects' => 0,
+ 'header' => 'Content-type: application/json',
+ )
+ ));
+
+ if (false === @file_get_contents($url, null, $context)) {
+ throw new \RuntimeException(sprintf('Could not connect to %s', $url));
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php
new file mode 100644
index 00000000..d968720c
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php
@@ -0,0 +1,145 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Logs to Cube.
+ *
+ * @link http://square.github.com/cube/
+ * @author Wan Chen <kami@kamisama.me>
+ */
+class CubeHandler extends AbstractProcessingHandler
+{
+ private $udpConnection = null;
+ private $httpConnection = null;
+ private $scheme = null;
+ private $host = null;
+ private $port = null;
+ private $acceptedSchemes = array('http', 'udp');
+
+ /**
+ * Create a Cube handler
+ *
+ * @throws UnexpectedValueException when given url is not a valid url.
+ * A valid url must consists of three parts : protocol://host:port
+ * Only valid protocol used by Cube are http and udp
+ */
+ public function __construct($url, $level = Logger::DEBUG, $bubble = true)
+ {
+ $urlInfos = parse_url($url);
+
+ if (!isset($urlInfos['scheme']) || !isset($urlInfos['host']) || !isset($urlInfos['port'])) {
+ throw new \UnexpectedValueException('URL "'.$url.'" is not valid');
+ }
+
+ if (!in_array($urlInfos['scheme'], $this->acceptedSchemes)) {
+ throw new \UnexpectedValueException(
+ 'Invalid protocol (' . $urlInfos['scheme'] . ').'
+ . ' Valid options are ' . implode(', ', $this->acceptedSchemes));
+ }
+
+ $this->scheme = $urlInfos['scheme'];
+ $this->host = $urlInfos['host'];
+ $this->port = $urlInfos['port'];
+
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * Establish a connection to an UDP socket
+ *
+ * @throws LogicException when unable to connect to the socket
+ */
+ protected function connectUdp()
+ {
+ if (!extension_loaded('sockets')) {
+ throw new MissingExtensionException('The sockets extension is required to use udp URLs with the CubeHandler');
+ }
+
+ $this->udpConnection = socket_create(AF_INET, SOCK_DGRAM, 0);
+ if (!$this->udpConnection) {
+ throw new \LogicException('Unable to create a socket');
+ }
+
+ if (!socket_connect($this->udpConnection, $this->host, $this->port)) {
+ throw new \LogicException('Unable to connect to the socket at ' . $this->host . ':' . $this->port);
+ }
+ }
+
+ /**
+ * Establish a connection to a http server
+ */
+ protected function connectHttp()
+ {
+ if (!extension_loaded('curl')) {
+ throw new \LogicException('The curl extension is needed to use http URLs with the CubeHandler');
+ }
+
+ $this->httpConnection = curl_init('http://'.$this->host.':'.$this->port.'/1.0/event/put');
+
+ if (!$this->httpConnection) {
+ throw new \LogicException('Unable to connect to ' . $this->host . ':' . $this->port);
+ }
+
+ curl_setopt($this->httpConnection, CURLOPT_CUSTOMREQUEST, "POST");
+ curl_setopt($this->httpConnection, CURLOPT_RETURNTRANSFER, true);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $date = $record['datetime'];
+
+ $data = array('time' => $date->format('Y-m-d\TH:i:s.uO'));
+ unset($record['datetime']);
+
+ if (isset($record['context']['type'])) {
+ $data['type'] = $record['context']['type'];
+ unset($record['context']['type']);
+ } else {
+ $data['type'] = $record['channel'];
+ }
+
+ $data['data'] = $record['context'];
+ $data['data']['level'] = $record['level'];
+
+ $this->{'write'.$this->scheme}(json_encode($data));
+ }
+
+ private function writeUdp($data)
+ {
+ if (!$this->udpConnection) {
+ $this->connectUdp();
+ }
+
+ socket_send($this->udpConnection, $data, strlen($data), 0);
+ }
+
+ private function writeHttp($data)
+ {
+ if (!$this->httpConnection) {
+ $this->connectHttp();
+ }
+
+ curl_setopt($this->httpConnection, CURLOPT_POSTFIELDS, '['.$data.']');
+ curl_setopt($this->httpConnection, CURLOPT_HTTPHEADER, array(
+ 'Content-Type: application/json',
+ 'Content-Length: ' . strlen('['.$data.']'))
+ );
+
+ return curl_exec($this->httpConnection);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php
new file mode 100644
index 00000000..b91ffec9
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php
@@ -0,0 +1,45 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\NormalizerFormatter;
+use Doctrine\CouchDB\CouchDBClient;
+
+/**
+ * CouchDB handler for Doctrine CouchDB ODM
+ *
+ * @author Markus Bachmann <markus.bachmann@bachi.biz>
+ */
+class DoctrineCouchDBHandler extends AbstractProcessingHandler
+{
+ private $client;
+
+ public function __construct(CouchDBClient $client, $level = Logger::DEBUG, $bubble = true)
+ {
+ $this->client = $client;
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ $this->client->postDocument($record['formatted']);
+ }
+
+ protected function getDefaultFormatter()
+ {
+ return new NormalizerFormatter;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php
new file mode 100644
index 00000000..e7f843c8
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php
@@ -0,0 +1,89 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Aws\Common\Aws;
+use Aws\DynamoDb\DynamoDbClient;
+use Monolog\Formatter\ScalarFormatter;
+use Monolog\Logger;
+
+/**
+ * Amazon DynamoDB handler (http://aws.amazon.com/dynamodb/)
+ *
+ * @link https://github.com/aws/aws-sdk-php/
+ * @author Andrew Lawson <adlawson@gmail.com>
+ */
+class DynamoDbHandler extends AbstractProcessingHandler
+{
+ const DATE_FORMAT = 'Y-m-d\TH:i:s.uO';
+
+ /**
+ * @var DynamoDbClient
+ */
+ protected $client;
+
+ /**
+ * @var string
+ */
+ protected $table;
+
+ /**
+ * @param DynamoDbClient $client
+ * @param string $table
+ * @param integer $level
+ * @param boolean $bubble
+ */
+ public function __construct(DynamoDbClient $client, $table, $level = Logger::DEBUG, $bubble = true)
+ {
+ if (!defined('Aws\Common\Aws::VERSION') || version_compare('3.0', Aws::VERSION, '<=')) {
+ throw new \RuntimeException('The DynamoDbHandler is only known to work with the AWS SDK 2.x releases');
+ }
+
+ $this->client = $client;
+ $this->table = $table;
+
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $filtered = $this->filterEmptyFields($record['formatted']);
+ $formatted = $this->client->formatAttributes($filtered);
+
+ $this->client->putItem(array(
+ 'TableName' => $this->table,
+ 'Item' => $formatted
+ ));
+ }
+
+ /**
+ * @param array $record
+ * @return array
+ */
+ protected function filterEmptyFields(array $record)
+ {
+ return array_filter($record, function ($value) {
+ return !empty($value) || false === $value || 0 === $value;
+ });
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new ScalarFormatter(self::DATE_FORMAT);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php
new file mode 100644
index 00000000..96e5d57f
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php
@@ -0,0 +1,128 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FormatterInterface;
+use Monolog\Formatter\ElasticaFormatter;
+use Monolog\Logger;
+use Elastica\Client;
+use Elastica\Exception\ExceptionInterface;
+
+/**
+ * Elastic Search handler
+ *
+ * Usage example:
+ *
+ * $client = new \Elastica\Client();
+ * $options = array(
+ * 'index' => 'elastic_index_name',
+ * 'type' => 'elastic_doc_type',
+ * );
+ * $handler = new ElasticSearchHandler($client, $options);
+ * $log = new Logger('application');
+ * $log->pushHandler($handler);
+ *
+ * @author Jelle Vink <jelle.vink@gmail.com>
+ */
+class ElasticSearchHandler extends AbstractProcessingHandler
+{
+ /**
+ * @var Client
+ */
+ protected $client;
+
+ /**
+ * @var array Handler config options
+ */
+ protected $options = array();
+
+ /**
+ * @param Client $client Elastica Client object
+ * @param array $options Handler configuration
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(Client $client, array $options = array(), $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+ $this->client = $client;
+ $this->options = array_merge(
+ array(
+ 'index' => 'monolog', // Elastic index name
+ 'type' => 'record', // Elastic document type
+ 'ignore_error' => false, // Suppress Elastica exceptions
+ ),
+ $options
+ );
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ $this->bulkSend(array($record['formatted']));
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function setFormatter(FormatterInterface $formatter)
+ {
+ if ($formatter instanceof ElasticaFormatter) {
+ return parent::setFormatter($formatter);
+ }
+ throw new \InvalidArgumentException('ElasticSearchHandler is only compatible with ElasticaFormatter');
+ }
+
+ /**
+ * Getter options
+ * @return array
+ */
+ public function getOptions()
+ {
+ return $this->options;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new ElasticaFormatter($this->options['index'], $this->options['type']);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ $documents = $this->getFormatter()->formatBatch($records);
+ $this->bulkSend($documents);
+ }
+
+ /**
+ * Use Elasticsearch bulk API to send list of documents
+ * @param array $documents
+ * @throws \RuntimeException
+ */
+ protected function bulkSend(array $documents)
+ {
+ try {
+ $this->client->addDocuments($documents);
+ } catch (ExceptionInterface $e) {
+ if (!$this->options['ignore_error']) {
+ throw new \RuntimeException("Error sending messages to Elasticsearch", 0, $e);
+ }
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php
new file mode 100644
index 00000000..d1e1ee60
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php
@@ -0,0 +1,82 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Logger;
+
+/**
+ * Stores to PHP error_log() handler.
+ *
+ * @author Elan Ruusamäe <glen@delfi.ee>
+ */
+class ErrorLogHandler extends AbstractProcessingHandler
+{
+ const OPERATING_SYSTEM = 0;
+ const SAPI = 4;
+
+ protected $messageType;
+ protected $expandNewlines;
+
+ /**
+ * @param integer $messageType Says where the error should go.
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param Boolean $expandNewlines If set to true, newlines in the message will be expanded to be take multiple log entries
+ */
+ public function __construct($messageType = self::OPERATING_SYSTEM, $level = Logger::DEBUG, $bubble = true, $expandNewlines = false)
+ {
+ parent::__construct($level, $bubble);
+
+ if (false === in_array($messageType, self::getAvailableTypes())) {
+ $message = sprintf('The given message type "%s" is not supported', print_r($messageType, true));
+ throw new \InvalidArgumentException($message);
+ }
+
+ $this->messageType = $messageType;
+ $this->expandNewlines = $expandNewlines;
+ }
+
+ /**
+ * @return array With all available types
+ */
+ public static function getAvailableTypes()
+ {
+ return array(
+ self::OPERATING_SYSTEM,
+ self::SAPI,
+ );
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter('[%datetime%] %channel%.%level_name%: %message% %context% %extra%');
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ if ($this->expandNewlines) {
+ $lines = preg_split('{[\r\n]+}', (string) $record['formatted']);
+ foreach ($lines as $line) {
+ error_log($line, $this->messageType);
+ }
+ } else {
+ error_log((string) $record['formatted'], $this->messageType);
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php
new file mode 100644
index 00000000..dad82273
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php
@@ -0,0 +1,140 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Simple handler wrapper that filters records based on a list of levels
+ *
+ * It can be configured with an exact list of levels to allow, or a min/max level.
+ *
+ * @author Hennadiy Verkh
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class FilterHandler extends AbstractHandler
+{
+ /**
+ * Handler or factory callable($record, $this)
+ *
+ * @var callable|\Monolog\Handler\HandlerInterface
+ */
+ protected $handler;
+
+ /**
+ * Minimum level for logs that are passes to handler
+ *
+ * @var int[]
+ */
+ protected $acceptedLevels;
+
+ /**
+ * Whether the messages that are handled can bubble up the stack or not
+ *
+ * @var Boolean
+ */
+ protected $bubble;
+
+ /**
+ * @param callable|HandlerInterface $handler Handler or factory callable($record, $this).
+ * @param int|array $minLevelOrList A list of levels to accept or a minimum level if maxLevel is provided
+ * @param int $maxLevel Maximum level to accept, only used if $minLevelOrList is not an array
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($handler, $minLevelOrList = Logger::DEBUG, $maxLevel = Logger::EMERGENCY, $bubble = true)
+ {
+ $this->handler = $handler;
+ $this->bubble = $bubble;
+ $this->setAcceptedLevels($minLevelOrList, $maxLevel);
+
+ if (!$this->handler instanceof HandlerInterface && !is_callable($this->handler)) {
+ throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object");
+ }
+ }
+
+ /**
+ * @return array
+ */
+ public function getAcceptedLevels()
+ {
+ return array_flip($this->acceptedLevels);
+ }
+
+ /**
+ * @param int|array $minLevelOrList A list of levels to accept or a minimum level if maxLevel is provided
+ * @param int $maxLevel Maximum level to accept, only used if $minLevelOrList is not an array
+ */
+ public function setAcceptedLevels($minLevelOrList = Logger::DEBUG, $maxLevel = Logger::EMERGENCY)
+ {
+ if (is_array($minLevelOrList)) {
+ $acceptedLevels = array_map('Monolog\Logger::toMonologLevel', $minLevelOrList);
+ } else {
+ $minLevelOrList = Logger::toMonologLevel($minLevelOrList);
+ $maxLevel = Logger::toMonologLevel($maxLevel);
+ $acceptedLevels = array_values(array_filter(Logger::getLevels(), function ($level) use ($minLevelOrList, $maxLevel) {
+ return $level >= $minLevelOrList && $level <= $maxLevel;
+ }));
+ }
+ $this->acceptedLevels = array_flip($acceptedLevels);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function isHandling(array $record)
+ {
+ return isset($this->acceptedLevels[$record['level']]);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if (!$this->isHandling($record)) {
+ return false;
+ }
+
+ // The same logic as in FingersCrossedHandler
+ if (!$this->handler instanceof HandlerInterface) {
+ $this->handler = call_user_func($this->handler, $record, $this);
+ if (!$this->handler instanceof HandlerInterface) {
+ throw new \RuntimeException("The factory callable should return a HandlerInterface");
+ }
+ }
+
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ $this->handler->handle($record);
+
+ return false === $this->bubble;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ $filtered = array();
+ foreach ($records as $record) {
+ if ($this->isHandling($record)) {
+ $filtered[] = $record;
+ }
+ }
+
+ $this->handler->handleBatch($filtered);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php
new file mode 100644
index 00000000..c3e42efe
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php
@@ -0,0 +1,28 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\FingersCrossed;
+
+/**
+ * Interface for activation strategies for the FingersCrossedHandler.
+ *
+ * @author Johannes M. Schmitt <schmittjoh@gmail.com>
+ */
+interface ActivationStrategyInterface
+{
+ /**
+ * Returns whether the given record activates the handler.
+ *
+ * @param array $record
+ * @return Boolean
+ */
+ public function isHandlerActivated(array $record);
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php
new file mode 100644
index 00000000..e3b403f6
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php
@@ -0,0 +1,59 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+*
+* (c) Jordi Boggiano <j.boggiano@seld.be>
+*
+* For the full copyright and license information, please view the LICENSE
+* file that was distributed with this source code.
+*/
+
+namespace Monolog\Handler\FingersCrossed;
+
+use Monolog\Logger;
+
+/**
+ * Channel and Error level based monolog activation strategy. Allows to trigger activation
+ * based on level per channel. e.g. trigger activation on level 'ERROR' by default, except
+ * for records of the 'sql' channel; those should trigger activation on level 'WARN'.
+ *
+ * Example:
+ *
+ * <code>
+ * $activationStrategy = new ChannelLevelActivationStrategy(
+ * Logger::CRITICAL,
+ * array(
+ * 'request' => Logger::ALERT,
+ * 'sensitive' => Logger::ERROR,
+ * )
+ * );
+ * $handler = new FingersCrossedHandler(new StreamHandler('php://stderr'), $activationStrategy);
+ * </code>
+ *
+ * @author Mike Meessen <netmikey@gmail.com>
+ */
+class ChannelLevelActivationStrategy implements ActivationStrategyInterface
+{
+ private $defaultActionLevel;
+ private $channelToActionLevel;
+
+ /**
+ * @param int $defaultActionLevel The default action level to be used if the record's category doesn't match any
+ * @param array $channelToActionLevel An array that maps channel names to action levels.
+ */
+ public function __construct($defaultActionLevel, $channelToActionLevel = array())
+ {
+ $this->defaultActionLevel = Logger::toMonologLevel($defaultActionLevel);
+ $this->channelToActionLevel = array_map('Monolog\Logger::toMonologLevel', $channelToActionLevel);
+ }
+
+ public function isHandlerActivated(array $record)
+ {
+ if (isset($this->channelToActionLevel[$record['channel']])) {
+ return $record['level'] >= $this->channelToActionLevel[$record['channel']];
+ }
+
+ return $record['level'] >= $this->defaultActionLevel;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php
new file mode 100644
index 00000000..6e630852
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php
@@ -0,0 +1,34 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\FingersCrossed;
+
+use Monolog\Logger;
+
+/**
+ * Error level based activation strategy.
+ *
+ * @author Johannes M. Schmitt <schmittjoh@gmail.com>
+ */
+class ErrorLevelActivationStrategy implements ActivationStrategyInterface
+{
+ private $actionLevel;
+
+ public function __construct($actionLevel)
+ {
+ $this->actionLevel = Logger::toMonologLevel($actionLevel);
+ }
+
+ public function isHandlerActivated(array $record)
+ {
+ return $record['level'] >= $this->actionLevel;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php
new file mode 100644
index 00000000..a81c9e64
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php
@@ -0,0 +1,150 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy;
+use Monolog\Handler\FingersCrossed\ActivationStrategyInterface;
+use Monolog\Logger;
+
+/**
+ * Buffers all records until a certain level is reached
+ *
+ * The advantage of this approach is that you don't get any clutter in your log files.
+ * Only requests which actually trigger an error (or whatever your actionLevel is) will be
+ * in the logs, but they will contain all records, not only those above the level threshold.
+ *
+ * You can find the various activation strategies in the
+ * Monolog\Handler\FingersCrossed\ namespace.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class FingersCrossedHandler extends AbstractHandler
+{
+ protected $handler;
+ protected $activationStrategy;
+ protected $buffering = true;
+ protected $bufferSize;
+ protected $buffer = array();
+ protected $stopBuffering;
+ protected $passthruLevel;
+
+ /**
+ * @param callable|HandlerInterface $handler Handler or factory callable($record, $fingersCrossedHandler).
+ * @param int|ActivationStrategyInterface $activationStrategy Strategy which determines when this handler takes action
+ * @param int $bufferSize How many entries should be buffered at most, beyond that the oldest items are removed from the buffer.
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param Boolean $stopBuffering Whether the handler should stop buffering after being triggered (default true)
+ * @param int $passthruLevel Minimum level to always flush to handler on close, even if strategy not triggered
+ */
+ public function __construct($handler, $activationStrategy = null, $bufferSize = 0, $bubble = true, $stopBuffering = true, $passthruLevel = null)
+ {
+ if (null === $activationStrategy) {
+ $activationStrategy = new ErrorLevelActivationStrategy(Logger::WARNING);
+ }
+
+ // convert simple int activationStrategy to an object
+ if (!$activationStrategy instanceof ActivationStrategyInterface) {
+ $activationStrategy = new ErrorLevelActivationStrategy($activationStrategy);
+ }
+
+ $this->handler = $handler;
+ $this->activationStrategy = $activationStrategy;
+ $this->bufferSize = $bufferSize;
+ $this->bubble = $bubble;
+ $this->stopBuffering = $stopBuffering;
+ $this->passthruLevel = $passthruLevel;
+
+ if (!$this->handler instanceof HandlerInterface && !is_callable($this->handler)) {
+ throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object");
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function isHandling(array $record)
+ {
+ return true;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ if ($this->buffering) {
+ $this->buffer[] = $record;
+ if ($this->bufferSize > 0 && count($this->buffer) > $this->bufferSize) {
+ array_shift($this->buffer);
+ }
+ if ($this->activationStrategy->isHandlerActivated($record)) {
+ if ($this->stopBuffering) {
+ $this->buffering = false;
+ }
+ if (!$this->handler instanceof HandlerInterface) {
+ $this->handler = call_user_func($this->handler, $record, $this);
+ if (!$this->handler instanceof HandlerInterface) {
+ throw new \RuntimeException("The factory callable should return a HandlerInterface");
+ }
+ }
+ $this->handler->handleBatch($this->buffer);
+ $this->buffer = array();
+ }
+ } else {
+ $this->handler->handle($record);
+ }
+
+ return false === $this->bubble;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ if (null !== $this->passthruLevel) {
+ $level = $this->passthruLevel;
+ $this->buffer = array_filter($this->buffer, function ($record) use ($level) {
+ return $record['level'] >= $level;
+ });
+ if (count($this->buffer) > 0) {
+ $this->handler->handleBatch($this->buffer);
+ $this->buffer = array();
+ }
+ }
+ }
+
+ /**
+ * Resets the state of the handler. Stops forwarding records to the wrapped handler.
+ */
+ public function reset()
+ {
+ $this->buffering = true;
+ }
+
+ /**
+ * Clears the buffer without flushing any messages down to the wrapped handler.
+ *
+ * It also resets the handler to its initial buffering state.
+ */
+ public function clear()
+ {
+ $this->buffer = array();
+ $this->reset();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php
new file mode 100644
index 00000000..fee47950
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php
@@ -0,0 +1,195 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\WildfireFormatter;
+
+/**
+ * Simple FirePHP Handler (http://www.firephp.org/), which uses the Wildfire protocol.
+ *
+ * @author Eric Clemmons (@ericclemmons) <eric@uxdriven.com>
+ */
+class FirePHPHandler extends AbstractProcessingHandler
+{
+ /**
+ * WildFire JSON header message format
+ */
+ const PROTOCOL_URI = 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2';
+
+ /**
+ * FirePHP structure for parsing messages & their presentation
+ */
+ const STRUCTURE_URI = 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1';
+
+ /**
+ * Must reference a "known" plugin, otherwise headers won't display in FirePHP
+ */
+ const PLUGIN_URI = 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3';
+
+ /**
+ * Header prefix for Wildfire to recognize & parse headers
+ */
+ const HEADER_PREFIX = 'X-Wf';
+
+ /**
+ * Whether or not Wildfire vendor-specific headers have been generated & sent yet
+ */
+ protected static $initialized = false;
+
+ /**
+ * Shared static message index between potentially multiple handlers
+ * @var int
+ */
+ protected static $messageIndex = 1;
+
+ protected static $sendHeaders = true;
+
+ /**
+ * Base header creation function used by init headers & record headers
+ *
+ * @param array $meta Wildfire Plugin, Protocol & Structure Indexes
+ * @param string $message Log message
+ * @return array Complete header string ready for the client as key and message as value
+ */
+ protected function createHeader(array $meta, $message)
+ {
+ $header = sprintf('%s-%s', self::HEADER_PREFIX, join('-', $meta));
+
+ return array($header => $message);
+ }
+
+ /**
+ * Creates message header from record
+ *
+ * @see createHeader()
+ * @param array $record
+ * @return string
+ */
+ protected function createRecordHeader(array $record)
+ {
+ // Wildfire is extensible to support multiple protocols & plugins in a single request,
+ // but we're not taking advantage of that (yet), so we're using "1" for simplicity's sake.
+ return $this->createHeader(
+ array(1, 1, 1, self::$messageIndex++),
+ $record['formatted']
+ );
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new WildfireFormatter();
+ }
+
+ /**
+ * Wildfire initialization headers to enable message parsing
+ *
+ * @see createHeader()
+ * @see sendHeader()
+ * @return array
+ */
+ protected function getInitHeaders()
+ {
+ // Initial payload consists of required headers for Wildfire
+ return array_merge(
+ $this->createHeader(array('Protocol', 1), self::PROTOCOL_URI),
+ $this->createHeader(array(1, 'Structure', 1), self::STRUCTURE_URI),
+ $this->createHeader(array(1, 'Plugin', 1), self::PLUGIN_URI)
+ );
+ }
+
+ /**
+ * Send header string to the client
+ *
+ * @param string $header
+ * @param string $content
+ */
+ protected function sendHeader($header, $content)
+ {
+ if (!headers_sent() && self::$sendHeaders) {
+ header(sprintf('%s: %s', $header, $content));
+ }
+ }
+
+ /**
+ * Creates & sends header for a record, ensuring init headers have been sent prior
+ *
+ * @see sendHeader()
+ * @see sendInitHeaders()
+ * @param array $record
+ */
+ protected function write(array $record)
+ {
+ if (!self::$sendHeaders) {
+ return;
+ }
+
+ // WildFire-specific headers must be sent prior to any messages
+ if (!self::$initialized) {
+ self::$initialized = true;
+
+ self::$sendHeaders = $this->headersAccepted();
+ if (!self::$sendHeaders) {
+ return;
+ }
+
+ foreach ($this->getInitHeaders() as $header => $content) {
+ $this->sendHeader($header, $content);
+ }
+ }
+
+ $header = $this->createRecordHeader($record);
+ if (trim(current($header)) !== '') {
+ $this->sendHeader(key($header), current($header));
+ }
+ }
+
+ /**
+ * Verifies if the headers are accepted by the current user agent
+ *
+ * @return Boolean
+ */
+ protected function headersAccepted()
+ {
+ if (!empty($_SERVER['HTTP_USER_AGENT']) && preg_match('{\bFirePHP/\d+\.\d+\b}', $_SERVER['HTTP_USER_AGENT'])) {
+ return true;
+ }
+
+ return isset($_SERVER['HTTP_X_FIREPHP_VERSION']);
+ }
+
+ /**
+ * BC getter for the sendHeaders property that has been made static
+ */
+ public function __get($property)
+ {
+ if ('sendHeaders' !== $property) {
+ throw new \InvalidArgumentException('Undefined property '.$property);
+ }
+
+ return static::$sendHeaders;
+ }
+
+ /**
+ * BC setter for the sendHeaders property that has been made static
+ */
+ public function __set($property, $value)
+ {
+ if ('sendHeaders' !== $property) {
+ throw new \InvalidArgumentException('Undefined property '.$property);
+ }
+
+ static::$sendHeaders = $value;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php
new file mode 100644
index 00000000..388692c4
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php
@@ -0,0 +1,126 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Logger;
+
+/**
+ * Sends logs to Fleep.io using Webhook integrations
+ *
+ * You'll need a Fleep.io account to use this handler.
+ *
+ * @see https://fleep.io/integrations/webhooks/ Fleep Webhooks Documentation
+ * @author Ando Roots <ando@sqroot.eu>
+ */
+class FleepHookHandler extends SocketHandler
+{
+ const FLEEP_HOST = 'fleep.io';
+
+ const FLEEP_HOOK_URI = '/hook/';
+
+ /**
+ * @var string Webhook token (specifies the conversation where logs are sent)
+ */
+ protected $token;
+
+ /**
+ * Construct a new Fleep.io Handler.
+ *
+ * For instructions on how to create a new web hook in your conversations
+ * see https://fleep.io/integrations/webhooks/
+ *
+ * @param string $token Webhook token
+ * @param bool|int $level The minimum logging level at which this handler will be triggered
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ * @throws MissingExtensionException
+ */
+ public function __construct($token, $level = Logger::DEBUG, $bubble = true)
+ {
+ if (!extension_loaded('openssl')) {
+ throw new MissingExtensionException('The OpenSSL PHP extension is required to use the FleepHookHandler');
+ }
+
+ $this->token = $token;
+
+ $connectionString = 'ssl://' . self::FLEEP_HOST . ':443';
+ parent::__construct($connectionString, $level, $bubble);
+ }
+
+ /**
+ * Returns the default formatter to use with this handler
+ *
+ * Overloaded to remove empty context and extra arrays from the end of the log message.
+ *
+ * @return LineFormatter
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter(null, null, true, true);
+ }
+
+ /**
+ * Handles a log record
+ *
+ * @param array $record
+ */
+ public function write(array $record)
+ {
+ parent::write($record);
+ $this->closeSocket();
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ * @return string
+ */
+ protected function generateDataStream($record)
+ {
+ $content = $this->buildContent($record);
+
+ return $this->buildHeader($content) . $content;
+ }
+
+ /**
+ * Builds the header of the API Call
+ *
+ * @param string $content
+ * @return string
+ */
+ private function buildHeader($content)
+ {
+ $header = "POST " . self::FLEEP_HOOK_URI . $this->token . " HTTP/1.1\r\n";
+ $header .= "Host: " . self::FLEEP_HOST . "\r\n";
+ $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+ $header .= "Content-Length: " . strlen($content) . "\r\n";
+ $header .= "\r\n";
+
+ return $header;
+ }
+
+ /**
+ * Builds the body of API call
+ *
+ * @param array $record
+ * @return string
+ */
+ private function buildContent($record)
+ {
+ $dataArray = array(
+ 'message' => $record['formatted']
+ );
+
+ return http_build_query($dataArray);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php
new file mode 100644
index 00000000..6eaaa9d4
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php
@@ -0,0 +1,103 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Sends notifications through the Flowdock push API
+ *
+ * This must be configured with a FlowdockFormatter instance via setFormatter()
+ *
+ * Notes:
+ * API token - Flowdock API token
+ *
+ * @author Dominik Liebler <liebler.dominik@gmail.com>
+ * @see https://www.flowdock.com/api/push
+ */
+class FlowdockHandler extends SocketHandler
+{
+ /**
+ * @var string
+ */
+ protected $apiToken;
+
+ /**
+ * @param string $apiToken
+ * @param bool|int $level The minimum logging level at which this handler will be triggered
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ *
+ * @throws MissingExtensionException if OpenSSL is missing
+ */
+ public function __construct($apiToken, $level = Logger::DEBUG, $bubble = true)
+ {
+ if (!extension_loaded('openssl')) {
+ throw new MissingExtensionException('The OpenSSL PHP extension is required to use the FlowdockHandler');
+ }
+
+ parent::__construct('ssl://api.flowdock.com:443', $level, $bubble);
+ $this->apiToken = $apiToken;
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ */
+ protected function write(array $record)
+ {
+ parent::write($record);
+
+ $this->closeSocket();
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ * @return string
+ */
+ protected function generateDataStream($record)
+ {
+ $content = $this->buildContent($record);
+
+ return $this->buildHeader($content) . $content;
+ }
+
+ /**
+ * Builds the body of API call
+ *
+ * @param array $record
+ * @return string
+ */
+ private function buildContent($record)
+ {
+ return json_encode($record['formatted']['flowdock']);
+ }
+
+ /**
+ * Builds the header of the API Call
+ *
+ * @param string $content
+ * @return string
+ */
+ private function buildHeader($content)
+ {
+ $header = "POST /v1/messages/team_inbox/" . $this->apiToken . " HTTP/1.1\r\n";
+ $header .= "Host: api.flowdock.com\r\n";
+ $header .= "Content-Type: application/json\r\n";
+ $header .= "Content-Length: " . strlen($content) . "\r\n";
+ $header .= "\r\n";
+
+ return $header;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php
new file mode 100644
index 00000000..790f6364
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php
@@ -0,0 +1,72 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\IMessagePublisher;
+use Gelf\PublisherInterface;
+use InvalidArgumentException;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+/**
+ * Handler to send messages to a Graylog2 (http://www.graylog2.org) server
+ *
+ * @author Matt Lehner <mlehner@gmail.com>
+ * @author Benjamin Zikarsky <benjamin@zikarsky.de>
+ */
+class GelfHandler extends AbstractProcessingHandler
+{
+ /**
+ * @var Publisher the publisher object that sends the message to the server
+ */
+ protected $publisher;
+
+ /**
+ * @param PublisherInterface|IMessagePublisher $publisher a publisher object
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($publisher, $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+
+ if (!$publisher instanceof IMessagePublisher && !$publisher instanceof PublisherInterface) {
+ throw new InvalidArgumentException("Invalid publisher, expected a Gelf\IMessagePublisher or Gelf\PublisherInterface instance");
+ }
+
+ $this->publisher = $publisher;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ $this->publisher = null;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $this->publisher->publish($record['formatted']);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new GelfMessageFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php
new file mode 100644
index 00000000..99384d35
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php
@@ -0,0 +1,80 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Forwards records to multiple handlers
+ *
+ * @author Lenar Lõhmus <lenar@city.ee>
+ */
+class GroupHandler extends AbstractHandler
+{
+ protected $handlers;
+
+ /**
+ * @param array $handlers Array of Handlers.
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(array $handlers, $bubble = true)
+ {
+ foreach ($handlers as $handler) {
+ if (!$handler instanceof HandlerInterface) {
+ throw new \InvalidArgumentException('The first argument of the GroupHandler must be an array of HandlerInterface instances.');
+ }
+ }
+
+ $this->handlers = $handlers;
+ $this->bubble = $bubble;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function isHandling(array $record)
+ {
+ foreach ($this->handlers as $handler) {
+ if ($handler->isHandling($record)) {
+ return true;
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ foreach ($this->handlers as $handler) {
+ $handler->handle($record);
+ }
+
+ return false === $this->bubble;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ foreach ($this->handlers as $handler) {
+ $handler->handleBatch($records);
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php b/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php
new file mode 100644
index 00000000..d920c4ba
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php
@@ -0,0 +1,90 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FormatterInterface;
+
+/**
+ * Interface that all Monolog Handlers must implement
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+interface HandlerInterface
+{
+ /**
+ * Checks whether the given record will be handled by this handler.
+ *
+ * This is mostly done for performance reasons, to avoid calling processors for nothing.
+ *
+ * Handlers should still check the record levels within handle(), returning false in isHandling()
+ * is no guarantee that handle() will not be called, and isHandling() might not be called
+ * for a given record.
+ *
+ * @param array $record Partial log record containing only a level key
+ *
+ * @return Boolean
+ */
+ public function isHandling(array $record);
+
+ /**
+ * Handles a record.
+ *
+ * All records may be passed to this method, and the handler should discard
+ * those that it does not want to handle.
+ *
+ * The return value of this function controls the bubbling process of the handler stack.
+ * Unless the bubbling is interrupted (by returning true), the Logger class will keep on
+ * calling further handlers in the stack with a given log record.
+ *
+ * @param array $record The record to handle
+ * @return Boolean true means that this handler handled the record, and that bubbling is not permitted.
+ * false means the record was either not processed or that this handler allows bubbling.
+ */
+ public function handle(array $record);
+
+ /**
+ * Handles a set of records at once.
+ *
+ * @param array $records The records to handle (an array of record arrays)
+ */
+ public function handleBatch(array $records);
+
+ /**
+ * Adds a processor in the stack.
+ *
+ * @param callable $callback
+ * @return self
+ */
+ public function pushProcessor($callback);
+
+ /**
+ * Removes the processor on top of the stack and returns it.
+ *
+ * @return callable
+ */
+ public function popProcessor();
+
+ /**
+ * Sets the formatter.
+ *
+ * @param FormatterInterface $formatter
+ * @return self
+ */
+ public function setFormatter(FormatterInterface $formatter);
+
+ /**
+ * Gets the formatter.
+ *
+ * @return FormatterInterface
+ */
+ public function getFormatter();
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php
new file mode 100644
index 00000000..29614d31
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php
@@ -0,0 +1,300 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Sends notifications through the hipchat api to a hipchat room
+ *
+ * Notes:
+ * API token - HipChat API token
+ * Room - HipChat Room Id or name, where messages are sent
+ * Name - Name used to send the message (from)
+ * notify - Should the message trigger a notification in the clients
+ *
+ * @author Rafael Dohms <rafael@doh.ms>
+ * @see https://www.hipchat.com/docs/api
+ */
+class HipChatHandler extends SocketHandler
+{
+ /**
+ * The maximum allowed length for the name used in the "from" field.
+ */
+ const MAXIMUM_NAME_LENGTH = 15;
+
+ /**
+ * The maximum allowed length for the message.
+ */
+ const MAXIMUM_MESSAGE_LENGTH = 9500;
+
+ /**
+ * @var string
+ */
+ private $token;
+
+ /**
+ * @var array
+ */
+ private $room;
+
+ /**
+ * @var string
+ */
+ private $name;
+
+ /**
+ * @var boolean
+ */
+ private $notify;
+
+ /**
+ * @var string
+ */
+ private $format;
+
+ /**
+ * @param string $token HipChat API Token
+ * @param string $room The room that should be alerted of the message (Id or Name)
+ * @param string $name Name used in the "from" field
+ * @param bool $notify Trigger a notification in clients or not
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param Boolean $useSSL Whether to connect via SSL.
+ * @param string $format The format of the messages (default to text, can be set to html if you have html in the messages)
+ * @param string $host The HipChat server hostname.
+ */
+ public function __construct($token, $room, $name = 'Monolog', $notify = false, $level = Logger::CRITICAL, $bubble = true, $useSSL = true, $format = 'text', $host = 'api.hipchat.com')
+ {
+ if (!$this->validateStringLength($name, static::MAXIMUM_NAME_LENGTH)) {
+ throw new \InvalidArgumentException('The supplied name is too long. HipChat\'s v1 API supports names up to 15 UTF-8 characters.');
+ }
+
+ $connectionString = $useSSL ? 'ssl://'.$host.':443' : $host.':80';
+ parent::__construct($connectionString, $level, $bubble);
+
+ $this->token = $token;
+ $this->name = $name;
+ $this->notify = $notify;
+ $this->room = $room;
+ $this->format = $format;
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ * @return string
+ */
+ protected function generateDataStream($record)
+ {
+ $content = $this->buildContent($record);
+
+ return $this->buildHeader($content) . $content;
+ }
+
+ /**
+ * Builds the body of API call
+ *
+ * @param array $record
+ * @return string
+ */
+ private function buildContent($record)
+ {
+ $dataArray = array(
+ 'from' => $this->name,
+ 'room_id' => $this->room,
+ 'notify' => $this->notify,
+ 'message' => $record['formatted'],
+ 'message_format' => $this->format,
+ 'color' => $this->getAlertColor($record['level']),
+ );
+
+ return http_build_query($dataArray);
+ }
+
+ /**
+ * Builds the header of the API Call
+ *
+ * @param string $content
+ * @return string
+ */
+ private function buildHeader($content)
+ {
+ $header = "POST /v1/rooms/message?format=json&auth_token=".$this->token." HTTP/1.1\r\n";
+ $header .= "Host: api.hipchat.com\r\n";
+ $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+ $header .= "Content-Length: " . strlen($content) . "\r\n";
+ $header .= "\r\n";
+
+ return $header;
+ }
+
+ /**
+ * Assigns a color to each level of log records.
+ *
+ * @param integer $level
+ * @return string
+ */
+ protected function getAlertColor($level)
+ {
+ switch (true) {
+ case $level >= Logger::ERROR:
+ return 'red';
+ case $level >= Logger::WARNING:
+ return 'yellow';
+ case $level >= Logger::INFO:
+ return 'green';
+ case $level == Logger::DEBUG:
+ return 'gray';
+ default:
+ return 'yellow';
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ */
+ protected function write(array $record)
+ {
+ parent::write($record);
+ $this->closeSocket();
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ if (count($records) == 0) {
+ return true;
+ }
+
+ $batchRecords = $this->combineRecords($records);
+
+ $handled = false;
+ foreach ($batchRecords as $batchRecord) {
+ if ($this->isHandling($batchRecord)) {
+ $this->write($batchRecord);
+ $handled = true;
+ }
+ }
+
+ if (!$handled) {
+ return false;
+ }
+
+ return false === $this->bubble;
+ }
+
+ /**
+ * Combines multiple records into one. Error level of the combined record
+ * will be the highest level from the given records. Datetime will be taken
+ * from the first record.
+ *
+ * @param $records
+ * @return array
+ */
+ private function combineRecords($records)
+ {
+ $batchRecord = null;
+ $batchRecords = array();
+ $messages = array();
+ $formattedMessages = array();
+ $level = 0;
+ $levelName = null;
+ $datetime = null;
+
+ foreach ($records as $record) {
+ $record = $this->processRecord($record);
+
+ if ($record['level'] > $level) {
+ $level = $record['level'];
+ $levelName = $record['level_name'];
+ }
+
+ if (null === $datetime) {
+ $datetime = $record['datetime'];
+ }
+
+ $messages[] = $record['message'];
+ $messgeStr = implode(PHP_EOL, $messages);
+ $formattedMessages[] = $this->getFormatter()->format($record);
+ $formattedMessageStr = implode('', $formattedMessages);
+
+ $batchRecord = array(
+ 'message' => $messgeStr,
+ 'formatted' => $formattedMessageStr,
+ 'context' => array(),
+ 'extra' => array(),
+ );
+
+ if (!$this->validateStringLength($batchRecord['formatted'], static::MAXIMUM_MESSAGE_LENGTH)) {
+ // Pop the last message and implode the remainging messages
+ $lastMessage = array_pop($messages);
+ $lastFormattedMessage = array_pop($formattedMessages);
+ $batchRecord['message'] = implode(PHP_EOL, $messages);
+ $batchRecord['formatted'] = implode('', $formattedMessages);
+
+ $batchRecords[] = $batchRecord;
+ $messages = array($lastMessage);
+ $formattedMessages = array($lastFormattedMessage);
+
+ $batchRecord = null;
+ }
+ }
+
+ if (null !== $batchRecord) {
+ $batchRecords[] = $batchRecord;
+ }
+
+ // Set the max level and datetime for all records
+ foreach ($batchRecords as &$batchRecord) {
+ $batchRecord = array_merge(
+ $batchRecord,
+ array(
+ 'level' => $level,
+ 'level_name' => $levelName,
+ 'datetime' => $datetime
+ )
+ );
+ }
+
+ return $batchRecords;
+ }
+
+ /**
+ * Validates the length of a string.
+ *
+ * If the `mb_strlen()` function is available, it will use that, as HipChat
+ * allows UTF-8 characters. Otherwise, it will fall back to `strlen()`.
+ *
+ * Note that this might cause false failures in the specific case of using
+ * a valid name with less than 16 characters, but 16 or more bytes, on a
+ * system where `mb_strlen()` is unavailable.
+ *
+ * @param string $str
+ * @param int $length
+ *
+ * @return bool
+ */
+ private function validateStringLength($str, $length)
+ {
+ if (function_exists('mb_strlen')) {
+ return (mb_strlen($str) <= $length);
+ }
+
+ return (strlen($str) <= $length);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php
new file mode 100644
index 00000000..8bf388b3
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php
@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * @author Robert Kaufmann III <rok3@rok3.me>
+ */
+class LogEntriesHandler extends SocketHandler
+{
+ /**
+ * @var string
+ */
+ protected $logToken;
+
+ /**
+ * @param string $token Log token supplied by LogEntries
+ * @param boolean $useSSL Whether or not SSL encryption should be used.
+ * @param int $level The minimum logging level to trigger this handler
+ * @param boolean $bubble Whether or not messages that are handled should bubble up the stack.
+ *
+ * @throws MissingExtensionExcpetion If SSL encryption is set to true and OpenSSL is missing
+ */
+ public function __construct($token, $useSSL = true, $level = Logger::DEBUG, $bubble = true)
+ {
+ if ($useSSL && !extension_loaded('openssl')) {
+ throw new MissingExtensionException('The OpenSSL PHP plugin is required to use SSL encrypted connection for LogEntriesHandler');
+ }
+
+ $endpoint = $useSSL ? 'ssl://api.logentries.com:20000' : 'data.logentries.com:80';
+ parent::__construct($endpoint, $level, $bubble);
+ $this->logToken = $token;
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ * @return string
+ */
+ protected function generateDataStream($record)
+ {
+ return $this->logToken . ' ' . $record['formatted'];
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php
new file mode 100644
index 00000000..efd94d30
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php
@@ -0,0 +1,98 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LogglyFormatter;
+
+/**
+ * Sends errors to Loggly.
+ *
+ * @author Przemek Sobstel <przemek@sobstel.org>
+ * @author Adam Pancutt <adam@pancutt.com>
+ */
+class LogglyHandler extends AbstractProcessingHandler
+{
+ const HOST = 'logs-01.loggly.com';
+ const ENDPOINT_SINGLE = 'inputs';
+ const ENDPOINT_BATCH = 'bulk';
+
+ protected $token;
+
+ protected $tag;
+
+ public function __construct($token, $level = Logger::DEBUG, $bubble = true)
+ {
+ if (!extension_loaded('curl')) {
+ throw new \LogicException('The curl extension is needed to use the LogglyHandler');
+ }
+
+ $this->token = $token;
+
+ parent::__construct($level, $bubble);
+ }
+
+ public function setTag($tag)
+ {
+ $this->tag = $tag;
+ }
+
+ public function addTag($tag)
+ {
+ $this->tag = (strlen($this->tag) > 0) ? $this->tag .','. $tag : $tag;
+ }
+
+ protected function write(array $record)
+ {
+ $this->send($record["formatted"], self::ENDPOINT_SINGLE);
+ }
+
+ public function handleBatch(array $records)
+ {
+ $level = $this->level;
+
+ $records = array_filter($records, function ($record) use ($level) {
+ return ($record['level'] >= $level);
+ });
+
+ if ($records) {
+ $this->send($this->getFormatter()->formatBatch($records), self::ENDPOINT_BATCH);
+ }
+ }
+
+ protected function send($data, $endpoint)
+ {
+ $url = sprintf("https://%s/%s/%s/", self::HOST, $endpoint, $this->token);
+
+ $headers = array('Content-Type: application/json');
+
+ if ($this->tag) {
+ $headers[] = "X-LOGGLY-TAG: {$this->tag}";
+ }
+
+ $ch = curl_init();
+
+ curl_setopt($ch, CURLOPT_URL, $url);
+ curl_setopt($ch, CURLOPT_POST, true);
+ curl_setopt($ch, CURLOPT_POSTFIELDS, $data);
+ curl_setopt($ch, CURLOPT_HTTPHEADER, $headers);
+ curl_setopt($ch, CURLOPT_RETURNTRANSFER, true);
+
+ curl_exec($ch);
+ curl_close($ch);
+ }
+
+ protected function getDefaultFormatter()
+ {
+ return new LogglyFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php
new file mode 100644
index 00000000..86292727
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php
@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Base class for all mail handlers
+ *
+ * @author Gyula Sallai
+ */
+abstract class MailHandler extends AbstractProcessingHandler
+{
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ $messages = array();
+
+ foreach ($records as $record) {
+ if ($record['level'] < $this->level) {
+ continue;
+ }
+ $messages[] = $this->processRecord($record);
+ }
+
+ if (!empty($messages)) {
+ $this->send((string) $this->getFormatter()->formatBatch($messages), $messages);
+ }
+ }
+
+ /**
+ * Send a mail with the given content
+ *
+ * @param string $content
+ * @param array $records the array of log records that formed this content
+ */
+ abstract protected function send($content, array $records);
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $this->send((string) $record['formatted'], array($record));
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php
new file mode 100644
index 00000000..60a2901e
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php
@@ -0,0 +1,69 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * MandrillHandler uses cURL to send the emails to the Mandrill API
+ *
+ * @author Adam Nicholson <adamnicholson10@gmail.com>
+ */
+class MandrillHandler extends MailHandler
+{
+ protected $client;
+ protected $message;
+
+ /**
+ * @param string $apiKey A valid Mandrill API key
+ * @param callable|\Swift_Message $message An example message for real messages, only the body will be replaced
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($apiKey, $message, $level = Logger::ERROR, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+
+ if (!$message instanceof \Swift_Message && is_callable($message)) {
+ $message = call_user_func($message);
+ }
+ if (!$message instanceof \Swift_Message) {
+ throw new \InvalidArgumentException('You must provide either a Swift_Message instance or a callable returning it');
+ }
+ $this->message = $message;
+ $this->apiKey = $apiKey;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function send($content, array $records)
+ {
+ $message = clone $this->message;
+ $message->setBody($content);
+ $message->setDate(time());
+
+ $ch = curl_init();
+
+ curl_setopt($ch, CURLOPT_URL, 'https://mandrillapp.com/api/1.0/messages/send-raw.json');
+ curl_setopt($ch, CURLOPT_POST, 1);
+ curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
+ curl_setopt($ch, CURLOPT_POSTFIELDS, http_build_query(array(
+ 'key' => $this->apiKey,
+ 'raw_message' => (string) $message,
+ 'async' => false,
+ )));
+
+ curl_exec($ch);
+ curl_close($ch);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php b/vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php
new file mode 100644
index 00000000..4724a7e2
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php
@@ -0,0 +1,21 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Exception can be thrown if an extension for an handler is missing
+ *
+ * @author Christian Bergau <cbergau86@gmail.com>
+ */
+class MissingExtensionException extends \Exception
+{
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php
new file mode 100644
index 00000000..6c431f2b
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php
@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\NormalizerFormatter;
+
+/**
+ * Logs to a MongoDB database.
+ *
+ * usage example:
+ *
+ * $log = new Logger('application');
+ * $mongodb = new MongoDBHandler(new \Mongo("mongodb://localhost:27017"), "logs", "prod");
+ * $log->pushHandler($mongodb);
+ *
+ * @author Thomas Tourlourat <thomas@tourlourat.com>
+ */
+class MongoDBHandler extends AbstractProcessingHandler
+{
+ protected $mongoCollection;
+
+ public function __construct($mongo, $database, $collection, $level = Logger::DEBUG, $bubble = true)
+ {
+ if (!($mongo instanceof \MongoClient || $mongo instanceof \Mongo)) {
+ throw new \InvalidArgumentException('MongoClient or Mongo instance required');
+ }
+
+ $this->mongoCollection = $mongo->selectCollection($database, $collection);
+
+ parent::__construct($level, $bubble);
+ }
+
+ protected function write(array $record)
+ {
+ $this->mongoCollection->save($record["formatted"]);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new NormalizerFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php
new file mode 100644
index 00000000..0fe6b642
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php
@@ -0,0 +1,155 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * NativeMailerHandler uses the mail() function to send the emails
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ * @author Mark Garrett <mark@moderndeveloperllc.com>
+ */
+class NativeMailerHandler extends MailHandler
+{
+ /**
+ * The email addresses to which the message will be sent
+ * @var array
+ */
+ protected $to;
+
+ /**
+ * The subject of the email
+ * @var string
+ */
+ protected $subject;
+
+ /**
+ * Optional headers for the message
+ * @var array
+ */
+ protected $headers = array();
+
+ /**
+ * The wordwrap length for the message
+ * @var integer
+ */
+ protected $maxColumnWidth;
+
+ /**
+ * The Content-type for the message
+ * @var string
+ */
+ protected $contentType = 'text/plain';
+
+ /**
+ * The encoding for the message
+ * @var string
+ */
+ protected $encoding = 'utf-8';
+
+ /**
+ * @param string|array $to The receiver of the mail
+ * @param string $subject The subject of the mail
+ * @param string $from The sender of the mail
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param int $maxColumnWidth The maximum column width that the message lines will have
+ */
+ public function __construct($to, $subject, $from, $level = Logger::ERROR, $bubble = true, $maxColumnWidth = 70)
+ {
+ parent::__construct($level, $bubble);
+ $this->to = is_array($to) ? $to : array($to);
+ $this->subject = $subject;
+ $this->addHeader(sprintf('From: %s', $from));
+ $this->maxColumnWidth = $maxColumnWidth;
+ }
+
+ /**
+ * Add headers to the message
+ *
+ * @param string|array $headers Custom added headers
+ * @return null
+ */
+ public function addHeader($headers)
+ {
+ foreach ((array) $headers as $header) {
+ if (strpos($header, "\n") !== false || strpos($header, "\r") !== false) {
+ throw new \InvalidArgumentException('Headers can not contain newline characters for security reasons');
+ }
+ $this->headers[] = $header;
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function send($content, array $records)
+ {
+ $content = wordwrap($content, $this->maxColumnWidth);
+ $headers = ltrim(implode("\r\n", $this->headers) . "\r\n", "\r\n");
+ $headers .= 'Content-type: ' . $this->getContentType() . '; charset=' . $this->getEncoding() . "\r\n";
+ if ($this->getContentType() == 'text/html' && false === strpos($headers, 'MIME-Version:')) {
+ $headers .= 'MIME-Version: 1.0' . "\r\n";
+ }
+ foreach ($this->to as $to) {
+ mail($to, $this->subject, $content, $headers);
+ }
+ }
+
+ /**
+ * @return string $contentType
+ */
+ public function getContentType()
+ {
+ return $this->contentType;
+ }
+
+ /**
+ * @return string $encoding
+ */
+ public function getEncoding()
+ {
+ return $this->encoding;
+ }
+
+ /**
+ * @param string $contentType The content type of the email - Defaults to text/plain. Use text/html for HTML
+ * messages.
+ * @return self
+ */
+ public function setContentType($contentType)
+ {
+ if (strpos($contentType, "\n") !== false || strpos($contentType, "\r") !== false) {
+ throw new \InvalidArgumentException('The content type can not contain newline characters to prevent email header injection');
+ }
+
+ $this->contentType = $contentType;
+
+ return $this;
+ }
+
+ /**
+ * @param string $encoding
+ * @return self
+ */
+ public function setEncoding($encoding)
+ {
+ if (strpos($encoding, "\n") !== false || strpos($encoding, "\r") !== false) {
+ throw new \InvalidArgumentException('The content type can not contain newline characters to prevent email header injection');
+ }
+
+ $this->encoding = $encoding;
+
+ return $this;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php
new file mode 100644
index 00000000..9807410d
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php
@@ -0,0 +1,174 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Class to record a log on a NewRelic application
+ *
+ * @see https://docs.newrelic.com/docs/agents/php-agent
+ */
+class NewRelicHandler extends AbstractProcessingHandler
+{
+ /**
+ * Name of the New Relic application that will receive logs from this handler.
+ *
+ * @var string
+ */
+ protected $appName;
+
+ /**
+ * Name of the current transaction
+ *
+ * @var string
+ */
+ protected $transactionName;
+
+ /**
+ * Some context and extra data is passed into the handler as arrays of values. Do we send them as is
+ * (useful if we are using the API), or explode them for display on the NewRelic RPM website?
+ *
+ * @var boolean
+ */
+ protected $explodeArrays;
+
+ /**
+ * {@inheritDoc}
+ *
+ * @param string $appName
+ * @param boolean $explodeArrays
+ * @param string $transactionName
+ */
+ public function __construct(
+ $level = Logger::ERROR,
+ $bubble = true,
+ $appName = null,
+ $explodeArrays = false,
+ $transactionName = null
+ ) {
+ parent::__construct($level, $bubble);
+
+ $this->appName = $appName;
+ $this->explodeArrays = $explodeArrays;
+ $this->transactionName = $transactionName;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function write(array $record)
+ {
+ if (!$this->isNewRelicEnabled()) {
+ throw new MissingExtensionException('The newrelic PHP extension is required to use the NewRelicHandler');
+ }
+
+ if ($appName = $this->getAppName($record['context'])) {
+ $this->setNewRelicAppName($appName);
+ }
+
+ if ($transactionName = $this->getTransactionName($record['context'])) {
+ $this->setNewRelicTransactionName($transactionName);
+ unset($record['context']['transaction_name']);
+ }
+
+ if (isset($record['context']['exception']) && $record['context']['exception'] instanceof \Exception) {
+ newrelic_notice_error($record['message'], $record['context']['exception']);
+ unset($record['context']['exception']);
+ } else {
+ newrelic_notice_error($record['message']);
+ }
+
+ foreach ($record['context'] as $key => $parameter) {
+ if (is_array($parameter) && $this->explodeArrays) {
+ foreach ($parameter as $paramKey => $paramValue) {
+ newrelic_add_custom_parameter('context_' . $key . '_' . $paramKey, $paramValue);
+ }
+ } else {
+ newrelic_add_custom_parameter('context_' . $key, $parameter);
+ }
+ }
+
+ foreach ($record['extra'] as $key => $parameter) {
+ if (is_array($parameter) && $this->explodeArrays) {
+ foreach ($parameter as $paramKey => $paramValue) {
+ newrelic_add_custom_parameter('extra_' . $key . '_' . $paramKey, $paramValue);
+ }
+ } else {
+ newrelic_add_custom_parameter('extra_' . $key, $parameter);
+ }
+ }
+ }
+
+ /**
+ * Checks whether the NewRelic extension is enabled in the system.
+ *
+ * @return bool
+ */
+ protected function isNewRelicEnabled()
+ {
+ return extension_loaded('newrelic');
+ }
+
+ /**
+ * Returns the appname where this log should be sent. Each log can override the default appname, set in this
+ * handler's constructor, by providing the appname in it's context.
+ *
+ * @param array $context
+ * @return null|string
+ */
+ protected function getAppName(array $context)
+ {
+ if (isset($context['appname'])) {
+ return $context['appname'];
+ }
+
+ return $this->appName;
+ }
+
+ /**
+ * Returns the name of the current transaction. Each log can override the default transaction name, set in this
+ * handler's constructor, by providing the transaction_name in it's context
+ *
+ * @param array $context
+ *
+ * @return null|string
+ */
+ protected function getTransactionName(array $context)
+ {
+ if (isset($context['transaction_name'])) {
+ return $context['transaction_name'];
+ }
+
+ return $this->transactionName;
+ }
+
+ /**
+ * Sets the NewRelic application that should receive this log.
+ *
+ * @param string $appName
+ */
+ protected function setNewRelicAppName($appName)
+ {
+ newrelic_set_appname($appName);
+ }
+
+ /**
+ * Overwrites the name of the current transaction
+ *
+ * @param $transactionName
+ */
+ protected function setNewRelicTransactionName($transactionName)
+ {
+ newrelic_name_transaction($transactionName);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php
new file mode 100644
index 00000000..3754e45d
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php
@@ -0,0 +1,45 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Blackhole
+ *
+ * Any record it can handle will be thrown away. This can be used
+ * to put on top of an existing stack to override it temporarily.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class NullHandler extends AbstractHandler
+{
+ /**
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ */
+ public function __construct($level = Logger::DEBUG)
+ {
+ parent::__construct($level, false);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if ($record['level'] < $this->level) {
+ return false;
+ }
+
+ return true;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php
new file mode 100644
index 00000000..1ae85845
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php
@@ -0,0 +1,56 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Psr\Log\LoggerInterface;
+
+/**
+ * Proxies log messages to an existing PSR-3 compliant logger.
+ *
+ * @author Michael Moussa <michael.moussa@gmail.com>
+ */
+class PsrHandler extends AbstractHandler
+{
+ /**
+ * PSR-3 compliant logger
+ *
+ * @var LoggerInterface
+ */
+ protected $logger;
+
+ /**
+ * @param LoggerInterface $logger The underlying PSR-3 compliant logger to which messages will be proxied
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(LoggerInterface $logger, $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+
+ $this->logger = $logger;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public function handle(array $record)
+ {
+ if (!$this->isHandling($record)) {
+ return false;
+ }
+
+ $this->logger->log(strtolower($record['level_name']), $record['message'], $record['context']);
+
+ return false === $this->bubble;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php
new file mode 100644
index 00000000..cd2fcfa3
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php
@@ -0,0 +1,172 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Sends notifications through the pushover api to mobile phones
+ *
+ * @author Sebastian Göttschkes <sebastian.goettschkes@googlemail.com>
+ * @see https://www.pushover.net/api
+ */
+class PushoverHandler extends SocketHandler
+{
+ private $token;
+ private $users;
+ private $title;
+ private $user;
+ private $retry;
+ private $expire;
+
+ private $highPriorityLevel;
+ private $emergencyLevel;
+
+ /**
+ * All parameters that can be sent to Pushover
+ * @see https://pushover.net/api
+ * @var array
+ */
+ private $parameterNames = array(
+ 'token' => true,
+ 'user' => true,
+ 'message' => true,
+ 'device' => true,
+ 'title' => true,
+ 'url' => true,
+ 'url_title' => true,
+ 'priority' => true,
+ 'timestamp' => true,
+ 'sound' => true,
+ 'retry' => true,
+ 'expire' => true,
+ 'callback' => true,
+ );
+
+ /**
+ * Sounds the api supports by default
+ * @see https://pushover.net/api#sounds
+ * @var array
+ */
+ private $sounds = array(
+ 'pushover', 'bike', 'bugle', 'cashregister', 'classical', 'cosmic', 'falling', 'gamelan', 'incoming',
+ 'intermission', 'magic', 'mechanical', 'pianobar', 'siren', 'spacealarm', 'tugboat', 'alien', 'climb',
+ 'persistent', 'echo', 'updown', 'none',
+ );
+
+ /**
+ * @param string $token Pushover api token
+ * @param string|array $users Pushover user id or array of ids the message will be sent to
+ * @param string $title Title sent to the Pushover API
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param Boolean $useSSL Whether to connect via SSL. Required when pushing messages to users that are not
+ * the pushover.net app owner. OpenSSL is required for this option.
+ * @param integer $highPriorityLevel The minimum logging level at which this handler will start
+ * sending "high priority" requests to the Pushover API
+ * @param integer $emergencyLevel The minimum logging level at which this handler will start
+ * sending "emergency" requests to the Pushover API
+ * @param integer $retry The retry parameter specifies how often (in seconds) the Pushover servers will send the same notification to the user.
+ * @param integer $expire The expire parameter specifies how many seconds your notification will continue to be retried for (every retry seconds).
+ */
+ public function __construct($token, $users, $title = null, $level = Logger::CRITICAL, $bubble = true, $useSSL = true, $highPriorityLevel = Logger::CRITICAL, $emergencyLevel = Logger::EMERGENCY, $retry = 30, $expire = 25200)
+ {
+ $connectionString = $useSSL ? 'ssl://api.pushover.net:443' : 'api.pushover.net:80';
+ parent::__construct($connectionString, $level, $bubble);
+
+ $this->token = $token;
+ $this->users = (array) $users;
+ $this->title = $title ?: gethostname();
+ $this->highPriorityLevel = Logger::toMonologLevel($highPriorityLevel);
+ $this->emergencyLevel = Logger::toMonologLevel($emergencyLevel);
+ $this->retry = $retry;
+ $this->expire = $expire;
+ }
+
+ protected function generateDataStream($record)
+ {
+ $content = $this->buildContent($record);
+
+ return $this->buildHeader($content) . $content;
+ }
+
+ private function buildContent($record)
+ {
+ // Pushover has a limit of 512 characters on title and message combined.
+ $maxMessageLength = 512 - strlen($this->title);
+ $message = substr($record['message'], 0, $maxMessageLength);
+ $timestamp = $record['datetime']->getTimestamp();
+
+ $dataArray = array(
+ 'token' => $this->token,
+ 'user' => $this->user,
+ 'message' => $message,
+ 'title' => $this->title,
+ 'timestamp' => $timestamp
+ );
+
+ if (isset($record['level']) && $record['level'] >= $this->emergencyLevel) {
+ $dataArray['priority'] = 2;
+ $dataArray['retry'] = $this->retry;
+ $dataArray['expire'] = $this->expire;
+ } elseif (isset($record['level']) && $record['level'] >= $this->highPriorityLevel) {
+ $dataArray['priority'] = 1;
+ }
+
+ // First determine the available parameters
+ $context = array_intersect_key($record['context'], $this->parameterNames);
+ $extra = array_intersect_key($record['extra'], $this->parameterNames);
+
+ // Least important info should be merged with subsequent info
+ $dataArray = array_merge($extra, $context, $dataArray);
+
+ // Only pass sounds that are supported by the API
+ if (isset($dataArray['sound']) && !in_array($dataArray['sound'], $this->sounds)) {
+ unset($dataArray['sound']);
+ }
+
+ return http_build_query($dataArray);
+ }
+
+ private function buildHeader($content)
+ {
+ $header = "POST /1/messages.json HTTP/1.1\r\n";
+ $header .= "Host: api.pushover.net\r\n";
+ $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+ $header .= "Content-Length: " . strlen($content) . "\r\n";
+ $header .= "\r\n";
+
+ return $header;
+ }
+
+ protected function write(array $record)
+ {
+ foreach ($this->users as $user) {
+ $this->user = $user;
+
+ parent::write($record);
+ $this->closeSocket();
+ }
+
+ $this->user = null;
+ }
+
+ public function setHighPriorityLevel($value)
+ {
+ $this->highPriorityLevel = $value;
+ }
+
+ public function setEmergencyLevel($value)
+ {
+ $this->emergencyLevel = $value;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php
new file mode 100644
index 00000000..f5743cd6
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php
@@ -0,0 +1,181 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Formatter\FormatterInterface;
+use Monolog\Logger;
+use Raven_Client;
+
+/**
+ * Handler to send messages to a Sentry (https://github.com/getsentry/sentry) server
+ * using raven-php (https://github.com/getsentry/raven-php)
+ *
+ * @author Marc Abramowitz <marc@marc-abramowitz.com>
+ */
+class RavenHandler extends AbstractProcessingHandler
+{
+ /**
+ * Translates Monolog log levels to Raven log levels.
+ */
+ private $logLevels = array(
+ Logger::DEBUG => Raven_Client::DEBUG,
+ Logger::INFO => Raven_Client::INFO,
+ Logger::NOTICE => Raven_Client::INFO,
+ Logger::WARNING => Raven_Client::WARNING,
+ Logger::ERROR => Raven_Client::ERROR,
+ Logger::CRITICAL => Raven_Client::FATAL,
+ Logger::ALERT => Raven_Client::FATAL,
+ Logger::EMERGENCY => Raven_Client::FATAL,
+ );
+
+ /**
+ * @var Raven_Client the client object that sends the message to the server
+ */
+ protected $ravenClient;
+
+ /**
+ * @var LineFormatter The formatter to use for the logs generated via handleBatch()
+ */
+ protected $batchFormatter;
+
+ /**
+ * @param Raven_Client $ravenClient
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(Raven_Client $ravenClient, $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+
+ $this->ravenClient = $ravenClient;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ $level = $this->level;
+
+ // filter records based on their level
+ $records = array_filter($records, function ($record) use ($level) {
+ return $record['level'] >= $level;
+ });
+
+ if (!$records) {
+ return;
+ }
+
+ // the record with the highest severity is the "main" one
+ $record = array_reduce($records, function ($highest, $record) {
+ if ($record['level'] >= $highest['level']) {
+ return $record;
+ }
+
+ return $highest;
+ });
+
+ // the other ones are added as a context item
+ $logs = array();
+ foreach ($records as $r) {
+ $logs[] = $this->processRecord($r);
+ }
+
+ if ($logs) {
+ $record['context']['logs'] = (string) $this->getBatchFormatter()->formatBatch($logs);
+ }
+
+ $this->handle($record);
+ }
+
+ /**
+ * Sets the formatter for the logs generated by handleBatch().
+ *
+ * @param FormatterInterface $formatter
+ */
+ public function setBatchFormatter(FormatterInterface $formatter)
+ {
+ $this->batchFormatter = $formatter;
+ }
+
+ /**
+ * Gets the formatter for the logs generated by handleBatch().
+ *
+ * @return FormatterInterface
+ */
+ public function getBatchFormatter()
+ {
+ if (!$this->batchFormatter) {
+ $this->batchFormatter = $this->getDefaultBatchFormatter();
+ }
+
+ return $this->batchFormatter;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $options = array();
+ $options['level'] = $this->logLevels[$record['level']];
+ $options['tags'] = array();
+ if (!empty($record['extra']['tags'])) {
+ $options['tags'] = array_merge($options['tags'], $record['extra']['tags']);
+ unset($record['extra']['tags']);
+ }
+ if (!empty($record['context']['tags'])) {
+ $options['tags'] = array_merge($options['tags'], $record['context']['tags']);
+ unset($record['context']['tags']);
+ }
+ if (!empty($record['context']['logger'])) {
+ $options['logger'] = $record['context']['logger'];
+ unset($record['context']['logger']);
+ } else {
+ $options['logger'] = $record['channel'];
+ }
+ if (!empty($record['context'])) {
+ $options['extra']['context'] = $record['context'];
+ }
+ if (!empty($record['extra'])) {
+ $options['extra']['extra'] = $record['extra'];
+ }
+
+ if (isset($record['context']['exception']) && $record['context']['exception'] instanceof \Exception) {
+ $options['extra']['message'] = $record['formatted'];
+ $this->ravenClient->captureException($record['context']['exception'], $options);
+
+ return;
+ }
+
+ $this->ravenClient->captureMessage($record['formatted'], array(), $options);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter('[%channel%] %message%');
+ }
+
+ /**
+ * Gets the default formatter for the logs generated by handleBatch().
+ *
+ * @return FormatterInterface
+ */
+ protected function getDefaultBatchFormatter()
+ {
+ return new LineFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php
new file mode 100644
index 00000000..3fc7f34b
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php
@@ -0,0 +1,58 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Logs to a Redis key using rpush
+ *
+ * usage example:
+ *
+ * $log = new Logger('application');
+ * $redis = new RedisHandler(new Predis\Client("tcp://localhost:6379"), "logs", "prod");
+ * $log->pushHandler($redis);
+ *
+ * @author Thomas Tourlourat <thomas@tourlourat.com>
+ */
+class RedisHandler extends AbstractProcessingHandler
+{
+ private $redisClient;
+ private $redisKey;
+
+ # redis instance, key to use
+ public function __construct($redis, $key, $level = Logger::DEBUG, $bubble = true)
+ {
+ if (!(($redis instanceof \Predis\Client) || ($redis instanceof \Redis))) {
+ throw new \InvalidArgumentException('Predis\Client or Redis instance required');
+ }
+
+ $this->redisClient = $redis;
+ $this->redisKey = $key;
+
+ parent::__construct($level, $bubble);
+ }
+
+ protected function write(array $record)
+ {
+ $this->redisClient->rpush($this->redisKey, $record["formatted"]);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected function getDefaultFormatter()
+ {
+ return new LineFormatter();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php
new file mode 100644
index 00000000..81abf086
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php
@@ -0,0 +1,73 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use RollbarNotifier;
+use Exception;
+use Monolog\Logger;
+
+/**
+ * Sends errors to Rollbar
+ *
+ * @author Paul Statezny <paulstatezny@gmail.com>
+ */
+class RollbarHandler extends AbstractProcessingHandler
+{
+ /**
+ * Rollbar notifier
+ *
+ * @var RollbarNotifier
+ */
+ protected $rollbarNotifier;
+
+ /**
+ * @param RollbarNotifier $rollbarNotifier RollbarNotifier object constructed with valid token
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(RollbarNotifier $rollbarNotifier, $level = Logger::ERROR, $bubble = true)
+ {
+ $this->rollbarNotifier = $rollbarNotifier;
+
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ if (isset($record['context']['exception']) && $record['context']['exception'] instanceof Exception) {
+ $this->rollbarNotifier->report_exception($record['context']['exception']);
+ } else {
+ $extraData = array(
+ 'level' => $record['level'],
+ 'channel' => $record['channel'],
+ 'datetime' => $record['datetime']->format('U'),
+ );
+
+ $this->rollbarNotifier->report_message(
+ $record['message'],
+ $record['level_name'],
+ array_merge($record['context'], $record['extra'], $extraData)
+ );
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ $this->rollbarNotifier->flush();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php
new file mode 100644
index 00000000..4168c32f
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php
@@ -0,0 +1,153 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores logs to files that are rotated every day and a limited number of files are kept.
+ *
+ * This rotation is only intended to be used as a workaround. Using logrotate to
+ * handle the rotation is strongly encouraged when you can use it.
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class RotatingFileHandler extends StreamHandler
+{
+ protected $filename;
+ protected $maxFiles;
+ protected $mustRotate;
+ protected $nextRotation;
+ protected $filenameFormat;
+ protected $dateFormat;
+
+ /**
+ * @param string $filename
+ * @param integer $maxFiles The maximal amount of files to keep (0 means unlimited)
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param int|null $filePermission Optional file permissions (default (0644) are only for owner read/write)
+ * @param Boolean $useLocking Try to lock log file before doing any writes
+ */
+ public function __construct($filename, $maxFiles = 0, $level = Logger::DEBUG, $bubble = true, $filePermission = null, $useLocking = false)
+ {
+ $this->filename = $filename;
+ $this->maxFiles = (int) $maxFiles;
+ $this->nextRotation = new \DateTime('tomorrow');
+ $this->filenameFormat = '{filename}-{date}';
+ $this->dateFormat = 'Y-m-d';
+
+ parent::__construct($this->getTimedFilename(), $level, $bubble, $filePermission, $useLocking);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ parent::close();
+
+ if (true === $this->mustRotate) {
+ $this->rotate();
+ }
+ }
+
+ public function setFilenameFormat($filenameFormat, $dateFormat)
+ {
+ $this->filenameFormat = $filenameFormat;
+ $this->dateFormat = $dateFormat;
+ $this->url = $this->getTimedFilename();
+ $this->close();
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ // on the first record written, if the log is new, we should rotate (once per day)
+ if (null === $this->mustRotate) {
+ $this->mustRotate = !file_exists($this->url);
+ }
+
+ if ($this->nextRotation < $record['datetime']) {
+ $this->mustRotate = true;
+ $this->close();
+ }
+
+ parent::write($record);
+ }
+
+ /**
+ * Rotates the files.
+ */
+ protected function rotate()
+ {
+ // update filename
+ $this->url = $this->getTimedFilename();
+ $this->nextRotation = new \DateTime('tomorrow');
+
+ // skip GC of old logs if files are unlimited
+ if (0 === $this->maxFiles) {
+ return;
+ }
+
+ $logFiles = glob($this->getGlobPattern());
+ if ($this->maxFiles >= count($logFiles)) {
+ // no files to remove
+ return;
+ }
+
+ // Sorting the files by name to remove the older ones
+ usort($logFiles, function ($a, $b) {
+ return strcmp($b, $a);
+ });
+
+ foreach (array_slice($logFiles, $this->maxFiles) as $file) {
+ if (is_writable($file)) {
+ unlink($file);
+ }
+ }
+ }
+
+ protected function getTimedFilename()
+ {
+ $fileInfo = pathinfo($this->filename);
+ $timedFilename = str_replace(
+ array('{filename}', '{date}'),
+ array($fileInfo['filename'], date($this->dateFormat)),
+ $fileInfo['dirname'] . '/' . $this->filenameFormat
+ );
+
+ if (!empty($fileInfo['extension'])) {
+ $timedFilename .= '.'.$fileInfo['extension'];
+ }
+
+ return $timedFilename;
+ }
+
+ protected function getGlobPattern()
+ {
+ $fileInfo = pathinfo($this->filename);
+ $glob = str_replace(
+ array('{filename}', '{date}'),
+ array($fileInfo['filename'], '*'),
+ $fileInfo['dirname'] . '/' . $this->filenameFormat
+ );
+ if (!empty($fileInfo['extension'])) {
+ $glob .= '.'.$fileInfo['extension'];
+ }
+
+ return $glob;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php
new file mode 100644
index 00000000..487e26f6
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php
@@ -0,0 +1,83 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+
+/**
+ * Sampling handler
+ *
+ * A sampled event stream can be useful for logging high frequency events in
+ * a production environment where you only need an idea of what is happening
+ * and are not concerned with capturing every occurrence. Since the decision to
+ * handle or not handle a particular event is determined randomly, the
+ * resulting sampled log is not guaranteed to contain 1/N of the events that
+ * occurred in the application, but based on the Law of large numbers, it will
+ * tend to be close to this ratio with a large number of attempts.
+ *
+ * @author Bryan Davis <bd808@wikimedia.org>
+ * @author Kunal Mehta <legoktm@gmail.com>
+ */
+class SamplingHandler extends AbstractHandler
+{
+ /**
+ * @var callable|HandlerInterface $handler
+ */
+ protected $handler;
+
+ /**
+ * @var int $factor
+ */
+ protected $factor;
+
+ /**
+ * @param callable|HandlerInterface $handler Handler or factory callable($record, $fingersCrossedHandler).
+ * @param int $factor Sample factor
+ */
+ public function __construct($handler, $factor)
+ {
+ parent::__construct();
+ $this->handler = $handler;
+ $this->factor = $factor;
+
+ if (!$this->handler instanceof HandlerInterface && !is_callable($this->handler)) {
+ throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object");
+ }
+ }
+
+ public function isHandling(array $record)
+ {
+ return $this->handler->isHandling($record);
+ }
+
+ public function handle(array $record)
+ {
+ if ($this->isHandling($record) && mt_rand(1, $this->factor) === 1) {
+ // The same logic as in FingersCrossedHandler
+ if (!$this->handler instanceof HandlerInterface) {
+ $this->handler = call_user_func($this->handler, $record, $this);
+ if (!$this->handler instanceof HandlerInterface) {
+ throw new \RuntimeException("The factory callable should return a HandlerInterface");
+ }
+ }
+
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ $this->handler->handle($record);
+ }
+
+ return false === $this->bubble;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php
new file mode 100644
index 00000000..e3c8e11b
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php
@@ -0,0 +1,234 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Sends notifications through Slack API
+ *
+ * @author Greg Kedzierski <greg@gregkedzierski.com>
+ * @see https://api.slack.com/
+ */
+class SlackHandler extends SocketHandler
+{
+ /**
+ * Slack API token
+ * @var string
+ */
+ private $token;
+
+ /**
+ * Slack channel (encoded ID or name)
+ * @var string
+ */
+ private $channel;
+
+ /**
+ * Name of a bot
+ * @var string
+ */
+ private $username;
+
+ /**
+ * Emoji icon name
+ * @var string
+ */
+ private $iconEmoji;
+
+ /**
+ * Whether the message should be added to Slack as attachment (plain text otherwise)
+ * @var bool
+ */
+ private $useAttachment;
+
+ /**
+ * Whether the the message that is added to Slack as attachment is in a short style (or not)
+ * @var bool
+ */
+ private $useShortAttachment;
+
+ /**
+ * Whether the attachment should include extra data (or not)
+ * @var bool
+ */
+ private $includeExtra;
+
+ /**
+ * @var LineFormatter
+ */
+ private $lineFormatter;
+
+ /**
+ * @param string $token Slack API token
+ * @param string $channel Slack channel (encoded ID or name)
+ * @param string $username Name of a bot
+ * @param bool $useAttachment Whether the message should be added to Slack as attachment (plain text otherwise)
+ * @param string|null $iconEmoji The emoji name to use (or null)
+ * @param int $level The minimum logging level at which this handler will be triggered
+ * @param bool $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($token, $channel, $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $level = Logger::CRITICAL, $bubble = true, $useShortAttachment = false, $includeExtra = false)
+ {
+ if (!extension_loaded('openssl')) {
+ throw new MissingExtensionException('The OpenSSL PHP extension is required to use the SlackHandler');
+ }
+
+ parent::__construct('ssl://slack.com:443', $level, $bubble);
+
+ $this->token = $token;
+ $this->channel = $channel;
+ $this->username = $username;
+ $this->iconEmoji = trim($iconEmoji, ':');
+ $this->useAttachment = $useAttachment;
+ $this->useShortAttachment = $useShortAttachment;
+ $this->includeExtra = $includeExtra;
+ if ($this->includeExtra) {
+ $this->lineFormatter = new LineFormatter;
+ }
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ * @return string
+ */
+ protected function generateDataStream($record)
+ {
+ $content = $this->buildContent($record);
+
+ return $this->buildHeader($content) . $content;
+ }
+
+ /**
+ * Builds the body of API call
+ *
+ * @param array $record
+ * @return string
+ */
+ private function buildContent($record)
+ {
+ $dataArray = array(
+ 'token' => $this->token,
+ 'channel' => $this->channel,
+ 'username' => $this->username,
+ 'text' => '',
+ 'attachments' => array()
+ );
+
+ if ($this->useAttachment) {
+ $attachment = array(
+ 'fallback' => $record['message'],
+ 'color' => $this->getAttachmentColor($record['level'])
+ );
+
+ if ($this->useShortAttachment) {
+ $attachment['fields'] = array(
+ array(
+ 'title' => $record['level_name'],
+ 'value' => $record['message'],
+ 'short' => false
+ )
+ );
+ } else {
+ $attachment['fields'] = array(
+ array(
+ 'title' => 'Message',
+ 'value' => $record['message'],
+ 'short' => false
+ ),
+ array(
+ 'title' => 'Level',
+ 'value' => $record['level_name'],
+ 'short' => true
+ )
+ );
+ }
+
+ if ($this->includeExtra) {
+ $extra = '';
+ foreach ($record['extra'] as $var => $val) {
+ $extra .= $var.': '.$this->lineFormatter->stringify($val)." | ";
+ }
+
+ $extra = rtrim($extra, " |");
+
+ $attachment['fields'][] = array(
+ 'title' => "Extra",
+ 'value' => $extra,
+ 'short' => false
+ );
+ }
+
+ $dataArray['attachments'] = json_encode(array($attachment));
+ } else {
+ $dataArray['text'] = $record['message'];
+ }
+
+ if ($this->iconEmoji) {
+ $dataArray['icon_emoji'] = ":{$this->iconEmoji}:";
+ }
+
+ return http_build_query($dataArray);
+ }
+
+ /**
+ * Builds the header of the API Call
+ *
+ * @param string $content
+ * @return string
+ */
+ private function buildHeader($content)
+ {
+ $header = "POST /api/chat.postMessage HTTP/1.1\r\n";
+ $header .= "Host: slack.com\r\n";
+ $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+ $header .= "Content-Length: " . strlen($content) . "\r\n";
+ $header .= "\r\n";
+
+ return $header;
+ }
+
+ /**
+ * {@inheritdoc}
+ *
+ * @param array $record
+ */
+ protected function write(array $record)
+ {
+ parent::write($record);
+ $this->closeSocket();
+ }
+
+ /**
+ * Returned a Slack message attachment color associated with
+ * provided level.
+ *
+ * @param int $level
+ * @return string
+ */
+ protected function getAttachmentColor($level)
+ {
+ switch (true) {
+ case $level >= Logger::ERROR:
+ return 'danger';
+ case $level >= Logger::WARNING:
+ return 'warning';
+ case $level >= Logger::INFO:
+ return 'good';
+ default:
+ return '#e3e4e6';
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php
new file mode 100644
index 00000000..ee486f69
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php
@@ -0,0 +1,284 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores to any socket - uses fsockopen() or pfsockopen().
+ *
+ * @author Pablo de Leon Belloc <pablolb@gmail.com>
+ * @see http://php.net/manual/en/function.fsockopen.php
+ */
+class SocketHandler extends AbstractProcessingHandler
+{
+ private $connectionString;
+ private $connectionTimeout;
+ private $resource;
+ private $timeout = 0;
+ private $persistent = false;
+ private $errno;
+ private $errstr;
+
+ /**
+ * @param string $connectionString Socket connection string
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($connectionString, $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+ $this->connectionString = $connectionString;
+ $this->connectionTimeout = (float) ini_get('default_socket_timeout');
+ }
+
+ /**
+ * Connect (if necessary) and write to the socket
+ *
+ * @param array $record
+ *
+ * @throws \UnexpectedValueException
+ * @throws \RuntimeException
+ */
+ protected function write(array $record)
+ {
+ $this->connectIfNotConnected();
+ $data = $this->generateDataStream($record);
+ $this->writeToSocket($data);
+ }
+
+ /**
+ * We will not close a PersistentSocket instance so it can be reused in other requests.
+ */
+ public function close()
+ {
+ if (!$this->isPersistent()) {
+ $this->closeSocket();
+ }
+ }
+
+ /**
+ * Close socket, if open
+ */
+ public function closeSocket()
+ {
+ if (is_resource($this->resource)) {
+ fclose($this->resource);
+ $this->resource = null;
+ }
+ }
+
+ /**
+ * Set socket connection to nbe persistent. It only has effect before the connection is initiated.
+ *
+ * @param type $boolean
+ */
+ public function setPersistent($boolean)
+ {
+ $this->persistent = (boolean) $boolean;
+ }
+
+ /**
+ * Set connection timeout. Only has effect before we connect.
+ *
+ * @param float $seconds
+ *
+ * @see http://php.net/manual/en/function.fsockopen.php
+ */
+ public function setConnectionTimeout($seconds)
+ {
+ $this->validateTimeout($seconds);
+ $this->connectionTimeout = (float) $seconds;
+ }
+
+ /**
+ * Set write timeout. Only has effect before we connect.
+ *
+ * @param float $seconds
+ *
+ * @see http://php.net/manual/en/function.stream-set-timeout.php
+ */
+ public function setTimeout($seconds)
+ {
+ $this->validateTimeout($seconds);
+ $this->timeout = (float) $seconds;
+ }
+
+ /**
+ * Get current connection string
+ *
+ * @return string
+ */
+ public function getConnectionString()
+ {
+ return $this->connectionString;
+ }
+
+ /**
+ * Get persistent setting
+ *
+ * @return boolean
+ */
+ public function isPersistent()
+ {
+ return $this->persistent;
+ }
+
+ /**
+ * Get current connection timeout setting
+ *
+ * @return float
+ */
+ public function getConnectionTimeout()
+ {
+ return $this->connectionTimeout;
+ }
+
+ /**
+ * Get current in-transfer timeout
+ *
+ * @return float
+ */
+ public function getTimeout()
+ {
+ return $this->timeout;
+ }
+
+ /**
+ * Check to see if the socket is currently available.
+ *
+ * UDP might appear to be connected but might fail when writing. See http://php.net/fsockopen for details.
+ *
+ * @return boolean
+ */
+ public function isConnected()
+ {
+ return is_resource($this->resource)
+ && !feof($this->resource); // on TCP - other party can close connection.
+ }
+
+ /**
+ * Wrapper to allow mocking
+ */
+ protected function pfsockopen()
+ {
+ return @pfsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout);
+ }
+
+ /**
+ * Wrapper to allow mocking
+ */
+ protected function fsockopen()
+ {
+ return @fsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout);
+ }
+
+ /**
+ * Wrapper to allow mocking
+ *
+ * @see http://php.net/manual/en/function.stream-set-timeout.php
+ */
+ protected function streamSetTimeout()
+ {
+ $seconds = floor($this->timeout);
+ $microseconds = round(($this->timeout - $seconds)*1e6);
+
+ return stream_set_timeout($this->resource, $seconds, $microseconds);
+ }
+
+ /**
+ * Wrapper to allow mocking
+ */
+ protected function fwrite($data)
+ {
+ return @fwrite($this->resource, $data);
+ }
+
+ /**
+ * Wrapper to allow mocking
+ */
+ protected function streamGetMetadata()
+ {
+ return stream_get_meta_data($this->resource);
+ }
+
+ private function validateTimeout($value)
+ {
+ $ok = filter_var($value, FILTER_VALIDATE_FLOAT);
+ if ($ok === false || $value < 0) {
+ throw new \InvalidArgumentException("Timeout must be 0 or a positive float (got $value)");
+ }
+ }
+
+ private function connectIfNotConnected()
+ {
+ if ($this->isConnected()) {
+ return;
+ }
+ $this->connect();
+ }
+
+ protected function generateDataStream($record)
+ {
+ return (string) $record['formatted'];
+ }
+
+ private function connect()
+ {
+ $this->createSocketResource();
+ $this->setSocketTimeout();
+ }
+
+ private function createSocketResource()
+ {
+ if ($this->isPersistent()) {
+ $resource = $this->pfsockopen();
+ } else {
+ $resource = $this->fsockopen();
+ }
+ if (!$resource) {
+ throw new \UnexpectedValueException("Failed connecting to $this->connectionString ($this->errno: $this->errstr)");
+ }
+ $this->resource = $resource;
+ }
+
+ private function setSocketTimeout()
+ {
+ if (!$this->streamSetTimeout()) {
+ throw new \UnexpectedValueException("Failed setting timeout with stream_set_timeout()");
+ }
+ }
+
+ private function writeToSocket($data)
+ {
+ $length = strlen($data);
+ $sent = 0;
+ while ($this->isConnected() && $sent < $length) {
+ if (0 == $sent) {
+ $chunk = $this->fwrite($data);
+ } else {
+ $chunk = $this->fwrite(substr($data, $sent));
+ }
+ if ($chunk === false) {
+ throw new \RuntimeException("Could not write to socket");
+ }
+ $sent += $chunk;
+ $socketInfo = $this->streamGetMetadata();
+ if ($socketInfo['timed_out']) {
+ throw new \RuntimeException("Write timed-out");
+ }
+ }
+ if (!$this->isConnected() && $sent < $length) {
+ throw new \RuntimeException("End-of-file reached, probably we got disconnected (sent $sent of $length)");
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php
new file mode 100644
index 00000000..7965db74
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php
@@ -0,0 +1,104 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores to any stream resource
+ *
+ * Can be used to store into php://stderr, remote and local files, etc.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class StreamHandler extends AbstractProcessingHandler
+{
+ protected $stream;
+ protected $url;
+ private $errorMessage;
+ protected $filePermission;
+ protected $useLocking;
+
+ /**
+ * @param resource|string $stream
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param int|null $filePermission Optional file permissions (default (0644) are only for owner read/write)
+ * @param Boolean $useLocking Try to lock log file before doing any writes
+ *
+ * @throws \InvalidArgumentException If stream is not a resource or string
+ */
+ public function __construct($stream, $level = Logger::DEBUG, $bubble = true, $filePermission = null, $useLocking = false)
+ {
+ parent::__construct($level, $bubble);
+ if (is_resource($stream)) {
+ $this->stream = $stream;
+ } elseif (is_string($stream)) {
+ $this->url = $stream;
+ } else {
+ throw new \InvalidArgumentException('A stream must either be a resource or a string.');
+ }
+
+ $this->filePermission = $filePermission;
+ $this->useLocking = $useLocking;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ if (is_resource($this->stream)) {
+ fclose($this->stream);
+ }
+ $this->stream = null;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ if (!is_resource($this->stream)) {
+ if (!$this->url) {
+ throw new \LogicException('Missing stream url, the stream can not be opened. This may be caused by a premature call to close().');
+ }
+ $this->errorMessage = null;
+ set_error_handler(array($this, 'customErrorHandler'));
+ $this->stream = fopen($this->url, 'a');
+ if ($this->filePermission !== null) {
+ @chmod($this->url, $this->filePermission);
+ }
+ restore_error_handler();
+ if (!is_resource($this->stream)) {
+ $this->stream = null;
+ throw new \UnexpectedValueException(sprintf('The stream or file "%s" could not be opened: '.$this->errorMessage, $this->url));
+ }
+ }
+
+ if ($this->useLocking) {
+ // ignoring errors here, there's not much we can do about them
+ flock($this->stream, LOCK_EX);
+ }
+
+ fwrite($this->stream, (string) $record['formatted']);
+
+ if ($this->useLocking) {
+ flock($this->stream, LOCK_UN);
+ }
+ }
+
+ private function customErrorHandler($code, $msg)
+ {
+ $this->errorMessage = preg_replace('{^fopen\(.*?\): }', '', $msg);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php
new file mode 100644
index 00000000..af321db2
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php
@@ -0,0 +1,56 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * SwiftMailerHandler uses Swift_Mailer to send the emails
+ *
+ * @author Gyula Sallai
+ */
+class SwiftMailerHandler extends MailHandler
+{
+ protected $mailer;
+ protected $message;
+
+ /**
+ * @param \Swift_Mailer $mailer The mailer to use
+ * @param callable|\Swift_Message $message An example message for real messages, only the body will be replaced
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct(\Swift_Mailer $mailer, $message, $level = Logger::ERROR, $bubble = true)
+ {
+ parent::__construct($level, $bubble);
+ $this->mailer = $mailer;
+ if (!$message instanceof \Swift_Message && is_callable($message)) {
+ $message = call_user_func($message);
+ }
+ if (!$message instanceof \Swift_Message) {
+ throw new \InvalidArgumentException('You must provide either a Swift_Message instance or a callable returning it');
+ }
+ $this->message = $message;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function send($content, array $records)
+ {
+ $message = clone $this->message;
+ $message->setBody($content);
+ $message->setDate(time());
+
+ $this->mailer->send($message);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php
new file mode 100644
index 00000000..47c73e12
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php
@@ -0,0 +1,67 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Logs to syslog service.
+ *
+ * usage example:
+ *
+ * $log = new Logger('application');
+ * $syslog = new SyslogHandler('myfacility', 'local6');
+ * $formatter = new LineFormatter("%channel%.%level_name%: %message% %extra%");
+ * $syslog->setFormatter($formatter);
+ * $log->pushHandler($syslog);
+ *
+ * @author Sven Paulus <sven@karlsruhe.org>
+ */
+class SyslogHandler extends AbstractSyslogHandler
+{
+ protected $ident;
+ protected $logopts;
+
+ /**
+ * @param string $ident
+ * @param mixed $facility
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ * @param int $logopts Option flags for the openlog() call, defaults to LOG_PID
+ */
+ public function __construct($ident, $facility = LOG_USER, $level = Logger::DEBUG, $bubble = true, $logopts = LOG_PID)
+ {
+ parent::__construct($facility, $level, $bubble);
+
+ $this->ident = $ident;
+ $this->logopts = $logopts;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function close()
+ {
+ closelog();
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ if (!openlog($this->ident, $this->logopts, $this->facility)) {
+ throw new \LogicException('Can\'t open syslog for ident "'.$this->ident.'" and facility "'.$this->facility.'"');
+ }
+ syslog($this->logLevels[$record['level']], (string) $record['formatted']);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php
new file mode 100644
index 00000000..dcf3f1f9
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php
@@ -0,0 +1,46 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\SyslogUdp;
+
+class UdpSocket
+{
+ const DATAGRAM_MAX_LENGTH = 65023;
+
+ public function __construct($ip, $port = 514)
+ {
+ $this->ip = $ip;
+ $this->port = $port;
+ $this->socket = socket_create(AF_INET, SOCK_DGRAM, SOL_UDP);
+ }
+
+ public function write($line, $header = "")
+ {
+ $this->send($this->assembleMessage($line, $header));
+ }
+
+ public function close()
+ {
+ socket_close($this->socket);
+ }
+
+ protected function send($chunk)
+ {
+ socket_sendto($this->socket, $chunk, strlen($chunk), $flags = 0, $this->ip, $this->port);
+ }
+
+ protected function assembleMessage($line, $header)
+ {
+ $chunkSize = self::DATAGRAM_MAX_LENGTH - strlen($header);
+
+ return $header . substr($line, 0, $chunkSize);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php
new file mode 100644
index 00000000..aa047c07
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php
@@ -0,0 +1,80 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Handler\SyslogUdp\UdpSocket;
+
+/**
+ * A Handler for logging to a remote syslogd server.
+ *
+ * @author Jesper Skovgaard Nielsen <nulpunkt@gmail.com>
+ */
+class SyslogUdpHandler extends AbstractSyslogHandler
+{
+ /**
+ * @param string $host
+ * @param int $port
+ * @param mixed $facility
+ * @param integer $level The minimum logging level at which this handler will be triggered
+ * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+ */
+ public function __construct($host, $port = 514, $facility = LOG_USER, $level = Logger::DEBUG, $bubble = true)
+ {
+ parent::__construct($facility, $level, $bubble);
+
+ $this->socket = new UdpSocket($host, $port ?: 514);
+ }
+
+ protected function write(array $record)
+ {
+ $lines = $this->splitMessageIntoLines($record['formatted']);
+
+ $header = $this->makeCommonSyslogHeader($this->logLevels[$record['level']]);
+
+ foreach ($lines as $line) {
+ $this->socket->write($line, $header);
+ }
+ }
+
+ public function close()
+ {
+ $this->socket->close();
+ }
+
+ private function splitMessageIntoLines($message)
+ {
+ if (is_array($message)) {
+ $message = implode("\n", $message);
+ }
+
+ return preg_split('/$\R?^/m', $message);
+ }
+
+ /**
+ * Make common syslog header (see rfc5424)
+ */
+ protected function makeCommonSyslogHeader($severity)
+ {
+ $priority = $severity + $this->facility;
+
+ return "<$priority>1 ";
+ }
+
+ /**
+ * Inject your own socket, mainly used for testing
+ */
+ public function setSocket($socket)
+ {
+ $this->socket = $socket;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php
new file mode 100644
index 00000000..085d9e17
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php
@@ -0,0 +1,140 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Used for testing purposes.
+ *
+ * It records all records and gives you access to them for verification.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class TestHandler extends AbstractProcessingHandler
+{
+ protected $records = array();
+ protected $recordsByLevel = array();
+
+ public function getRecords()
+ {
+ return $this->records;
+ }
+
+ public function hasEmergency($record)
+ {
+ return $this->hasRecord($record, Logger::EMERGENCY);
+ }
+
+ public function hasAlert($record)
+ {
+ return $this->hasRecord($record, Logger::ALERT);
+ }
+
+ public function hasCritical($record)
+ {
+ return $this->hasRecord($record, Logger::CRITICAL);
+ }
+
+ public function hasError($record)
+ {
+ return $this->hasRecord($record, Logger::ERROR);
+ }
+
+ public function hasWarning($record)
+ {
+ return $this->hasRecord($record, Logger::WARNING);
+ }
+
+ public function hasNotice($record)
+ {
+ return $this->hasRecord($record, Logger::NOTICE);
+ }
+
+ public function hasInfo($record)
+ {
+ return $this->hasRecord($record, Logger::INFO);
+ }
+
+ public function hasDebug($record)
+ {
+ return $this->hasRecord($record, Logger::DEBUG);
+ }
+
+ public function hasEmergencyRecords()
+ {
+ return isset($this->recordsByLevel[Logger::EMERGENCY]);
+ }
+
+ public function hasAlertRecords()
+ {
+ return isset($this->recordsByLevel[Logger::ALERT]);
+ }
+
+ public function hasCriticalRecords()
+ {
+ return isset($this->recordsByLevel[Logger::CRITICAL]);
+ }
+
+ public function hasErrorRecords()
+ {
+ return isset($this->recordsByLevel[Logger::ERROR]);
+ }
+
+ public function hasWarningRecords()
+ {
+ return isset($this->recordsByLevel[Logger::WARNING]);
+ }
+
+ public function hasNoticeRecords()
+ {
+ return isset($this->recordsByLevel[Logger::NOTICE]);
+ }
+
+ public function hasInfoRecords()
+ {
+ return isset($this->recordsByLevel[Logger::INFO]);
+ }
+
+ public function hasDebugRecords()
+ {
+ return isset($this->recordsByLevel[Logger::DEBUG]);
+ }
+
+ protected function hasRecord($record, $level)
+ {
+ if (!isset($this->recordsByLevel[$level])) {
+ return false;
+ }
+
+ if (is_array($record)) {
+ $record = $record['message'];
+ }
+
+ foreach ($this->recordsByLevel[$level] as $rec) {
+ if ($rec['message'] === $record) {
+ return true;
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $this->recordsByLevel[$record['level']][] = $record;
+ $this->records[] = $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php
new file mode 100644
index 00000000..05a88173
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php
@@ -0,0 +1,57 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Forwards records to multiple handlers suppressing failures of each handler
+ * and continuing through to give every handler a chance to succeed.
+ *
+ * @author Craig D'Amelio <craig@damelio.ca>
+ */
+class WhatFailureGroupHandler extends GroupHandler
+{
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ if ($this->processors) {
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ }
+
+ foreach ($this->handlers as $handler) {
+ try {
+ $handler->handle($record);
+ } catch (\Exception $e) {
+ // What failure?
+ }
+ }
+
+ return false === $this->bubble;
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function handleBatch(array $records)
+ {
+ foreach ($this->handlers as $handler) {
+ try {
+ $handler->handleBatch($records);
+ } catch (\Exception $e) {
+ // What failure?
+ }
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php
new file mode 100644
index 00000000..f22cf218
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php
@@ -0,0 +1,95 @@
+<?php
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\NormalizerFormatter;
+use Monolog\Logger;
+
+/**
+ * Handler sending logs to Zend Monitor
+ *
+ * @author Christian Bergau <cbergau86@gmail.com>
+ */
+class ZendMonitorHandler extends AbstractProcessingHandler
+{
+ /**
+ * Monolog level / ZendMonitor Custom Event priority map
+ *
+ * @var array
+ */
+ protected $levelMap = array(
+ Logger::DEBUG => 1,
+ Logger::INFO => 2,
+ Logger::NOTICE => 3,
+ Logger::WARNING => 4,
+ Logger::ERROR => 5,
+ Logger::CRITICAL => 6,
+ Logger::ALERT => 7,
+ Logger::EMERGENCY => 0,
+ );
+
+ /**
+ * Construct
+ *
+ * @param int $level
+ * @param bool $bubble
+ * @throws MissingExtensionException
+ */
+ public function __construct($level = Logger::DEBUG, $bubble = true)
+ {
+ if (!function_exists('zend_monitor_custom_event')) {
+ throw new MissingExtensionException('You must have Zend Server installed in order to use this handler');
+ }
+ parent::__construct($level, $bubble);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ protected function write(array $record)
+ {
+ $this->writeZendMonitorCustomEvent(
+ $this->levelMap[$record['level']],
+ $record['message'],
+ $record['formatted']
+ );
+ }
+
+ /**
+ * Write a record to Zend Monitor
+ *
+ * @param int $level
+ * @param string $message
+ * @param array $formatted
+ */
+ protected function writeZendMonitorCustomEvent($level, $message, $formatted)
+ {
+ zend_monitor_custom_event($level, $message, $formatted);
+ }
+
+ /**
+ * {@inheritdoc}
+ */
+ public function getDefaultFormatter()
+ {
+ return new NormalizerFormatter();
+ }
+
+ /**
+ * Get the level map
+ *
+ * @return array
+ */
+ public function getLevelMap()
+ {
+ return $this->levelMap;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Logger.php b/vendor/monolog/monolog/src/Monolog/Logger.php
new file mode 100644
index 00000000..4a38de7f
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Logger.php
@@ -0,0 +1,615 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\HandlerInterface;
+use Monolog\Handler\StreamHandler;
+use Psr\Log\LoggerInterface;
+use Psr\Log\InvalidArgumentException;
+
+/**
+ * Monolog log channel
+ *
+ * It contains a stack of Handlers and a stack of Processors,
+ * and uses them to store records that are added to it.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class Logger implements LoggerInterface
+{
+ /**
+ * Detailed debug information
+ */
+ const DEBUG = 100;
+
+ /**
+ * Interesting events
+ *
+ * Examples: User logs in, SQL logs.
+ */
+ const INFO = 200;
+
+ /**
+ * Uncommon events
+ */
+ const NOTICE = 250;
+
+ /**
+ * Exceptional occurrences that are not errors
+ *
+ * Examples: Use of deprecated APIs, poor use of an API,
+ * undesirable things that are not necessarily wrong.
+ */
+ const WARNING = 300;
+
+ /**
+ * Runtime errors
+ */
+ const ERROR = 400;
+
+ /**
+ * Critical conditions
+ *
+ * Example: Application component unavailable, unexpected exception.
+ */
+ const CRITICAL = 500;
+
+ /**
+ * Action must be taken immediately
+ *
+ * Example: Entire website down, database unavailable, etc.
+ * This should trigger the SMS alerts and wake you up.
+ */
+ const ALERT = 550;
+
+ /**
+ * Urgent alert.
+ */
+ const EMERGENCY = 600;
+
+ /**
+ * Monolog API version
+ *
+ * This is only bumped when API breaks are done and should
+ * follow the major version of the library
+ *
+ * @var int
+ */
+ const API = 1;
+
+ /**
+ * Logging levels from syslog protocol defined in RFC 5424
+ *
+ * @var array $levels Logging levels
+ */
+ protected static $levels = array(
+ 100 => 'DEBUG',
+ 200 => 'INFO',
+ 250 => 'NOTICE',
+ 300 => 'WARNING',
+ 400 => 'ERROR',
+ 500 => 'CRITICAL',
+ 550 => 'ALERT',
+ 600 => 'EMERGENCY',
+ );
+
+ /**
+ * @var \DateTimeZone
+ */
+ protected static $timezone;
+
+ /**
+ * @var string
+ */
+ protected $name;
+
+ /**
+ * The handler stack
+ *
+ * @var HandlerInterface[]
+ */
+ protected $handlers;
+
+ /**
+ * Processors that will process all log records
+ *
+ * To process records of a single handler instead, add the processor on that specific handler
+ *
+ * @var callable[]
+ */
+ protected $processors;
+
+ /**
+ * @param string $name The logging channel
+ * @param HandlerInterface[] $handlers Optional stack of handlers, the first one in the array is called first, etc.
+ * @param callable[] $processors Optional array of processors
+ */
+ public function __construct($name, array $handlers = array(), array $processors = array())
+ {
+ $this->name = $name;
+ $this->handlers = $handlers;
+ $this->processors = $processors;
+ }
+
+ /**
+ * @return string
+ */
+ public function getName()
+ {
+ return $this->name;
+ }
+
+ /**
+ * Pushes a handler on to the stack.
+ *
+ * @param HandlerInterface $handler
+ */
+ public function pushHandler(HandlerInterface $handler)
+ {
+ array_unshift($this->handlers, $handler);
+ }
+
+ /**
+ * Pops a handler from the stack
+ *
+ * @return HandlerInterface
+ */
+ public function popHandler()
+ {
+ if (!$this->handlers) {
+ throw new \LogicException('You tried to pop from an empty handler stack.');
+ }
+
+ return array_shift($this->handlers);
+ }
+
+ /**
+ * @return HandlerInterface[]
+ */
+ public function getHandlers()
+ {
+ return $this->handlers;
+ }
+
+ /**
+ * Adds a processor on to the stack.
+ *
+ * @param callable $callback
+ */
+ public function pushProcessor($callback)
+ {
+ if (!is_callable($callback)) {
+ throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given');
+ }
+ array_unshift($this->processors, $callback);
+ }
+
+ /**
+ * Removes the processor on top of the stack and returns it.
+ *
+ * @return callable
+ */
+ public function popProcessor()
+ {
+ if (!$this->processors) {
+ throw new \LogicException('You tried to pop from an empty processor stack.');
+ }
+
+ return array_shift($this->processors);
+ }
+
+ /**
+ * @return callable[]
+ */
+ public function getProcessors()
+ {
+ return $this->processors;
+ }
+
+ /**
+ * Adds a log record.
+ *
+ * @param integer $level The logging level
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addRecord($level, $message, array $context = array())
+ {
+ if (!$this->handlers) {
+ $this->pushHandler(new StreamHandler('php://stderr', static::DEBUG));
+ }
+
+ $levelName = static::getLevelName($level);
+
+ // check if any handler will handle this message so we can return early and save cycles
+ $handlerKey = null;
+ foreach ($this->handlers as $key => $handler) {
+ if ($handler->isHandling(array('level' => $level))) {
+ $handlerKey = $key;
+ break;
+ }
+ }
+
+ if (null === $handlerKey) {
+ return false;
+ }
+
+ if (!static::$timezone) {
+ static::$timezone = new \DateTimeZone(date_default_timezone_get() ?: 'UTC');
+ }
+
+ $record = array(
+ 'message' => (string) $message,
+ 'context' => $context,
+ 'level' => $level,
+ 'level_name' => $levelName,
+ 'channel' => $this->name,
+ 'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true)), static::$timezone)->setTimezone(static::$timezone),
+ 'extra' => array(),
+ );
+
+ foreach ($this->processors as $processor) {
+ $record = call_user_func($processor, $record);
+ }
+ while (isset($this->handlers[$handlerKey]) &&
+ false === $this->handlers[$handlerKey]->handle($record)) {
+ $handlerKey++;
+ }
+
+ return true;
+ }
+
+ /**
+ * Adds a log record at the DEBUG level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addDebug($message, array $context = array())
+ {
+ return $this->addRecord(static::DEBUG, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the INFO level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addInfo($message, array $context = array())
+ {
+ return $this->addRecord(static::INFO, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the NOTICE level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addNotice($message, array $context = array())
+ {
+ return $this->addRecord(static::NOTICE, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the WARNING level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addWarning($message, array $context = array())
+ {
+ return $this->addRecord(static::WARNING, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the ERROR level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addError($message, array $context = array())
+ {
+ return $this->addRecord(static::ERROR, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the CRITICAL level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addCritical($message, array $context = array())
+ {
+ return $this->addRecord(static::CRITICAL, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the ALERT level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addAlert($message, array $context = array())
+ {
+ return $this->addRecord(static::ALERT, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the EMERGENCY level.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function addEmergency($message, array $context = array())
+ {
+ return $this->addRecord(static::EMERGENCY, $message, $context);
+ }
+
+ /**
+ * Gets all supported logging levels.
+ *
+ * @return array Assoc array with human-readable level names => level codes.
+ */
+ public static function getLevels()
+ {
+ return array_flip(static::$levels);
+ }
+
+ /**
+ * Gets the name of the logging level.
+ *
+ * @param integer $level
+ * @return string
+ */
+ public static function getLevelName($level)
+ {
+ if (!isset(static::$levels[$level])) {
+ throw new InvalidArgumentException('Level "'.$level.'" is not defined, use one of: '.implode(', ', array_keys(static::$levels)));
+ }
+
+ return static::$levels[$level];
+ }
+
+ /**
+ * Converts PSR-3 levels to Monolog ones if necessary
+ *
+ * @param string|int Level number (monolog) or name (PSR-3)
+ * @return int
+ */
+ public static function toMonologLevel($level)
+ {
+ if (is_string($level) && defined(__CLASS__.'::'.strtoupper($level))) {
+ return constant(__CLASS__.'::'.strtoupper($level));
+ }
+
+ return $level;
+ }
+
+ /**
+ * Checks whether the Logger has a handler that listens on the given level
+ *
+ * @param integer $level
+ * @return Boolean
+ */
+ public function isHandling($level)
+ {
+ $record = array(
+ 'level' => $level,
+ );
+
+ foreach ($this->handlers as $handler) {
+ if ($handler->isHandling($record)) {
+ return true;
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * Adds a log record at an arbitrary level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param mixed $level The log level
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function log($level, $message, array $context = array())
+ {
+ if (is_string($level) && defined(__CLASS__.'::'.strtoupper($level))) {
+ $level = constant(__CLASS__.'::'.strtoupper($level));
+ }
+
+ return $this->addRecord($level, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the DEBUG level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function debug($message, array $context = array())
+ {
+ return $this->addRecord(static::DEBUG, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the INFO level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function info($message, array $context = array())
+ {
+ return $this->addRecord(static::INFO, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the NOTICE level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function notice($message, array $context = array())
+ {
+ return $this->addRecord(static::NOTICE, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the WARNING level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function warn($message, array $context = array())
+ {
+ return $this->addRecord(static::WARNING, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the WARNING level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function warning($message, array $context = array())
+ {
+ return $this->addRecord(static::WARNING, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the ERROR level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function err($message, array $context = array())
+ {
+ return $this->addRecord(static::ERROR, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the ERROR level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function error($message, array $context = array())
+ {
+ return $this->addRecord(static::ERROR, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the CRITICAL level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function crit($message, array $context = array())
+ {
+ return $this->addRecord(static::CRITICAL, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the CRITICAL level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function critical($message, array $context = array())
+ {
+ return $this->addRecord(static::CRITICAL, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the ALERT level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function alert($message, array $context = array())
+ {
+ return $this->addRecord(static::ALERT, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the EMERGENCY level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function emerg($message, array $context = array())
+ {
+ return $this->addRecord(static::EMERGENCY, $message, $context);
+ }
+
+ /**
+ * Adds a log record at the EMERGENCY level.
+ *
+ * This method allows for compatibility with common interfaces.
+ *
+ * @param string $message The log message
+ * @param array $context The log context
+ * @return Boolean Whether the record has been processed
+ */
+ public function emergency($message, array $context = array())
+ {
+ return $this->addRecord(static::EMERGENCY, $message, $context);
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php
new file mode 100644
index 00000000..1899400d
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php
@@ -0,0 +1,64 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\Logger;
+
+/**
+ * Injects Git branch and Git commit SHA in all records
+ *
+ * @author Nick Otter
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class GitProcessor
+{
+ private $level;
+ private static $cache;
+
+ public function __construct($level = Logger::DEBUG)
+ {
+ $this->level = Logger::toMonologLevel($level);
+ }
+
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ // return if the level is not high enough
+ if ($record['level'] < $this->level) {
+ return $record;
+ }
+
+ $record['extra']['git'] = self::getGitInfo();
+
+ return $record;
+ }
+
+ private static function getGitInfo()
+ {
+ if (self::$cache) {
+ return self::$cache;
+ }
+
+ $branches = `git branch -v --no-abbrev`;
+ if (preg_match('{^\* (.+?)\s+([a-f0-9]{40})(?:\s|$)}m', $branches, $matches)) {
+ return self::$cache = array(
+ 'branch' => $matches[1],
+ 'commit' => $matches[2],
+ );
+ }
+
+ return self::$cache = array();
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php
new file mode 100644
index 00000000..294a295c
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php
@@ -0,0 +1,82 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\Logger;
+
+/**
+ * Injects line/file:class/function where the log message came from
+ *
+ * Warning: This only works if the handler processes the logs directly.
+ * If you put the processor on a handler that is behind a FingersCrossedHandler
+ * for example, the processor will only be called once the trigger level is reached,
+ * and all the log records will have the same file/line/.. data from the call that
+ * triggered the FingersCrossedHandler.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class IntrospectionProcessor
+{
+ private $level;
+
+ private $skipClassesPartials;
+
+ public function __construct($level = Logger::DEBUG, array $skipClassesPartials = array('Monolog\\'))
+ {
+ $this->level = Logger::toMonologLevel($level);
+ $this->skipClassesPartials = $skipClassesPartials;
+ }
+
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ // return if the level is not high enough
+ if ($record['level'] < $this->level) {
+ return $record;
+ }
+
+ $trace = debug_backtrace();
+
+ // skip first since it's always the current method
+ array_shift($trace);
+ // the call_user_func call is also skipped
+ array_shift($trace);
+
+ $i = 0;
+
+ while (isset($trace[$i]['class'])) {
+ foreach ($this->skipClassesPartials as $part) {
+ if (strpos($trace[$i]['class'], $part) !== false) {
+ $i++;
+ continue 2;
+ }
+ }
+ break;
+ }
+
+ // we should have the call source now
+ $record['extra'] = array_merge(
+ $record['extra'],
+ array(
+ 'file' => isset($trace[$i-1]['file']) ? $trace[$i-1]['file'] : null,
+ 'line' => isset($trace[$i-1]['line']) ? $trace[$i-1]['line'] : null,
+ 'class' => isset($trace[$i]['class']) ? $trace[$i]['class'] : null,
+ 'function' => isset($trace[$i]['function']) ? $trace[$i]['function'] : null,
+ )
+ );
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php
new file mode 100644
index 00000000..552fd709
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php
@@ -0,0 +1,40 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects memory_get_peak_usage in all records
+ *
+ * @see Monolog\Processor\MemoryProcessor::__construct() for options
+ * @author Rob Jensen
+ */
+class MemoryPeakUsageProcessor extends MemoryProcessor
+{
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ $bytes = memory_get_peak_usage($this->realUsage);
+ $formatted = $this->formatBytes($bytes);
+
+ $record['extra'] = array_merge(
+ $record['extra'],
+ array(
+ 'memory_peak_usage' => $formatted,
+ )
+ );
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php
new file mode 100644
index 00000000..0820def4
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php
@@ -0,0 +1,63 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Some methods that are common for all memory processors
+ *
+ * @author Rob Jensen
+ */
+abstract class MemoryProcessor
+{
+ /**
+ * @var boolean If true, get the real size of memory allocated from system. Else, only the memory used by emalloc() is reported.
+ */
+ protected $realUsage;
+
+ /**
+ * @var boolean If true, then format memory size to human readable string (MB, KB, B depending on size)
+ */
+ protected $useFormatting;
+
+ /**
+ * @param boolean $realUsage Set this to true to get the real size of memory allocated from system.
+ * @param boolean $useFormatting If true, then format memory size to human readable string (MB, KB, B depending on size)
+ */
+ public function __construct($realUsage = true, $useFormatting = true)
+ {
+ $this->realUsage = (boolean) $realUsage;
+ $this->useFormatting = (boolean) $useFormatting;
+ }
+
+ /**
+ * Formats bytes into a human readable string if $this->useFormatting is true, otherwise return $bytes as is
+ *
+ * @param int $bytes
+ * @return string|int Formatted string if $this->useFormatting is true, otherwise return $bytes as is
+ */
+ protected function formatBytes($bytes)
+ {
+ $bytes = (int) $bytes;
+
+ if (!$this->useFormatting) {
+ return $bytes;
+ }
+
+ if ($bytes > 1024*1024) {
+ return round($bytes/1024/1024, 2).' MB';
+ } elseif ($bytes > 1024) {
+ return round($bytes/1024, 2).' KB';
+ }
+
+ return $bytes . ' B';
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php
new file mode 100644
index 00000000..0c4dd9ab
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php
@@ -0,0 +1,40 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects memory_get_usage in all records
+ *
+ * @see Monolog\Processor\MemoryProcessor::__construct() for options
+ * @author Rob Jensen
+ */
+class MemoryUsageProcessor extends MemoryProcessor
+{
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ $bytes = memory_get_usage($this->realUsage);
+ $formatted = $this->formatBytes($bytes);
+
+ $record['extra'] = array_merge(
+ $record['extra'],
+ array(
+ 'memory_usage' => $formatted,
+ )
+ );
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php
new file mode 100644
index 00000000..9d3f5590
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php
@@ -0,0 +1,31 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Adds value of getmypid into records
+ *
+ * @author Andreas Hörnicke
+ */
+class ProcessIdProcessor
+{
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ $record['extra']['process_id'] = getmypid();
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php
new file mode 100644
index 00000000..c2686ce5
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php
@@ -0,0 +1,48 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Processes a record's message according to PSR-3 rules
+ *
+ * It replaces {foo} with the value from $context['foo']
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class PsrLogMessageProcessor
+{
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ if (false === strpos($record['message'], '{')) {
+ return $record;
+ }
+
+ $replacements = array();
+ foreach ($record['context'] as $key => $val) {
+ if (is_null($val) || is_scalar($val) || (is_object($val) && method_exists($val, "__toString"))) {
+ $replacements['{'.$key.'}'] = $val;
+ } elseif (is_object($val)) {
+ $replacements['{'.$key.'}'] = '[object '.get_class($val).']';
+ } else {
+ $replacements['{'.$key.'}'] = '['.gettype($val).']';
+ }
+ }
+
+ $record['message'] = strtr($record['message'], $replacements);
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php
new file mode 100644
index 00000000..2784cef4
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php
@@ -0,0 +1,34 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Adds a tags array into record
+ *
+ * @author Martijn Riemers
+ */
+class TagProcessor
+{
+ private $tags;
+
+ public function __construct(array $tags = array())
+ {
+ $this->tags = $tags;
+ }
+
+ public function __invoke(array $record)
+ {
+ $record['extra']['tags'] = $this->tags;
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php
new file mode 100644
index 00000000..80270d08
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php
@@ -0,0 +1,38 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Adds a unique identifier into records
+ *
+ * @author Simon Mönch <sm@webfactory.de>
+ */
+class UidProcessor
+{
+ private $uid;
+
+ public function __construct($length = 7)
+ {
+ if (!is_int($length) || $length > 32 || $length < 1) {
+ throw new \InvalidArgumentException('The uid length must be an integer between 1 and 32');
+ }
+
+ $this->uid = substr(hash('md5', uniqid('', true)), 0, $length);
+ }
+
+ public function __invoke(array $record)
+ {
+ $record['extra']['uid'] = $this->uid;
+
+ return $record;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php
new file mode 100644
index 00000000..21f22a6e
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php
@@ -0,0 +1,105 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects url/method and remote IP of the current web request in all records
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class WebProcessor
+{
+ /**
+ * @var array|\ArrayAccess
+ */
+ protected $serverData;
+
+ /**
+ * @var array
+ */
+ protected $extraFields = array(
+ 'url' => 'REQUEST_URI',
+ 'ip' => 'REMOTE_ADDR',
+ 'http_method' => 'REQUEST_METHOD',
+ 'server' => 'SERVER_NAME',
+ 'referrer' => 'HTTP_REFERER',
+ );
+
+ /**
+ * @param array|\ArrayAccess $serverData Array or object w/ ArrayAccess that provides access to the $_SERVER data
+ * @param array|null $extraFields Extra field names to be added (all available by default)
+ */
+ public function __construct($serverData = null, array $extraFields = null)
+ {
+ if (null === $serverData) {
+ $this->serverData = &$_SERVER;
+ } elseif (is_array($serverData) || $serverData instanceof \ArrayAccess) {
+ $this->serverData = $serverData;
+ } else {
+ throw new \UnexpectedValueException('$serverData must be an array or object implementing ArrayAccess.');
+ }
+
+ if (null !== $extraFields) {
+ foreach (array_keys($this->extraFields) as $fieldName) {
+ if (!in_array($fieldName, $extraFields)) {
+ unset($this->extraFields[$fieldName]);
+ }
+ }
+ }
+ }
+
+ /**
+ * @param array $record
+ * @return array
+ */
+ public function __invoke(array $record)
+ {
+ // skip processing if for some reason request data
+ // is not present (CLI or wonky SAPIs)
+ if (!isset($this->serverData['REQUEST_URI'])) {
+ return $record;
+ }
+
+ $record['extra'] = $this->appendExtraFields($record['extra']);
+
+ return $record;
+ }
+
+ /**
+ * @param string $extraName
+ * @param string $serverName
+ * @return $this
+ */
+ public function addExtraField($extraName, $serverName)
+ {
+ $this->extraFields[$extraName] = $serverName;
+
+ return $this;
+ }
+
+ /**
+ * @param array $extra
+ * @return array
+ */
+ private function appendExtraFields(array $extra)
+ {
+ foreach ($this->extraFields as $extraName => $serverName) {
+ $extra[$extraName] = isset($this->serverData[$serverName]) ? $this->serverData[$serverName] : null;
+ }
+
+ if (isset($this->serverData['UNIQUE_ID'])) {
+ $extra['unique_id'] = $this->serverData['UNIQUE_ID'];
+ }
+
+ return $extra;
+ }
+}
diff --git a/vendor/monolog/monolog/src/Monolog/Registry.php b/vendor/monolog/monolog/src/Monolog/Registry.php
new file mode 100644
index 00000000..a3eba079
--- /dev/null
+++ b/vendor/monolog/monolog/src/Monolog/Registry.php
@@ -0,0 +1,118 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use InvalidArgumentException;
+
+/**
+ * Monolog log registry
+ *
+ * Allows to get `Logger` instances in the global scope
+ * via static method calls on this class.
+ *
+ * <code>
+ * $application = new Monolog\Logger('application');
+ * $api = new Monolog\Logger('api');
+ *
+ * Monolog\Registry::addLogger($application);
+ * Monolog\Registry::addLogger($api);
+ *
+ * function testLogger()
+ * {
+ * Monolog\Registry::api()->addError('Sent to $api Logger instance');
+ * Monolog\Registry::application()->addError('Sent to $application Logger instance');
+ * }
+ * </code>
+ *
+ * @author Tomas Tatarko <tomas@tatarko.sk>
+ */
+class Registry
+{
+ /**
+ * List of all loggers in the registry (ba named indexes)
+ *
+ * @var Logger[]
+ */
+ private static $loggers = array();
+
+ /**
+ * Adds new logging channel to the registry
+ *
+ * @param Logger $logger Instance of the logging channel
+ * @param string|null $name Name of the logging channel ($logger->getName() by default)
+ * @param boolean $overwrite Overwrite instance in the registry if the given name already exists?
+ * @throws \InvalidArgumentException If $overwrite set to false and named Logger instance already exists
+ */
+ public static function addLogger(Logger $logger, $name = null, $overwrite = false)
+ {
+ $name = $name ?: $logger->getName();
+
+ if (isset(self::$loggers[$name]) && !$overwrite) {
+ throw new InvalidArgumentException('Logger with the given name already exists');
+ }
+
+ self::$loggers[$name] = $logger;
+ }
+
+ /**
+ * Removes instance from registry by name or instance
+ *
+ * @param string|Logger $logger Name or logger instance
+ */
+ public static function removeLogger($logger)
+ {
+ if ($logger instanceof Logger) {
+ if (false !== ($idx = array_search($logger, self::$loggers, true))) {
+ unset(self::$loggers[$idx]);
+ }
+ } else {
+ unset(self::$loggers[$logger]);
+ }
+ }
+
+ /**
+ * Clears the registry
+ */
+ public static function clear()
+ {
+ self::$loggers = array();
+ }
+
+ /**
+ * Gets Logger instance from the registry
+ *
+ * @param string $name Name of the requested Logger instance
+ * @return Logger Requested instance of Logger
+ * @throws \InvalidArgumentException If named Logger instance is not in the registry
+ */
+ public static function getInstance($name)
+ {
+ if (!isset(self::$loggers[$name])) {
+ throw new InvalidArgumentException(sprintf('Requested "%s" logger instance is not in the registry', $name));
+ }
+
+ return self::$loggers[$name];
+ }
+
+ /**
+ * Gets Logger instance from the registry via static method call
+ *
+ * @param string $name Name of the requested Logger instance
+ * @param array $arguments Arguments passed to static method call
+ * @return Logger Requested instance of Logger
+ * @throws \InvalidArgumentException If named Logger instance is not in the registry
+ */
+ public static function __callStatic($name, $arguments)
+ {
+ return self::getInstance($name);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php
new file mode 100644
index 00000000..a9a3f301
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php
@@ -0,0 +1,31 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\TestHandler;
+
+class ErrorHandlerTest extends \PHPUnit_Framework_TestCase
+{
+ public function testHandleError()
+ {
+ $logger = new Logger('test', array($handler = new TestHandler));
+ $errHandler = new ErrorHandler($logger);
+
+ $errHandler->registerErrorHandler(array(E_USER_NOTICE => Logger::EMERGENCY), false);
+ trigger_error('Foo', E_USER_ERROR);
+ $this->assertCount(1, $handler->getRecords());
+ $this->assertTrue($handler->hasErrorRecords());
+ trigger_error('Foo', E_USER_NOTICE);
+ $this->assertCount(2, $handler->getRecords());
+ $this->assertTrue($handler->hasEmergencyRecords());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php
new file mode 100644
index 00000000..e7f7334e
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php
@@ -0,0 +1,158 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class ChromePHPFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @covers Monolog\Formatter\ChromePHPFormatter::format
+ */
+ public function testDefaultFormat()
+ {
+ $formatter = new ChromePHPFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('ip' => '127.0.0.1'),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'meh',
+ array(
+ 'message' => 'log',
+ 'context' => array('from' => 'logger'),
+ 'extra' => array('ip' => '127.0.0.1'),
+ ),
+ 'unknown',
+ 'error'
+ ),
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\ChromePHPFormatter::format
+ */
+ public function testFormatWithFileAndLine()
+ {
+ $formatter = new ChromePHPFormatter();
+ $record = array(
+ 'level' => Logger::CRITICAL,
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'meh',
+ array(
+ 'message' => 'log',
+ 'context' => array('from' => 'logger'),
+ 'extra' => array('ip' => '127.0.0.1'),
+ ),
+ 'test : 14',
+ 'error'
+ ),
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\ChromePHPFormatter::format
+ */
+ public function testFormatWithoutContext()
+ {
+ $formatter = new ChromePHPFormatter();
+ $record = array(
+ 'level' => Logger::DEBUG,
+ 'level_name' => 'DEBUG',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'meh',
+ 'log',
+ 'unknown',
+ 'log'
+ ),
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\ChromePHPFormatter::formatBatch
+ */
+ public function testBatchFormatThrowException()
+ {
+ $formatter = new ChromePHPFormatter();
+ $records = array(
+ array(
+ 'level' => Logger::INFO,
+ 'level_name' => 'INFO',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ ),
+ array(
+ 'level' => Logger::WARNING,
+ 'level_name' => 'WARNING',
+ 'channel' => 'foo',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log2',
+ ),
+ );
+
+ $this->assertEquals(
+ array(
+ array(
+ 'meh',
+ 'log',
+ 'unknown',
+ 'info'
+ ),
+ array(
+ 'foo',
+ 'log2',
+ 'unknown',
+ 'warn'
+ ),
+ ),
+ $formatter->formatBatch($records)
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php
new file mode 100644
index 00000000..546e5c26
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php
@@ -0,0 +1,79 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class ElasticaFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists("Elastica\Document")) {
+ $this->markTestSkipped("ruflin/elastica not installed");
+ }
+ }
+
+ /**
+ * @covers Monolog\Formatter\ElasticaFormatter::__construct
+ * @covers Monolog\Formatter\ElasticaFormatter::format
+ * @covers Monolog\Formatter\ElasticaFormatter::getDocument
+ */
+ public function testFormat()
+ {
+ // test log message
+ $msg = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ // expected values
+ $expected = $msg;
+ $expected['datetime'] = '1970-01-01T00:00:00+0000';
+ $expected['context'] = array(
+ 'class' => '[object] (stdClass: {})',
+ 'foo' => 7,
+ 0 => 'bar',
+ );
+
+ // format log message
+ $formatter = new ElasticaFormatter('my_index', 'doc_type');
+ $doc = $formatter->format($msg);
+ $this->assertInstanceOf('Elastica\Document', $doc);
+
+ // Document parameters
+ $params = $doc->getParams();
+ $this->assertEquals('my_index', $params['_index']);
+ $this->assertEquals('doc_type', $params['_type']);
+
+ // Document data values
+ $data = $doc->getData();
+ foreach (array_keys($expected) as $key) {
+ $this->assertEquals($expected[$key], $data[$key]);
+ }
+ }
+
+ /**
+ * @covers Monolog\Formatter\ElasticaFormatter::getIndex
+ * @covers Monolog\Formatter\ElasticaFormatter::getType
+ */
+ public function testGetters()
+ {
+ $formatter = new ElasticaFormatter('my_index', 'doc_type');
+ $this->assertEquals('my_index', $formatter->getIndex());
+ $this->assertEquals('doc_type', $formatter->getType());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php
new file mode 100644
index 00000000..1b2fd97a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php
@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class FlowdockFormatterTest extends TestCase
+{
+ /**
+ * @covers Monolog\Formatter\FlowdockFormatter::format
+ */
+ public function testFormat()
+ {
+ $formatter = new FlowdockFormatter('test_source', 'source@test.com');
+ $record = $this->getRecord();
+
+ $expected = array(
+ 'source' => 'test_source',
+ 'from_address' => 'source@test.com',
+ 'subject' => 'in test_source: WARNING - test',
+ 'content' => 'test',
+ 'tags' => array('#logs', '#warning', '#test'),
+ 'project' => 'test_source',
+ );
+ $formatted = $formatter->format($record);
+
+ $this->assertEquals($expected, $formatted['flowdock']);
+ }
+
+ /**
+ * @ covers Monolog\Formatter\FlowdockFormatter::formatBatch
+ */
+ public function testFormatBatch()
+ {
+ $formatter = new FlowdockFormatter('test_source', 'source@test.com');
+ $records = array(
+ $this->getRecord(Logger::WARNING),
+ $this->getRecord(Logger::DEBUG),
+ );
+ $formatted = $formatter->formatBatch($records);
+
+ $this->assertArrayHasKey('flowdock', $formatted[0]);
+ $this->assertArrayHasKey('flowdock', $formatted[1]);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php
new file mode 100644
index 00000000..3f47a09a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php
@@ -0,0 +1,189 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class GelfMessageFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('\Gelf\Message')) {
+ $this->markTestSkipped("graylog2/gelf-php or mlehner/gelf-php is not installed");
+ }
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testDefaultFormatter()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+ $this->assertEquals(0, $message->getTimestamp());
+ $this->assertEquals('log', $message->getShortMessage());
+ $this->assertEquals('meh', $message->getFacility());
+ $this->assertEquals(null, $message->getLine());
+ $this->assertEquals(null, $message->getFile());
+ $this->assertEquals($this->isLegacy() ? 3 : 'error', $message->getLevel());
+ $this->assertNotEmpty($message->getHost());
+
+ $formatter = new GelfMessageFormatter('mysystem');
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+ $this->assertEquals('mysystem', $message->getHost());
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testFormatWithFileAndLine()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+ $this->assertEquals('test', $message->getFile());
+ $this->assertEquals(14, $message->getLine());
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testFormatWithContext()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $message_array = $message->toArray();
+
+ $this->assertArrayHasKey('_ctxt_from', $message_array);
+ $this->assertEquals('logger', $message_array['_ctxt_from']);
+
+ // Test with extraPrefix
+ $formatter = new GelfMessageFormatter(null, null, 'CTX');
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $message_array = $message->toArray();
+
+ $this->assertArrayHasKey('_CTXfrom', $message_array);
+ $this->assertEquals('logger', $message_array['_CTXfrom']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testFormatWithContextContainingException()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger', 'exception' => array(
+ 'class' => '\Exception',
+ 'file' => '/some/file/in/dir.php:56',
+ 'trace' => array('/some/file/1.php:23', '/some/file/2.php:3')
+ )),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log'
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $this->assertEquals("/some/file/in/dir.php", $message->getFile());
+ $this->assertEquals("56", $message->getLine());
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testFormatWithExtra()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $message_array = $message->toArray();
+
+ $this->assertArrayHasKey('_key', $message_array);
+ $this->assertEquals('pair', $message_array['_key']);
+
+ // Test with extraPrefix
+ $formatter = new GelfMessageFormatter(null, 'EXT');
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $message_array = $message->toArray();
+
+ $this->assertArrayHasKey('_EXTkey', $message_array);
+ $this->assertEquals('pair', $message_array['_EXTkey']);
+ }
+
+ private function isLegacy()
+ {
+ return interface_exists('\Gelf\IMessagePublisher');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php
new file mode 100644
index 00000000..69e20077
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php
@@ -0,0 +1,78 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class JsonFormatterTest extends TestCase
+{
+ /**
+ * @covers Monolog\Formatter\JsonFormatter::__construct
+ * @covers Monolog\Formatter\JsonFormatter::getBatchMode
+ * @covers Monolog\Formatter\JsonFormatter::isAppendingNewlines
+ */
+ public function testConstruct()
+ {
+ $formatter = new JsonFormatter();
+ $this->assertEquals(JsonFormatter::BATCH_MODE_JSON, $formatter->getBatchMode());
+ $this->assertEquals(true, $formatter->isAppendingNewlines());
+ $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES, false);
+ $this->assertEquals(JsonFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode());
+ $this->assertEquals(false, $formatter->isAppendingNewlines());
+ }
+
+ /**
+ * @covers Monolog\Formatter\JsonFormatter::format
+ */
+ public function testFormat()
+ {
+ $formatter = new JsonFormatter();
+ $record = $this->getRecord();
+ $this->assertEquals(json_encode($record)."\n", $formatter->format($record));
+
+ $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false);
+ $record = $this->getRecord();
+ $this->assertEquals(json_encode($record), $formatter->format($record));
+ }
+
+ /**
+ * @covers Monolog\Formatter\JsonFormatter::formatBatch
+ * @covers Monolog\Formatter\JsonFormatter::formatBatchJson
+ */
+ public function testFormatBatch()
+ {
+ $formatter = new JsonFormatter();
+ $records = array(
+ $this->getRecord(Logger::WARNING),
+ $this->getRecord(Logger::DEBUG),
+ );
+ $this->assertEquals(json_encode($records), $formatter->formatBatch($records));
+ }
+
+ /**
+ * @covers Monolog\Formatter\JsonFormatter::formatBatch
+ * @covers Monolog\Formatter\JsonFormatter::formatBatchNewlines
+ */
+ public function testFormatBatchNewlines()
+ {
+ $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES);
+ $records = $expected = array(
+ $this->getRecord(Logger::WARNING),
+ $this->getRecord(Logger::DEBUG),
+ );
+ array_walk($expected, function (&$value, $key) {
+ $value = json_encode($value);
+ });
+ $this->assertEquals(implode("\n", $expected), $formatter->formatBatch($records));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php
new file mode 100644
index 00000000..89e1ca2e
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php
@@ -0,0 +1,208 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\LineFormatter
+ */
+class LineFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function testDefFormatWithString()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'WARNING',
+ 'channel' => 'log',
+ 'context' => array(),
+ 'message' => 'foo',
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
+ }
+
+ public function testDefFormatWithArrayContext()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'message' => 'foo',
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ 'context' => array(
+ 'foo' => 'bar',
+ 'baz' => 'qux',
+ 'bool' => false,
+ 'null' => null,
+ )
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foo {"foo":"bar","baz":"qux","bool":false,"null":null} []'."\n", $message);
+ }
+
+ public function testDefFormatExtras()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array('ip' => '127.0.0.1'),
+ 'message' => 'log',
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] {"ip":"127.0.0.1"}'."\n", $message);
+ }
+
+ public function testFormatExtras()
+ {
+ $formatter = new LineFormatter("[%datetime%] %channel%.%level_name%: %message% %context% %extra.file% %extra%\n", 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array('ip' => '127.0.0.1', 'file' => 'test'),
+ 'message' => 'log',
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] test {"ip":"127.0.0.1"}'."\n", $message);
+ }
+
+ public function testContextAndExtraOptionallyNotShownIfEmpty()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d', false, true);
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ 'message' => 'log',
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log '."\n", $message);
+ }
+
+ public function testDefFormatWithObject()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array('foo' => new TestFoo, 'bar' => new TestBar, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+ 'message' => 'foobar',
+ ));
+
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foobar [] {"foo":"[object] (Monolog\\\\Formatter\\\\TestFoo: {\\"foo\\":\\"foo\\"})","bar":"[object] (Monolog\\\\Formatter\\\\TestBar: {})","baz":[],"res":"[resource]"}'."\n", $message);
+ }
+
+ public function testDefFormatWithException()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'core',
+ 'context' => array('exception' => new \RuntimeException('Foo')),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ 'message' => 'foobar',
+ ));
+
+ $path = str_replace('\\/', '/', json_encode(__FILE__));
+
+ $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__-8).')"} []'."\n", $message);
+ }
+
+ public function testDefFormatWithPreviousException()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $previous = new \LogicException('Wut?');
+ $message = $formatter->format(array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'core',
+ 'context' => array('exception' => new \RuntimeException('Foo', 0, $previous)),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ 'message' => 'foobar',
+ ));
+
+ $path = str_replace('\\/', '/', json_encode(__FILE__));
+
+ $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__-8).', LogicException(code: 0): Wut? at '.substr($path, 1, -1).':'.(__LINE__-12).')"} []'."\n", $message);
+ }
+
+ public function testBatchFormat()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->formatBatch(array(
+ array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'test',
+ 'message' => 'bar',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ),
+ array(
+ 'level_name' => 'WARNING',
+ 'channel' => 'log',
+ 'message' => 'foo',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ),
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] test.CRITICAL: bar [] []'."\n".'['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
+ }
+
+ public function testFormatShouldStripInlineLineBreaks()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(
+ array(
+ 'message' => "foo\nbar",
+ 'context' => array(),
+ 'extra' => array(),
+ )
+ );
+
+ $this->assertRegExp('/foo bar/', $message);
+ }
+
+ public function testFormatShouldNotStripInlineLineBreaksWhenFlagIsSet()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d', true);
+ $message = $formatter->format(
+ array(
+ 'message' => "foo\nbar",
+ 'context' => array(),
+ 'extra' => array(),
+ )
+ );
+
+ $this->assertRegExp('/foo\nbar/', $message);
+ }
+}
+
+class TestFoo
+{
+ public $foo = 'foo';
+}
+
+class TestBar
+{
+ public function __toString()
+ {
+ return 'bar';
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php
new file mode 100644
index 00000000..6d59b3f3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php
@@ -0,0 +1,40 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\TestCase;
+
+class LogglyFormatterTest extends TestCase
+{
+ /**
+ * @covers Monolog\Formatter\LogglyFormatter::__construct
+ */
+ public function testConstruct()
+ {
+ $formatter = new LogglyFormatter();
+ $this->assertEquals(LogglyFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode());
+ $formatter = new LogglyFormatter(LogglyFormatter::BATCH_MODE_JSON);
+ $this->assertEquals(LogglyFormatter::BATCH_MODE_JSON, $formatter->getBatchMode());
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogglyFormatter::format
+ */
+ public function testFormat()
+ {
+ $formatter = new LogglyFormatter();
+ $record = $this->getRecord();
+ $formatted_decoded = json_decode($formatter->format($record), true);
+ $this->assertArrayHasKey("timestamp", $formatted_decoded);
+ $this->assertEquals(new \DateTime($formatted_decoded["timestamp"]), $record["datetime"]);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php
new file mode 100644
index 00000000..de4a3c2c
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php
@@ -0,0 +1,289 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class LogstashFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testDefaultFormatter()
+ {
+ $formatter = new LogstashFormatter('test', 'hostname');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
+ $this->assertEquals('log', $message['@message']);
+ $this->assertEquals('meh', $message['@fields']['channel']);
+ $this->assertContains('meh', $message['@tags']);
+ $this->assertEquals(Logger::ERROR, $message['@fields']['level']);
+ $this->assertEquals('test', $message['@type']);
+ $this->assertEquals('hostname', $message['@source']);
+
+ $formatter = new LogstashFormatter('mysystem');
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals('mysystem', $message['@type']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithFileAndLine()
+ {
+ $formatter = new LogstashFormatter('test');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals('test', $message['@fields']['file']);
+ $this->assertEquals(14, $message['@fields']['line']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithContext()
+ {
+ $formatter = new LogstashFormatter('test');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $message_array = $message['@fields'];
+
+ $this->assertArrayHasKey('ctxt_from', $message_array);
+ $this->assertEquals('logger', $message_array['ctxt_from']);
+
+ // Test with extraPrefix
+ $formatter = new LogstashFormatter('test', null, null, 'CTX');
+ $message = json_decode($formatter->format($record), true);
+
+ $message_array = $message['@fields'];
+
+ $this->assertArrayHasKey('CTXfrom', $message_array);
+ $this->assertEquals('logger', $message_array['CTXfrom']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithExtra()
+ {
+ $formatter = new LogstashFormatter('test');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $message_array = $message['@fields'];
+
+ $this->assertArrayHasKey('key', $message_array);
+ $this->assertEquals('pair', $message_array['key']);
+
+ // Test with extraPrefix
+ $formatter = new LogstashFormatter('test', null, 'EXT');
+ $message = json_decode($formatter->format($record), true);
+
+ $message_array = $message['@fields'];
+
+ $this->assertArrayHasKey('EXTkey', $message_array);
+ $this->assertEquals('pair', $message_array['EXTkey']);
+ }
+
+ public function testFormatWithApplicationName()
+ {
+ $formatter = new LogstashFormatter('app', 'test');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('@type', $message);
+ $this->assertEquals('app', $message['@type']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testDefaultFormatterV1()
+ {
+ $formatter = new LogstashFormatter('test', 'hostname', null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
+ $this->assertEquals("1", $message['@version']);
+ $this->assertEquals('log', $message['message']);
+ $this->assertEquals('meh', $message['channel']);
+ $this->assertEquals('ERROR', $message['level']);
+ $this->assertEquals('test', $message['type']);
+ $this->assertEquals('hostname', $message['host']);
+
+ $formatter = new LogstashFormatter('mysystem', null, null, 'ctxt_', LogstashFormatter::V1);
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals('mysystem', $message['type']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithFileAndLineV1()
+ {
+ $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals('test', $message['file']);
+ $this->assertEquals(14, $message['line']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithContextV1()
+ {
+ $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('ctxt_from', $message);
+ $this->assertEquals('logger', $message['ctxt_from']);
+
+ // Test with extraPrefix
+ $formatter = new LogstashFormatter('test', null, null, 'CTX', LogstashFormatter::V1);
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('CTXfrom', $message);
+ $this->assertEquals('logger', $message['CTXfrom']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithExtraV1()
+ {
+ $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('key', $message);
+ $this->assertEquals('pair', $message['key']);
+
+ // Test with extraPrefix
+ $formatter = new LogstashFormatter('test', null, 'EXT', 'ctxt_', LogstashFormatter::V1);
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('EXTkey', $message);
+ $this->assertEquals('pair', $message['EXTkey']);
+ }
+
+ public function testFormatWithApplicationNameV1()
+ {
+ $formatter = new LogstashFormatter('app', 'test', null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('type', $message);
+ $this->assertEquals('app', $message['type']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php
new file mode 100644
index 00000000..1554ef46
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php
@@ -0,0 +1,253 @@
+<?php
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * @author Florian Plattner <me@florianplattner.de>
+ */
+class MongoDBFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('MongoDate')) {
+ $this->markTestSkipped('mongo extension not installed');
+ }
+ }
+
+ public function constructArgumentProvider()
+ {
+ return array(
+ array(1, true, 1, true),
+ array(0, false, 0, false),
+ );
+ }
+
+ /**
+ * @param $traceDepth
+ * @param $traceAsString
+ * @param $expectedTraceDepth
+ * @param $expectedTraceAsString
+ *
+ * @dataProvider constructArgumentProvider
+ */
+ public function testConstruct($traceDepth, $traceAsString, $expectedTraceDepth, $expectedTraceAsString)
+ {
+ $formatter = new MongoDBFormatter($traceDepth, $traceAsString);
+
+ $reflTrace = new \ReflectionProperty($formatter, 'exceptionTraceAsString');
+ $reflTrace->setAccessible(true);
+ $this->assertEquals($expectedTraceAsString, $reflTrace->getValue($formatter));
+
+ $reflDepth = new\ReflectionProperty($formatter, 'maxNestingLevel');
+ $reflDepth->setAccessible(true);
+ $this->assertEquals($expectedTraceDepth, $reflDepth->getValue($formatter));
+ }
+
+ public function testSimpleFormat()
+ {
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter();
+ $formattedRecord = $formatter->format($record);
+
+ $this->assertCount(7, $formattedRecord);
+ $this->assertEquals('some log message', $formattedRecord['message']);
+ $this->assertEquals(array(), $formattedRecord['context']);
+ $this->assertEquals(Logger::WARNING, $formattedRecord['level']);
+ $this->assertEquals(Logger::getLevelName(Logger::WARNING), $formattedRecord['level_name']);
+ $this->assertEquals('test', $formattedRecord['channel']);
+ $this->assertInstanceOf('\MongoDate', $formattedRecord['datetime']);
+ $this->assertEquals('0.00000000 1391212800', $formattedRecord['datetime']->__toString());
+ $this->assertEquals(array(), $formattedRecord['extra']);
+ }
+
+ public function testRecursiveFormat()
+ {
+ $someObject = new \stdClass();
+ $someObject->foo = 'something';
+ $someObject->bar = 'stuff';
+
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'stuff' => new \DateTime('2014-02-01 02:31:33'),
+ 'some_object' => $someObject,
+ 'context_string' => 'some string',
+ 'context_int' => 123456,
+ 'except' => new \Exception('exception message', 987),
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter();
+ $formattedRecord = $formatter->format($record);
+
+ $this->assertCount(5, $formattedRecord['context']);
+ $this->assertInstanceOf('\MongoDate', $formattedRecord['context']['stuff']);
+ $this->assertEquals('0.00000000 1391221893', $formattedRecord['context']['stuff']->__toString());
+ $this->assertEquals(
+ array(
+ 'foo' => 'something',
+ 'bar' => 'stuff',
+ 'class' => 'stdClass',
+ ),
+ $formattedRecord['context']['some_object']
+ );
+ $this->assertEquals('some string', $formattedRecord['context']['context_string']);
+ $this->assertEquals(123456, $formattedRecord['context']['context_int']);
+
+ $this->assertCount(5, $formattedRecord['context']['except']);
+ $this->assertEquals('exception message', $formattedRecord['context']['except']['message']);
+ $this->assertEquals(987, $formattedRecord['context']['except']['code']);
+ $this->assertInternalType('string', $formattedRecord['context']['except']['file']);
+ $this->assertInternalType('integer', $formattedRecord['context']['except']['code']);
+ $this->assertInternalType('string', $formattedRecord['context']['except']['trace']);
+ $this->assertEquals('Exception', $formattedRecord['context']['except']['class']);
+ }
+
+ public function testFormatDepthArray()
+ {
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'nest2' => array(
+ 'property' => 'anything',
+ 'nest3' => array(
+ 'nest4' => 'value',
+ 'property' => 'nothing'
+ )
+ )
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter(2);
+ $formattedResult = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'nest2' => array(
+ 'property' => 'anything',
+ 'nest3' => '[...]',
+ )
+ ),
+ $formattedResult['context']
+ );
+ }
+
+ public function testFormatDepthArrayInfiniteNesting()
+ {
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'nest2' => array(
+ 'property' => 'something',
+ 'nest3' => array(
+ 'property' => 'anything',
+ 'nest4' => array(
+ 'property' => 'nothing',
+ ),
+ )
+ )
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter(0);
+ $formattedResult = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'nest2' => array(
+ 'property' => 'something',
+ 'nest3' => array(
+ 'property' => 'anything',
+ 'nest4' => array(
+ 'property' => 'nothing',
+ )
+ ),
+ )
+ ),
+ $formattedResult['context']
+ );
+ }
+
+ public function testFormatDepthObjects()
+ {
+ $someObject = new \stdClass();
+ $someObject->property = 'anything';
+ $someObject->nest3 = new \stdClass();
+ $someObject->nest3->property = 'nothing';
+ $someObject->nest3->nest4 = 'invisible';
+
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'nest2' => $someObject
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter(2, true);
+ $formattedResult = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'nest2' => array(
+ 'property' => 'anything',
+ 'nest3' => '[...]',
+ 'class' => 'stdClass',
+ ),
+ ),
+ $formattedResult['context']
+ );
+ }
+
+ public function testFormatDepthException()
+ {
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'nest2' => new \Exception('exception message', 987),
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter(2, false);
+ $formattedRecord = $formatter->format($record);
+
+ $this->assertEquals('exception message', $formattedRecord['context']['nest2']['message']);
+ $this->assertEquals(987, $formattedRecord['context']['nest2']['code']);
+ $this->assertEquals('[...]', $formattedRecord['context']['nest2']['trace']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php
new file mode 100644
index 00000000..00bbb249
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php
@@ -0,0 +1,247 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\NormalizerFormatter
+ */
+class NormalizerFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function testFormat()
+ {
+ $formatter = new NormalizerFormatter('Y-m-d');
+ $formatted = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'message' => 'foo',
+ 'datetime' => new \DateTime,
+ 'extra' => array('foo' => new TestFooNorm, 'bar' => new TestBarNorm, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+ 'context' => array(
+ 'foo' => 'bar',
+ 'baz' => 'qux',
+ ),
+ ));
+
+ $this->assertEquals(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'message' => 'foo',
+ 'datetime' => date('Y-m-d'),
+ 'extra' => array(
+ 'foo' => '[object] (Monolog\\Formatter\\TestFooNorm: {"foo":"foo"})',
+ 'bar' => '[object] (Monolog\\Formatter\\TestBarNorm: {})',
+ 'baz' => array(),
+ 'res' => '[resource]',
+ ),
+ 'context' => array(
+ 'foo' => 'bar',
+ 'baz' => 'qux',
+ )
+ ), $formatted);
+ }
+
+ public function testFormatExceptions()
+ {
+ $formatter = new NormalizerFormatter('Y-m-d');
+ $e = new \LogicException('bar');
+ $e2 = new \RuntimeException('foo', 0, $e);
+ $formatted = $formatter->format(array(
+ 'exception' => $e2,
+ ));
+
+ $this->assertGreaterThan(5, count($formatted['exception']['trace']));
+ $this->assertTrue(isset($formatted['exception']['previous']));
+ unset($formatted['exception']['trace'], $formatted['exception']['previous']);
+
+ $this->assertEquals(array(
+ 'exception' => array(
+ 'class' => get_class($e2),
+ 'message' => $e2->getMessage(),
+ 'code' => $e2->getCode(),
+ 'file' => $e2->getFile().':'.$e2->getLine(),
+ )
+ ), $formatted);
+ }
+
+ public function testBatchFormat()
+ {
+ $formatter = new NormalizerFormatter('Y-m-d');
+ $formatted = $formatter->formatBatch(array(
+ array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'test',
+ 'message' => 'bar',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ),
+ array(
+ 'level_name' => 'WARNING',
+ 'channel' => 'log',
+ 'message' => 'foo',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ),
+ ));
+ $this->assertEquals(array(
+ array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'test',
+ 'message' => 'bar',
+ 'context' => array(),
+ 'datetime' => date('Y-m-d'),
+ 'extra' => array(),
+ ),
+ array(
+ 'level_name' => 'WARNING',
+ 'channel' => 'log',
+ 'message' => 'foo',
+ 'context' => array(),
+ 'datetime' => date('Y-m-d'),
+ 'extra' => array(),
+ ),
+ ), $formatted);
+ }
+
+ /**
+ * Test issue #137
+ */
+ public function testIgnoresRecursiveObjectReferences()
+ {
+ // set up the recursion
+ $foo = new \stdClass();
+ $bar = new \stdClass();
+
+ $foo->bar = $bar;
+ $bar->foo = $foo;
+
+ // set an error handler to assert that the error is not raised anymore
+ $that = $this;
+ set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
+ if (error_reporting() & $level) {
+ restore_error_handler();
+ $that->fail("$message should not be raised");
+ }
+ });
+
+ $formatter = new NormalizerFormatter();
+ $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+ $reflMethod->setAccessible(true);
+ $res = $reflMethod->invoke($formatter, array($foo, $bar), true);
+
+ restore_error_handler();
+
+ $this->assertEquals(@json_encode(array($foo, $bar)), $res);
+ }
+
+ public function testIgnoresInvalidTypes()
+ {
+ // set up the recursion
+ $resource = fopen(__FILE__, 'r');
+
+ // set an error handler to assert that the error is not raised anymore
+ $that = $this;
+ set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
+ if (error_reporting() & $level) {
+ restore_error_handler();
+ $that->fail("$message should not be raised");
+ }
+ });
+
+ $formatter = new NormalizerFormatter();
+ $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+ $reflMethod->setAccessible(true);
+ $res = $reflMethod->invoke($formatter, array($resource), true);
+
+ restore_error_handler();
+
+ $this->assertEquals(@json_encode(array($resource)), $res);
+ }
+
+ public function testExceptionTraceWithArgs()
+ {
+ if (defined('HHVM_VERSION')) {
+ $this->markTestSkipped('Not supported in HHVM since it detects errors differently');
+ }
+
+ // This happens i.e. in React promises or Guzzle streams where stream wrappers are registered
+ // and no file or line are included in the trace because it's treated as internal function
+ set_error_handler(function ($errno, $errstr, $errfile, $errline) {
+ throw new \ErrorException($errstr, 0, $errno, $errfile, $errline);
+ });
+
+ try {
+ // This will contain $resource and $wrappedResource as arguments in the trace item
+ $resource = fopen('php://memory', 'rw+');
+ fwrite($resource, 'test_resource');
+ $wrappedResource = new TestStreamFoo($resource);
+ // Just do something stupid with a resource/wrapped resource as argument
+ array_keys($wrappedResource);
+ } catch (\Exception $e) {
+ restore_error_handler();
+ }
+
+ $formatter = new NormalizerFormatter();
+ $record = array('context' => array('exception' => $e));
+ $result = $formatter->format($record);
+
+ $this->assertRegExp(
+ '%"resource":"\[resource\]"%',
+ $result['context']['exception']['trace'][0]
+ );
+
+ if (version_compare(PHP_VERSION, '5.5.0', '>=')) {
+ $pattern = '%"wrappedResource":"\[object\] \(Monolog\\\\\\\\Formatter\\\\\\\\TestStreamFoo: \)"%';
+ } else {
+ $pattern = '%\\\\"resource\\\\":null%';
+ }
+
+ // Tests that the wrapped resource is ignored while encoding, only works for PHP <= 5.4
+ $this->assertRegExp(
+ $pattern,
+ $result['context']['exception']['trace'][0]
+ );
+ }
+}
+
+class TestFooNorm
+{
+ public $foo = 'foo';
+}
+
+class TestBarNorm
+{
+ public function __toString()
+ {
+ return 'bar';
+ }
+}
+
+class TestStreamFoo
+{
+ public $foo;
+ public $resource;
+
+ public function __construct($resource)
+ {
+ $this->resource = $resource;
+ $this->foo = 'BAR';
+ }
+
+ public function __toString()
+ {
+ fseek($this->resource, 0);
+
+ return $this->foo . ' - ' . (string) stream_get_contents($this->resource);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php
new file mode 100644
index 00000000..c5a4ebb5
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php
@@ -0,0 +1,98 @@
+<?php
+namespace Monolog\Formatter;
+
+class ScalarFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function setUp()
+ {
+ $this->formatter = new ScalarFormatter();
+ }
+
+ public function buildTrace(\Exception $e)
+ {
+ $data = array();
+ $trace = $e->getTrace();
+ foreach ($trace as $frame) {
+ if (isset($frame['file'])) {
+ $data[] = $frame['file'].':'.$frame['line'];
+ } else {
+ $data[] = json_encode($frame);
+ }
+ }
+
+ return $data;
+ }
+
+ public function encodeJson($data)
+ {
+ if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+ return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+ }
+
+ return json_encode($data);
+ }
+
+ public function testFormat()
+ {
+ $exception = new \Exception('foo');
+ $formatted = $this->formatter->format(array(
+ 'foo' => 'string',
+ 'bar' => 1,
+ 'baz' => false,
+ 'bam' => array(1, 2, 3),
+ 'bat' => array('foo' => 'bar'),
+ 'bap' => \DateTime::createFromFormat(\DateTime::ISO8601, '1970-01-01T00:00:00+0000'),
+ 'ban' => $exception
+ ));
+
+ $this->assertSame(array(
+ 'foo' => 'string',
+ 'bar' => 1,
+ 'baz' => false,
+ 'bam' => $this->encodeJson(array(1, 2, 3)),
+ 'bat' => $this->encodeJson(array('foo' => 'bar')),
+ 'bap' => '1970-01-01 00:00:00',
+ 'ban' => $this->encodeJson(array(
+ 'class' => get_class($exception),
+ 'message' => $exception->getMessage(),
+ 'code' => $exception->getCode(),
+ 'file' => $exception->getFile() . ':' . $exception->getLine(),
+ 'trace' => $this->buildTrace($exception)
+ ))
+ ), $formatted);
+ }
+
+ public function testFormatWithErrorContext()
+ {
+ $context = array('file' => 'foo', 'line' => 1);
+ $formatted = $this->formatter->format(array(
+ 'context' => $context
+ ));
+
+ $this->assertSame(array(
+ 'context' => $this->encodeJson($context)
+ ), $formatted);
+ }
+
+ public function testFormatWithExceptionContext()
+ {
+ $exception = new \Exception('foo');
+ $formatted = $this->formatter->format(array(
+ 'context' => array(
+ 'exception' => $exception
+ )
+ ));
+
+ $this->assertSame(array(
+ 'context' => $this->encodeJson(array(
+ 'exception' => array(
+ 'class' => get_class($exception),
+ 'message' => $exception->getMessage(),
+ 'code' => $exception->getCode(),
+ 'file' => $exception->getFile() . ':' . $exception->getLine(),
+ 'trace' => $this->buildTrace($exception)
+ )
+ ))
+ ), $formatted);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php
new file mode 100644
index 00000000..52f15a36
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php
@@ -0,0 +1,142 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class WildfireFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::format
+ */
+ public function testDefaultFormat()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('ip' => '127.0.0.1'),
+ 'message' => 'log',
+ );
+
+ $message = $wildfire->format($record);
+
+ $this->assertEquals(
+ '125|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},'
+ .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::format
+ */
+ public function testFormatWithFileAndLine()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = $wildfire->format($record);
+
+ $this->assertEquals(
+ '129|[{"Type":"ERROR","File":"test","Line":14,"Label":"meh"},'
+ .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::format
+ */
+ public function testFormatWithoutContext()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = $wildfire->format($record);
+
+ $this->assertEquals(
+ '58|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},"log"]|',
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::formatBatch
+ * @expectedException BadMethodCallException
+ */
+ public function testBatchFormatThrowException()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $wildfire->formatBatch(array($record));
+ }
+
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::format
+ */
+ public function testTableFormat()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'table-channel',
+ 'context' => array(
+ WildfireFormatter::TABLE => array(
+ array('col1', 'col2', 'col3'),
+ array('val1', 'val2', 'val3'),
+ array('foo1', 'foo2', 'foo3'),
+ array('bar1', 'bar2', 'bar3'),
+ ),
+ ),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'table-message',
+ );
+
+ $message = $wildfire->format($record);
+
+ $this->assertEquals(
+ '171|[{"Type":"TABLE","File":"","Line":"","Label":"table-channel: table-message"},[["col1","col2","col3"],["val1","val2","val3"],["foo1","foo2","foo3"],["bar1","bar2","bar3"]]]|',
+ $message
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Functional/Handler/FirePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Functional/Handler/FirePHPHandlerTest.php
new file mode 100644
index 00000000..7e4e7eb5
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Functional/Handler/FirePHPHandlerTest.php
@@ -0,0 +1,32 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+spl_autoload_register(function ($class) {
+ $file = __DIR__.'/../../../../src/'.strtr($class, '\\', '/').'.php';
+ if (file_exists($file)) {
+ require $file;
+
+ return true;
+ }
+});
+
+use Monolog\Logger;
+use Monolog\Handler\FirePHPHandler;
+use Monolog\Handler\ChromePHPHandler;
+
+$logger = new Logger('firephp');
+$logger->pushHandler(new FirePHPHandler);
+$logger->pushHandler(new ChromePHPHandler());
+
+$logger->addDebug('Debug');
+$logger->addInfo('Info');
+$logger->addWarning('Warning');
+$logger->addError('Error');
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php
new file mode 100644
index 00000000..568eb9da
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php
@@ -0,0 +1,115 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Processor\WebProcessor;
+
+class AbstractHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\AbstractHandler::__construct
+ * @covers Monolog\Handler\AbstractHandler::getLevel
+ * @covers Monolog\Handler\AbstractHandler::setLevel
+ * @covers Monolog\Handler\AbstractHandler::getBubble
+ * @covers Monolog\Handler\AbstractHandler::setBubble
+ * @covers Monolog\Handler\AbstractHandler::getFormatter
+ * @covers Monolog\Handler\AbstractHandler::setFormatter
+ */
+ public function testConstructAndGetSet()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+ $this->assertEquals(Logger::WARNING, $handler->getLevel());
+ $this->assertEquals(false, $handler->getBubble());
+
+ $handler->setLevel(Logger::ERROR);
+ $handler->setBubble(true);
+ $handler->setFormatter($formatter = new LineFormatter);
+ $this->assertEquals(Logger::ERROR, $handler->getLevel());
+ $this->assertEquals(true, $handler->getBubble());
+ $this->assertSame($formatter, $handler->getFormatter());
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::handleBatch
+ */
+ public function testHandleBatch()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+ $handler->expects($this->exactly(2))
+ ->method('handle');
+ $handler->handleBatch(array($this->getRecord(), $this->getRecord()));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::isHandling
+ */
+ public function testIsHandling()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+ $this->assertTrue($handler->isHandling($this->getRecord()));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::__construct
+ */
+ public function testHandlesPsrStyleLevels()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array('warning', false));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ $handler->setLevel('debug');
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::getFormatter
+ * @covers Monolog\Handler\AbstractHandler::getDefaultFormatter
+ */
+ public function testGetFormatterInitializesDefault()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+ $this->assertInstanceOf('Monolog\Formatter\LineFormatter', $handler->getFormatter());
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::pushProcessor
+ * @covers Monolog\Handler\AbstractHandler::popProcessor
+ * @expectedException LogicException
+ */
+ public function testPushPopProcessor()
+ {
+ $logger = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+ $processor1 = new WebProcessor;
+ $processor2 = new WebProcessor;
+
+ $logger->pushProcessor($processor1);
+ $logger->pushProcessor($processor2);
+
+ $this->assertEquals($processor2, $logger->popProcessor());
+ $this->assertEquals($processor1, $logger->popProcessor());
+ $logger->popProcessor();
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::pushProcessor
+ * @expectedException InvalidArgumentException
+ */
+ public function testPushProcessorWithNonCallable()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+
+ $handler->pushProcessor(new \stdClass());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php
new file mode 100644
index 00000000..24d4f63c
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php
@@ -0,0 +1,80 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Processor\WebProcessor;
+
+class AbstractProcessingHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::handle
+ */
+ public function testHandleLowerLevelMessage()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, true));
+ $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::handle
+ */
+ public function testHandleBubbling()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, true));
+ $this->assertFalse($handler->handle($this->getRecord()));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::handle
+ */
+ public function testHandleNotBubbling()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, false));
+ $this->assertTrue($handler->handle($this->getRecord()));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::handle
+ */
+ public function testHandleIsFalseWhenNotHandled()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, false));
+ $this->assertTrue($handler->handle($this->getRecord()));
+ $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::processRecord
+ */
+ public function testProcessRecord()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler');
+ $handler->pushProcessor(new WebProcessor(array(
+ 'REQUEST_URI' => '',
+ 'REQUEST_METHOD' => '',
+ 'REMOTE_ADDR' => '',
+ 'SERVER_NAME' => '',
+ 'UNIQUE_ID' => '',
+ )));
+ $handledRecord = null;
+ $handler->expects($this->once())
+ ->method('write')
+ ->will($this->returnCallback(function ($record) use (&$handledRecord) {
+ $handledRecord = $record;
+ }))
+ ;
+ $handler->handle($this->getRecord());
+ $this->assertEquals(6, count($handledRecord['extra']));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php
new file mode 100644
index 00000000..074d50c6
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php
@@ -0,0 +1,137 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use PhpAmqpLib\Message\AMQPMessage;
+use PhpAmqpLib\Channel\AMQPChannel;
+use PhpAmqpLib\Connection\AMQPConnection;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class AmqpHandlerTest extends TestCase
+{
+ public function testHandleAmqpExt()
+ {
+ if (!class_exists('AMQPConnection') || !class_exists('AMQPExchange')) {
+ $this->markTestSkipped("amqp-php not installed");
+ }
+
+ if (!class_exists('AMQPChannel')) {
+ $this->markTestSkipped("Please update AMQP to version >= 1.0");
+ }
+
+ $messages = array();
+
+ $exchange = $this->getMock('AMQPExchange', array('publish', 'setName'), array(), '', false);
+ $exchange->expects($this->once())
+ ->method('setName')
+ ->with('log')
+ ;
+ $exchange->expects($this->any())
+ ->method('publish')
+ ->will($this->returnCallback(function ($message, $routing_key, $flags = 0, $attributes = array()) use (&$messages) {
+ $messages[] = array($message, $routing_key, $flags, $attributes);
+ }))
+ ;
+
+ $handler = new AmqpHandler($exchange, 'log');
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $expected = array(
+ array(
+ 'message' => 'test',
+ 'context' => array(
+ 'data' => array(),
+ 'foo' => 34,
+ ),
+ 'level' => 300,
+ 'level_name' => 'WARNING',
+ 'channel' => 'test',
+ 'extra' => array(),
+ ),
+ 'warn.test',
+ 0,
+ array(
+ 'delivery_mode' => 2,
+ 'Content-type' => 'application/json'
+ )
+ );
+
+ $handler->handle($record);
+
+ $this->assertCount(1, $messages);
+ $messages[0][0] = json_decode($messages[0][0], true);
+ unset($messages[0][0]['datetime']);
+ $this->assertEquals($expected, $messages[0]);
+ }
+
+ public function testHandlePhpAmqpLib()
+ {
+ if (!class_exists('PhpAmqpLib\Connection\AMQPConnection')) {
+ $this->markTestSkipped("php-amqplib not installed");
+ }
+
+ $messages = array();
+
+ $exchange = $this->getMock('PhpAmqpLib\Channel\AMQPChannel', array('basic_publish', '__destruct'), array(), '', false);
+
+ $exchange->expects($this->any())
+ ->method('basic_publish')
+ ->will($this->returnCallback(function (AMQPMessage $msg, $exchange = "", $routing_key = "", $mandatory = false, $immediate = false, $ticket = null) use (&$messages) {
+ $messages[] = array($msg, $exchange, $routing_key, $mandatory, $immediate, $ticket);
+ }))
+ ;
+
+ $handler = new AmqpHandler($exchange, 'log');
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $expected = array(
+ array(
+ 'message' => 'test',
+ 'context' => array(
+ 'data' => array(),
+ 'foo' => 34,
+ ),
+ 'level' => 300,
+ 'level_name' => 'WARNING',
+ 'channel' => 'test',
+ 'extra' => array(),
+ ),
+ 'log',
+ 'warn.test',
+ false,
+ false,
+ null,
+ array(
+ 'delivery_mode' => 2,
+ 'content_type' => 'application/json'
+ )
+ );
+
+ $handler->handle($record);
+
+ $this->assertCount(1, $messages);
+
+ /* @var $msg AMQPMessage */
+ $msg = $messages[0][0];
+ $messages[0][0] = json_decode($msg->body, true);
+ $messages[0][] = $msg->get_properties();
+ unset($messages[0][0]['datetime']);
+
+ $this->assertEquals($expected, $messages[0]);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php
new file mode 100644
index 00000000..ffb1d746
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php
@@ -0,0 +1,130 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\BrowserConsoleHandlerTest
+ */
+class BrowserConsoleHandlerTest extends TestCase
+{
+ protected function setUp()
+ {
+ BrowserConsoleHandler::reset();
+ }
+
+ protected function generateScript()
+ {
+ $reflMethod = new \ReflectionMethod('Monolog\Handler\BrowserConsoleHandler', 'generateScript');
+ $reflMethod->setAccessible(true);
+
+ return $reflMethod->invoke(null);
+ }
+
+ public function testStyling()
+ {
+ $handler = new BrowserConsoleHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+
+ $handler->handle($this->getRecord(Logger::DEBUG, 'foo[[bar]]{color: red}'));
+
+ $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%cfoo%cbar%c", "font-weight: normal", "color: red", "font-weight: normal");
+}})(console);
+EOF;
+
+ $this->assertEquals($expected, $this->generateScript());
+ }
+
+ public function testEscaping()
+ {
+ $handler = new BrowserConsoleHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+
+ $handler->handle($this->getRecord(Logger::DEBUG, "[foo] [[\"bar\n[baz]\"]]{color: red}"));
+
+ $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%c[foo] %c\"bar\\n[baz]\"%c", "font-weight: normal", "color: red", "font-weight: normal");
+}})(console);
+EOF;
+
+ $this->assertEquals($expected, $this->generateScript());
+ }
+
+ public function testAutolabel()
+ {
+ $handler = new BrowserConsoleHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+
+ $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}'));
+ $handler->han