summaryrefslogtreecommitdiff
path: root/vendor/monolog/monolog/tests
diff options
context:
space:
mode:
authorPierre Schmitz <pierre@archlinux.de>2015-12-17 09:15:42 +0100
committerPierre Schmitz <pierre@archlinux.de>2015-12-17 09:44:51 +0100
commita1789ddde42033f1b05cc4929491214ee6e79383 (patch)
tree63615735c4ddffaaabf2428946bb26f90899f7bf /vendor/monolog/monolog/tests
parent9e06a62f265e3a2aaabecc598d4bc617e06fa32d (diff)
Update to MediaWiki 1.26.0
Diffstat (limited to 'vendor/monolog/monolog/tests')
-rw-r--r--vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php31
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php158
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php79
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php55
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php204
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php78
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php208
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php40
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php289
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php253
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php254
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php98
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php142
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php115
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php80
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php136
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php130
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php158
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php141
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php31
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php52
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php73
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php239
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php66
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php170
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php255
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php96
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php85
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php88
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php95
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php117
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php25
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php89
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php240
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php84
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php75
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php27
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php65
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php61
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php192
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php33
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php271
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php50
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php141
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php185
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php71
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php99
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php33
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php133
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php282
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php118
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php65
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php44
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php49
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php58
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php46
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php121
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php69
-rw-r--r--vendor/monolog/monolog/tests/Monolog/LoggerTest.php447
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php29
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php123
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php42
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php42
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php30
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php43
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php29
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php27
-rw-r--r--vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php98
-rw-r--r--vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php47
-rw-r--r--vendor/monolog/monolog/tests/Monolog/RegistryTest.php63
-rw-r--r--vendor/monolog/monolog/tests/Monolog/TestCase.php58
71 files changed, 7820 insertions, 0 deletions
diff --git a/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php
new file mode 100644
index 00000000..a9a3f301
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php
@@ -0,0 +1,31 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\TestHandler;
+
+class ErrorHandlerTest extends \PHPUnit_Framework_TestCase
+{
+ public function testHandleError()
+ {
+ $logger = new Logger('test', array($handler = new TestHandler));
+ $errHandler = new ErrorHandler($logger);
+
+ $errHandler->registerErrorHandler(array(E_USER_NOTICE => Logger::EMERGENCY), false);
+ trigger_error('Foo', E_USER_ERROR);
+ $this->assertCount(1, $handler->getRecords());
+ $this->assertTrue($handler->hasErrorRecords());
+ trigger_error('Foo', E_USER_NOTICE);
+ $this->assertCount(2, $handler->getRecords());
+ $this->assertTrue($handler->hasEmergencyRecords());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php
new file mode 100644
index 00000000..e7f7334e
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php
@@ -0,0 +1,158 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class ChromePHPFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @covers Monolog\Formatter\ChromePHPFormatter::format
+ */
+ public function testDefaultFormat()
+ {
+ $formatter = new ChromePHPFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('ip' => '127.0.0.1'),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'meh',
+ array(
+ 'message' => 'log',
+ 'context' => array('from' => 'logger'),
+ 'extra' => array('ip' => '127.0.0.1'),
+ ),
+ 'unknown',
+ 'error'
+ ),
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\ChromePHPFormatter::format
+ */
+ public function testFormatWithFileAndLine()
+ {
+ $formatter = new ChromePHPFormatter();
+ $record = array(
+ 'level' => Logger::CRITICAL,
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'meh',
+ array(
+ 'message' => 'log',
+ 'context' => array('from' => 'logger'),
+ 'extra' => array('ip' => '127.0.0.1'),
+ ),
+ 'test : 14',
+ 'error'
+ ),
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\ChromePHPFormatter::format
+ */
+ public function testFormatWithoutContext()
+ {
+ $formatter = new ChromePHPFormatter();
+ $record = array(
+ 'level' => Logger::DEBUG,
+ 'level_name' => 'DEBUG',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'meh',
+ 'log',
+ 'unknown',
+ 'log'
+ ),
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\ChromePHPFormatter::formatBatch
+ */
+ public function testBatchFormatThrowException()
+ {
+ $formatter = new ChromePHPFormatter();
+ $records = array(
+ array(
+ 'level' => Logger::INFO,
+ 'level_name' => 'INFO',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ ),
+ array(
+ 'level' => Logger::WARNING,
+ 'level_name' => 'WARNING',
+ 'channel' => 'foo',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log2',
+ ),
+ );
+
+ $this->assertEquals(
+ array(
+ array(
+ 'meh',
+ 'log',
+ 'unknown',
+ 'info'
+ ),
+ array(
+ 'foo',
+ 'log2',
+ 'unknown',
+ 'warn'
+ ),
+ ),
+ $formatter->formatBatch($records)
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php
new file mode 100644
index 00000000..546e5c26
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php
@@ -0,0 +1,79 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class ElasticaFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists("Elastica\Document")) {
+ $this->markTestSkipped("ruflin/elastica not installed");
+ }
+ }
+
+ /**
+ * @covers Monolog\Formatter\ElasticaFormatter::__construct
+ * @covers Monolog\Formatter\ElasticaFormatter::format
+ * @covers Monolog\Formatter\ElasticaFormatter::getDocument
+ */
+ public function testFormat()
+ {
+ // test log message
+ $msg = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ // expected values
+ $expected = $msg;
+ $expected['datetime'] = '1970-01-01T00:00:00+0000';
+ $expected['context'] = array(
+ 'class' => '[object] (stdClass: {})',
+ 'foo' => 7,
+ 0 => 'bar',
+ );
+
+ // format log message
+ $formatter = new ElasticaFormatter('my_index', 'doc_type');
+ $doc = $formatter->format($msg);
+ $this->assertInstanceOf('Elastica\Document', $doc);
+
+ // Document parameters
+ $params = $doc->getParams();
+ $this->assertEquals('my_index', $params['_index']);
+ $this->assertEquals('doc_type', $params['_type']);
+
+ // Document data values
+ $data = $doc->getData();
+ foreach (array_keys($expected) as $key) {
+ $this->assertEquals($expected[$key], $data[$key]);
+ }
+ }
+
+ /**
+ * @covers Monolog\Formatter\ElasticaFormatter::getIndex
+ * @covers Monolog\Formatter\ElasticaFormatter::getType
+ */
+ public function testGetters()
+ {
+ $formatter = new ElasticaFormatter('my_index', 'doc_type');
+ $this->assertEquals('my_index', $formatter->getIndex());
+ $this->assertEquals('doc_type', $formatter->getType());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php
new file mode 100644
index 00000000..1b2fd97a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php
@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class FlowdockFormatterTest extends TestCase
+{
+ /**
+ * @covers Monolog\Formatter\FlowdockFormatter::format
+ */
+ public function testFormat()
+ {
+ $formatter = new FlowdockFormatter('test_source', 'source@test.com');
+ $record = $this->getRecord();
+
+ $expected = array(
+ 'source' => 'test_source',
+ 'from_address' => 'source@test.com',
+ 'subject' => 'in test_source: WARNING - test',
+ 'content' => 'test',
+ 'tags' => array('#logs', '#warning', '#test'),
+ 'project' => 'test_source',
+ );
+ $formatted = $formatter->format($record);
+
+ $this->assertEquals($expected, $formatted['flowdock']);
+ }
+
+ /**
+ * @ covers Monolog\Formatter\FlowdockFormatter::formatBatch
+ */
+ public function testFormatBatch()
+ {
+ $formatter = new FlowdockFormatter('test_source', 'source@test.com');
+ $records = array(
+ $this->getRecord(Logger::WARNING),
+ $this->getRecord(Logger::DEBUG),
+ );
+ $formatted = $formatter->formatBatch($records);
+
+ $this->assertArrayHasKey('flowdock', $formatted[0]);
+ $this->assertArrayHasKey('flowdock', $formatted[1]);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php
new file mode 100644
index 00000000..6ac14854
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php
@@ -0,0 +1,204 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class GelfMessageFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('\Gelf\Message')) {
+ $this->markTestSkipped("graylog2/gelf-php or mlehner/gelf-php is not installed");
+ }
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testDefaultFormatter()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+ $this->assertEquals(0, $message->getTimestamp());
+ $this->assertEquals('log', $message->getShortMessage());
+ $this->assertEquals('meh', $message->getFacility());
+ $this->assertEquals(null, $message->getLine());
+ $this->assertEquals(null, $message->getFile());
+ $this->assertEquals($this->isLegacy() ? 3 : 'error', $message->getLevel());
+ $this->assertNotEmpty($message->getHost());
+
+ $formatter = new GelfMessageFormatter('mysystem');
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+ $this->assertEquals('mysystem', $message->getHost());
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testFormatWithFileAndLine()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+ $this->assertEquals('test', $message->getFile());
+ $this->assertEquals(14, $message->getLine());
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ * @expectedException InvalidArgumentException
+ */
+ public function testFormatInvalidFails()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ );
+
+ $formatter->format($record);
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testFormatWithContext()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $message_array = $message->toArray();
+
+ $this->assertArrayHasKey('_ctxt_from', $message_array);
+ $this->assertEquals('logger', $message_array['_ctxt_from']);
+
+ // Test with extraPrefix
+ $formatter = new GelfMessageFormatter(null, null, 'CTX');
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $message_array = $message->toArray();
+
+ $this->assertArrayHasKey('_CTXfrom', $message_array);
+ $this->assertEquals('logger', $message_array['_CTXfrom']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testFormatWithContextContainingException()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger', 'exception' => array(
+ 'class' => '\Exception',
+ 'file' => '/some/file/in/dir.php:56',
+ 'trace' => array('/some/file/1.php:23', '/some/file/2.php:3')
+ )),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log'
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $this->assertEquals("/some/file/in/dir.php", $message->getFile());
+ $this->assertEquals("56", $message->getLine());
+ }
+
+ /**
+ * @covers Monolog\Formatter\GelfMessageFormatter::format
+ */
+ public function testFormatWithExtra()
+ {
+ $formatter = new GelfMessageFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $message_array = $message->toArray();
+
+ $this->assertArrayHasKey('_key', $message_array);
+ $this->assertEquals('pair', $message_array['_key']);
+
+ // Test with extraPrefix
+ $formatter = new GelfMessageFormatter(null, 'EXT');
+ $message = $formatter->format($record);
+
+ $this->assertInstanceOf('Gelf\Message', $message);
+
+ $message_array = $message->toArray();
+
+ $this->assertArrayHasKey('_EXTkey', $message_array);
+ $this->assertEquals('pair', $message_array['_EXTkey']);
+ }
+
+ private function isLegacy()
+ {
+ return interface_exists('\Gelf\IMessagePublisher');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php
new file mode 100644
index 00000000..69e20077
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php
@@ -0,0 +1,78 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class JsonFormatterTest extends TestCase
+{
+ /**
+ * @covers Monolog\Formatter\JsonFormatter::__construct
+ * @covers Monolog\Formatter\JsonFormatter::getBatchMode
+ * @covers Monolog\Formatter\JsonFormatter::isAppendingNewlines
+ */
+ public function testConstruct()
+ {
+ $formatter = new JsonFormatter();
+ $this->assertEquals(JsonFormatter::BATCH_MODE_JSON, $formatter->getBatchMode());
+ $this->assertEquals(true, $formatter->isAppendingNewlines());
+ $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES, false);
+ $this->assertEquals(JsonFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode());
+ $this->assertEquals(false, $formatter->isAppendingNewlines());
+ }
+
+ /**
+ * @covers Monolog\Formatter\JsonFormatter::format
+ */
+ public function testFormat()
+ {
+ $formatter = new JsonFormatter();
+ $record = $this->getRecord();
+ $this->assertEquals(json_encode($record)."\n", $formatter->format($record));
+
+ $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false);
+ $record = $this->getRecord();
+ $this->assertEquals(json_encode($record), $formatter->format($record));
+ }
+
+ /**
+ * @covers Monolog\Formatter\JsonFormatter::formatBatch
+ * @covers Monolog\Formatter\JsonFormatter::formatBatchJson
+ */
+ public function testFormatBatch()
+ {
+ $formatter = new JsonFormatter();
+ $records = array(
+ $this->getRecord(Logger::WARNING),
+ $this->getRecord(Logger::DEBUG),
+ );
+ $this->assertEquals(json_encode($records), $formatter->formatBatch($records));
+ }
+
+ /**
+ * @covers Monolog\Formatter\JsonFormatter::formatBatch
+ * @covers Monolog\Formatter\JsonFormatter::formatBatchNewlines
+ */
+ public function testFormatBatchNewlines()
+ {
+ $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES);
+ $records = $expected = array(
+ $this->getRecord(Logger::WARNING),
+ $this->getRecord(Logger::DEBUG),
+ );
+ array_walk($expected, function (&$value, $key) {
+ $value = json_encode($value);
+ });
+ $this->assertEquals(implode("\n", $expected), $formatter->formatBatch($records));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php
new file mode 100644
index 00000000..c1b2e0ee
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php
@@ -0,0 +1,208 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\LineFormatter
+ */
+class LineFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function testDefFormatWithString()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'WARNING',
+ 'channel' => 'log',
+ 'context' => array(),
+ 'message' => 'foo',
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
+ }
+
+ public function testDefFormatWithArrayContext()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'message' => 'foo',
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ 'context' => array(
+ 'foo' => 'bar',
+ 'baz' => 'qux',
+ 'bool' => false,
+ 'null' => null,
+ )
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foo {"foo":"bar","baz":"qux","bool":false,"null":null} []'."\n", $message);
+ }
+
+ public function testDefFormatExtras()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array('ip' => '127.0.0.1'),
+ 'message' => 'log',
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] {"ip":"127.0.0.1"}'."\n", $message);
+ }
+
+ public function testFormatExtras()
+ {
+ $formatter = new LineFormatter("[%datetime%] %channel%.%level_name%: %message% %context% %extra.file% %extra%\n", 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array('ip' => '127.0.0.1', 'file' => 'test'),
+ 'message' => 'log',
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] test {"ip":"127.0.0.1"}'."\n", $message);
+ }
+
+ public function testContextAndExtraOptionallyNotShownIfEmpty()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d', false, true);
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ 'message' => 'log',
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log '."\n", $message);
+ }
+
+ public function testDefFormatWithObject()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array('foo' => new TestFoo, 'bar' => new TestBar, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+ 'message' => 'foobar',
+ ));
+
+ $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foobar [] {"foo":"[object] (Monolog\\\\Formatter\\\\TestFoo: {\\"foo\\":\\"foo\\"})","bar":"[object] (Monolog\\\\Formatter\\\\TestBar: bar)","baz":[],"res":"[resource]"}'."\n", $message);
+ }
+
+ public function testDefFormatWithException()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'core',
+ 'context' => array('exception' => new \RuntimeException('Foo')),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ 'message' => 'foobar',
+ ));
+
+ $path = str_replace('\\/', '/', json_encode(__FILE__));
+
+ $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__-8).')"} []'."\n", $message);
+ }
+
+ public function testDefFormatWithPreviousException()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $previous = new \LogicException('Wut?');
+ $message = $formatter->format(array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'core',
+ 'context' => array('exception' => new \RuntimeException('Foo', 0, $previous)),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ 'message' => 'foobar',
+ ));
+
+ $path = str_replace('\\/', '/', json_encode(__FILE__));
+
+ $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__-8).', LogicException(code: 0): Wut? at '.substr($path, 1, -1).':'.(__LINE__-12).')"} []'."\n", $message);
+ }
+
+ public function testBatchFormat()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->formatBatch(array(
+ array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'test',
+ 'message' => 'bar',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ),
+ array(
+ 'level_name' => 'WARNING',
+ 'channel' => 'log',
+ 'message' => 'foo',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ),
+ ));
+ $this->assertEquals('['.date('Y-m-d').'] test.CRITICAL: bar [] []'."\n".'['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
+ }
+
+ public function testFormatShouldStripInlineLineBreaks()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d');
+ $message = $formatter->format(
+ array(
+ 'message' => "foo\nbar",
+ 'context' => array(),
+ 'extra' => array(),
+ )
+ );
+
+ $this->assertRegExp('/foo bar/', $message);
+ }
+
+ public function testFormatShouldNotStripInlineLineBreaksWhenFlagIsSet()
+ {
+ $formatter = new LineFormatter(null, 'Y-m-d', true);
+ $message = $formatter->format(
+ array(
+ 'message' => "foo\nbar",
+ 'context' => array(),
+ 'extra' => array(),
+ )
+ );
+
+ $this->assertRegExp('/foo\nbar/', $message);
+ }
+}
+
+class TestFoo
+{
+ public $foo = 'foo';
+}
+
+class TestBar
+{
+ public function __toString()
+ {
+ return 'bar';
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php
new file mode 100644
index 00000000..6d59b3f3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php
@@ -0,0 +1,40 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\TestCase;
+
+class LogglyFormatterTest extends TestCase
+{
+ /**
+ * @covers Monolog\Formatter\LogglyFormatter::__construct
+ */
+ public function testConstruct()
+ {
+ $formatter = new LogglyFormatter();
+ $this->assertEquals(LogglyFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode());
+ $formatter = new LogglyFormatter(LogglyFormatter::BATCH_MODE_JSON);
+ $this->assertEquals(LogglyFormatter::BATCH_MODE_JSON, $formatter->getBatchMode());
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogglyFormatter::format
+ */
+ public function testFormat()
+ {
+ $formatter = new LogglyFormatter();
+ $record = $this->getRecord();
+ $formatted_decoded = json_decode($formatter->format($record), true);
+ $this->assertArrayHasKey("timestamp", $formatted_decoded);
+ $this->assertEquals(new \DateTime($formatted_decoded["timestamp"]), $record["datetime"]);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php
new file mode 100644
index 00000000..de4a3c2c
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php
@@ -0,0 +1,289 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class LogstashFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testDefaultFormatter()
+ {
+ $formatter = new LogstashFormatter('test', 'hostname');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
+ $this->assertEquals('log', $message['@message']);
+ $this->assertEquals('meh', $message['@fields']['channel']);
+ $this->assertContains('meh', $message['@tags']);
+ $this->assertEquals(Logger::ERROR, $message['@fields']['level']);
+ $this->assertEquals('test', $message['@type']);
+ $this->assertEquals('hostname', $message['@source']);
+
+ $formatter = new LogstashFormatter('mysystem');
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals('mysystem', $message['@type']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithFileAndLine()
+ {
+ $formatter = new LogstashFormatter('test');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals('test', $message['@fields']['file']);
+ $this->assertEquals(14, $message['@fields']['line']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithContext()
+ {
+ $formatter = new LogstashFormatter('test');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $message_array = $message['@fields'];
+
+ $this->assertArrayHasKey('ctxt_from', $message_array);
+ $this->assertEquals('logger', $message_array['ctxt_from']);
+
+ // Test with extraPrefix
+ $formatter = new LogstashFormatter('test', null, null, 'CTX');
+ $message = json_decode($formatter->format($record), true);
+
+ $message_array = $message['@fields'];
+
+ $this->assertArrayHasKey('CTXfrom', $message_array);
+ $this->assertEquals('logger', $message_array['CTXfrom']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithExtra()
+ {
+ $formatter = new LogstashFormatter('test');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $message_array = $message['@fields'];
+
+ $this->assertArrayHasKey('key', $message_array);
+ $this->assertEquals('pair', $message_array['key']);
+
+ // Test with extraPrefix
+ $formatter = new LogstashFormatter('test', null, 'EXT');
+ $message = json_decode($formatter->format($record), true);
+
+ $message_array = $message['@fields'];
+
+ $this->assertArrayHasKey('EXTkey', $message_array);
+ $this->assertEquals('pair', $message_array['EXTkey']);
+ }
+
+ public function testFormatWithApplicationName()
+ {
+ $formatter = new LogstashFormatter('app', 'test');
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('@type', $message);
+ $this->assertEquals('app', $message['@type']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testDefaultFormatterV1()
+ {
+ $formatter = new LogstashFormatter('test', 'hostname', null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
+ $this->assertEquals("1", $message['@version']);
+ $this->assertEquals('log', $message['message']);
+ $this->assertEquals('meh', $message['channel']);
+ $this->assertEquals('ERROR', $message['level']);
+ $this->assertEquals('test', $message['type']);
+ $this->assertEquals('hostname', $message['host']);
+
+ $formatter = new LogstashFormatter('mysystem', null, null, 'ctxt_', LogstashFormatter::V1);
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals('mysystem', $message['type']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithFileAndLineV1()
+ {
+ $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertEquals('test', $message['file']);
+ $this->assertEquals(14, $message['line']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithContextV1()
+ {
+ $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('ctxt_from', $message);
+ $this->assertEquals('logger', $message['ctxt_from']);
+
+ // Test with extraPrefix
+ $formatter = new LogstashFormatter('test', null, null, 'CTX', LogstashFormatter::V1);
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('CTXfrom', $message);
+ $this->assertEquals('logger', $message['CTXfrom']);
+ }
+
+ /**
+ * @covers Monolog\Formatter\LogstashFormatter::format
+ */
+ public function testFormatWithExtraV1()
+ {
+ $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('key', $message);
+ $this->assertEquals('pair', $message['key']);
+
+ // Test with extraPrefix
+ $formatter = new LogstashFormatter('test', null, 'EXT', 'ctxt_', LogstashFormatter::V1);
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('EXTkey', $message);
+ $this->assertEquals('pair', $message['EXTkey']);
+ }
+
+ public function testFormatWithApplicationNameV1()
+ {
+ $formatter = new LogstashFormatter('app', 'test', null, 'ctxt_', LogstashFormatter::V1);
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('key' => 'pair'),
+ 'message' => 'log'
+ );
+
+ $message = json_decode($formatter->format($record), true);
+
+ $this->assertArrayHasKey('type', $message);
+ $this->assertEquals('app', $message['type']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php
new file mode 100644
index 00000000..1554ef46
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php
@@ -0,0 +1,253 @@
+<?php
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * @author Florian Plattner <me@florianplattner.de>
+ */
+class MongoDBFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('MongoDate')) {
+ $this->markTestSkipped('mongo extension not installed');
+ }
+ }
+
+ public function constructArgumentProvider()
+ {
+ return array(
+ array(1, true, 1, true),
+ array(0, false, 0, false),
+ );
+ }
+
+ /**
+ * @param $traceDepth
+ * @param $traceAsString
+ * @param $expectedTraceDepth
+ * @param $expectedTraceAsString
+ *
+ * @dataProvider constructArgumentProvider
+ */
+ public function testConstruct($traceDepth, $traceAsString, $expectedTraceDepth, $expectedTraceAsString)
+ {
+ $formatter = new MongoDBFormatter($traceDepth, $traceAsString);
+
+ $reflTrace = new \ReflectionProperty($formatter, 'exceptionTraceAsString');
+ $reflTrace->setAccessible(true);
+ $this->assertEquals($expectedTraceAsString, $reflTrace->getValue($formatter));
+
+ $reflDepth = new\ReflectionProperty($formatter, 'maxNestingLevel');
+ $reflDepth->setAccessible(true);
+ $this->assertEquals($expectedTraceDepth, $reflDepth->getValue($formatter));
+ }
+
+ public function testSimpleFormat()
+ {
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter();
+ $formattedRecord = $formatter->format($record);
+
+ $this->assertCount(7, $formattedRecord);
+ $this->assertEquals('some log message', $formattedRecord['message']);
+ $this->assertEquals(array(), $formattedRecord['context']);
+ $this->assertEquals(Logger::WARNING, $formattedRecord['level']);
+ $this->assertEquals(Logger::getLevelName(Logger::WARNING), $formattedRecord['level_name']);
+ $this->assertEquals('test', $formattedRecord['channel']);
+ $this->assertInstanceOf('\MongoDate', $formattedRecord['datetime']);
+ $this->assertEquals('0.00000000 1391212800', $formattedRecord['datetime']->__toString());
+ $this->assertEquals(array(), $formattedRecord['extra']);
+ }
+
+ public function testRecursiveFormat()
+ {
+ $someObject = new \stdClass();
+ $someObject->foo = 'something';
+ $someObject->bar = 'stuff';
+
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'stuff' => new \DateTime('2014-02-01 02:31:33'),
+ 'some_object' => $someObject,
+ 'context_string' => 'some string',
+ 'context_int' => 123456,
+ 'except' => new \Exception('exception message', 987),
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter();
+ $formattedRecord = $formatter->format($record);
+
+ $this->assertCount(5, $formattedRecord['context']);
+ $this->assertInstanceOf('\MongoDate', $formattedRecord['context']['stuff']);
+ $this->assertEquals('0.00000000 1391221893', $formattedRecord['context']['stuff']->__toString());
+ $this->assertEquals(
+ array(
+ 'foo' => 'something',
+ 'bar' => 'stuff',
+ 'class' => 'stdClass',
+ ),
+ $formattedRecord['context']['some_object']
+ );
+ $this->assertEquals('some string', $formattedRecord['context']['context_string']);
+ $this->assertEquals(123456, $formattedRecord['context']['context_int']);
+
+ $this->assertCount(5, $formattedRecord['context']['except']);
+ $this->assertEquals('exception message', $formattedRecord['context']['except']['message']);
+ $this->assertEquals(987, $formattedRecord['context']['except']['code']);
+ $this->assertInternalType('string', $formattedRecord['context']['except']['file']);
+ $this->assertInternalType('integer', $formattedRecord['context']['except']['code']);
+ $this->assertInternalType('string', $formattedRecord['context']['except']['trace']);
+ $this->assertEquals('Exception', $formattedRecord['context']['except']['class']);
+ }
+
+ public function testFormatDepthArray()
+ {
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'nest2' => array(
+ 'property' => 'anything',
+ 'nest3' => array(
+ 'nest4' => 'value',
+ 'property' => 'nothing'
+ )
+ )
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter(2);
+ $formattedResult = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'nest2' => array(
+ 'property' => 'anything',
+ 'nest3' => '[...]',
+ )
+ ),
+ $formattedResult['context']
+ );
+ }
+
+ public function testFormatDepthArrayInfiniteNesting()
+ {
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'nest2' => array(
+ 'property' => 'something',
+ 'nest3' => array(
+ 'property' => 'anything',
+ 'nest4' => array(
+ 'property' => 'nothing',
+ ),
+ )
+ )
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter(0);
+ $formattedResult = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'nest2' => array(
+ 'property' => 'something',
+ 'nest3' => array(
+ 'property' => 'anything',
+ 'nest4' => array(
+ 'property' => 'nothing',
+ )
+ ),
+ )
+ ),
+ $formattedResult['context']
+ );
+ }
+
+ public function testFormatDepthObjects()
+ {
+ $someObject = new \stdClass();
+ $someObject->property = 'anything';
+ $someObject->nest3 = new \stdClass();
+ $someObject->nest3->property = 'nothing';
+ $someObject->nest3->nest4 = 'invisible';
+
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'nest2' => $someObject
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter(2, true);
+ $formattedResult = $formatter->format($record);
+
+ $this->assertEquals(
+ array(
+ 'nest2' => array(
+ 'property' => 'anything',
+ 'nest3' => '[...]',
+ 'class' => 'stdClass',
+ ),
+ ),
+ $formattedResult['context']
+ );
+ }
+
+ public function testFormatDepthException()
+ {
+ $record = array(
+ 'message' => 'some log message',
+ 'context' => array(
+ 'nest2' => new \Exception('exception message', 987),
+ ),
+ 'level' => Logger::WARNING,
+ 'level_name' => Logger::getLevelName(Logger::WARNING),
+ 'channel' => 'test',
+ 'datetime' => new \DateTime('2014-02-01 00:00:00'),
+ 'extra' => array(),
+ );
+
+ $formatter = new MongoDBFormatter(2, false);
+ $formattedRecord = $formatter->format($record);
+
+ $this->assertEquals('exception message', $formattedRecord['context']['nest2']['message']);
+ $this->assertEquals(987, $formattedRecord['context']['nest2']['code']);
+ $this->assertEquals('[...]', $formattedRecord['context']['nest2']['trace']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php
new file mode 100644
index 00000000..4ffeded0
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php
@@ -0,0 +1,254 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\NormalizerFormatter
+ */
+class NormalizerFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function testFormat()
+ {
+ $formatter = new NormalizerFormatter('Y-m-d');
+ $formatted = $formatter->format(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'message' => 'foo',
+ 'datetime' => new \DateTime,
+ 'extra' => array('foo' => new TestFooNorm, 'bar' => new TestBarNorm, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+ 'context' => array(
+ 'foo' => 'bar',
+ 'baz' => 'qux',
+ 'inf' => INF,
+ '-inf' => -INF,
+ 'nan' => acos(4),
+ ),
+ ));
+
+ $this->assertEquals(array(
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'message' => 'foo',
+ 'datetime' => date('Y-m-d'),
+ 'extra' => array(
+ 'foo' => '[object] (Monolog\\Formatter\\TestFooNorm: {"foo":"foo"})',
+ 'bar' => '[object] (Monolog\\Formatter\\TestBarNorm: bar)',
+ 'baz' => array(),
+ 'res' => '[resource]',
+ ),
+ 'context' => array(
+ 'foo' => 'bar',
+ 'baz' => 'qux',
+ 'inf' => 'INF',
+ '-inf' => '-INF',
+ 'nan' => 'NaN',
+ )
+ ), $formatted);
+ }
+
+ public function testFormatExceptions()
+ {
+ $formatter = new NormalizerFormatter('Y-m-d');
+ $e = new \LogicException('bar');
+ $e2 = new \RuntimeException('foo', 0, $e);
+ $formatted = $formatter->format(array(
+ 'exception' => $e2,
+ ));
+
+ $this->assertGreaterThan(5, count($formatted['exception']['trace']));
+ $this->assertTrue(isset($formatted['exception']['previous']));
+ unset($formatted['exception']['trace'], $formatted['exception']['previous']);
+
+ $this->assertEquals(array(
+ 'exception' => array(
+ 'class' => get_class($e2),
+ 'message' => $e2->getMessage(),
+ 'code' => $e2->getCode(),
+ 'file' => $e2->getFile().':'.$e2->getLine(),
+ )
+ ), $formatted);
+ }
+
+ public function testBatchFormat()
+ {
+ $formatter = new NormalizerFormatter('Y-m-d');
+ $formatted = $formatter->formatBatch(array(
+ array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'test',
+ 'message' => 'bar',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ),
+ array(
+ 'level_name' => 'WARNING',
+ 'channel' => 'log',
+ 'message' => 'foo',
+ 'context' => array(),
+ 'datetime' => new \DateTime,
+ 'extra' => array(),
+ ),
+ ));
+ $this->assertEquals(array(
+ array(
+ 'level_name' => 'CRITICAL',
+ 'channel' => 'test',
+ 'message' => 'bar',
+ 'context' => array(),
+ 'datetime' => date('Y-m-d'),
+ 'extra' => array(),
+ ),
+ array(
+ 'level_name' => 'WARNING',
+ 'channel' => 'log',
+ 'message' => 'foo',
+ 'context' => array(),
+ 'datetime' => date('Y-m-d'),
+ 'extra' => array(),
+ ),
+ ), $formatted);
+ }
+
+ /**
+ * Test issue #137
+ */
+ public function testIgnoresRecursiveObjectReferences()
+ {
+ // set up the recursion
+ $foo = new \stdClass();
+ $bar = new \stdClass();
+
+ $foo->bar = $bar;
+ $bar->foo = $foo;
+
+ // set an error handler to assert that the error is not raised anymore
+ $that = $this;
+ set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
+ if (error_reporting() & $level) {
+ restore_error_handler();
+ $that->fail("$message should not be raised");
+ }
+ });
+
+ $formatter = new NormalizerFormatter();
+ $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+ $reflMethod->setAccessible(true);
+ $res = $reflMethod->invoke($formatter, array($foo, $bar), true);
+
+ restore_error_handler();
+
+ $this->assertEquals(@json_encode(array($foo, $bar)), $res);
+ }
+
+ public function testIgnoresInvalidTypes()
+ {
+ // set up the recursion
+ $resource = fopen(__FILE__, 'r');
+
+ // set an error handler to assert that the error is not raised anymore
+ $that = $this;
+ set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
+ if (error_reporting() & $level) {
+ restore_error_handler();
+ $that->fail("$message should not be raised");
+ }
+ });
+
+ $formatter = new NormalizerFormatter();
+ $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+ $reflMethod->setAccessible(true);
+ $res = $reflMethod->invoke($formatter, array($resource), true);
+
+ restore_error_handler();
+
+ $this->assertEquals(@json_encode(array($resource)), $res);
+ }
+
+ public function testExceptionTraceWithArgs()
+ {
+ if (defined('HHVM_VERSION')) {
+ $this->markTestSkipped('Not supported in HHVM since it detects errors differently');
+ }
+
+ // This happens i.e. in React promises or Guzzle streams where stream wrappers are registered
+ // and no file or line are included in the trace because it's treated as internal function
+ set_error_handler(function ($errno, $errstr, $errfile, $errline) {
+ throw new \ErrorException($errstr, 0, $errno, $errfile, $errline);
+ });
+
+ try {
+ // This will contain $resource and $wrappedResource as arguments in the trace item
+ $resource = fopen('php://memory', 'rw+');
+ fwrite($resource, 'test_resource');
+ $wrappedResource = new TestFooNorm;
+ $wrappedResource->foo = $resource;
+ // Just do something stupid with a resource/wrapped resource as argument
+ array_keys($wrappedResource);
+ } catch (\Exception $e) {
+ restore_error_handler();
+ }
+
+ $formatter = new NormalizerFormatter();
+ $record = array('context' => array('exception' => $e));
+ $result = $formatter->format($record);
+
+ $this->assertRegExp(
+ '%"resource":"\[resource\]"%',
+ $result['context']['exception']['trace'][0]
+ );
+
+ if (version_compare(PHP_VERSION, '5.5.0', '>=')) {
+ $pattern = '%"wrappedResource":"\[object\] \(Monolog\\\\\\\\Formatter\\\\\\\\TestFooNorm: \)"%';
+ } else {
+ $pattern = '%\\\\"foo\\\\":null%';
+ }
+
+ // Tests that the wrapped resource is ignored while encoding, only works for PHP <= 5.4
+ $this->assertRegExp(
+ $pattern,
+ $result['context']['exception']['trace'][0]
+ );
+ }
+}
+
+class TestFooNorm
+{
+ public $foo = 'foo';
+}
+
+class TestBarNorm
+{
+ public function __toString()
+ {
+ return 'bar';
+ }
+}
+
+class TestStreamFoo
+{
+ public $foo;
+ public $resource;
+
+ public function __construct($resource)
+ {
+ $this->resource = $resource;
+ $this->foo = 'BAR';
+ }
+
+ public function __toString()
+ {
+ fseek($this->resource, 0);
+
+ return $this->foo . ' - ' . (string) stream_get_contents($this->resource);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php
new file mode 100644
index 00000000..c5a4ebb5
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php
@@ -0,0 +1,98 @@
+<?php
+namespace Monolog\Formatter;
+
+class ScalarFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ public function setUp()
+ {
+ $this->formatter = new ScalarFormatter();
+ }
+
+ public function buildTrace(\Exception $e)
+ {
+ $data = array();
+ $trace = $e->getTrace();
+ foreach ($trace as $frame) {
+ if (isset($frame['file'])) {
+ $data[] = $frame['file'].':'.$frame['line'];
+ } else {
+ $data[] = json_encode($frame);
+ }
+ }
+
+ return $data;
+ }
+
+ public function encodeJson($data)
+ {
+ if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+ return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+ }
+
+ return json_encode($data);
+ }
+
+ public function testFormat()
+ {
+ $exception = new \Exception('foo');
+ $formatted = $this->formatter->format(array(
+ 'foo' => 'string',
+ 'bar' => 1,
+ 'baz' => false,
+ 'bam' => array(1, 2, 3),
+ 'bat' => array('foo' => 'bar'),
+ 'bap' => \DateTime::createFromFormat(\DateTime::ISO8601, '1970-01-01T00:00:00+0000'),
+ 'ban' => $exception
+ ));
+
+ $this->assertSame(array(
+ 'foo' => 'string',
+ 'bar' => 1,
+ 'baz' => false,
+ 'bam' => $this->encodeJson(array(1, 2, 3)),
+ 'bat' => $this->encodeJson(array('foo' => 'bar')),
+ 'bap' => '1970-01-01 00:00:00',
+ 'ban' => $this->encodeJson(array(
+ 'class' => get_class($exception),
+ 'message' => $exception->getMessage(),
+ 'code' => $exception->getCode(),
+ 'file' => $exception->getFile() . ':' . $exception->getLine(),
+ 'trace' => $this->buildTrace($exception)
+ ))
+ ), $formatted);
+ }
+
+ public function testFormatWithErrorContext()
+ {
+ $context = array('file' => 'foo', 'line' => 1);
+ $formatted = $this->formatter->format(array(
+ 'context' => $context
+ ));
+
+ $this->assertSame(array(
+ 'context' => $this->encodeJson($context)
+ ), $formatted);
+ }
+
+ public function testFormatWithExceptionContext()
+ {
+ $exception = new \Exception('foo');
+ $formatted = $this->formatter->format(array(
+ 'context' => array(
+ 'exception' => $exception
+ )
+ ));
+
+ $this->assertSame(array(
+ 'context' => $this->encodeJson(array(
+ 'exception' => array(
+ 'class' => get_class($exception),
+ 'message' => $exception->getMessage(),
+ 'code' => $exception->getCode(),
+ 'file' => $exception->getFile() . ':' . $exception->getLine(),
+ 'trace' => $this->buildTrace($exception)
+ )
+ ))
+ ), $formatted);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php
new file mode 100644
index 00000000..52f15a36
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php
@@ -0,0 +1,142 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class WildfireFormatterTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::format
+ */
+ public function testDefaultFormat()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('ip' => '127.0.0.1'),
+ 'message' => 'log',
+ );
+
+ $message = $wildfire->format($record);
+
+ $this->assertEquals(
+ '125|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},'
+ .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::format
+ */
+ public function testFormatWithFileAndLine()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('from' => 'logger'),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+ 'message' => 'log',
+ );
+
+ $message = $wildfire->format($record);
+
+ $this->assertEquals(
+ '129|[{"Type":"ERROR","File":"test","Line":14,"Label":"meh"},'
+ .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::format
+ */
+ public function testFormatWithoutContext()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $message = $wildfire->format($record);
+
+ $this->assertEquals(
+ '58|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},"log"]|',
+ $message
+ );
+ }
+
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::formatBatch
+ * @expectedException BadMethodCallException
+ */
+ public function testBatchFormatThrowException()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array(),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $wildfire->formatBatch(array($record));
+ }
+
+ /**
+ * @covers Monolog\Formatter\WildfireFormatter::format
+ */
+ public function testTableFormat()
+ {
+ $wildfire = new WildfireFormatter();
+ $record = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'table-channel',
+ 'context' => array(
+ WildfireFormatter::TABLE => array(
+ array('col1', 'col2', 'col3'),
+ array('val1', 'val2', 'val3'),
+ array('foo1', 'foo2', 'foo3'),
+ array('bar1', 'bar2', 'bar3'),
+ ),
+ ),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'table-message',
+ );
+
+ $message = $wildfire->format($record);
+
+ $this->assertEquals(
+ '171|[{"Type":"TABLE","File":"","Line":"","Label":"table-channel: table-message"},[["col1","col2","col3"],["val1","val2","val3"],["foo1","foo2","foo3"],["bar1","bar2","bar3"]]]|',
+ $message
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php
new file mode 100644
index 00000000..568eb9da
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php
@@ -0,0 +1,115 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Processor\WebProcessor;
+
+class AbstractHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\AbstractHandler::__construct
+ * @covers Monolog\Handler\AbstractHandler::getLevel
+ * @covers Monolog\Handler\AbstractHandler::setLevel
+ * @covers Monolog\Handler\AbstractHandler::getBubble
+ * @covers Monolog\Handler\AbstractHandler::setBubble
+ * @covers Monolog\Handler\AbstractHandler::getFormatter
+ * @covers Monolog\Handler\AbstractHandler::setFormatter
+ */
+ public function testConstructAndGetSet()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+ $this->assertEquals(Logger::WARNING, $handler->getLevel());
+ $this->assertEquals(false, $handler->getBubble());
+
+ $handler->setLevel(Logger::ERROR);
+ $handler->setBubble(true);
+ $handler->setFormatter($formatter = new LineFormatter);
+ $this->assertEquals(Logger::ERROR, $handler->getLevel());
+ $this->assertEquals(true, $handler->getBubble());
+ $this->assertSame($formatter, $handler->getFormatter());
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::handleBatch
+ */
+ public function testHandleBatch()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+ $handler->expects($this->exactly(2))
+ ->method('handle');
+ $handler->handleBatch(array($this->getRecord(), $this->getRecord()));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::isHandling
+ */
+ public function testIsHandling()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+ $this->assertTrue($handler->isHandling($this->getRecord()));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::__construct
+ */
+ public function testHandlesPsrStyleLevels()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array('warning', false));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ $handler->setLevel('debug');
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::getFormatter
+ * @covers Monolog\Handler\AbstractHandler::getDefaultFormatter
+ */
+ public function testGetFormatterInitializesDefault()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+ $this->assertInstanceOf('Monolog\Formatter\LineFormatter', $handler->getFormatter());
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::pushProcessor
+ * @covers Monolog\Handler\AbstractHandler::popProcessor
+ * @expectedException LogicException
+ */
+ public function testPushPopProcessor()
+ {
+ $logger = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+ $processor1 = new WebProcessor;
+ $processor2 = new WebProcessor;
+
+ $logger->pushProcessor($processor1);
+ $logger->pushProcessor($processor2);
+
+ $this->assertEquals($processor2, $logger->popProcessor());
+ $this->assertEquals($processor1, $logger->popProcessor());
+ $logger->popProcessor();
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractHandler::pushProcessor
+ * @expectedException InvalidArgumentException
+ */
+ public function testPushProcessorWithNonCallable()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+
+ $handler->pushProcessor(new \stdClass());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php
new file mode 100644
index 00000000..24d4f63c
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php
@@ -0,0 +1,80 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Processor\WebProcessor;
+
+class AbstractProcessingHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::handle
+ */
+ public function testHandleLowerLevelMessage()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, true));
+ $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::handle
+ */
+ public function testHandleBubbling()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, true));
+ $this->assertFalse($handler->handle($this->getRecord()));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::handle
+ */
+ public function testHandleNotBubbling()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, false));
+ $this->assertTrue($handler->handle($this->getRecord()));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::handle
+ */
+ public function testHandleIsFalseWhenNotHandled()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, false));
+ $this->assertTrue($handler->handle($this->getRecord()));
+ $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\AbstractProcessingHandler::processRecord
+ */
+ public function testProcessRecord()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler');
+ $handler->pushProcessor(new WebProcessor(array(
+ 'REQUEST_URI' => '',
+ 'REQUEST_METHOD' => '',
+ 'REMOTE_ADDR' => '',
+ 'SERVER_NAME' => '',
+ 'UNIQUE_ID' => '',
+ )));
+ $handledRecord = null;
+ $handler->expects($this->once())
+ ->method('write')
+ ->will($this->returnCallback(function ($record) use (&$handledRecord) {
+ $handledRecord = $record;
+ }))
+ ;
+ $handler->handle($this->getRecord());
+ $this->assertEquals(6, count($handledRecord['extra']));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php
new file mode 100644
index 00000000..a71d6251
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php
@@ -0,0 +1,136 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use PhpAmqpLib\Message\AMQPMessage;
+use PhpAmqpLib\Connection\AMQPConnection;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class AmqpHandlerTest extends TestCase
+{
+ public function testHandleAmqpExt()
+ {
+ if (!class_exists('AMQPConnection') || !class_exists('AMQPExchange')) {
+ $this->markTestSkipped("amqp-php not installed");
+ }
+
+ if (!class_exists('AMQPChannel')) {
+ $this->markTestSkipped("Please update AMQP to version >= 1.0");
+ }
+
+ $messages = array();
+
+ $exchange = $this->getMock('AMQPExchange', array('publish', 'setName'), array(), '', false);
+ $exchange->expects($this->once())
+ ->method('setName')
+ ->with('log')
+ ;
+ $exchange->expects($this->any())
+ ->method('publish')
+ ->will($this->returnCallback(function ($message, $routing_key, $flags = 0, $attributes = array()) use (&$messages) {
+ $messages[] = array($message, $routing_key, $flags, $attributes);
+ }))
+ ;
+
+ $handler = new AmqpHandler($exchange, 'log');
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $expected = array(
+ array(
+ 'message' => 'test',
+ 'context' => array(
+ 'data' => array(),
+ 'foo' => 34,
+ ),
+ 'level' => 300,
+ 'level_name' => 'WARNING',
+ 'channel' => 'test',
+ 'extra' => array(),
+ ),
+ 'warn.test',
+ 0,
+ array(
+ 'delivery_mode' => 2,
+ 'Content-type' => 'application/json'
+ )
+ );
+
+ $handler->handle($record);
+
+ $this->assertCount(1, $messages);
+ $messages[0][0] = json_decode($messages[0][0], true);
+ unset($messages[0][0]['datetime']);
+ $this->assertEquals($expected, $messages[0]);
+ }
+
+ public function testHandlePhpAmqpLib()
+ {
+ if (!class_exists('PhpAmqpLib\Connection\AMQPConnection')) {
+ $this->markTestSkipped("php-amqplib not installed");
+ }
+
+ $messages = array();
+
+ $exchange = $this->getMock('PhpAmqpLib\Channel\AMQPChannel', array('basic_publish', '__destruct'), array(), '', false);
+
+ $exchange->expects($this->any())
+ ->method('basic_publish')
+ ->will($this->returnCallback(function (AMQPMessage $msg, $exchange = "", $routing_key = "", $mandatory = false, $immediate = false, $ticket = null) use (&$messages) {
+ $messages[] = array($msg, $exchange, $routing_key, $mandatory, $immediate, $ticket);
+ }))
+ ;
+
+ $handler = new AmqpHandler($exchange, 'log');
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $expected = array(
+ array(
+ 'message' => 'test',
+ 'context' => array(
+ 'data' => array(),
+ 'foo' => 34,
+ ),
+ 'level' => 300,
+ 'level_name' => 'WARNING',
+ 'channel' => 'test',
+ 'extra' => array(),
+ ),
+ 'log',
+ 'warn.test',
+ false,
+ false,
+ null,
+ array(
+ 'delivery_mode' => 2,
+ 'content_type' => 'application/json'
+ )
+ );
+
+ $handler->handle($record);
+
+ $this->assertCount(1, $messages);
+
+ /* @var $msg AMQPMessage */
+ $msg = $messages[0][0];
+ $messages[0][0] = json_decode($msg->body, true);
+ $messages[0][] = $msg->get_properties();
+ unset($messages[0][0]['datetime']);
+
+ $this->assertEquals($expected, $messages[0]);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php
new file mode 100644
index 00000000..ffb1d746
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php
@@ -0,0 +1,130 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\BrowserConsoleHandlerTest
+ */
+class BrowserConsoleHandlerTest extends TestCase
+{
+ protected function setUp()
+ {
+ BrowserConsoleHandler::reset();
+ }
+
+ protected function generateScript()
+ {
+ $reflMethod = new \ReflectionMethod('Monolog\Handler\BrowserConsoleHandler', 'generateScript');
+ $reflMethod->setAccessible(true);
+
+ return $reflMethod->invoke(null);
+ }
+
+ public function testStyling()
+ {
+ $handler = new BrowserConsoleHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+
+ $handler->handle($this->getRecord(Logger::DEBUG, 'foo[[bar]]{color: red}'));
+
+ $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%cfoo%cbar%c", "font-weight: normal", "color: red", "font-weight: normal");
+}})(console);
+EOF;
+
+ $this->assertEquals($expected, $this->generateScript());
+ }
+
+ public function testEscaping()
+ {
+ $handler = new BrowserConsoleHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+
+ $handler->handle($this->getRecord(Logger::DEBUG, "[foo] [[\"bar\n[baz]\"]]{color: red}"));
+
+ $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%c[foo] %c\"bar\\n[baz]\"%c", "font-weight: normal", "color: red", "font-weight: normal");
+}})(console);
+EOF;
+
+ $this->assertEquals($expected, $this->generateScript());
+ }
+
+ public function testAutolabel()
+ {
+ $handler = new BrowserConsoleHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+
+ $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}'));
+ $handler->handle($this->getRecord(Logger::DEBUG, '[[bar]]{macro: autolabel}'));
+ $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}'));
+
+ $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%c%cfoo%c", "font-weight: normal", "background-color: blue; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal");
+c.log("%c%cbar%c", "font-weight: normal", "background-color: green; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal");
+c.log("%c%cfoo%c", "font-weight: normal", "background-color: blue; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal");
+}})(console);
+EOF;
+
+ $this->assertEquals($expected, $this->generateScript());
+ }
+
+ public function testContext()
+ {
+ $handler = new BrowserConsoleHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+
+ $handler->handle($this->getRecord(Logger::DEBUG, 'test', array('foo' => 'bar')));
+
+ $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.groupCollapsed("%ctest", "font-weight: normal");
+c.log("%c%s", "font-weight: bold", "Context");
+c.log("%s: %o", "foo", "bar");
+c.groupEnd();
+}})(console);
+EOF;
+
+ $this->assertEquals($expected, $this->generateScript());
+ }
+
+ public function testConcurrentHandlers()
+ {
+ $handler1 = new BrowserConsoleHandler();
+ $handler1->setFormatter($this->getIdentityFormatter());
+
+ $handler2 = new BrowserConsoleHandler();
+ $handler2->setFormatter($this->getIdentityFormatter());
+
+ $handler1->handle($this->getRecord(Logger::DEBUG, 'test1'));
+ $handler2->handle($this->getRecord(Logger::DEBUG, 'test2'));
+ $handler1->handle($this->getRecord(Logger::DEBUG, 'test3'));
+ $handler2->handle($this->getRecord(Logger::DEBUG, 'test4'));
+
+ $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%ctest1", "font-weight: normal");
+c.log("%ctest2", "font-weight: normal");
+c.log("%ctest3", "font-weight: normal");
+c.log("%ctest4", "font-weight: normal");
+}})(console);
+EOF;
+
+ $this->assertEquals($expected, $this->generateScript());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php
new file mode 100644
index 00000000..da8b3c39
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php
@@ -0,0 +1,158 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class BufferHandlerTest extends TestCase
+{
+ private $shutdownCheckHandler;
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::__construct
+ * @covers Monolog\Handler\BufferHandler::handle
+ * @covers Monolog\Handler\BufferHandler::close
+ */
+ public function testHandleBuffers()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertFalse($test->hasInfoRecords());
+ $handler->close();
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 2);
+ }
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::close
+ * @covers Monolog\Handler\BufferHandler::flush
+ */
+ public function testPropagatesRecordsAtEndOfRequest()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test);
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $this->shutdownCheckHandler = $test;
+ register_shutdown_function(array($this, 'checkPropagation'));
+ }
+
+ public function checkPropagation()
+ {
+ if (!$this->shutdownCheckHandler->hasWarningRecords() || !$this->shutdownCheckHandler->hasDebugRecords()) {
+ echo '!!! BufferHandlerTest::testPropagatesRecordsAtEndOfRequest failed to verify that the messages have been propagated' . PHP_EOL;
+ exit(1);
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::handle
+ */
+ public function testHandleBufferLimit()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test, 2);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->close();
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertFalse($test->hasDebugRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::handle
+ */
+ public function testHandleBufferLimitWithFlushOnOverflow()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test, 3, Logger::DEBUG, true, true);
+
+ // send two records
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertCount(0, $test->getRecords());
+
+ // overflow
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertCount(3, $test->getRecords());
+
+ // should buffer again
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertCount(3, $test->getRecords());
+
+ $handler->close();
+ $this->assertCount(5, $test->getRecords());
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::handle
+ */
+ public function testHandleLevel()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test, 0, Logger::INFO);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->close();
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertFalse($test->hasDebugRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::flush
+ */
+ public function testFlush()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test, 0);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->flush();
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertFalse($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\BufferHandler::handle
+ */
+ public function testHandleUsesProcessors()
+ {
+ $test = new TestHandler();
+ $handler = new BufferHandler($test);
+ $handler->pushProcessor(function ($record) {
+ $record['extra']['foo'] = true;
+
+ return $record;
+ });
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->flush();
+ $this->assertTrue($test->hasWarningRecords());
+ $records = $test->getRecords();
+ $this->assertTrue($records[0]['extra']['foo']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php
new file mode 100644
index 00000000..2f55faf8
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php
@@ -0,0 +1,141 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\ChromePHPHandler
+ */
+class ChromePHPHandlerTest extends TestCase
+{
+ protected function setUp()
+ {
+ TestChromePHPHandler::reset();
+ $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; Chrome/1.0';
+ }
+
+ public function testHeaders()
+ {
+ $handler = new TestChromePHPHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::WARNING));
+
+ $expected = array(
+ 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array(
+ 'version' => ChromePHPHandler::VERSION,
+ 'columns' => array('label', 'log', 'backtrace', 'type'),
+ 'rows' => array(
+ 'test',
+ 'test',
+ ),
+ 'request_uri' => '',
+ ))))
+ );
+
+ $this->assertEquals($expected, $handler->getHeaders());
+ }
+
+ public function testHeadersOverflow()
+ {
+ $handler = new TestChromePHPHandler();
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 150*1024)));
+
+ // overflow chrome headers limit
+ $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 100*1024)));
+
+ $expected = array(
+ 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array(
+ 'version' => ChromePHPHandler::VERSION,
+ 'columns' => array('label', 'log', 'backtrace', 'type'),
+ 'rows' => array(
+ array(
+ 'test',
+ 'test',
+ 'unknown',
+ 'log',
+ ),
+ array(
+ 'test',
+ str_repeat('a', 150*1024),
+ 'unknown',
+ 'warn',
+ ),
+ array(
+ 'monolog',
+ 'Incomplete logs, chrome header size limit reached',
+ 'unknown',
+ 'warn',
+ ),
+ ),
+ 'request_uri' => '',
+ ))))
+ );
+
+ $this->assertEquals($expected, $handler->getHeaders());
+ }
+
+ public function testConcurrentHandlers()
+ {
+ $handler = new TestChromePHPHandler();
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::WARNING));
+
+ $handler2 = new TestChromePHPHandler();
+ $handler2->setFormatter($this->getIdentityFormatter());
+ $handler2->handle($this->getRecord(Logger::DEBUG));
+ $handler2->handle($this->getRecord(Logger::WARNING));
+
+ $expected = array(
+ 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array(
+ 'version' => ChromePHPHandler::VERSION,
+ 'columns' => array('label', 'log', 'backtrace', 'type'),
+ 'rows' => array(
+ 'test',
+ 'test',
+ 'test',
+ 'test',
+ ),
+ 'request_uri' => '',
+ ))))
+ );
+
+ $this->assertEquals($expected, $handler2->getHeaders());
+ }
+}
+
+class TestChromePHPHandler extends ChromePHPHandler
+{
+ protected $headers = array();
+
+ public static function reset()
+ {
+ self::$initialized = false;
+ self::$overflowed = false;
+ self::$sendHeaders = true;
+ self::$json['rows'] = array();
+ }
+
+ protected function sendHeader($header, $content)
+ {
+ $this->headers[$header] = $content;
+ }
+
+ public function getHeaders()
+ {
+ return $this->headers;
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php
new file mode 100644
index 00000000..9fc4b388
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php
@@ -0,0 +1,31 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class CouchDBHandlerTest extends TestCase
+{
+ public function testHandle()
+ {
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $handler = new CouchDBHandler();
+
+ try {
+ $handler->handle($record);
+ } catch (\RuntimeException $e) {
+ $this->markTestSkipped('Could not connect to couchdb server on http://localhost:5984');
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php
new file mode 100644
index 00000000..d67da90a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php
@@ -0,0 +1,52 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class DoctrineCouchDBHandlerTest extends TestCase
+{
+ protected function setup()
+ {
+ if (!class_exists('Doctrine\CouchDB\CouchDBClient')) {
+ $this->markTestSkipped('The "doctrine/couchdb" package is not installed');
+ }
+ }
+
+ public function testHandle()
+ {
+ $client = $this->getMockBuilder('Doctrine\\CouchDB\\CouchDBClient')
+ ->setMethods(array('postDocument'))
+ ->disableOriginalConstructor()
+ ->getMock();
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $expected = array(
+ 'message' => 'test',
+ 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
+ 'level' => Logger::WARNING,
+ 'level_name' => 'WARNING',
+ 'channel' => 'test',
+ 'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
+ 'extra' => array(),
+ );
+
+ $client->expects($this->once())
+ ->method('postDocument')
+ ->with($expected);
+
+ $handler = new DoctrineCouchDBHandler($client);
+ $handler->handle($record);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php
new file mode 100644
index 00000000..a38a8cb7
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php
@@ -0,0 +1,73 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+class DynamoDbHandlerTest extends TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('Aws\DynamoDb\DynamoDbClient')) {
+ $this->markTestSkipped('aws/aws-sdk-php not installed');
+ }
+
+ $this->client = $this->getMockBuilder('Aws\DynamoDb\DynamoDbClient')
+ ->setMethods(array('formatAttributes', '__call'))
+ ->disableOriginalConstructor()->getMock();
+ }
+
+ public function testConstruct()
+ {
+ $this->assertInstanceOf('Monolog\Handler\DynamoDbHandler', new DynamoDbHandler($this->client, 'foo'));
+ }
+
+ public function testInterface()
+ {
+ $this->assertInstanceOf('Monolog\Handler\HandlerInterface', new DynamoDbHandler($this->client, 'foo'));
+ }
+
+ public function testGetFormatter()
+ {
+ $handler = new DynamoDbHandler($this->client, 'foo');
+ $this->assertInstanceOf('Monolog\Formatter\ScalarFormatter', $handler->getFormatter());
+ }
+
+ public function testHandle()
+ {
+ $record = $this->getRecord();
+ $formatter = $this->getMock('Monolog\Formatter\FormatterInterface');
+ $formatted = array('foo' => 1, 'bar' => 2);
+ $handler = new DynamoDbHandler($this->client, 'foo');
+ $handler->setFormatter($formatter);
+
+ $formatter
+ ->expects($this->once())
+ ->method('format')
+ ->with($record)
+ ->will($this->returnValue($formatted));
+ $this->client
+ ->expects($this->once())
+ ->method('formatAttributes')
+ ->with($this->isType('array'))
+ ->will($this->returnValue($formatted));
+ $this->client
+ ->expects($this->once())
+ ->method('__call')
+ ->with('putItem', array(array(
+ 'TableName' => 'foo',
+ 'Item' => $formatted
+ )));
+
+ $handler->handle($record);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php
new file mode 100644
index 00000000..1687074b
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php
@@ -0,0 +1,239 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\ElasticaFormatter;
+use Monolog\Formatter\NormalizerFormatter;
+use Monolog\TestCase;
+use Monolog\Logger;
+use Elastica\Client;
+use Elastica\Request;
+use Elastica\Response;
+
+class ElasticSearchHandlerTest extends TestCase
+{
+ /**
+ * @var Client mock
+ */
+ protected $client;
+
+ /**
+ * @var array Default handler options
+ */
+ protected $options = array(
+ 'index' => 'my_index',
+ 'type' => 'doc_type',
+ );
+
+ public function setUp()
+ {
+ // Elastica lib required
+ if (!class_exists("Elastica\Client")) {
+ $this->markTestSkipped("ruflin/elastica not installed");
+ }
+
+ // base mock Elastica Client object
+ $this->client = $this->getMockBuilder('Elastica\Client')
+ ->setMethods(array('addDocuments'))
+ ->disableOriginalConstructor()
+ ->getMock();
+ }
+
+ /**
+ * @covers Monolog\Handler\ElasticSearchHandler::write
+ * @covers Monolog\Handler\ElasticSearchHandler::handleBatch
+ * @covers Monolog\Handler\ElasticSearchHandler::bulkSend
+ * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter
+ */
+ public function testHandle()
+ {
+ // log message
+ $msg = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ // format expected result
+ $formatter = new ElasticaFormatter($this->options['index'], $this->options['type']);
+ $expected = array($formatter->format($msg));
+
+ // setup ES client mock
+ $this->client->expects($this->any())
+ ->method('addDocuments')
+ ->with($expected);
+
+ // perform tests
+ $handler = new ElasticSearchHandler($this->client, $this->options);
+ $handler->handle($msg);
+ $handler->handleBatch(array($msg));
+ }
+
+ /**
+ * @covers Monolog\Handler\ElasticSearchHandler::setFormatter
+ */
+ public function testSetFormatter()
+ {
+ $handler = new ElasticSearchHandler($this->client);
+ $formatter = new ElasticaFormatter('index_new', 'type_new');
+ $handler->setFormatter($formatter);
+ $this->assertInstanceOf('Monolog\Formatter\ElasticaFormatter', $handler->getFormatter());
+ $this->assertEquals('index_new', $handler->getFormatter()->getIndex());
+ $this->assertEquals('type_new', $handler->getFormatter()->getType());
+ }
+
+ /**
+ * @covers Monolog\Handler\ElasticSearchHandler::setFormatter
+ * @expectedException InvalidArgumentException
+ * @expectedExceptionMessage ElasticSearchHandler is only compatible with ElasticaFormatter
+ */
+ public function testSetFormatterInvalid()
+ {
+ $handler = new ElasticSearchHandler($this->client);
+ $formatter = new NormalizerFormatter();
+ $handler->setFormatter($formatter);
+ }
+
+ /**
+ * @covers Monolog\Handler\ElasticSearchHandler::__construct
+ * @covers Monolog\Handler\ElasticSearchHandler::getOptions
+ */
+ public function testOptions()
+ {
+ $expected = array(
+ 'index' => $this->options['index'],
+ 'type' => $this->options['type'],
+ 'ignore_error' => false,
+ );
+ $handler = new ElasticSearchHandler($this->client, $this->options);
+ $this->assertEquals($expected, $handler->getOptions());
+ }
+
+ /**
+ * @covers Monolog\Handler\ElasticSearchHandler::bulkSend
+ * @dataProvider providerTestConnectionErrors
+ */
+ public function testConnectionErrors($ignore, $expectedError)
+ {
+ $clientOpts = array('host' => '127.0.0.1', 'port' => 1);
+ $client = new Client($clientOpts);
+ $handlerOpts = array('ignore_error' => $ignore);
+ $handler = new ElasticSearchHandler($client, $handlerOpts);
+
+ if ($expectedError) {
+ $this->setExpectedException($expectedError[0], $expectedError[1]);
+ $handler->handle($this->getRecord());
+ } else {
+ $this->assertFalse($handler->handle($this->getRecord()));
+ }
+ }
+
+ /**
+ * @return array
+ */
+ public function providerTestConnectionErrors()
+ {
+ return array(
+ array(false, array('RuntimeException', 'Error sending messages to Elasticsearch')),
+ array(true, false),
+ );
+ }
+
+ /**
+ * Integration test using localhost Elastic Search server
+ *
+ * @covers Monolog\Handler\ElasticSearchHandler::__construct
+ * @covers Monolog\Handler\ElasticSearchHandler::handleBatch
+ * @covers Monolog\Handler\ElasticSearchHandler::bulkSend
+ * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter
+ */
+ public function testHandleIntegration()
+ {
+ $msg = array(
+ 'level' => Logger::ERROR,
+ 'level_name' => 'ERROR',
+ 'channel' => 'meh',
+ 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+ 'datetime' => new \DateTime("@0"),
+ 'extra' => array(),
+ 'message' => 'log',
+ );
+
+ $expected = $msg;
+ $expected['datetime'] = $msg['datetime']->format(\DateTime::ISO8601);
+ $expected['context'] = array(
+ 'class' => '[object] (stdClass: {})',
+ 'foo' => 7,
+ 0 => 'bar',
+ );
+
+ $client = new Client();
+ $handler = new ElasticSearchHandler($client, $this->options);
+ try {
+ $handler->handleBatch(array($msg));
+ } catch (\RuntimeException $e) {
+ $this->markTestSkipped("Cannot connect to Elastic Search server on localhost");
+ }
+
+ // check document id from ES server response
+ $documentId = $this->getCreatedDocId($client->getLastResponse());
+ $this->assertNotEmpty($documentId, 'No elastic document id received');
+
+ // retrieve document source from ES and validate
+ $document = $this->getDocSourceFromElastic(
+ $client,
+ $this->options['index'],
+ $this->options['type'],
+ $documentId
+ );
+ $this->assertEquals($expected, $document);
+
+ // remove test index from ES
+ $client->request("/{$this->options['index']}", Request::DELETE);
+ }
+
+ /**
+ * Return last created document id from ES response
+ * @param Response $response Elastica Response object
+ * @return string|null
+ */
+ protected function getCreatedDocId(Response $response)
+ {
+ $data = $response->getData();
+ if (!empty($data['items'][0]['create']['_id'])) {
+ return $data['items'][0]['create']['_id'];
+ }
+ }
+
+ /**
+ * Retrieve document by id from Elasticsearch
+ * @param Client $client Elastica client
+ * @param string $index
+ * @param string $type
+ * @param string $documentId
+ * @return array
+ */
+ protected function getDocSourceFromElastic(Client $client, $index, $type, $documentId)
+ {
+ $resp = $client->request("/{$index}/{$type}/{$documentId}", Request::GET);
+ $data = $resp->getData();
+ if (!empty($data['_source'])) {
+ return $data['_source'];
+ }
+
+ return array();
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php
new file mode 100644
index 00000000..99785cbb
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php
@@ -0,0 +1,66 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+function error_log()
+{
+ $GLOBALS['error_log'][] = func_get_args();
+}
+
+class ErrorLogHandlerTest extends TestCase
+{
+ protected function setUp()
+ {
+ $GLOBALS['error_log'] = array();
+ }
+
+ /**
+ * @covers Monolog\Handler\ErrorLogHandler::__construct
+ * @expectedException InvalidArgumentException
+ * @expectedExceptionMessage The given message type "42" is not supported
+ */
+ public function testShouldNotAcceptAnInvalidTypeOnContructor()
+ {
+ new ErrorLogHandler(42);
+ }
+
+ /**
+ * @covers Monolog\Handler\ErrorLogHandler::write
+ */
+ public function testShouldLogMessagesUsingErrorLogFuncion()
+ {
+ $type = ErrorLogHandler::OPERATING_SYSTEM;
+ $handler = new ErrorLogHandler($type);
+ $handler->setFormatter(new LineFormatter('%channel%.%level_name%: %message% %context% %extra%', null, true));
+ $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
+
+ $this->assertSame("test.ERROR: Foo\nBar\r\n\r\nBaz [] []", $GLOBALS['error_log'][0][0]);
+ $this->assertSame($GLOBALS['error_log'][0][1], $type);
+
+ $handler = new ErrorLogHandler($type, Logger::DEBUG, true, true);
+ $handler->setFormatter(new LineFormatter(null, null, true));
+ $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
+
+ $this->assertStringMatchesFormat('[%s] test.ERROR: Foo', $GLOBALS['error_log'][1][0]);
+ $this->assertSame($GLOBALS['error_log'][1][1], $type);
+
+ $this->assertStringMatchesFormat('Bar', $GLOBALS['error_log'][2][0]);
+ $this->assertSame($GLOBALS['error_log'][2][1], $type);
+
+ $this->assertStringMatchesFormat('Baz [] []', $GLOBALS['error_log'][3][0]);
+ $this->assertSame($GLOBALS['error_log'][3][1], $type);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php
new file mode 100644
index 00000000..31b7686a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php
@@ -0,0 +1,170 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class FilterHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\FilterHandler::isHandling
+ */
+ public function testIsHandling()
+ {
+ $test = new TestHandler();
+ $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE);
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::INFO)));
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::NOTICE)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::WARNING)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::ERROR)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::CRITICAL)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::ALERT)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::EMERGENCY)));
+ }
+
+ /**
+ * @covers Monolog\Handler\FilterHandler::handle
+ * @covers Monolog\Handler\FilterHandler::setAcceptedLevels
+ * @covers Monolog\Handler\FilterHandler::isHandling
+ */
+ public function testHandleProcessOnlyNeededLevels()
+ {
+ $test = new TestHandler();
+ $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE);
+
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $this->assertFalse($test->hasDebugRecords());
+
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertTrue($test->hasInfoRecords());
+ $handler->handle($this->getRecord(Logger::NOTICE));
+ $this->assertTrue($test->hasNoticeRecords());
+
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertFalse($test->hasWarningRecords());
+ $handler->handle($this->getRecord(Logger::ERROR));
+ $this->assertFalse($test->hasErrorRecords());
+ $handler->handle($this->getRecord(Logger::CRITICAL));
+ $this->assertFalse($test->hasCriticalRecords());
+ $handler->handle($this->getRecord(Logger::ALERT));
+ $this->assertFalse($test->hasAlertRecords());
+ $handler->handle($this->getRecord(Logger::EMERGENCY));
+ $this->assertFalse($test->hasEmergencyRecords());
+
+ $test = new TestHandler();
+ $handler = new FilterHandler($test, array(Logger::INFO, Logger::ERROR));
+
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $this->assertFalse($test->hasDebugRecords());
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertTrue($test->hasInfoRecords());
+ $handler->handle($this->getRecord(Logger::NOTICE));
+ $this->assertFalse($test->hasNoticeRecords());
+ $handler->handle($this->getRecord(Logger::ERROR));
+ $this->assertTrue($test->hasErrorRecords());
+ $handler->handle($this->getRecord(Logger::CRITICAL));
+ $this->assertFalse($test->hasCriticalRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FilterHandler::setAcceptedLevels
+ * @covers Monolog\Handler\FilterHandler::getAcceptedLevels
+ */
+ public function testAcceptedLevelApi()
+ {
+ $test = new TestHandler();
+ $handler = new FilterHandler($test);
+
+ $levels = array(Logger::INFO, Logger::ERROR);
+ $handler->setAcceptedLevels($levels);
+ $this->assertSame($levels, $handler->getAcceptedLevels());
+
+ $handler->setAcceptedLevels(array('info', 'error'));
+ $this->assertSame($levels, $handler->getAcceptedLevels());
+
+ $levels = array(Logger::CRITICAL, Logger::ALERT, Logger::EMERGENCY);
+ $handler->setAcceptedLevels(Logger::CRITICAL, Logger::EMERGENCY);
+ $this->assertSame($levels, $handler->getAcceptedLevels());
+
+ $handler->setAcceptedLevels('critical', 'emergency');
+ $this->assertSame($levels, $handler->getAcceptedLevels());
+ }
+
+ /**
+ * @covers Monolog\Handler\FilterHandler::handle
+ */
+ public function testHandleUsesProcessors()
+ {
+ $test = new TestHandler();
+ $handler = new FilterHandler($test, Logger::DEBUG, Logger::EMERGENCY);
+ $handler->pushProcessor(
+ function ($record) {
+ $record['extra']['foo'] = true;
+
+ return $record;
+ }
+ );
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasWarningRecords());
+ $records = $test->getRecords();
+ $this->assertTrue($records[0]['extra']['foo']);
+ }
+
+ /**
+ * @covers Monolog\Handler\FilterHandler::handle
+ */
+ public function testHandleRespectsBubble()
+ {
+ $test = new TestHandler();
+
+ $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, false);
+ $this->assertTrue($handler->handle($this->getRecord(Logger::INFO)));
+ $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING)));
+
+ $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, true);
+ $this->assertFalse($handler->handle($this->getRecord(Logger::INFO)));
+ $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING)));
+ }
+
+ /**
+ * @covers Monolog\Handler\FilterHandler::handle
+ */
+ public function testHandleWithCallback()
+ {
+ $test = new TestHandler();
+ $handler = new FilterHandler(
+ function ($record, $handler) use ($test) {
+ return $test;
+ }, Logger::INFO, Logger::NOTICE, false
+ );
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FilterHandler::handle
+ * @expectedException \RuntimeException
+ */
+ public function testHandleWithBadCallbackThrowsException()
+ {
+ $handler = new FilterHandler(
+ function ($record, $handler) {
+ return 'foo';
+ }
+ );
+ $handler->handle($this->getRecord(Logger::WARNING));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php
new file mode 100644
index 00000000..8e31e9b8
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php
@@ -0,0 +1,255 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy;
+use Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy;
+use Psr\Log\LogLevel;
+
+class FingersCrossedHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::__construct
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ */
+ public function testHandleBuffers()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertFalse($test->hasInfoRecords());
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->close();
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 3);
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ */
+ public function testHandleStopsBufferingAfterTrigger()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test);
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->close();
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasDebugRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ * @covers Monolog\Handler\FingersCrossedHandler::reset
+ */
+ public function testHandleRestartBufferingAfterReset()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test);
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->reset();
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->close();
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertFalse($test->hasInfoRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ */
+ public function testHandleRestartBufferingAfterBeingTriggeredWhenStopBufferingIsDisabled()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, Logger::WARNING, 0, false, false);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->close();
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertFalse($test->hasInfoRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ */
+ public function testHandleBufferLimit()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, Logger::WARNING, 2);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasWarningRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertFalse($test->hasDebugRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ */
+ public function testHandleWithCallback()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler(function ($record, $handler) use ($test) {
+ return $test;
+ });
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertFalse($test->hasInfoRecords());
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 3);
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ * @expectedException RuntimeException
+ */
+ public function testHandleWithBadCallbackThrowsException()
+ {
+ $handler = new FingersCrossedHandler(function ($record, $handler) {
+ return 'foo';
+ });
+ $handler->handle($this->getRecord(Logger::WARNING));
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::isHandling
+ */
+ public function testIsHandlingAlways()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, Logger::ERROR);
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::__construct
+ * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct
+ * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated
+ */
+ public function testErrorLevelActivationStrategy()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $this->assertFalse($test->hasDebugRecords());
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::__construct
+ * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct
+ * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated
+ */
+ public function testErrorLevelActivationStrategyWithPsrLevel()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy('warning'));
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $this->assertFalse($test->hasDebugRecords());
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct
+ * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated
+ */
+ public function testChannelLevelActivationStrategy()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy(Logger::ERROR, array('othertest' => Logger::DEBUG)));
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertFalse($test->hasWarningRecords());
+ $record = $this->getRecord(Logger::DEBUG);
+ $record['channel'] = 'othertest';
+ $handler->handle($record);
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct
+ * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated
+ */
+ public function testChannelLevelActivationStrategyWithPsrLevels()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy('error', array('othertest' => 'debug')));
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertFalse($test->hasWarningRecords());
+ $record = $this->getRecord(Logger::DEBUG);
+ $record['channel'] = 'othertest';
+ $handler->handle($record);
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasWarningRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::handle
+ */
+ public function testHandleUsesProcessors()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, Logger::INFO);
+ $handler->pushProcessor(function ($record) {
+ $record['extra']['foo'] = true;
+
+ return $record;
+ });
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasWarningRecords());
+ $records = $test->getRecords();
+ $this->assertTrue($records[0]['extra']['foo']);
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::close
+ */
+ public function testPassthruOnClose()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, Logger::INFO);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->close();
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\FingersCrossedHandler::close
+ */
+ public function testPsrLevelPassthruOnClose()
+ {
+ $test = new TestHandler();
+ $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, LogLevel::INFO);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ $handler->close();
+ $this->assertFalse($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php
new file mode 100644
index 00000000..0eb10a63
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php
@@ -0,0 +1,96 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\FirePHPHandler
+ */
+class FirePHPHandlerTest extends TestCase
+{
+ public function setUp()
+ {
+ TestFirePHPHandler::reset();
+ $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; FirePHP/1.0';
+ }
+
+ public function testHeaders()
+ {
+ $handler = new TestFirePHPHandler;
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::WARNING));
+
+ $expected = array(
+ 'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
+ 'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
+ 'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
+ 'X-Wf-1-1-1-1' => 'test',
+ 'X-Wf-1-1-1-2' => 'test',
+ );
+
+ $this->assertEquals($expected, $handler->getHeaders());
+ }
+
+ public function testConcurrentHandlers()
+ {
+ $handler = new TestFirePHPHandler;
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::WARNING));
+
+ $handler2 = new TestFirePHPHandler;
+ $handler2->setFormatter($this->getIdentityFormatter());
+ $handler2->handle($this->getRecord(Logger::DEBUG));
+ $handler2->handle($this->getRecord(Logger::WARNING));
+
+ $expected = array(
+ 'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
+ 'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
+ 'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
+ 'X-Wf-1-1-1-1' => 'test',
+ 'X-Wf-1-1-1-2' => 'test',
+ );
+
+ $expected2 = array(
+ 'X-Wf-1-1-1-3' => 'test',
+ 'X-Wf-1-1-1-4' => 'test',
+ );
+
+ $this->assertEquals($expected, $handler->getHeaders());
+ $this->assertEquals($expected2, $handler2->getHeaders());
+ }
+}
+
+class TestFirePHPHandler extends FirePHPHandler
+{
+ protected $headers = array();
+
+ public static function reset()
+ {
+ self::$initialized = false;
+ self::$sendHeaders = true;
+ self::$messageIndex = 1;
+ }
+
+ protected function sendHeader($header, $content)
+ {
+ $this->headers[$header] = $content;
+ }
+
+ public function getHeaders()
+ {
+ return $this->headers;
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php
new file mode 100644
index 00000000..91cdd312
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php
@@ -0,0 +1,85 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Logger;
+use Monolog\TestCase;
+
+/**
+ * @coversDefaultClass \Monolog\Handler\FleepHookHandler
+ */
+class FleepHookHandlerTest extends TestCase
+{
+ /**
+ * Default token to use in tests
+ */
+ const TOKEN = '123abc';
+
+ /**
+ * @var FleepHookHandler
+ */
+ private $handler;
+
+ public function setUp()
+ {
+ parent::setUp();
+
+ if (!extension_loaded('openssl')) {
+ $this->markTestSkipped('This test requires openssl extension to run');
+ }
+
+ // Create instances of the handler and logger for convenience
+ $this->handler = new FleepHookHandler(self::TOKEN);
+ }
+
+ /**
+ * @covers ::__construct
+ */
+ public function testConstructorSetsExpectedDefaults()
+ {
+ $this->assertEquals(Logger::DEBUG, $this->handler->getLevel());
+ $this->assertEquals(true, $this->handler->getBubble());
+ }
+
+ /**
+ * @covers ::getDefaultFormatter
+ */
+ public function testHandlerUsesLineFormatterWhichIgnoresEmptyArrays()
+ {
+ $record = array(
+ 'message' => 'msg',
+ 'context' => array(),
+ 'level' => Logger::DEBUG,
+ 'level_name' => Logger::getLevelName(Logger::DEBUG),
+ 'channel' => 'channel',
+ 'datetime' => new \DateTime(),
+ 'extra' => array(),
+ );
+
+ $expectedFormatter = new LineFormatter(null, null, true, true);
+ $expected = $expectedFormatter->format($record);
+
+ $handlerFormatter = $this->handler->getFormatter();
+ $actual = $handlerFormatter->format($record);
+
+ $this->assertEquals($expected, $actual, 'Empty context and extra arrays should not be rendered');
+ }
+
+ /**
+ * @covers ::__construct
+ */
+ public function testConnectionStringisConstructedCorrectly()
+ {
+ $this->assertEquals('ssl://' . FleepHookHandler::FLEEP_HOST . ':443', $this->handler->getConnectionString());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php
new file mode 100644
index 00000000..4b120d51
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php
@@ -0,0 +1,88 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FlowdockFormatter;
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Dominik Liebler <liebler.dominik@gmail.com>
+ * @see https://www.hipchat.com/docs/api
+ */
+class FlowdockHandlerTest extends TestCase
+{
+ /**
+ * @var resource
+ */
+ private $res;
+
+ /**
+ * @var FlowdockHandler
+ */
+ private $handler;
+
+ public function setUp()
+ {
+ if (!extension_loaded('openssl')) {
+ $this->markTestSkipped('This test requires openssl to run');
+ }
+ }
+
+ public function testWriteHeader()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/v1\/messages\/team_inbox\/.* HTTP\/1.1\\r\\nHost: api.flowdock.com\\r\\nContent-Type: application\/json\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ /**
+ * @depends testWriteHeader
+ */
+ public function testWriteContent($content)
+ {
+ $this->assertRegexp('/"source":"test_source"/', $content);
+ $this->assertRegexp('/"from_address":"source@test\.com"/', $content);
+ }
+
+ private function createHandler($token = 'myToken')
+ {
+ $constructorArgs = array($token, Logger::DEBUG);
+ $this->res = fopen('php://memory', 'a');
+ $this->handler = $this->getMock(
+ '\Monolog\Handler\FlowdockHandler',
+ array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+ $constructorArgs
+ );
+
+ $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+ $reflectionProperty->setAccessible(true);
+ $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+ $this->handler->expects($this->any())
+ ->method('fsockopen')
+ ->will($this->returnValue($this->res));
+ $this->handler->expects($this->any())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(true));
+ $this->handler->expects($this->any())
+ ->method('closeSocket')
+ ->will($this->returnValue(true));
+
+ $this->handler->setFormatter(new FlowdockFormatter('test_source', 'source@test.com'));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php
new file mode 100644
index 00000000..9d007b13
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php
@@ -0,0 +1,95 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\Message;
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+class GelfHandlerLegacyTest extends TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('Gelf\MessagePublisher') || !class_exists('Gelf\Message')) {
+ $this->markTestSkipped("mlehner/gelf-php not installed");
+ }
+
+ require_once __DIR__ . '/GelfMockMessagePublisher.php';
+ }
+
+ /**
+ * @covers Monolog\Handler\GelfHandler::__construct
+ */
+ public function testConstruct()
+ {
+ $handler = new GelfHandler($this->getMessagePublisher());
+ $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler);
+ }
+
+ protected function getHandler($messagePublisher)
+ {
+ $handler = new GelfHandler($messagePublisher);
+
+ return $handler;
+ }
+
+ protected function getMessagePublisher()
+ {
+ return new GelfMockMessagePublisher('localhost');
+ }
+
+ public function testDebug()
+ {
+ $messagePublisher = $this->getMessagePublisher();
+ $handler = $this->getHandler($messagePublisher);
+
+ $record = $this->getRecord(Logger::DEBUG, "A test debug message");
+ $handler->handle($record);
+
+ $this->assertEquals(7, $messagePublisher->lastMessage->getLevel());
+ $this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
+ $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage());
+ $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
+ }
+
+ public function testWarning()
+ {
+ $messagePublisher = $this->getMessagePublisher();
+ $handler = $this->getHandler($messagePublisher);
+
+ $record = $this->getRecord(Logger::WARNING, "A test warning message");
+ $handler->handle($record);
+
+ $this->assertEquals(4, $messagePublisher->lastMessage->getLevel());
+ $this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
+ $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage());
+ $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
+ }
+
+ public function testInjectedGelfMessageFormatter()
+ {
+ $messagePublisher = $this->getMessagePublisher();
+ $handler = $this->getHandler($messagePublisher);
+
+ $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX'));
+
+ $record = $this->getRecord(Logger::WARNING, "A test warning message");
+ $record['extra']['blarg'] = 'yep';
+ $record['context']['from'] = 'logger';
+ $handler->handle($record);
+
+ $this->assertEquals('mysystem', $messagePublisher->lastMessage->getHost());
+ $this->assertArrayHasKey('_EXTblarg', $messagePublisher->lastMessage->toArray());
+ $this->assertArrayHasKey('_CTXfrom', $messagePublisher->lastMessage->toArray());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php
new file mode 100644
index 00000000..8cdd64f4
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php
@@ -0,0 +1,117 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\Message;
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+class GelfHandlerTest extends TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('Gelf\Publisher') || !class_exists('Gelf\Message')) {
+ $this->markTestSkipped("graylog2/gelf-php not installed");
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\GelfHandler::__construct
+ */
+ public function testConstruct()
+ {
+ $handler = new GelfHandler($this->getMessagePublisher());
+ $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler);
+ }
+
+ protected function getHandler($messagePublisher)
+ {
+ $handler = new GelfHandler($messagePublisher);
+
+ return $handler;
+ }
+
+ protected function getMessagePublisher()
+ {
+ return $this->getMock('Gelf\Publisher', array('publish'), array(), '', false);
+ }
+
+ public function testDebug()
+ {
+ $record = $this->getRecord(Logger::DEBUG, "A test debug message");
+ $expectedMessage = new Message();
+ $expectedMessage
+ ->setLevel(7)
+ ->setFacility("test")
+ ->setShortMessage($record['message'])
+ ->setTimestamp($record['datetime'])
+ ;
+
+ $messagePublisher = $this->getMessagePublisher();
+ $messagePublisher->expects($this->once())
+ ->method('publish')
+ ->with($expectedMessage);
+
+ $handler = $this->getHandler($messagePublisher);
+
+ $handler->handle($record);
+ }
+
+ public function testWarning()
+ {
+ $record = $this->getRecord(Logger::WARNING, "A test warning message");
+ $expectedMessage = new Message();
+ $expectedMessage
+ ->setLevel(4)
+ ->setFacility("test")
+ ->setShortMessage($record['message'])
+ ->setTimestamp($record['datetime'])
+ ;
+
+ $messagePublisher = $this->getMessagePublisher();
+ $messagePublisher->expects($this->once())
+ ->method('publish')
+ ->with($expectedMessage);
+
+ $handler = $this->getHandler($messagePublisher);
+
+ $handler->handle($record);
+ }
+
+ public function testInjectedGelfMessageFormatter()
+ {
+ $record = $this->getRecord(Logger::WARNING, "A test warning message");
+ $record['extra']['blarg'] = 'yep';
+ $record['context']['from'] = 'logger';
+
+ $expectedMessage = new Message();
+ $expectedMessage
+ ->setLevel(4)
+ ->setFacility("test")
+ ->setHost("mysystem")
+ ->setShortMessage($record['message'])
+ ->setTimestamp($record['datetime'])
+ ->setAdditional("EXTblarg", 'yep')
+ ->setAdditional("CTXfrom", 'logger')
+ ;
+
+ $messagePublisher = $this->getMessagePublisher();
+ $messagePublisher->expects($this->once())
+ ->method('publish')
+ ->with($expectedMessage);
+
+ $handler = $this->getHandler($messagePublisher);
+ $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX'));
+ $handler->handle($record);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php
new file mode 100644
index 00000000..873d92fb
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php
@@ -0,0 +1,25 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\MessagePublisher;
+use Gelf\Message;
+
+class GelfMockMessagePublisher extends MessagePublisher
+{
+ public function publish(Message $message)
+ {
+ $this->lastMessage = $message;
+ }
+
+ public $lastMessage = null;
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php
new file mode 100644
index 00000000..c6298a6e
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php
@@ -0,0 +1,89 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class GroupHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\GroupHandler::__construct
+ * @expectedException InvalidArgumentException
+ */
+ public function testConstructorOnlyTakesHandler()
+ {
+ new GroupHandler(array(new TestHandler(), "foo"));
+ }
+
+ /**
+ * @covers Monolog\Handler\GroupHandler::__construct
+ * @covers Monolog\Handler\GroupHandler::handle
+ */
+ public function testHandle()
+ {
+ $testHandlers = array(new TestHandler(), new TestHandler());
+ $handler = new GroupHandler($testHandlers);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ foreach ($testHandlers as $test) {
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 2);
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\GroupHandler::handleBatch
+ */
+ public function testHandleBatch()
+ {
+ $testHandlers = array(new TestHandler(), new TestHandler());
+ $handler = new GroupHandler($testHandlers);
+ $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
+ foreach ($testHandlers as $test) {
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 2);
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\GroupHandler::isHandling
+ */
+ public function testIsHandling()
+ {
+ $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING));
+ $handler = new GroupHandler($testHandlers);
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR)));
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\GroupHandler::handle
+ */
+ public function testHandleUsesProcessors()
+ {
+ $test = new TestHandler();
+ $handler = new GroupHandler(array($test));
+ $handler->pushProcessor(function ($record) {
+ $record['extra']['foo'] = true;
+
+ return $record;
+ });
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasWarningRecords());
+ $records = $test->getRecords();
+ $this->assertTrue($records[0]['extra']['foo']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php
new file mode 100644
index 00000000..ff773c98
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php
@@ -0,0 +1,240 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Rafael Dohms <rafael@doh.ms>
+ * @see https://www.hipchat.com/docs/api
+ */
+class HipChatHandlerTest extends TestCase
+{
+ private $res;
+ private $handler;
+
+ public function testWriteHeader()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: api.hipchat.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ public function testWriteCustomHostHeader()
+ {
+ $this->createHandler('myToken', 'room1', 'Monolog', true, 'hipchat.foo.bar');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ public function testWriteV2() {
+ $this->createHandler('myToken', 'room1', 'Monolog', false, 'hipchat.foo.bar', 'v2');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/v2\/room\/room1\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ public function testWriteV2Notify() {
+ $this->createHandler('myToken', 'room1', 'Monolog', true, 'hipchat.foo.bar', 'v2');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/v2\/room\/room1\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ public function testRoomSpaces() {
+ $this->createHandler('myToken', 'room name', 'Monolog', false, 'hipchat.foo.bar', 'v2');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/v2\/room\/room%20name\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ /**
+ * @depends testWriteHeader
+ */
+ public function testWriteContent($content)
+ {
+ $this->assertRegexp('/notify=0&message=test1&message_format=text&color=red&room_id=room1&from=Monolog$/', $content);
+ }
+
+ /**
+ * @depends testWriteCustomHostHeader
+ */
+ public function testWriteContentNotify($content)
+ {
+ $this->assertRegexp('/notify=1&message=test1&message_format=text&color=red&room_id=room1&from=Monolog$/', $content);
+ }
+
+ /**
+ * @depends testWriteV2
+ */
+ public function testWriteContentV2($content)
+ {
+ $this->assertRegexp('/notify=false&message=test1&message_format=text&color=red$/', $content);
+ }
+
+ /**
+ * @depends testWriteV2Notify
+ */
+ public function testWriteContentV2Notify($content)
+ {
+ $this->assertRegexp('/notify=true&message=test1&message_format=text&color=red$/', $content);
+ }
+
+ public function testWriteWithComplexMessage()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content);
+ }
+
+ /**
+ * @dataProvider provideLevelColors
+ */
+ public function testWriteWithErrorLevelsAndColors($level, $expectedColor)
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord($level, 'Backup of database "example" finished in 16 minutes.'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/color='.$expectedColor.'/', $content);
+ }
+
+ public function provideLevelColors()
+ {
+ return array(
+ array(Logger::DEBUG, 'gray'),
+ array(Logger::INFO, 'green'),
+ array(Logger::WARNING, 'yellow'),
+ array(Logger::ERROR, 'red'),
+ array(Logger::CRITICAL, 'red'),
+ array(Logger::ALERT, 'red'),
+ array(Logger::EMERGENCY,'red'),
+ array(Logger::NOTICE, 'green'),
+ );
+ }
+
+ /**
+ * @dataProvider provideBatchRecords
+ */
+ public function testHandleBatch($records, $expectedColor)
+ {
+ $this->createHandler();
+
+ $this->handler->handleBatch($records);
+
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/color='.$expectedColor.'/', $content);
+ }
+
+ public function provideBatchRecords()
+ {
+ return array(
+ array(
+ array(
+ array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()),
+ array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
+ array('level' => Logger::CRITICAL, 'message' => 'Everything is broken!', 'level_name' => 'critical', 'datetime' => new \DateTime())
+ ),
+ 'red',
+ ),
+ array(
+ array(
+ array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()),
+ array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
+ ),
+ 'yellow',
+ ),
+ array(
+ array(
+ array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()),
+ array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
+ ),
+ 'green',
+ ),
+ array(
+ array(
+ array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()),
+ ),
+ 'gray',
+ ),
+ );
+ }
+
+ private function createHandler($token = 'myToken', $room = 'room1', $name = 'Monolog', $notify = false, $host = 'api.hipchat.com', $version = 'v1')
+ {
+ $constructorArgs = array($token, $room, $name, $notify, Logger::DEBUG, true, true, 'text', $host, $version);
+ $this->res = fopen('php://memory', 'a');
+ $this->handler = $this->getMock(
+ '\Monolog\Handler\HipChatHandler',
+ array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+ $constructorArgs
+ );
+
+ $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+ $reflectionProperty->setAccessible(true);
+ $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+ $this->handler->expects($this->any())
+ ->method('fsockopen')
+ ->will($this->returnValue($this->res));
+ $this->handler->expects($this->any())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(true));
+ $this->handler->expects($this->any())
+ ->method('closeSocket')
+ ->will($this->returnValue(true));
+
+ $this->handler->setFormatter($this->getIdentityFormatter());
+ }
+
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testCreateWithTooLongName()
+ {
+ $hipChatHandler = new \Monolog\Handler\HipChatHandler('token', 'room', 'SixteenCharsHere');
+ }
+
+ public function testCreateWithTooLongNameV2() {
+ // creating a handler with too long of a name but using the v2 api doesn't matter.
+ $hipChatHandler = new \Monolog\Handler\HipChatHandler('token', 'room', 'SixteenCharsHere', false, Logger::CRITICAL, true, true, 'test', 'api.hipchat.com', 'v2');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php
new file mode 100644
index 00000000..7af60be8
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php
@@ -0,0 +1,84 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Robert Kaufmann III <rok3@rok3.me>
+ */
+class LogEntriesHandlerTest extends TestCase
+{
+ /**
+ * @var resource
+ */
+ private $res;
+
+ /**
+ * @var LogEntriesHandler
+ */
+ private $handler;
+
+ public function testWriteContent()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Critical write test'));
+
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] test.CRITICAL: Critical write test/', $content);
+ }
+
+ public function testWriteBatchContent()
+ {
+ $records = array(
+ $this->getRecord(),
+ $this->getRecord(),
+ $this->getRecord()
+ );
+ $this->createHandler();
+ $this->handler->handleBatch($records);
+
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/(testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] .* \[\] \[\]\n){3}/', $content);
+ }
+
+ private function createHandler()
+ {
+ $useSSL = extension_loaded('openssl');
+ $args = array('testToken', $useSSL, Logger::DEBUG, true);
+ $this->res = fopen('php://memory', 'a');
+ $this->handler = $this->getMock(
+ '\Monolog\Handler\LogEntriesHandler',
+ array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+ $args
+ );
+
+ $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+ $reflectionProperty->setAccessible(true);
+ $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+ $this->handler->expects($this->any())
+ ->method('fsockopen')
+ ->will($this->returnValue($this->res));
+ $this->handler->expects($this->any())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(true));
+ $this->handler->expects($this->any())
+ ->method('closeSocket')
+ ->will($this->returnValue(true));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php
new file mode 100644
index 00000000..6754f3d6
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php
@@ -0,0 +1,75 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class MailHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\MailHandler::handleBatch
+ */
+ public function testHandleBatch()
+ {
+ $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+ $formatter->expects($this->once())
+ ->method('formatBatch'); // Each record is formatted
+
+ $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+ $handler->expects($this->once())
+ ->method('send');
+ $handler->expects($this->never())
+ ->method('write'); // write is for individual records
+
+ $handler->setFormatter($formatter);
+
+ $handler->handleBatch($this->getMultipleRecords());
+ }
+
+ /**
+ * @covers Monolog\Handler\MailHandler::handleBatch
+ */
+ public function testHandleBatchNotSendsMailIfMessagesAreBelowLevel()
+ {
+ $records = array(
+ $this->getRecord(Logger::DEBUG, 'debug message 1'),
+ $this->getRecord(Logger::DEBUG, 'debug message 2'),
+ $this->getRecord(Logger::INFO, 'information'),
+ );
+
+ $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+ $handler->expects($this->never())
+ ->method('send');
+ $handler->setLevel(Logger::ERROR);
+
+ $handler->handleBatch($records);
+ }
+
+ /**
+ * @covers Monolog\Handler\MailHandler::write
+ */
+ public function testHandle()
+ {
+ $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+
+ $record = $this->getRecord();
+ $records = array($record);
+ $records[0]['formatted'] = '['.$record['datetime']->format('Y-m-d H:i:s').'] test.WARNING: test [] []'."\n";
+
+ $handler->expects($this->once())
+ ->method('send')
+ ->with($records[0]['formatted'], $records);
+
+ $handler->handle($record);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php b/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php
new file mode 100644
index 00000000..a0833225
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php
@@ -0,0 +1,27 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Raven_Client;
+
+class MockRavenClient extends Raven_Client
+{
+ public function capture($data, $stack, $vars = null)
+ {
+ $data = array_merge($this->get_user_data(), $data);
+ $this->lastData = $data;
+ $this->lastStack = $stack;
+ }
+
+ public $lastData;
+ public $lastStack;
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php
new file mode 100644
index 00000000..0fdef63a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php
@@ -0,0 +1,65 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class MongoDBHandlerTest extends TestCase
+{
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testConstructorShouldThrowExceptionForInvalidMongo()
+ {
+ new MongoDBHandler(new \stdClass(), 'DB', 'Collection');
+ }
+
+ public function testHandle()
+ {
+ $mongo = $this->getMock('Mongo', array('selectCollection'), array(), '', false);
+ $collection = $this->getMock('stdClass', array('save'));
+
+ $mongo->expects($this->once())
+ ->method('selectCollection')
+ ->with('DB', 'Collection')
+ ->will($this->returnValue($collection));
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $expected = array(
+ 'message' => 'test',
+ 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
+ 'level' => Logger::WARNING,
+ 'level_name' => 'WARNING',
+ 'channel' => 'test',
+ 'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
+ 'extra' => array(),
+ );
+
+ $collection->expects($this->once())
+ ->method('save')
+ ->with($expected);
+
+ $handler = new MongoDBHandler($mongo, 'DB', 'Collection');
+ $handler->handle($record);
+ }
+}
+
+if (!class_exists('Mongo')) {
+ class Mongo
+ {
+ public function selectCollection()
+ {
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php
new file mode 100644
index 00000000..c2553ee4
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php
@@ -0,0 +1,61 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+class NativeMailerHandlerTest extends TestCase
+{
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testConstructorHeaderInjection()
+ {
+ $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', "receiver@example.org\r\nFrom: faked@attacker.org");
+ }
+
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testSetterHeaderInjection()
+ {
+ $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+ $mailer->addHeader("Content-Type: text/html\r\nFrom: faked@attacker.org");
+ }
+
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testSetterArrayHeaderInjection()
+ {
+ $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+ $mailer->addHeader(array("Content-Type: text/html\r\nFrom: faked@attacker.org"));
+ }
+
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testSetterContentTypeInjection()
+ {
+ $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+ $mailer->setContentType("text/html\r\nFrom: faked@attacker.org");
+ }
+
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testSetterEncodingInjection()
+ {
+ $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+ $mailer->setEncoding("utf-8\r\nFrom: faked@attacker.org");
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php
new file mode 100644
index 00000000..4eda6155
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php
@@ -0,0 +1,192 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class NewRelicHandlerTest extends TestCase
+{
+ public static $appname;
+ public static $customParameters;
+ public static $transactionName;
+
+ public function setUp()
+ {
+ self::$appname = null;
+ self::$customParameters = array();
+ self::$transactionName = null;
+ }
+
+ /**
+ * @expectedException Monolog\Handler\MissingExtensionException
+ */
+ public function testThehandlerThrowsAnExceptionIfTheNRExtensionIsNotLoaded()
+ {
+ $handler = new StubNewRelicHandlerWithoutExtension();
+ $handler->handle($this->getRecord(Logger::ERROR));
+ }
+
+ public function testThehandlerCanHandleTheRecord()
+ {
+ $handler = new StubNewRelicHandler();
+ $handler->handle($this->getRecord(Logger::ERROR));
+ }
+
+ public function testThehandlerCanAddContextParamsToTheNewRelicTrace()
+ {
+ $handler = new StubNewRelicHandler();
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('a' => 'b')));
+ $this->assertEquals(array('context_a' => 'b'), self::$customParameters);
+ }
+
+ public function testThehandlerCanAddExplodedContextParamsToTheNewRelicTrace()
+ {
+ $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true);
+ $handler->handle($this->getRecord(
+ Logger::ERROR,
+ 'log message',
+ array('a' => array('key1' => 'value1', 'key2' => 'value2'))
+ ));
+ $this->assertEquals(
+ array('context_a_key1' => 'value1', 'context_a_key2' => 'value2'),
+ self::$customParameters
+ );
+ }
+
+ public function testThehandlerCanAddExtraParamsToTheNewRelicTrace()
+ {
+ $record = $this->getRecord(Logger::ERROR, 'log message');
+ $record['extra'] = array('c' => 'd');
+
+ $handler = new StubNewRelicHandler();
+ $handler->handle($record);
+
+ $this->assertEquals(array('extra_c' => 'd'), self::$customParameters);
+ }
+
+ public function testThehandlerCanAddExplodedExtraParamsToTheNewRelicTrace()
+ {
+ $record = $this->getRecord(Logger::ERROR, 'log message');
+ $record['extra'] = array('c' => array('key1' => 'value1', 'key2' => 'value2'));
+
+ $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true);
+ $handler->handle($record);
+
+ $this->assertEquals(
+ array('extra_c_key1' => 'value1', 'extra_c_key2' => 'value2'),
+ self::$customParameters
+ );
+ }
+
+ public function testThehandlerCanAddExtraContextAndParamsToTheNewRelicTrace()
+ {
+ $record = $this->getRecord(Logger::ERROR, 'log message', array('a' => 'b'));
+ $record['extra'] = array('c' => 'd');
+
+ $handler = new StubNewRelicHandler();
+ $handler->handle($record);
+
+ $expected = array(
+ 'context_a' => 'b',
+ 'extra_c' => 'd',
+ );
+
+ $this->assertEquals($expected, self::$customParameters);
+ }
+
+ public function testTheAppNameIsNullByDefault()
+ {
+ $handler = new StubNewRelicHandler();
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+ $this->assertEquals(null, self::$appname);
+ }
+
+ public function testTheAppNameCanBeInjectedFromtheConstructor()
+ {
+ $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName');
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+ $this->assertEquals('myAppName', self::$appname);
+ }
+
+ public function testTheAppNameCanBeOverriddenFromEachLog()
+ {
+ $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName');
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('appname' => 'logAppName')));
+
+ $this->assertEquals('logAppName', self::$appname);
+ }
+
+ public function testTheTransactionNameIsNullByDefault()
+ {
+ $handler = new StubNewRelicHandler();
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+ $this->assertEquals(null, self::$transactionName);
+ }
+
+ public function testTheTransactionNameCanBeInjectedFromTheConstructor()
+ {
+ $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction');
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+ $this->assertEquals('myTransaction', self::$transactionName);
+ }
+
+ public function testTheTransactionNameCanBeOverriddenFromEachLog()
+ {
+ $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction');
+ $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('transaction_name' => 'logTransactName')));
+
+ $this->assertEquals('logTransactName', self::$transactionName);
+ }
+}
+
+class StubNewRelicHandlerWithoutExtension extends NewRelicHandler
+{
+ protected function isNewRelicEnabled()
+ {
+ return false;
+ }
+}
+
+class StubNewRelicHandler extends NewRelicHandler
+{
+ protected function isNewRelicEnabled()
+ {
+ return true;
+ }
+}
+
+function newrelic_notice_error()
+{
+ return true;
+}
+
+function newrelic_set_appname($appname)
+{
+ return NewRelicHandlerTest::$appname = $appname;
+}
+
+function newrelic_name_transaction($transactionName)
+{
+ return NewRelicHandlerTest::$transactionName = $transactionName;
+}
+
+function newrelic_add_custom_parameter($key, $value)
+{
+ NewRelicHandlerTest::$customParameters[$key] = $value;
+
+ return true;
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php
new file mode 100644
index 00000000..292df78c
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php
@@ -0,0 +1,33 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\NullHandler::handle
+ */
+class NullHandlerTest extends TestCase
+{
+ public function testHandle()
+ {
+ $handler = new NullHandler();
+ $this->assertTrue($handler->handle($this->getRecord()));
+ }
+
+ public function testHandleLowerLevelRecord()
+ {
+ $handler = new NullHandler(Logger::WARNING);
+ $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php
new file mode 100644
index 00000000..81684c5e
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php
@@ -0,0 +1,271 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Exception;
+use Monolog\ErrorHandler;
+use Monolog\Logger;
+use Monolog\TestCase;
+use PhpConsole\Connector;
+use PhpConsole\Dispatcher\Debug as DebugDispatcher;
+use PhpConsole\Dispatcher\Errors as ErrorDispatcher;
+use PhpConsole\Handler;
+use PHPUnit_Framework_MockObject_MockObject;
+
+/**
+ * @covers Monolog\Handler\PHPConsoleHandler
+ * @author Sergey Barbushin https://www.linkedin.com/in/barbushin
+ */
+class PHPConsoleHandlerTest extends TestCase
+{
+
+ /** @var Connector|PHPUnit_Framework_MockObject_MockObject */
+ protected $connector;
+ /** @var DebugDispatcher|PHPUnit_Framework_MockObject_MockObject */
+ protected $debugDispatcher;
+ /** @var ErrorDispatcher|PHPUnit_Framework_MockObject_MockObject */
+ protected $errorDispatcher;
+
+ protected function setUp()
+ {
+ if (!class_exists('PhpConsole\Connector')) {
+ $this->markTestSkipped('PHP Console library not found. See https://github.com/barbushin/php-console#installation');
+ }
+ $this->connector = $this->initConnectorMock();
+
+ $this->debugDispatcher = $this->initDebugDispatcherMock($this->connector);
+ $this->connector->setDebugDispatcher($this->debugDispatcher);
+
+ $this->errorDispatcher = $this->initErrorDispatcherMock($this->connector);
+ $this->connector->setErrorsDispatcher($this->errorDispatcher);
+ }
+
+ protected function initDebugDispatcherMock(Connector $connector)
+ {
+ return $this->getMockBuilder('PhpConsole\Dispatcher\Debug')
+ ->disableOriginalConstructor()
+ ->setMethods(array('dispatchDebug'))
+ ->setConstructorArgs(array($connector, $connector->getDumper()))
+ ->getMock();
+ }
+
+ protected function initErrorDispatcherMock(Connector $connector)
+ {
+ return $this->getMockBuilder('PhpConsole\Dispatcher\Errors')
+ ->disableOriginalConstructor()
+ ->setMethods(array('dispatchError', 'dispatchException'))
+ ->setConstructorArgs(array($connector, $connector->getDumper()))
+ ->getMock();
+ }
+
+ protected function initConnectorMock()
+ {
+ $connector = $this->getMockBuilder('PhpConsole\Connector')
+ ->disableOriginalConstructor()
+ ->setMethods(array(
+ 'sendMessage',
+ 'onShutDown',
+ 'isActiveClient',
+ 'setSourcesBasePath',
+ 'setServerEncoding',
+ 'setPassword',
+ 'enableSslOnlyMode',
+ 'setAllowedIpMasks',
+ 'setHeadersLimit',
+ 'startEvalRequestsListener',
+ ))
+ ->getMock();
+
+ $connector->expects($this->any())
+ ->method('isActiveClient')
+ ->will($this->returnValue(true));
+
+ return $connector;
+ }
+
+ protected function getHandlerDefaultOption($name)
+ {
+ $handler = new PHPConsoleHandler(array(), $this->connector);
+ $options = $handler->getOptions();
+
+ return $options[$name];
+ }
+
+ protected function initLogger($handlerOptions = array(), $level = Logger::DEBUG)
+ {
+ return new Logger('test', array(
+ new PHPConsoleHandler($handlerOptions, $this->connector, $level)
+ ));
+ }
+
+ public function testInitWithDefaultConnector()
+ {
+ $handler = new PHPConsoleHandler();
+ $this->assertEquals(spl_object_hash(Connector::getInstance()), spl_object_hash($handler->getConnector()));
+ }
+
+ public function testInitWithCustomConnector()
+ {
+ $handler = new PHPConsoleHandler(array(), $this->connector);
+ $this->assertEquals(spl_object_hash($this->connector), spl_object_hash($handler->getConnector()));
+ }
+
+ public function testDebug()
+ {
+ $this->debugDispatcher->expects($this->once())->method('dispatchDebug')->with($this->equalTo('test'));
+ $this->initLogger()->addDebug('test');
+ }
+
+ public function testDebugContextInMessage()
+ {
+ $message = 'test';
+ $tag = 'tag';
+ $context = array($tag, 'custom' => mt_rand());
+ $expectedMessage = $message . ' ' . json_encode(array_slice($context, 1));
+ $this->debugDispatcher->expects($this->once())->method('dispatchDebug')->with(
+ $this->equalTo($expectedMessage),
+ $this->equalTo($tag)
+ );
+ $this->initLogger()->addDebug($message, $context);
+ }
+
+ public function testDebugTags($tagsContextKeys = null)
+ {
+ $expectedTags = mt_rand();
+ $logger = $this->initLogger($tagsContextKeys ? array('debugTagsKeysInContext' => $tagsContextKeys) : array());
+ if (!$tagsContextKeys) {
+ $tagsContextKeys = $this->getHandlerDefaultOption('debugTagsKeysInContext');
+ }
+ foreach ($tagsContextKeys as $key) {
+ $debugDispatcher = $this->initDebugDispatcherMock($this->connector);
+ $debugDispatcher->expects($this->once())->method('dispatchDebug')->with(
+ $this->anything(),
+ $this->equalTo($expectedTags)
+ );
+ $this->connector->setDebugDispatcher($debugDispatcher);
+ $logger->addDebug('test', array($key => $expectedTags));
+ }
+ }
+
+ public function testError($classesPartialsTraceIgnore = null)
+ {
+ $code = E_USER_NOTICE;
+ $message = 'message';
+ $file = __FILE__;
+ $line = __LINE__;
+ $this->errorDispatcher->expects($this->once())->method('dispatchError')->with(
+ $this->equalTo($code),
+ $this->equalTo($message),
+ $this->equalTo($file),
+ $this->equalTo($line),
+ $classesPartialsTraceIgnore ?: $this->equalTo($this->getHandlerDefaultOption('classesPartialsTraceIgnore'))
+ );
+ $errorHandler = ErrorHandler::register($this->initLogger($classesPartialsTraceIgnore ? array('classesPartialsTraceIgnore' => $classesPartialsTraceIgnore) : array()), false);
+ $errorHandler->registerErrorHandler(array(), false, E_USER_WARNING);
+ $errorHandler->handleError($code, $message, $file, $line);
+ }
+
+ public function testException()
+ {
+ $exception = new Exception();
+ $this->errorDispatcher->expects($this->once())->method('dispatchException')->with(
+ $this->equalTo($exception)
+ );
+ $errorHandler = ErrorHandler::register($this->initLogger(), false, false);
+ $errorHandler->registerExceptionHandler(null, false);
+ $errorHandler->handleException($exception);
+ }
+
+ /**
+ * @expectedException Exception
+ */
+ public function testWrongOptionsThrowsException()
+ {
+ new PHPConsoleHandler(array('xxx' => 1));
+ }
+
+ public function testOptionEnabled()
+ {
+ $this->debugDispatcher->expects($this->never())->method('dispatchDebug');
+ $this->initLogger(array('enabled' => false))->addDebug('test');
+ }
+
+ public function testOptionClassesPartialsTraceIgnore()
+ {
+ $this->testError(array('Class', 'Namespace\\'));
+ }
+
+ public function testOptionDebugTagsKeysInContext()
+ {
+ $this->testDebugTags(array('key1', 'key2'));
+ }
+
+ public function testOptionUseOwnErrorsAndExceptionsHandler()
+ {
+ $this->initLogger(array('useOwnErrorsHandler' => true, 'useOwnExceptionsHandler' => true));
+ $this->assertEquals(array(Handler::getInstance(), 'handleError'), set_error_handler(function () {
+ }));
+ $this->assertEquals(array(Handler::getInstance(), 'handleException'), set_exception_handler(function () {
+ }));
+ }
+
+ public static function provideConnectorMethodsOptionsSets()
+ {
+ return array(
+ array('sourcesBasePath', 'setSourcesBasePath', __DIR__),
+ array('serverEncoding', 'setServerEncoding', 'cp1251'),
+ array('password', 'setPassword', '******'),
+ array('enableSslOnlyMode', 'enableSslOnlyMode', true, false),
+ array('ipMasks', 'setAllowedIpMasks', array('127.0.0.*')),
+ array('headersLimit', 'setHeadersLimit', 2500),
+ array('enableEvalListener', 'startEvalRequestsListener', true, false),
+ );
+ }
+
+ /**
+ * @dataProvider provideConnectorMethodsOptionsSets
+ */
+ public function testOptionCallsConnectorMethod($option, $method, $value, $isArgument = true)
+ {
+ $expectCall = $this->connector->expects($this->once())->method($method);
+ if ($isArgument) {
+ $expectCall->with($value);
+ }
+ new PHPConsoleHandler(array($option => $value), $this->connector);
+ }
+
+ public function testOptionDetectDumpTraceAndSource()
+ {
+ new PHPConsoleHandler(array('detectDumpTraceAndSource' => true), $this->connector);
+ $this->assertTrue($this->connector->getDebugDispatcher()->detectTraceAndSource);
+ }
+
+ public static function provideDumperOptionsValues()
+ {
+ return array(
+ array('dumperLevelLimit', 'levelLimit', 1001),
+ array('dumperItemsCountLimit', 'itemsCountLimit', 1002),
+ array('dumperItemSizeLimit', 'itemSizeLimit', 1003),
+ array('dumperDumpSizeLimit', 'dumpSizeLimit', 1004),
+ array('dumperDetectCallbacks', 'detectCallbacks', true),
+ );
+ }
+
+ /**
+ * @dataProvider provideDumperOptionsValues
+ */
+ public function testDumperOptions($option, $dumperProperty, $value)
+ {
+ new PHPConsoleHandler(array($option => $value), $this->connector);
+ $this->assertEquals($value, $this->connector->getDumper()->$dumperProperty);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php
new file mode 100644
index 00000000..64eaab16
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php
@@ -0,0 +1,50 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\PsrHandler::handle
+ */
+class PsrHandlerTest extends TestCase
+{
+ public function logLevelProvider()
+ {
+ $levels = array();
+ $monologLogger = new Logger('');
+
+ foreach ($monologLogger->getLevels() as $levelName => $level) {
+ $levels[] = array($levelName, $level);
+ }
+
+ return $levels;
+ }
+
+ /**
+ * @dataProvider logLevelProvider
+ */
+ public function testHandlesAllLevels($levelName, $level)
+ {
+ $message = 'Hello, world! ' . $level;
+ $context = array('foo' => 'bar', 'level' => $level);
+
+ $psrLogger = $this->getMock('Psr\Log\NullLogger');
+ $psrLogger->expects($this->once())
+ ->method('log')
+ ->with(strtolower($levelName), $message, $context);
+
+ $handler = new PsrHandler($psrLogger);
+ $handler->handle(array('level' => $level, 'level_name' => $levelName, 'message' => $message, 'context' => $context));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php
new file mode 100644
index 00000000..89408236
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php
@@ -0,0 +1,141 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * Almost all examples (expected header, titles, messages) taken from
+ * https://www.pushover.net/api
+ * @author Sebastian Göttschkes <sebastian.goettschkes@googlemail.com>
+ * @see https://www.pushover.net/api
+ */
+class PushoverHandlerTest extends TestCase
+{
+ private $res;
+ private $handler;
+
+ public function testWriteHeader()
+ {
+ $this->createHandler();
+ $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/1\/messages.json HTTP\/1.1\\r\\nHost: api.pushover.net\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+ return $content;
+ }
+
+ /**
+ * @depends testWriteHeader
+ */
+ public function testWriteContent($content)
+ {
+ $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog&timestamp=\d{10}$/', $content);
+ }
+
+ public function testWriteWithComplexTitle()
+ {
+ $this->createHandler('myToken', 'myUser', 'Backup finished - SQL1', Logger::EMERGENCY);
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/title=Backup\+finished\+-\+SQL1/', $content);
+ }
+
+ public function testWriteWithComplexMessage()
+ {
+ $this->createHandler();
+ $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content);
+ }
+
+ public function testWriteWithTooLongMessage()
+ {
+ $message = str_pad('test', 520, 'a');
+ $this->createHandler();
+ $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, $message));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $expectedMessage = substr($message, 0, 505);
+
+ $this->assertRegexp('/message=' . $expectedMessage . '&title/', $content);
+ }
+
+ public function testWriteWithHighPriority()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog&timestamp=\d{10}&priority=1$/', $content);
+ }
+
+ public function testWriteWithEmergencyPriority()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog&timestamp=\d{10}&priority=2&retry=30&expire=25200$/', $content);
+ }
+
+ public function testWriteToMultipleUsers()
+ {
+ $this->createHandler('myToken', array('userA', 'userB'));
+ $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/token=myToken&user=userA&message=test1&title=Monolog&timestamp=\d{10}&priority=2&retry=30&expire=25200POST/', $content);
+ $this->assertRegexp('/token=myToken&user=userB&message=test1&title=Monolog&timestamp=\d{10}&priority=2&retry=30&expire=25200$/', $content);
+ }
+
+ private function createHandler($token = 'myToken', $user = 'myUser', $title = 'Monolog')
+ {
+ $constructorArgs = array($token, $user, $title);
+ $this->res = fopen('php://memory', 'a');
+ $this->handler = $this->getMock(
+ '\Monolog\Handler\PushoverHandler',
+ array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+ $constructorArgs
+ );
+
+ $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+ $reflectionProperty->setAccessible(true);
+ $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+ $this->handler->expects($this->any())
+ ->method('fsockopen')
+ ->will($this->returnValue($this->res));
+ $this->handler->expects($this->any())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(true));
+ $this->handler->expects($this->any())
+ ->method('closeSocket')
+ ->will($this->returnValue(true));
+
+ $this->handler->setFormatter($this->getIdentityFormatter());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php
new file mode 100644
index 00000000..9a9d1006
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php
@@ -0,0 +1,185 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+class RavenHandlerTest extends TestCase
+{
+ public function setUp()
+ {
+ if (!class_exists('Raven_Client')) {
+ $this->markTestSkipped('raven/raven not installed');
+ }
+
+ require_once __DIR__ . '/MockRavenClient.php';
+ }
+
+ /**
+ * @covers Monolog\Handler\RavenHandler::__construct
+ */
+ public function testConstruct()
+ {
+ $handler = new RavenHandler($this->getRavenClient());
+ $this->assertInstanceOf('Monolog\Handler\RavenHandler', $handler);
+ }
+
+ protected function getHandler($ravenClient)
+ {
+ $handler = new RavenHandler($ravenClient);
+
+ return $handler;
+ }
+
+ protected function getRavenClient()
+ {
+ $dsn = 'http://43f6017361224d098402974103bfc53d:a6a0538fc2934ba2bed32e08741b2cd3@marca.python.live.cheggnet.com:9000/1';
+
+ return new MockRavenClient($dsn);
+ }
+
+ public function testDebug()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ $record = $this->getRecord(Logger::DEBUG, 'A test debug message');
+ $handler->handle($record);
+
+ $this->assertEquals($ravenClient::DEBUG, $ravenClient->lastData['level']);
+ $this->assertContains($record['message'], $ravenClient->lastData['message']);
+ }
+
+ public function testWarning()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ $record = $this->getRecord(Logger::WARNING, 'A test warning message');
+ $handler->handle($record);
+
+ $this->assertEquals($ravenClient::WARNING, $ravenClient->lastData['level']);
+ $this->assertContains($record['message'], $ravenClient->lastData['message']);
+ }
+
+ public function testTag()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ $tags = array(1, 2, 'foo');
+ $record = $this->getRecord(Logger::INFO, 'test', array('tags' => $tags));
+ $handler->handle($record);
+
+ $this->assertEquals($tags, $ravenClient->lastData['tags']);
+ }
+
+ public function testUserContext()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ $recordWithNoContext = $this->getRecord(Logger::INFO, 'test with default user context');
+ // set user context 'externally'
+
+ $user = array(
+ 'id' => '123',
+ 'email' => 'test@test.com'
+ );
+
+ $recordWithContext = $this->getRecord(Logger::INFO, 'test', array('user' => $user));
+
+ $ravenClient->user_context(array('id' => 'test_user_id'));
+ // handle context
+ $handler->handle($recordWithContext);
+ $this->assertEquals($user, $ravenClient->lastData['sentry.interfaces.User']);
+
+ // check to see if its reset
+ $handler->handle($recordWithNoContext);
+ $this->assertInternalType('array', $ravenClient->context->user);
+ $this->assertSame('test_user_id', $ravenClient->context->user['id']);
+
+ // handle with null context
+ $ravenClient->user_context(null);
+ $handler->handle($recordWithContext);
+ $this->assertEquals($user, $ravenClient->lastData['sentry.interfaces.User']);
+
+ // check to see if its reset
+ $handler->handle($recordWithNoContext);
+ $this->assertNull($ravenClient->context->user);
+ }
+
+ public function testException()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ try {
+ $this->methodThatThrowsAnException();
+ } catch (\Exception $e) {
+ $record = $this->getRecord(Logger::ERROR, $e->getMessage(), array('exception' => $e));
+ $handler->handle($record);
+ }
+
+ $this->assertEquals($record['message'], $ravenClient->lastData['message']);
+ }
+
+ public function testHandleBatch()
+ {
+ $records = $this->getMultipleRecords();
+ $records[] = $this->getRecord(Logger::WARNING, 'warning');
+ $records[] = $this->getRecord(Logger::WARNING, 'warning');
+
+ $logFormatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+ $logFormatter->expects($this->once())->method('formatBatch');
+
+ $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+ $formatter->expects($this->once())->method('format')->with($this->callback(function ($record) {
+ return $record['level'] == 400;
+ }));
+
+ $handler = $this->getHandler($this->getRavenClient());
+ $handler->setBatchFormatter($logFormatter);
+ $handler->setFormatter($formatter);
+ $handler->handleBatch($records);
+ }
+
+ public function testHandleBatchDoNothingIfRecordsAreBelowLevel()
+ {
+ $records = array(
+ $this->getRecord(Logger::DEBUG, 'debug message 1'),
+ $this->getRecord(Logger::DEBUG, 'debug message 2'),
+ $this->getRecord(Logger::INFO, 'information'),
+ );
+
+ $handler = $this->getMock('Monolog\Handler\RavenHandler', null, array($this->getRavenClient()));
+ $handler->expects($this->never())->method('handle');
+ $handler->setLevel(Logger::ERROR);
+ $handler->handleBatch($records);
+ }
+
+ public function testGetSetBatchFormatter()
+ {
+ $ravenClient = $this->getRavenClient();
+ $handler = $this->getHandler($ravenClient);
+
+ $handler->setBatchFormatter($formatter = new LineFormatter());
+ $this->assertSame($formatter, $handler->getBatchFormatter());
+ }
+
+ private function methodThatThrowsAnException()
+ {
+ throw new \Exception('This is an exception');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php
new file mode 100644
index 00000000..3629f8a2
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php
@@ -0,0 +1,71 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+class RedisHandlerTest extends TestCase
+{
+ /**
+ * @expectedException InvalidArgumentException
+ */
+ public function testConstructorShouldThrowExceptionForInvalidRedis()
+ {
+ new RedisHandler(new \stdClass(), 'key');
+ }
+
+ public function testConstructorShouldWorkWithPredis()
+ {
+ $redis = $this->getMock('Predis\Client');
+ $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key'));
+ }
+
+ public function testConstructorShouldWorkWithRedis()
+ {
+ $redis = $this->getMock('Redis');
+ $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key'));
+ }
+
+ public function testPredisHandle()
+ {
+ $redis = $this->getMock('Predis\Client', array('rpush'));
+
+ // Predis\Client uses rpush
+ $redis->expects($this->once())
+ ->method('rpush')
+ ->with('key', 'test');
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $handler = new RedisHandler($redis, 'key');
+ $handler->setFormatter(new LineFormatter("%message%"));
+ $handler->handle($record);
+ }
+
+ public function testRedisHandle()
+ {
+ $redis = $this->getMock('Redis', array('rpush'));
+
+ // Redis uses rPush
+ $redis->expects($this->once())
+ ->method('rPush')
+ ->with('key', 'test');
+
+ $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+ $handler = new RedisHandler($redis, 'key');
+ $handler->setFormatter(new LineFormatter("%message%"));
+ $handler->handle($record);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php
new file mode 100644
index 00000000..f4cefda1
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php
@@ -0,0 +1,99 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class RotatingFileHandlerTest extends TestCase
+{
+ public function setUp()
+ {
+ $dir = __DIR__.'/Fixtures';
+ chmod($dir, 0777);
+ if (!is_writable($dir)) {
+ $this->markTestSkipped($dir.' must be writeable to test the RotatingFileHandler.');
+ }
+ }
+
+ public function testRotationCreatesNewFile()
+ {
+ touch(__DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot');
+
+ $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord());
+
+ $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+ $this->assertTrue(file_exists($log));
+ $this->assertEquals('test', file_get_contents($log));
+ }
+
+ /**
+ * @dataProvider rotationTests
+ */
+ public function testRotation($createFile)
+ {
+ touch($old1 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot');
+ touch($old2 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 2).'.rot');
+ touch($old3 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 3).'.rot');
+ touch($old4 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 4).'.rot');
+
+ $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+
+ if ($createFile) {
+ touch($log);
+ }
+
+ $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2);
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord());
+
+ $handler->close();
+
+ $this->assertTrue(file_exists($log));
+ $this->assertTrue(file_exists($old1));
+ $this->assertEquals($createFile, file_exists($old2));
+ $this->assertEquals($createFile, file_exists($old3));
+ $this->assertEquals($createFile, file_exists($old4));
+ $this->assertEquals('test', file_get_contents($log));
+ }
+
+ public function rotationTests()
+ {
+ return array(
+ 'Rotation is triggered when the file of the current day is not present'
+ => array(true),
+ 'Rotation is not triggered when the file is already present'
+ => array(false),
+ );
+ }
+
+ public function testReuseCurrentFile()
+ {
+ $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+ file_put_contents($log, "foo");
+ $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord());
+ $this->assertEquals('footest', file_get_contents($log));
+ }
+
+ public function tearDown()
+ {
+ foreach (glob(__DIR__.'/Fixtures/*.rot') as $file) {
+ unlink($file);
+ }
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php
new file mode 100644
index 00000000..b354cee1
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php
@@ -0,0 +1,33 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @covers Monolog\Handler\SamplingHandler::handle
+ */
+class SamplingHandlerTest extends TestCase
+{
+ public function testHandle()
+ {
+ $testHandler = new TestHandler();
+ $handler = new SamplingHandler($testHandler, 2);
+ for ($i = 0; $i < 10000; $i++) {
+ $handler->handle($this->getRecord());
+ }
+ $count = count($testHandler->getRecords());
+ // $count should be half of 10k, so between 4k and 6k
+ $this->assertLessThan(6000, $count);
+ $this->assertGreaterThan(4000, $count);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php
new file mode 100644
index 00000000..d657fae3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php
@@ -0,0 +1,133 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Greg Kedzierski <greg@gregkedzierski.com>
+ * @see https://api.slack.com/
+ */
+class SlackHandlerTest extends TestCase
+{
+ /**
+ * @var resource
+ */
+ private $res;
+
+ /**
+ * @var SlackHandler
+ */
+ private $handler;
+
+ public function setUp()
+ {
+ if (!extension_loaded('openssl')) {
+ $this->markTestSkipped('This test requires openssl to run');
+ }
+ }
+
+ public function testWriteHeader()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/POST \/api\/chat.postMessage HTTP\/1.1\\r\\nHost: slack.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+ }
+
+ public function testWriteContent()
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/token=myToken&channel=channel1&username=Monolog&text=&attachments=.*$/', $content);
+ }
+
+ public function testWriteContentWithEmoji()
+ {
+ $this->createHandler('myToken', 'channel1', 'Monolog', true, 'alien');
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/icon_emoji=%3Aalien%3A$/', $content);
+ }
+
+ /**
+ * @dataProvider provideLevelColors
+ */
+ public function testWriteContentWithColors($level, $expectedColor)
+ {
+ $this->createHandler();
+ $this->handler->handle($this->getRecord($level, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/color%22%3A%22'.$expectedColor.'/', $content);
+ }
+
+ public function testWriteContentWithPlainTextMessage()
+ {
+ $this->createHandler('myToken', 'channel1', 'Monolog', false);
+ $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+ fseek($this->res, 0);
+ $content = fread($this->res, 1024);
+
+ $this->assertRegexp('/text=test1/', $content);
+ }
+
+ public function provideLevelColors()
+ {
+ return array(
+ array(Logger::DEBUG, '%23e3e4e6'), // escaped #e3e4e6
+ array(Logger::INFO, 'good'),
+ array(Logger::NOTICE, 'good'),
+ array(Logger::WARNING, 'warning'),
+ array(Logger::ERROR, 'danger'),
+ array(Logger::CRITICAL, 'danger'),
+ array(Logger::ALERT, 'danger'),
+ array(Logger::EMERGENCY,'danger'),
+ );
+ }
+
+ private function createHandler($token = 'myToken', $channel = 'channel1', $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $useShortAttachment = false, $includeExtra = false)
+ {
+ $constructorArgs = array($token, $channel, $username, $useAttachment, $iconEmoji, Logger::DEBUG, true, $useShortAttachment, $includeExtra);
+ $this->res = fopen('php://memory', 'a');
+ $this->handler = $this->getMock(
+ '\Monolog\Handler\SlackHandler',
+ array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+ $constructorArgs
+ );
+
+ $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+ $reflectionProperty->setAccessible(true);
+ $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+ $this->handler->expects($this->any())
+ ->method('fsockopen')
+ ->will($this->returnValue($this->res));
+ $this->handler->expects($this->any())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(true));
+ $this->handler->expects($this->any())
+ ->method('closeSocket')
+ ->will($this->returnValue(true));
+
+ $this->handler->setFormatter($this->getIdentityFormatter());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php
new file mode 100644
index 00000000..2e3d504a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php
@@ -0,0 +1,282 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Pablo de Leon Belloc <pablolb@gmail.com>
+ */
+class SocketHandlerTest extends TestCase
+{
+ /**
+ * @var Monolog\Handler\SocketHandler
+ */
+ private $handler;
+
+ /**
+ * @var resource
+ */
+ private $res;
+
+ /**
+ * @expectedException UnexpectedValueException
+ */
+ public function testInvalidHostname()
+ {
+ $this->createHandler('garbage://here');
+ $this->writeRecord('data');
+ }
+
+ /**
+ * @expectedException \InvalidArgumentException
+ */
+ public function testBadConnectionTimeout()
+ {
+ $this->createHandler('localhost:1234');
+ $this->handler->setConnectionTimeout(-1);
+ }
+
+ public function testSetConnectionTimeout()
+ {
+ $this->createHandler('localhost:1234');
+ $this->handler->setConnectionTimeout(10.1);
+ $this->assertEquals(10.1, $this->handler->getConnectionTimeout());
+ }
+
+ /**
+ * @expectedException \InvalidArgumentException
+ */
+ public function testBadTimeout()
+ {
+ $this->createHandler('localhost:1234');
+ $this->handler->setTimeout(-1);
+ }
+
+ public function testSetTimeout()
+ {
+ $this->createHandler('localhost:1234');
+ $this->handler->setTimeout(10.25);
+ $this->assertEquals(10.25, $this->handler->getTimeout());
+ }
+
+ public function testSetConnectionString()
+ {
+ $this->createHandler('tcp://localhost:9090');
+ $this->assertEquals('tcp://localhost:9090', $this->handler->getConnectionString());
+ }
+
+ /**
+ * @expectedException UnexpectedValueException
+ */
+ public function testExceptionIsThrownOnFsockopenError()
+ {
+ $this->setMockHandler(array('fsockopen'));
+ $this->handler->expects($this->once())
+ ->method('fsockopen')
+ ->will($this->returnValue(false));
+ $this->writeRecord('Hello world');
+ }
+
+ /**
+ * @expectedException UnexpectedValueException
+ */
+ public function testExceptionIsThrownOnPfsockopenError()
+ {
+ $this->setMockHandler(array('pfsockopen'));
+ $this->handler->expects($this->once())
+ ->method('pfsockopen')
+ ->will($this->returnValue(false));
+ $this->handler->setPersistent(true);
+ $this->writeRecord('Hello world');
+ }
+
+ /**
+ * @expectedException UnexpectedValueException
+ */
+ public function testExceptionIsThrownIfCannotSetTimeout()
+ {
+ $this->setMockHandler(array('streamSetTimeout'));
+ $this->handler->expects($this->once())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(false));
+ $this->writeRecord('Hello world');
+ }
+
+ /**
+ * @expectedException RuntimeException
+ */
+ public function testWriteFailsOnIfFwriteReturnsFalse()
+ {
+ $this->setMockHandler(array('fwrite'));
+
+ $callback = function ($arg) {
+ $map = array(
+ 'Hello world' => 6,
+ 'world' => false,
+ );
+
+ return $map[$arg];
+ };
+
+ $this->handler->expects($this->exactly(2))
+ ->method('fwrite')
+ ->will($this->returnCallback($callback));
+
+ $this->writeRecord('Hello world');
+ }
+
+ /**
+ * @expectedException RuntimeException
+ */
+ public function testWriteFailsIfStreamTimesOut()
+ {
+ $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+ $callback = function ($arg) {
+ $map = array(
+ 'Hello world' => 6,
+ 'world' => 5,
+ );
+
+ return $map[$arg];
+ };
+
+ $this->handler->expects($this->exactly(1))
+ ->method('fwrite')
+ ->will($this->returnCallback($callback));
+ $this->handler->expects($this->exactly(1))
+ ->method('streamGetMetadata')
+ ->will($this->returnValue(array('timed_out' => true)));
+
+ $this->writeRecord('Hello world');
+ }
+
+ /**
+ * @expectedException RuntimeException
+ */
+ public function testWriteFailsOnIncompleteWrite()
+ {
+ $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+ $res = $this->res;
+ $callback = function ($string) use ($res) {
+ fclose($res);
+
+ return strlen('Hello');
+ };
+
+ $this->handler->expects($this->exactly(1))
+ ->method('fwrite')
+ ->will($this->returnCallback($callback));
+ $this->handler->expects($this->exactly(1))
+ ->method('streamGetMetadata')
+ ->will($this->returnValue(array('timed_out' => false)));
+
+ $this->writeRecord('Hello world');
+ }
+
+ public function testWriteWithMemoryFile()
+ {
+ $this->setMockHandler();
+ $this->writeRecord('test1');
+ $this->writeRecord('test2');
+ $this->writeRecord('test3');
+ fseek($this->res, 0);
+ $this->assertEquals('test1test2test3', fread($this->res, 1024));
+ }
+
+ public function testWriteWithMock()
+ {
+ $this->setMockHandler(array('fwrite'));
+
+ $callback = function ($arg) {
+ $map = array(
+ 'Hello world' => 6,
+ 'world' => 5,
+ );
+
+ return $map[$arg];
+ };
+
+ $this->handler->expects($this->exactly(2))
+ ->method('fwrite')
+ ->will($this->returnCallback($callback));
+
+ $this->writeRecord('Hello world');
+ }
+
+ public function testClose()
+ {
+ $this->setMockHandler();
+ $this->writeRecord('Hello world');
+ $this->assertInternalType('resource', $this->res);
+ $this->handler->close();
+ $this->assertFalse(is_resource($this->res), "Expected resource to be closed after closing handler");
+ }
+
+ public function testCloseDoesNotClosePersistentSocket()
+ {
+ $this->setMockHandler();
+ $this->handler->setPersistent(true);
+ $this->writeRecord('Hello world');
+ $this->assertTrue(is_resource($this->res));
+ $this->handler->close();
+ $this->assertTrue(is_resource($this->res));
+ }
+
+ private function createHandler($connectionString)
+ {
+ $this->handler = new SocketHandler($connectionString);
+ $this->handler->setFormatter($this->getIdentityFormatter());
+ }
+
+ private function writeRecord($string)
+ {
+ $this->handler->handle($this->getRecord(Logger::WARNING, $string));
+ }
+
+ private function setMockHandler(array $methods = array())
+ {
+ $this->res = fopen('php://memory', 'a');
+
+ $defaultMethods = array('fsockopen', 'pfsockopen', 'streamSetTimeout');
+ $newMethods = array_diff($methods, $defaultMethods);
+
+ $finalMethods = array_merge($defaultMethods, $newMethods);
+
+ $this->handler = $this->getMock(
+ '\Monolog\Handler\SocketHandler', $finalMethods, array('localhost:1234')
+ );
+
+ if (!in_array('fsockopen', $methods)) {
+ $this->handler->expects($this->any())
+ ->method('fsockopen')
+ ->will($this->returnValue($this->res));
+ }
+
+ if (!in_array('pfsockopen', $methods)) {
+ $this->handler->expects($this->any())
+ ->method('pfsockopen')
+ ->will($this->returnValue($this->res));
+ }
+
+ if (!in_array('streamSetTimeout', $methods)) {
+ $this->handler->expects($this->any())
+ ->method('streamSetTimeout')
+ ->will($this->returnValue(true));
+ }
+
+ $this->handler->setFormatter($this->getIdentityFormatter());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php
new file mode 100644
index 00000000..44d3d9f1
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php
@@ -0,0 +1,118 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class StreamHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWrite()
+ {
+ $handle = fopen('php://memory', 'a+');
+ $handler = new StreamHandler($handle);
+ $handler->setFormatter($this->getIdentityFormatter());
+ $handler->handle($this->getRecord(Logger::WARNING, 'test'));
+ $handler->handle($this->getRecord(Logger::WARNING, 'test2'));
+ $handler->handle($this->getRecord(Logger::WARNING, 'test3'));
+ fseek($handle, 0);
+ $this->assertEquals('testtest2test3', fread($handle, 100));
+ }
+
+ /**
+ * @covers Monolog\Handler\StreamHandler::close
+ */
+ public function testClose()
+ {
+ $handle = fopen('php://memory', 'a+');
+ $handler = new StreamHandler($handle);
+ $this->assertTrue(is_resource($handle));
+ $handler->close();
+ $this->assertFalse(is_resource($handle));
+ }
+
+ /**
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteCreatesTheStreamResource()
+ {
+ $handler = new StreamHandler('php://memory');
+ $handler->handle($this->getRecord());
+ }
+
+ /**
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteLocking()
+ {
+ $temp = sys_get_temp_dir() . DIRECTORY_SEPARATOR . 'monolog_locked_log';
+ $handler = new StreamHandler($temp, Logger::DEBUG, true, null, true);
+ $handler->handle($this->getRecord());
+ }
+
+ /**
+ * @expectedException LogicException
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteMissingResource()
+ {
+ $handler = new StreamHandler(null);
+ $handler->handle($this->getRecord());
+ }
+
+ public function invalidArgumentProvider()
+ {
+ return array(
+ array(1),
+ array(array()),
+ array(array('bogus://url')),
+ );
+ }
+
+ /**
+ * @dataProvider invalidArgumentProvider
+ * @expectedException InvalidArgumentException
+ * @covers Monolog\Handler\StreamHandler::__construct
+ */
+ public function testWriteInvalidArgument($invalidArgument)
+ {
+ $handler = new StreamHandler($invalidArgument);
+ }
+
+ /**
+ * @expectedException UnexpectedValueException
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteInvalidResource()
+ {
+ $handler = new StreamHandler('bogus://url');
+ $handler->handle($this->getRecord());
+ }
+
+ /**
+ * @expectedException UnexpectedValueException
+ * @covers Monolog\Handler\StreamHandler::__construct
+ * @covers Monolog\Handler\StreamHandler::write
+ */
+ public function testWriteNonExistingResource()
+ {
+ $handler = new StreamHandler('/foo/bar/baz/'.rand(0, 10000));
+ $handler->handle($this->getRecord());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php
new file mode 100644
index 00000000..ac885220
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php
@@ -0,0 +1,65 @@
+<?php
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class SwiftMailerHandlerTest extends TestCase
+{
+ /** @var \Swift_Mailer|\PHPUnit_Framework_MockObject_MockObject */
+ private $mailer;
+
+ public function setUp()
+ {
+ $this->mailer = $this
+ ->getMockBuilder('Swift_Mailer')
+ ->disableOriginalConstructor()
+ ->getMock();
+ }
+
+ public function testMessageCreationIsLazyWhenUsingCallback()
+ {
+ $this->mailer->expects($this->never())
+ ->method('send');
+
+ $callback = function () {
+ throw new \RuntimeException('Swift_Message creation callback should not have been called in this test');
+ };
+ $handler = new SwiftMailerHandler($this->mailer, $callback);
+
+ $records = array(
+ $this->getRecord(Logger::DEBUG),
+ $this->getRecord(Logger::INFO),
+ );
+ $handler->handleBatch($records);
+ }
+
+ public function testMessageCanBeCustomizedGivenLoggedData()
+ {
+ // Wire Mailer to expect a specific Swift_Message with a customized Subject
+ $expectedMessage = new \Swift_Message();
+ $this->mailer->expects($this->once())
+ ->method('send')
+ ->with($this->callback(function ($value) use ($expectedMessage) {
+ return $value instanceof \Swift_Message
+ && $value->getSubject() === 'Emergency'
+ && $value === $expectedMessage;
+ }));
+
+ // Callback dynamically changes subject based on number of logged records
+ $callback = function ($content, array $records) use ($expectedMessage) {
+ $subject = count($records) > 0 ? 'Emergency' : 'Normal';
+ $expectedMessage->setSubject($subject);
+
+ return $expectedMessage;
+ };
+ $handler = new SwiftMailerHandler($this->mailer, $callback);
+
+ // Logging 1 record makes this an Emergency
+ $records = array(
+ $this->getRecord(Logger::EMERGENCY),
+ );
+ $handler->handleBatch($records);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php
new file mode 100644
index 00000000..8f9e46bf
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php
@@ -0,0 +1,44 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+class SyslogHandlerTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @covers Monolog\Handler\SyslogHandler::__construct
+ */
+ public function testConstruct()
+ {
+ $handler = new SyslogHandler('test');
+ $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+ $handler = new SyslogHandler('test', LOG_USER);
+ $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+ $handler = new SyslogHandler('test', 'user');
+ $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+ $handler = new SyslogHandler('test', LOG_USER, Logger::DEBUG, true, LOG_PERROR);
+ $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+ }
+
+ /**
+ * @covers Monolog\Handler\SyslogHandler::__construct
+ */
+ public function testConstructInvalidFacility()
+ {
+ $this->setExpectedException('UnexpectedValueException');
+ $handler = new SyslogHandler('test', 'unknown');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php
new file mode 100644
index 00000000..497812b3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php
@@ -0,0 +1,49 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * @requires extension sockets
+ */
+class SyslogUdpHandlerTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @expectedException UnexpectedValueException
+ */
+ public function testWeValidateFacilities()
+ {
+ $handler = new SyslogUdpHandler("ip", null, "invalidFacility");
+ }
+
+ public function testWeSplitIntoLines()
+ {
+ $handler = new SyslogUdpHandler("127.0.0.1", 514, "authpriv");
+ $handler->setFormatter(new \Monolog\Formatter\ChromePHPFormatter());
+
+ $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('write'), array('lol', 'lol'));
+ $socket->expects($this->at(0))
+ ->method('write')
+ ->with("lol", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 ");
+ $socket->expects($this->at(1))
+ ->method('write')
+ ->with("hej", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 ");
+
+ $handler->setSocket($socket);
+
+ $handler->handle($this->getRecordWithMessage("hej\nlol"));
+ }
+
+ protected function getRecordWithMessage($msg)
+ {
+ return array('message' => $msg, 'level' => \Monolog\Logger::WARNING, 'context' => null, 'extra' => array(), 'channel' => 'lol');
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php
new file mode 100644
index 00000000..2a79fdc6
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php
@@ -0,0 +1,58 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\TestHandler
+ */
+class TestHandlerTest extends TestCase
+{
+ /**
+ * @dataProvider methodProvider
+ */
+ public function testHandler($method, $level)
+ {
+ $handler = new TestHandler;
+ $record = $this->getRecord($level, 'test'.$method);
+ $this->assertFalse($handler->{'has'.$method}($record));
+ $this->assertFalse($handler->{'has'.$method.'ThatContains'}('test'));
+ $this->assertFalse($handler->{'has'.$method.'Records'}());
+ $handler->handle($record);
+
+ $this->assertFalse($handler->{'has'.$method}('bar'));
+ $this->assertTrue($handler->{'has'.$method}($record));
+ $this->assertTrue($handler->{'has'.$method}('test'.$method));
+ $this->assertTrue($handler->{'has'.$method.'ThatContains'}('test'));
+ $this->assertTrue($handler->{'has'.$method.'Records'}());
+
+ $records = $handler->getRecords();
+ unset($records[0]['formatted']);
+ $this->assertEquals(array($record), $records);
+ }
+
+ public function methodProvider()
+ {
+ return array(
+ array('Emergency', Logger::EMERGENCY),
+ array('Alert' , Logger::ALERT),
+ array('Critical' , Logger::CRITICAL),
+ array('Error' , Logger::ERROR),
+ array('Warning' , Logger::WARNING),
+ array('Info' , Logger::INFO),
+ array('Notice' , Logger::NOTICE),
+ array('Debug' , Logger::DEBUG),
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php
new file mode 100644
index 00000000..bcaf52b3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php
@@ -0,0 +1,46 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @requires extension sockets
+ */
+class UdpSocketTest extends TestCase
+{
+ public function testWeDoNotTruncateShortMessages()
+ {
+ $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol'));
+
+ $socket->expects($this->at(0))
+ ->method('send')
+ ->with("HEADER: The quick brown fox jumps over the lazy dog");
+
+ $socket->write("The quick brown fox jumps over the lazy dog", "HEADER: ");
+ }
+
+ public function testLongMessagesAreTruncated()
+ {
+ $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol'));
+
+ $truncatedString = str_repeat("derp", 16254).'d';
+
+ $socket->expects($this->exactly(1))
+ ->method('send')
+ ->with("HEADER" . $truncatedString);
+
+ $longString = str_repeat("derp", 20000);
+
+ $socket->write($longString, "HEADER");
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php
new file mode 100644
index 00000000..8d37a1fc
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php
@@ -0,0 +1,121 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class WhatFailureGroupHandlerTest extends TestCase
+{
+ /**
+ * @covers Monolog\Handler\WhatFailureGroupHandler::__construct
+ * @expectedException InvalidArgumentException
+ */
+ public function testConstructorOnlyTakesHandler()
+ {
+ new WhatFailureGroupHandler(array(new TestHandler(), "foo"));
+ }
+
+ /**
+ * @covers Monolog\Handler\WhatFailureGroupHandler::__construct
+ * @covers Monolog\Handler\WhatFailureGroupHandler::handle
+ */
+ public function testHandle()
+ {
+ $testHandlers = array(new TestHandler(), new TestHandler());
+ $handler = new WhatFailureGroupHandler($testHandlers);
+ $handler->handle($this->getRecord(Logger::DEBUG));
+ $handler->handle($this->getRecord(Logger::INFO));
+ foreach ($testHandlers as $test) {
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 2);
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\WhatFailureGroupHandler::handleBatch
+ */
+ public function testHandleBatch()
+ {
+ $testHandlers = array(new TestHandler(), new TestHandler());
+ $handler = new WhatFailureGroupHandler($testHandlers);
+ $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
+ foreach ($testHandlers as $test) {
+ $this->assertTrue($test->hasDebugRecords());
+ $this->assertTrue($test->hasInfoRecords());
+ $this->assertTrue(count($test->getRecords()) === 2);
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\WhatFailureGroupHandler::isHandling
+ */
+ public function testIsHandling()
+ {
+ $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING));
+ $handler = new WhatFailureGroupHandler($testHandlers);
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR)));
+ $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING)));
+ $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+ }
+
+ /**
+ * @covers Monolog\Handler\WhatFailureGroupHandler::handle
+ */
+ public function testHandleUsesProcessors()
+ {
+ $test = new TestHandler();
+ $handler = new WhatFailureGroupHandler(array($test));
+ $handler->pushProcessor(function ($record) {
+ $record['extra']['foo'] = true;
+
+ return $record;
+ });
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasWarningRecords());
+ $records = $test->getRecords();
+ $this->assertTrue($records[0]['extra']['foo']);
+ }
+
+ /**
+ * @covers Monolog\Handler\WhatFailureGroupHandler::handle
+ */
+ public function testHandleException()
+ {
+ $test = new TestHandler();
+ $exception = new ExceptionTestHandler();
+ $handler = new WhatFailureGroupHandler(array($exception, $test, $exception));
+ $handler->pushProcessor(function ($record) {
+ $record['extra']['foo'] = true;
+
+ return $record;
+ });
+ $handler->handle($this->getRecord(Logger::WARNING));
+ $this->assertTrue($test->hasWarningRecords());
+ $records = $test->getRecords();
+ $this->assertTrue($records[0]['extra']['foo']);
+ }
+}
+
+class ExceptionTestHandler extends TestHandler
+{
+ /**
+ * {@inheritdoc}
+ */
+ public function handle(array $record)
+ {
+ parent::handle($record);
+
+ throw new \Exception("ExceptionTestHandler::handle");
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php
new file mode 100644
index 00000000..416039e6
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php
@@ -0,0 +1,69 @@
+<?php
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+class ZendMonitorHandlerTest extends TestCase
+{
+ protected $zendMonitorHandler;
+
+ public function setUp()
+ {
+ if (!function_exists('zend_monitor_custom_event')) {
+ $this->markTestSkipped('ZendServer is not installed');
+ }
+ }
+
+ /**
+ * @covers Monolog\Handler\ZendMonitorHandler::write
+ */
+ public function testWrite()
+ {
+ $record = $this->getRecord();
+ $formatterResult = array(
+ 'message' => $record['message']
+ );
+
+ $zendMonitor = $this->getMockBuilder('Monolog\Handler\ZendMonitorHandler')
+ ->setMethods(array('writeZendMonitorCustomEvent', 'getDefaultFormatter'))
+ ->getMock();
+
+ $formatterMock = $this->getMockBuilder('Monolog\Formatter\NormalizerFormatter')
+ ->disableOriginalConstructor()
+ ->getMock();
+
+ $formatterMock->expects($this->once())
+ ->method('format')
+ ->will($this->returnValue($formatterResult));
+
+ $zendMonitor->expects($this->once())
+ ->method('getDefaultFormatter')
+ ->will($this->returnValue($formatterMock));
+
+ $levelMap = $zendMonitor->getLevelMap();
+
+ $zendMonitor->expects($this->once())
+ ->method('writeZendMonitorCustomEvent')
+ ->with($levelMap[$record['level']], $record['message'], $formatterResult);
+
+ $zendMonitor->handle($record);
+ }
+
+ /**
+ * @covers Monolog\Handler\ZendMonitorHandler::getDefaultFormatter
+ */
+ public function testGetDefaultFormatterReturnsNormalizerFormatter()
+ {
+ $zendMonitor = new ZendMonitorHandler();
+ $this->assertInstanceOf('Monolog\Formatter\NormalizerFormatter', $zendMonitor->getDefaultFormatter());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/LoggerTest.php b/vendor/monolog/monolog/tests/Monolog/LoggerTest.php
new file mode 100644
index 00000000..146b6f1b
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/LoggerTest.php
@@ -0,0 +1,447 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Processor\WebProcessor;
+use Monolog\Handler\TestHandler;
+
+class LoggerTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @covers Monolog\Logger::getName
+ */
+ public function testGetName()
+ {
+ $logger = new Logger('foo');
+ $this->assertEquals('foo', $logger->getName());
+ }
+
+ /**
+ * @covers Monolog\Logger::getLevelName
+ */
+ public function testGetLevelName()
+ {
+ $this->assertEquals('ERROR', Logger::getLevelName(Logger::ERROR));
+ }
+
+ /**
+ * @covers Monolog\Logger::toMonologLevel
+ */
+ public function testConvertPSR3ToMonologLevel()
+ {
+ $this->assertEquals(Logger::toMonologLevel('debug'), 100);
+ $this->assertEquals(Logger::toMonologLevel('info'), 200);
+ $this->assertEquals(Logger::toMonologLevel('notice'), 250);
+ $this->assertEquals(Logger::toMonologLevel('warning'), 300);
+ $this->assertEquals(Logger::toMonologLevel('error'), 400);
+ $this->assertEquals(Logger::toMonologLevel('critical'), 500);
+ $this->assertEquals(Logger::toMonologLevel('alert'), 550);
+ $this->assertEquals(Logger::toMonologLevel('emergency'), 600);
+ }
+
+ /**
+ * @covers Monolog\Logger::getLevelName
+ * @expectedException InvalidArgumentException
+ */
+ public function testGetLevelNameThrows()
+ {
+ Logger::getLevelName(5);
+ }
+
+ /**
+ * @covers Monolog\Logger::__construct
+ */
+ public function testChannel()
+ {
+ $logger = new Logger('foo');
+ $handler = new TestHandler;
+ $logger->pushHandler($handler);
+ $logger->addWarning('test');
+ list($record) = $handler->getRecords();
+ $this->assertEquals('foo', $record['channel']);
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testLog()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'));
+ $handler->expects($this->once())
+ ->method('handle');
+ $logger->pushHandler($handler);
+
+ $this->assertTrue($logger->addWarning('test'));
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testLogNotHandled()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'), array(Logger::ERROR));
+ $handler->expects($this->never())
+ ->method('handle');
+ $logger->pushHandler($handler);
+
+ $this->assertFalse($logger->addWarning('test'));
+ }
+
+ public function testHandlersInCtor()
+ {
+ $handler1 = new TestHandler;
+ $handler2 = new TestHandler;
+ $logger = new Logger(__METHOD__, array($handler1, $handler2));
+
+ $this->assertEquals($handler1, $logger->popHandler());
+ $this->assertEquals($handler2, $logger->popHandler());
+ }
+
+ public function testProcessorsInCtor()
+ {
+ $processor1 = new WebProcessor;
+ $processor2 = new WebProcessor;
+ $logger = new Logger(__METHOD__, array(), array($processor1, $processor2));
+
+ $this->assertEquals($processor1, $logger->popProcessor());
+ $this->assertEquals($processor2, $logger->popProcessor());
+ }
+
+ /**
+ * @covers Monolog\Logger::pushHandler
+ * @covers Monolog\Logger::popHandler
+ * @expectedException LogicException
+ */
+ public function testPushPopHandler()
+ {
+ $logger = new Logger(__METHOD__);
+ $handler1 = new TestHandler;
+ $handler2 = new TestHandler;
+
+ $logger->pushHandler($handler1);
+ $logger->pushHandler($handler2);
+
+ $this->assertEquals($handler2, $logger->popHandler());
+ $this->assertEquals($handler1, $logger->popHandler());
+ $logger->popHandler();
+ }
+
+ /**
+ * @covers Monolog\Logger::pushProcessor
+ * @covers Monolog\Logger::popProcessor
+ * @expectedException LogicException
+ */
+ public function testPushPopProcessor()
+ {
+ $logger = new Logger(__METHOD__);
+ $processor1 = new WebProcessor;
+ $processor2 = new WebProcessor;
+
+ $logger->pushProcessor($processor1);
+ $logger->pushProcessor($processor2);
+
+ $this->assertEquals($processor2, $logger->popProcessor());
+ $this->assertEquals($processor1, $logger->popProcessor());
+ $logger->popProcessor();
+ }
+
+ /**
+ * @covers Monolog\Logger::pushProcessor
+ * @expectedException InvalidArgumentException
+ */
+ public function testPushProcessorWithNonCallable()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $logger->pushProcessor(new \stdClass());
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testProcessorsAreExecuted()
+ {
+ $logger = new Logger(__METHOD__);
+ $handler = new TestHandler;
+ $logger->pushHandler($handler);
+ $logger->pushProcessor(function ($record) {
+ $record['extra']['win'] = true;
+
+ return $record;
+ });
+ $logger->addError('test');
+ list($record) = $handler->getRecords();
+ $this->assertTrue($record['extra']['win']);
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testProcessorsAreCalledOnlyOnce()
+ {
+ $logger = new Logger(__METHOD__);
+ $handler = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler->expects($this->any())
+ ->method('handle')
+ ->will($this->returnValue(true))
+ ;
+ $logger->pushHandler($handler);
+
+ $processor = $this->getMockBuilder('Monolog\Processor\WebProcessor')
+ ->disableOriginalConstructor()
+ ->setMethods(array('__invoke'))
+ ->getMock()
+ ;
+ $processor->expects($this->once())
+ ->method('__invoke')
+ ->will($this->returnArgument(0))
+ ;
+ $logger->pushProcessor($processor);
+
+ $logger->addError('test');
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testProcessorsNotCalledWhenNotHandled()
+ {
+ $logger = new Logger(__METHOD__);
+ $handler = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler->expects($this->once())
+ ->method('isHandling')
+ ->will($this->returnValue(false))
+ ;
+ $logger->pushHandler($handler);
+ $that = $this;
+ $logger->pushProcessor(function ($record) use ($that) {
+ $that->fail('The processor should not be called');
+ });
+ $logger->addAlert('test');
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testHandlersNotCalledBeforeFirstHandling()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler1->expects($this->never())
+ ->method('isHandling')
+ ->will($this->returnValue(false))
+ ;
+ $handler1->expects($this->once())
+ ->method('handle')
+ ->will($this->returnValue(false))
+ ;
+ $logger->pushHandler($handler1);
+
+ $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler2->expects($this->once())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler2->expects($this->once())
+ ->method('handle')
+ ->will($this->returnValue(false))
+ ;
+ $logger->pushHandler($handler2);
+
+ $handler3 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler3->expects($this->once())
+ ->method('isHandling')
+ ->will($this->returnValue(false))
+ ;
+ $handler3->expects($this->never())
+ ->method('handle')
+ ;
+ $logger->pushHandler($handler3);
+
+ $logger->debug('test');
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testBubblingWhenTheHandlerReturnsFalse()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler1->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler1->expects($this->once())
+ ->method('handle')
+ ->will($this->returnValue(false))
+ ;
+ $logger->pushHandler($handler1);
+
+ $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler2->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler2->expects($this->once())
+ ->method('handle')
+ ->will($this->returnValue(false))
+ ;
+ $logger->pushHandler($handler2);
+
+ $logger->debug('test');
+ }
+
+ /**
+ * @covers Monolog\Logger::addRecord
+ */
+ public function testNotBubblingWhenTheHandlerReturnsTrue()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler1->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler1->expects($this->never())
+ ->method('handle')
+ ;
+ $logger->pushHandler($handler1);
+
+ $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler2->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+ $handler2->expects($this->once())
+ ->method('handle')
+ ->will($this->returnValue(true))
+ ;
+ $logger->pushHandler($handler2);
+
+ $logger->debug('test');
+ }
+
+ /**
+ * @covers Monolog\Logger::isHandling
+ */
+ public function testIsHandling()
+ {
+ $logger = new Logger(__METHOD__);
+
+ $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler1->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(false))
+ ;
+
+ $logger->pushHandler($handler1);
+ $this->assertFalse($logger->isHandling(Logger::DEBUG));
+
+ $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+ $handler2->expects($this->any())
+ ->method('isHandling')
+ ->will($this->returnValue(true))
+ ;
+
+ $logger->pushHandler($handler2);
+ $this->assertTrue($logger->isHandling(Logger::DEBUG));
+ }
+
+ /**
+ * @dataProvider logMethodProvider
+ * @covers Monolog\Logger::addDebug
+ * @covers Monolog\Logger::addInfo
+ * @covers Monolog\Logger::addNotice
+ * @covers Monolog\Logger::addWarning
+ * @covers Monolog\Logger::addError
+ * @covers Monolog\Logger::addCritical
+ * @covers Monolog\Logger::addAlert
+ * @covers Monolog\Logger::addEmergency
+ * @covers Monolog\Logger::debug
+ * @covers Monolog\Logger::info
+ * @covers Monolog\Logger::notice
+ * @covers Monolog\Logger::warn
+ * @covers Monolog\Logger::err
+ * @covers Monolog\Logger::crit
+ * @covers Monolog\Logger::alert
+ * @covers Monolog\Logger::emerg
+ */
+ public function testLogMethods($method, $expectedLevel)
+ {
+ $logger = new Logger('foo');
+ $handler = new TestHandler;
+ $logger->pushHandler($handler);
+ $logger->{$method}('test');
+ list($record) = $handler->getRecords();
+ $this->assertEquals($expectedLevel, $record['level']);
+ }
+
+ public function logMethodProvider()
+ {
+ return array(
+ // monolog methods
+ array('addDebug', Logger::DEBUG),
+ array('addInfo', Logger::INFO),
+ array('addNotice', Logger::NOTICE),
+ array('addWarning', Logger::WARNING),
+ array('addError', Logger::ERROR),
+ array('addCritical', Logger::CRITICAL),
+ array('addAlert', Logger::ALERT),
+ array('addEmergency', Logger::EMERGENCY),
+
+ // ZF/Sf2 compat methods
+ array('debug', Logger::DEBUG),
+ array('info', Logger::INFO),
+ array('notice', Logger::NOTICE),
+ array('warn', Logger::WARNING),
+ array('err', Logger::ERROR),
+ array('crit', Logger::CRITICAL),
+ array('alert', Logger::ALERT),
+ array('emerg', Logger::EMERGENCY),
+ );
+ }
+
+ /**
+ * @dataProvider setTimezoneProvider
+ * @covers Monolog\Logger::setTimezone
+ */
+ public function testSetTimezone($tz)
+ {
+ Logger::setTimezone($tz);
+ $logger = new Logger('foo');
+ $handler = new TestHandler;
+ $logger->pushHandler($handler);
+ $logger->info('test');
+ list($record) = $handler->getRecords();
+ $this->assertEquals($tz, $record['datetime']->getTimezone());
+ }
+
+ public function setTimezoneProvider()
+ {
+ return array_map(
+ function ($tz) { return array(new \DateTimeZone($tz)); },
+ \DateTimeZone::listIdentifiers()
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php
new file mode 100644
index 00000000..5adb505d
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php
@@ -0,0 +1,29 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class GitProcessorTest extends TestCase
+{
+ /**
+ * @covers Monolog\Processor\GitProcessor::__invoke
+ */
+ public function testProcessor()
+ {
+ $processor = new GitProcessor();
+ $record = $processor($this->getRecord());
+
+ $this->assertArrayHasKey('git', $record['extra']);
+ $this->assertTrue(!is_array($record['extra']['git']['branch']));
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php
new file mode 100644
index 00000000..0dd411d7
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php
@@ -0,0 +1,123 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Acme;
+
+class Tester
+{
+ public function test($handler, $record)
+ {
+ $handler->handle($record);
+ }
+}
+
+function tester($handler, $record)
+{
+ $handler->handle($record);
+}
+
+namespace Monolog\Processor;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+use Monolog\Handler\TestHandler;
+
+class IntrospectionProcessorTest extends TestCase
+{
+ public function getHandler()
+ {
+ $processor = new IntrospectionProcessor();
+ $handler = new TestHandler();
+ $handler->pushProcessor($processor);
+
+ return $handler;
+ }
+
+ public function testProcessorFromClass()
+ {
+ $handler = $this->getHandler();
+ $tester = new \Acme\Tester;
+ $tester->test($handler, $this->getRecord());
+ list($record) = $handler->getRecords();
+ $this->assertEquals(__FILE__, $record['extra']['file']);
+ $this->assertEquals(18, $record['extra']['line']);
+ $this->assertEquals('Acme\Tester', $record['extra']['class']);
+ $this->assertEquals('test', $record['extra']['function']);
+ }
+
+ public function testProcessorFromFunc()
+ {
+ $handler = $this->getHandler();
+ \Acme\tester($handler, $this->getRecord());
+ list($record) = $handler->getRecords();
+ $this->assertEquals(__FILE__, $record['extra']['file']);
+ $this->assertEquals(24, $record['extra']['line']);
+ $this->assertEquals(null, $record['extra']['class']);
+ $this->assertEquals('Acme\tester', $record['extra']['function']);
+ }
+
+ public function testLevelTooLow()
+ {
+ $input = array(
+ 'level' => Logger::DEBUG,
+ 'extra' => array(),
+ );
+
+ $expected = $input;
+
+ $processor = new IntrospectionProcessor(Logger::CRITICAL);
+ $actual = $processor($input);
+
+ $this->assertEquals($expected, $actual);
+ }
+
+ public function testLevelEqual()
+ {
+ $input = array(
+ 'level' => Logger::CRITICAL,
+ 'extra' => array(),
+ );
+
+ $expected = $input;
+ $expected['extra'] = array(
+ 'file' => null,
+ 'line' => null,
+ 'class' => 'ReflectionMethod',
+ 'function' => 'invokeArgs',
+ );
+
+ $processor = new IntrospectionProcessor(Logger::CRITICAL);
+ $actual = $processor($input);
+
+ $this->assertEquals($expected, $actual);
+ }
+
+ public function testLevelHigher()
+ {
+ $input = array(
+ 'level' => Logger::EMERGENCY,
+ 'extra' => array(),
+ );
+
+ $expected = $input;
+ $expected['extra'] = array(
+ 'file' => null,
+ 'line' => null,
+ 'class' => 'ReflectionMethod',
+ 'function' => 'invokeArgs',
+ );
+
+ $processor = new IntrospectionProcessor(Logger::CRITICAL);
+ $actual = $processor($input);
+
+ $this->assertEquals($expected, $actual);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php
new file mode 100644
index 00000000..eb666144
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php
@@ -0,0 +1,42 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class MemoryPeakUsageProcessorTest extends TestCase
+{
+ /**
+ * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke
+ * @covers Monolog\Processor\MemoryProcessor::formatBytes
+ */
+ public function testProcessor()
+ {
+ $processor = new MemoryPeakUsageProcessor();
+ $record = $processor($this->getRecord());
+ $this->assertArrayHasKey('memory_peak_usage', $record['extra']);
+ $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_peak_usage']);
+ }
+
+ /**
+ * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke
+ * @covers Monolog\Processor\MemoryProcessor::formatBytes
+ */
+ public function testProcessorWithoutFormatting()
+ {
+ $processor = new MemoryPeakUsageProcessor(true, false);
+ $record = $processor($this->getRecord());
+ $this->assertArrayHasKey('memory_peak_usage', $record['extra']);
+ $this->assertInternalType('int', $record['extra']['memory_peak_usage']);
+ $this->assertGreaterThan(0, $record['extra']['memory_peak_usage']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php
new file mode 100644
index 00000000..4692dbfc
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php
@@ -0,0 +1,42 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class MemoryUsageProcessorTest extends TestCase
+{
+ /**
+ * @covers Monolog\Processor\MemoryUsageProcessor::__invoke
+ * @covers Monolog\Processor\MemoryProcessor::formatBytes
+ */
+ public function testProcessor()
+ {
+ $processor = new MemoryUsageProcessor();
+ $record = $processor($this->getRecord());
+ $this->assertArrayHasKey('memory_usage', $record['extra']);
+ $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_usage']);
+ }
+
+ /**
+ * @covers Monolog\Processor\MemoryUsageProcessor::__invoke
+ * @covers Monolog\Processor\MemoryProcessor::formatBytes
+ */
+ public function testProcessorWithoutFormatting()
+ {
+ $processor = new MemoryUsageProcessor(true, false);
+ $record = $processor($this->getRecord());
+ $this->assertArrayHasKey('memory_usage', $record['extra']);
+ $this->assertInternalType('int', $record['extra']['memory_usage']);
+ $this->assertGreaterThan(0, $record['extra']['memory_usage']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php
new file mode 100644
index 00000000..458d2a33
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php
@@ -0,0 +1,30 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class ProcessIdProcessorTest extends TestCase
+{
+ /**
+ * @covers Monolog\Processor\ProcessIdProcessor::__invoke
+ */
+ public function testProcessor()
+ {
+ $processor = new ProcessIdProcessor();
+ $record = $processor($this->getRecord());
+ $this->assertArrayHasKey('process_id', $record['extra']);
+ $this->assertInternalType('int', $record['extra']['process_id']);
+ $this->assertGreaterThan(0, $record['extra']['process_id']);
+ $this->assertEquals(getmypid(), $record['extra']['process_id']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php
new file mode 100644
index 00000000..81bfbdc3
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php
@@ -0,0 +1,43 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+class PsrLogMessageProcessorTest extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @dataProvider getPairs
+ */
+ public function testReplacement($val, $expected)
+ {
+ $proc = new PsrLogMessageProcessor;
+
+ $message = $proc(array(
+ 'message' => '{foo}',
+ 'context' => array('foo' => $val)
+ ));
+ $this->assertEquals($expected, $message['message']);
+ }
+
+ public function getPairs()
+ {
+ return array(
+ array('foo', 'foo'),
+ array('3', '3'),
+ array(3, '3'),
+ array(null, ''),
+ array(true, '1'),
+ array(false, ''),
+ array(new \stdClass, '[object stdClass]'),
+ array(array(), '[array]'),
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php
new file mode 100644
index 00000000..851a9dc2
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php
@@ -0,0 +1,29 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class TagProcessorTest extends TestCase
+{
+ /**
+ * @covers Monolog\Processor\TagProcessor::__invoke
+ */
+ public function testProcessor()
+ {
+ $tags = array(1, 2, 3);
+ $processor = new TagProcessor($tags);
+ $record = $processor($this->getRecord());
+
+ $this->assertEquals($tags, $record['extra']['tags']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php
new file mode 100644
index 00000000..7ced62ca
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php
@@ -0,0 +1,27 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class UidProcessorTest extends TestCase
+{
+ /**
+ * @covers Monolog\Processor\UidProcessor::__invoke
+ */
+ public function testProcessor()
+ {
+ $processor = new UidProcessor();
+ $record = $processor($this->getRecord());
+ $this->assertArrayHasKey('uid', $record['extra']);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php
new file mode 100644
index 00000000..dba89412
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php
@@ -0,0 +1,98 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class WebProcessorTest extends TestCase
+{
+ public function testProcessor()
+ {
+ $server = array(
+ 'REQUEST_URI' => 'A',
+ 'REMOTE_ADDR' => 'B',
+ 'REQUEST_METHOD' => 'C',
+ 'HTTP_REFERER' => 'D',
+ 'SERVER_NAME' => 'F',
+ 'UNIQUE_ID' => 'G',
+ );
+
+ $processor = new WebProcessor($server);
+ $record = $processor($this->getRecord());
+ $this->assertEquals($server['REQUEST_URI'], $record['extra']['url']);
+ $this->assertEquals($server['REMOTE_ADDR'], $record['extra']['ip']);
+ $this->assertEquals($server['REQUEST_METHOD'], $record['extra']['http_method']);
+ $this->assertEquals($server['HTTP_REFERER'], $record['extra']['referrer']);
+ $this->assertEquals($server['SERVER_NAME'], $record['extra']['server']);
+ $this->assertEquals($server['UNIQUE_ID'], $record['extra']['unique_id']);
+ }
+
+ public function testProcessorDoNothingIfNoRequestUri()
+ {
+ $server = array(
+ 'REMOTE_ADDR' => 'B',
+ 'REQUEST_METHOD' => 'C',
+ );
+ $processor = new WebProcessor($server);
+ $record = $processor($this->getRecord());
+ $this->assertEmpty($record['extra']);
+ }
+
+ public function testProcessorReturnNullIfNoHttpReferer()
+ {
+ $server = array(
+ 'REQUEST_URI' => 'A',
+ 'REMOTE_ADDR' => 'B',
+ 'REQUEST_METHOD' => 'C',
+ 'SERVER_NAME' => 'F',
+ );
+ $processor = new WebProcessor($server);
+ $record = $processor($this->getRecord());
+ $this->assertNull($record['extra']['referrer']);
+ }
+
+ public function testProcessorDoesNotAddUniqueIdIfNotPresent()
+ {
+ $server = array(
+ 'REQUEST_URI' => 'A',
+ 'REMOTE_ADDR' => 'B',
+ 'REQUEST_METHOD' => 'C',
+ 'SERVER_NAME' => 'F',
+ );
+ $processor = new WebProcessor($server);
+ $record = $processor($this->getRecord());
+ $this->assertFalse(isset($record['extra']['unique_id']));
+ }
+
+ public function testProcessorAddsOnlyRequestedExtraFields()
+ {
+ $server = array(
+ 'REQUEST_URI' => 'A',
+ 'REMOTE_ADDR' => 'B',
+ 'REQUEST_METHOD' => 'C',
+ 'SERVER_NAME' => 'F',
+ );
+
+ $processor = new WebProcessor($server, array('url', 'http_method'));
+ $record = $processor($this->getRecord());
+
+ $this->assertSame(array('url' => 'A', 'http_method' => 'C'), $record['extra']);
+ }
+
+ /**
+ * @expectedException UnexpectedValueException
+ */
+ public function testInvalidData()
+ {
+ new WebProcessor(new \stdClass);
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php b/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php
new file mode 100644
index 00000000..ab899449
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php
@@ -0,0 +1,47 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\TestHandler;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Processor\PsrLogMessageProcessor;
+use Psr\Log\Test\LoggerInterfaceTest;
+
+class PsrLogCompatTest extends LoggerInterfaceTest
+{
+ private $handler;
+
+ public function getLogger()
+ {
+ $logger = new Logger('foo');
+ $logger->pushHandler($handler = new TestHandler);
+ $logger->pushProcessor(new PsrLogMessageProcessor);
+ $handler->setFormatter(new LineFormatter('%level_name% %message%'));
+
+ $this->handler = $handler;
+
+ return $logger;
+ }
+
+ public function getLogs()
+ {
+ $convert = function ($record) {
+ $lower = function ($match) {
+ return strtolower($match[0]);
+ };
+
+ return preg_replace_callback('{^[A-Z]+}', $lower, $record['formatted']);
+ };
+
+ return array_map($convert, $this->handler->getRecords());
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/RegistryTest.php b/vendor/monolog/monolog/tests/Monolog/RegistryTest.php
new file mode 100644
index 00000000..29925f8a
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/RegistryTest.php
@@ -0,0 +1,63 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+
+class RegistryTest extends \PHPUnit_Framework_TestCase
+{
+ protected function setUp()
+ {
+ Registry::clear();
+ }
+
+ /**
+ * @dataProvider hasLoggerProvider
+ * @covers Monolog\Registry::hasLogger
+ */
+ public function testHasLogger(array $loggersToAdd, array $loggersToCheck, array $expectedResult)
+ {
+ foreach ($loggersToAdd as $loggerToAdd) {
+ Registry::addLogger($loggerToAdd);
+ }
+ foreach ($loggersToCheck as $index => $loggerToCheck) {
+ $this->assertSame($expectedResult[$index], Registry::hasLogger($loggerToCheck));
+ }
+ }
+
+ public function hasLoggerProvider()
+ {
+ $logger1 = new Logger('test1');
+ $logger2 = new Logger('test2');
+ $logger3 = new Logger('test3');
+
+ return array(
+ // only instances
+ array(
+ array($logger1),
+ array($logger1, $logger2),
+ array(true, false),
+ ),
+ // only names
+ array(
+ array($logger1),
+ array('test1', 'test2'),
+ array(true, false),
+ ),
+ // mixed case
+ array(
+ array($logger1, $logger2),
+ array('test1', $logger2, 'test3', $logger3),
+ array(true, true, false, false),
+ ),
+ );
+ }
+}
diff --git a/vendor/monolog/monolog/tests/Monolog/TestCase.php b/vendor/monolog/monolog/tests/Monolog/TestCase.php
new file mode 100644
index 00000000..cae79340
--- /dev/null
+++ b/vendor/monolog/monolog/tests/Monolog/TestCase.php
@@ -0,0 +1,58 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+class TestCase extends \PHPUnit_Framework_TestCase
+{
+ /**
+ * @return array Record
+ */
+ protected function getRecord($level = Logger::WARNING, $message = 'test', $context = array())
+ {
+ return array(
+ 'message' => $message,
+ 'context' => $context,
+ 'level' => $level,
+ 'level_name' => Logger::getLevelName($level),
+ 'channel' => 'test',
+ 'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true))),
+ 'extra' => array(),
+ );
+ }
+
+ /**
+ * @return array
+ */
+ protected function getMultipleRecords()
+ {
+ return array(
+ $this->getRecord(Logger::DEBUG, 'debug message 1'),
+ $this->getRecord(Logger::DEBUG, 'debug message 2'),
+ $this->getRecord(Logger::INFO, 'information'),
+ $this->getRecord(Logger::WARNING, 'warning'),
+ $this->getRecord(Logger::ERROR, 'error')
+ );
+ }
+
+ /**
+ * @return Monolog\Formatter\FormatterInterface
+ */
+ protected function getIdentityFormatter()
+ {
+ $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+ $formatter->expects($this->any())
+ ->method('format')
+ ->will($this->returnCallback(function ($record) { return $record['message']; }));
+
+ return $formatter;
+ }
+}