diff options
Diffstat (limited to 'vendor/monolog/monolog')
159 files changed, 17785 insertions, 0 deletions
diff --git a/vendor/monolog/monolog/.php_cs b/vendor/monolog/monolog/.php_cs new file mode 100644 index 00000000..2511e98c --- /dev/null +++ b/vendor/monolog/monolog/.php_cs @@ -0,0 +1,15 @@ +<?php + +$finder = Symfony\CS\Finder\DefaultFinder::create() + ->files() + ->name('*.php') + ->in(__DIR__.'/src') + ->in(__DIR__.'/tests') +; + +return Symfony\CS\Config\Config::create() + ->fixers(array( + 'psr0', 'encoding', 'short_tag', 'braces', 'elseif', 'eof_ending', 'function_declaration', 'indentation', 'line_after_namespace', 'linefeed', 'lowercase_constants', 'lowercase_keywords', 'multiple_use', 'php_closing_tag', 'trailing_spaces', 'visibility', 'duplicate_semicolon', 'extra_empty_lines', 'include', 'namespace_no_leading_whitespace', 'object_operator', 'operators_spaces', 'phpdoc_params', 'return', 'single_array_no_trailing_comma', 'spaces_cast', 'standardize_not_equal', 'ternary_spaces', 'unused_use', 'whitespacy_lines', + )) + ->finder($finder) +; diff --git a/vendor/monolog/monolog/CHANGELOG.mdown b/vendor/monolog/monolog/CHANGELOG.mdown new file mode 100644 index 00000000..41d072e1 --- /dev/null +++ b/vendor/monolog/monolog/CHANGELOG.mdown @@ -0,0 +1,226 @@ +### 1.14.0 (2015-06-19) + + * Added PHPConsoleHandler to send record to Chrome's PHP Console extension and library + * Added support for objects implementing __toString in the NormalizerFormatter + * Added support for HipChat's v2 API in HipChatHandler + * Added Logger::setTimezone() to initialize the timezone monolog should use in case date.timezone isn't correct for your app + * Added an option to send formatted message instead of the raw record on PushoverHandler via ->useFormattedMessage(true) + * Fixed curl errors being silently suppressed + +### 1.13.1 (2015-03-09) + + * Fixed regression in HipChat requiring a new token to be created + +### 1.13.0 (2015-03-05) + + * Added Registry::hasLogger to check for the presence of a logger instance + * Added context.user support to RavenHandler + * Added HipChat API v2 support in the HipChatHandler + * Added NativeMailerHandler::addParameter to pass params to the mail() process + * Added context data to SlackHandler when $includeContextAndExtra is true + * Added ability to customize the Swift_Message per-email in SwiftMailerHandler + * Fixed SwiftMailerHandler to lazily create message instances if a callback is provided + * Fixed serialization of INF and NaN values in Normalizer and LineFormatter + +### 1.12.0 (2014-12-29) + + * Break: HandlerInterface::isHandling now receives a partial record containing only a level key. This was always the intent and does not break any Monolog handler but is strictly speaking a BC break and you should check if you relied on any other field in your own handlers. + * Added PsrHandler to forward records to another PSR-3 logger + * Added SamplingHandler to wrap around a handler and include only every Nth record + * Added MongoDBFormatter to support better storage with MongoDBHandler (it must be enabled manually for now) + * Added exception codes in the output of most formatters + * Added LineFormatter::includeStacktraces to enable exception stack traces in logs (uses more than one line) + * Added $useShortAttachment to SlackHandler to minify attachment size and $includeExtra to append extra data + * Added $host to HipChatHandler for users of private instances + * Added $transactionName to NewRelicHandler and support for a transaction_name context value + * Fixed MandrillHandler to avoid outputing API call responses + * Fixed some non-standard behaviors in SyslogUdpHandler + +### 1.11.0 (2014-09-30) + + * Break: The NewRelicHandler extra and context data are now prefixed with extra_ and context_ to avoid clashes. Watch out if you have scripts reading those from the API and rely on names + * Added WhatFailureGroupHandler to suppress any exception coming from the wrapped handlers and avoid chain failures if a logging service fails + * Added MandrillHandler to send emails via the Mandrillapp.com API + * Added SlackHandler to log records to a Slack.com account + * Added FleepHookHandler to log records to a Fleep.io account + * Added LogglyHandler::addTag to allow adding tags to an existing handler + * Added $ignoreEmptyContextAndExtra to LineFormatter to avoid empty [] at the end + * Added $useLocking to StreamHandler and RotatingFileHandler to enable flock() while writing + * Added support for PhpAmqpLib in the AmqpHandler + * Added FingersCrossedHandler::clear and BufferHandler::clear to reset them between batches in long running jobs + * Added support for adding extra fields from $_SERVER in the WebProcessor + * Fixed support for non-string values in PrsLogMessageProcessor + * Fixed SwiftMailer messages being sent with the wrong date in long running scripts + * Fixed minor PHP 5.6 compatibility issues + * Fixed BufferHandler::close being called twice + +### 1.10.0 (2014-06-04) + + * Added Logger::getHandlers() and Logger::getProcessors() methods + * Added $passthruLevel argument to FingersCrossedHandler to let it always pass some records through even if the trigger level is not reached + * Added support for extra data in NewRelicHandler + * Added $expandNewlines flag to the ErrorLogHandler to create multiple log entries when a message has multiple lines + +### 1.9.1 (2014-04-24) + + * Fixed regression in RotatingFileHandler file permissions + * Fixed initialization of the BufferHandler to make sure it gets flushed after receiving records + * Fixed ChromePHPHandler and FirePHPHandler's activation strategies to be more conservative + +### 1.9.0 (2014-04-20) + + * Added LogEntriesHandler to send logs to a LogEntries account + * Added $filePermissions to tweak file mode on StreamHandler and RotatingFileHandler + * Added $useFormatting flag to MemoryProcessor to make it send raw data in bytes + * Added support for table formatting in FirePHPHandler via the table context key + * Added a TagProcessor to add tags to records, and support for tags in RavenHandler + * Added $appendNewline flag to the JsonFormatter to enable using it when logging to files + * Added sound support to the PushoverHandler + * Fixed multi-threading support in StreamHandler + * Fixed empty headers issue when ChromePHPHandler received no records + * Fixed default format of the ErrorLogHandler + +### 1.8.0 (2014-03-23) + + * Break: the LineFormatter now strips newlines by default because this was a bug, set $allowInlineLineBreaks to true if you need them + * Added BrowserConsoleHandler to send logs to any browser's console via console.log() injection in the output + * Added FilterHandler to filter records and only allow those of a given list of levels through to the wrapped handler + * Added FlowdockHandler to send logs to a Flowdock account + * Added RollbarHandler to send logs to a Rollbar account + * Added HtmlFormatter to send prettier log emails with colors for each log level + * Added GitProcessor to add the current branch/commit to extra record data + * Added a Monolog\Registry class to allow easier global access to pre-configured loggers + * Added support for the new official graylog2/gelf-php lib for GelfHandler, upgrade if you can by replacing the mlehner/gelf-php requirement + * Added support for HHVM + * Added support for Loggly batch uploads + * Added support for tweaking the content type and encoding in NativeMailerHandler + * Added $skipClassesPartials to tweak the ignored classes in the IntrospectionProcessor + * Fixed batch request support in GelfHandler + +### 1.7.0 (2013-11-14) + + * Added ElasticSearchHandler to send logs to an Elastic Search server + * Added DynamoDbHandler and ScalarFormatter to send logs to Amazon's Dynamo DB + * Added SyslogUdpHandler to send logs to a remote syslogd server + * Added LogglyHandler to send logs to a Loggly account + * Added $level to IntrospectionProcessor so it only adds backtraces when needed + * Added $version to LogstashFormatter to allow using the new v1 Logstash format + * Added $appName to NewRelicHandler + * Added configuration of Pushover notification retries/expiry + * Added $maxColumnWidth to NativeMailerHandler to change the 70 chars default + * Added chainability to most setters for all handlers + * Fixed RavenHandler batch processing so it takes the message from the record with highest priority + * Fixed HipChatHandler batch processing so it sends all messages at once + * Fixed issues with eAccelerator + * Fixed and improved many small things + +### 1.6.0 (2013-07-29) + + * Added HipChatHandler to send logs to a HipChat chat room + * Added ErrorLogHandler to send logs to PHP's error_log function + * Added NewRelicHandler to send logs to NewRelic's service + * Added Monolog\ErrorHandler helper class to register a Logger as exception/error/fatal handler + * Added ChannelLevelActivationStrategy for the FingersCrossedHandler to customize levels by channel + * Added stack traces output when normalizing exceptions (json output & co) + * Added Monolog\Logger::API constant (currently 1) + * Added support for ChromePHP's v4.0 extension + * Added support for message priorities in PushoverHandler, see $highPriorityLevel and $emergencyLevel + * Added support for sending messages to multiple users at once with the PushoverHandler + * Fixed RavenHandler's support for batch sending of messages (when behind a Buffer or FingersCrossedHandler) + * Fixed normalization of Traversables with very large data sets, only the first 1000 items are shown now + * Fixed issue in RotatingFileHandler when an open_basedir restriction is active + * Fixed minor issues in RavenHandler and bumped the API to Raven 0.5.0 + * Fixed SyslogHandler issue when many were used concurrently with different facilities + +### 1.5.0 (2013-04-23) + + * Added ProcessIdProcessor to inject the PID in log records + * Added UidProcessor to inject a unique identifier to all log records of one request/run + * Added support for previous exceptions in the LineFormatter exception serialization + * Added Monolog\Logger::getLevels() to get all available levels + * Fixed ChromePHPHandler so it avoids sending headers larger than Chrome can handle + +### 1.4.1 (2013-04-01) + + * Fixed exception formatting in the LineFormatter to be more minimalistic + * Fixed RavenHandler's handling of context/extra data, requires Raven client >0.1.0 + * Fixed log rotation in RotatingFileHandler to work with long running scripts spanning multiple days + * Fixed WebProcessor array access so it checks for data presence + * Fixed Buffer, Group and FingersCrossed handlers to make use of their processors + +### 1.4.0 (2013-02-13) + + * Added RedisHandler to log to Redis via the Predis library or the phpredis extension + * Added ZendMonitorHandler to log to the Zend Server monitor + * Added the possibility to pass arrays of handlers and processors directly in the Logger constructor + * Added `$useSSL` option to the PushoverHandler which is enabled by default + * Fixed ChromePHPHandler and FirePHPHandler issue when multiple instances are used simultaneously + * Fixed header injection capability in the NativeMailHandler + +### 1.3.1 (2013-01-11) + + * Fixed LogstashFormatter to be usable with stream handlers + * Fixed GelfMessageFormatter levels on Windows + +### 1.3.0 (2013-01-08) + + * Added PSR-3 compliance, the `Monolog\Logger` class is now an instance of `Psr\Log\LoggerInterface` + * Added PsrLogMessageProcessor that you can selectively enable for full PSR-3 compliance + * Added LogstashFormatter (combine with SocketHandler or StreamHandler to send logs to Logstash) + * Added PushoverHandler to send mobile notifications + * Added CouchDBHandler and DoctrineCouchDBHandler + * Added RavenHandler to send data to Sentry servers + * Added support for the new MongoClient class in MongoDBHandler + * Added microsecond precision to log records' timestamps + * Added `$flushOnOverflow` param to BufferHandler to flush by batches instead of losing + the oldest entries + * Fixed normalization of objects with cyclic references + +### 1.2.1 (2012-08-29) + + * Added new $logopts arg to SyslogHandler to provide custom openlog options + * Fixed fatal error in SyslogHandler + +### 1.2.0 (2012-08-18) + + * Added AmqpHandler (for use with AMQP servers) + * Added CubeHandler + * Added NativeMailerHandler::addHeader() to send custom headers in mails + * Added the possibility to specify more than one recipient in NativeMailerHandler + * Added the possibility to specify float timeouts in SocketHandler + * Added NOTICE and EMERGENCY levels to conform with RFC 5424 + * Fixed the log records to use the php default timezone instead of UTC + * Fixed BufferHandler not being flushed properly on PHP fatal errors + * Fixed normalization of exotic resource types + * Fixed the default format of the SyslogHandler to avoid duplicating datetimes in syslog + +### 1.1.0 (2012-04-23) + + * Added Monolog\Logger::isHandling() to check if a handler will + handle the given log level + * Added ChromePHPHandler + * Added MongoDBHandler + * Added GelfHandler (for use with Graylog2 servers) + * Added SocketHandler (for use with syslog-ng for example) + * Added NormalizerFormatter + * Added the possibility to change the activation strategy of the FingersCrossedHandler + * Added possibility to show microseconds in logs + * Added `server` and `referer` to WebProcessor output + +### 1.0.2 (2011-10-24) + + * Fixed bug in IE with large response headers and FirePHPHandler + +### 1.0.1 (2011-08-25) + + * Added MemoryPeakUsageProcessor and MemoryUsageProcessor + * Added Monolog\Logger::getName() to get a logger's channel name + +### 1.0.0 (2011-07-06) + + * Added IntrospectionProcessor to get info from where the logger was called + * Fixed WebProcessor in CLI + +### 1.0.0-RC1 (2011-07-01) + + * Initial release diff --git a/vendor/monolog/monolog/LICENSE b/vendor/monolog/monolog/LICENSE new file mode 100644 index 00000000..56e08d55 --- /dev/null +++ b/vendor/monolog/monolog/LICENSE @@ -0,0 +1,19 @@ +Copyright (c) 2011-2015 Jordi Boggiano + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is furnished +to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/vendor/monolog/monolog/README.mdown b/vendor/monolog/monolog/README.mdown new file mode 100644 index 00000000..af745c8a --- /dev/null +++ b/vendor/monolog/monolog/README.mdown @@ -0,0 +1,302 @@ +Monolog - Logging for PHP 5.3+ [![Build Status](https://secure.travis-ci.org/Seldaek/monolog.png)](http://travis-ci.org/Seldaek/monolog) +============================== + +[![Total Downloads](https://poser.pugx.org/monolog/monolog/downloads.png)](https://packagist.org/packages/monolog/monolog) +[![Latest Stable Version](https://poser.pugx.org/monolog/monolog/v/stable.png)](https://packagist.org/packages/monolog/monolog) +[![Reference Status](https://www.versioneye.com/php/monolog:monolog/reference_badge.svg)](https://www.versioneye.com/php/monolog:monolog/references) + + +Monolog sends your logs to files, sockets, inboxes, databases and various +web services. See the complete list of handlers below. Special handlers +allow you to build advanced logging strategies. + +This library implements the [PSR-3](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-3-logger-interface.md) +interface that you can type-hint against in your own libraries to keep +a maximum of interoperability. You can also use it in your applications to +make sure you can always use another compatible logger at a later time. +As of 1.11.0 Monolog public APIs will also accept PSR-3 log levels. +Internally Monolog still uses its own level scheme since it predates PSR-3. + +Installation +------------ + +Install the latest version with + +```bash +$ composer require monolog/monolog +``` + +Usage +----- + +```php +<?php + +use Monolog\Logger; +use Monolog\Handler\StreamHandler; + +// create a log channel +$log = new Logger('name'); +$log->pushHandler(new StreamHandler('path/to/your.log', Logger::WARNING)); + +// add records to the log +$log->addWarning('Foo'); +$log->addError('Bar'); +``` + +Core Concepts +------------- + +Every `Logger` instance has a channel (name) and a stack of handlers. Whenever +you add a record to the logger, it traverses the handler stack. Each handler +decides whether it fully handled the record, and if so, the propagation of the +record ends there. + +This allows for flexible logging setups, for example having a `StreamHandler` at +the bottom of the stack that will log anything to disk, and on top of that add +a `MailHandler` that will send emails only when an error message is logged. +Handlers also have a `$bubble` property which defines whether they block the +record or not if they handled it. In this example, setting the `MailHandler`'s +`$bubble` argument to false means that records handled by the `MailHandler` will +not propagate to the `StreamHandler` anymore. + +You can create many `Logger`s, each defining a channel (e.g.: db, request, +router, ..) and each of them combining various handlers, which can be shared +or not. The channel is reflected in the logs and allows you to easily see or +filter records. + +Each Handler also has a Formatter, a default one with settings that make sense +will be created if you don't set one. The formatters normalize and format +incoming records so that they can be used by the handlers to output useful +information. + +Custom severity levels are not available. Only the eight +[RFC 5424](http://tools.ietf.org/html/rfc5424) levels (debug, info, notice, +warning, error, critical, alert, emergency) are present for basic filtering +purposes, but for sorting and other use cases that would require +flexibility, you should add Processors to the Logger that can add extra +information (tags, user ip, ..) to the records before they are handled. + +Log Levels +---------- + +Monolog supports the logging levels described by [RFC 5424](http://tools.ietf.org/html/rfc5424). + +- **DEBUG** (100): Detailed debug information. + +- **INFO** (200): Interesting events. Examples: User logs in, SQL logs. + +- **NOTICE** (250): Normal but significant events. + +- **WARNING** (300): Exceptional occurrences that are not errors. Examples: + Use of deprecated APIs, poor use of an API, undesirable things that are not + necessarily wrong. + +- **ERROR** (400): Runtime errors that do not require immediate action but + should typically be logged and monitored. + +- **CRITICAL** (500): Critical conditions. Example: Application component + unavailable, unexpected exception. + +- **ALERT** (550): Action must be taken immediately. Example: Entire website + down, database unavailable, etc. This should trigger the SMS alerts and wake + you up. + +- **EMERGENCY** (600): Emergency: system is unusable. + +Docs +==== + +**See the `doc` directory for more detailed documentation. +The following is only a list of all parts that come with Monolog.** + +Handlers +-------- + +### Log to files and syslog + +- _StreamHandler_: Logs records into any PHP stream, use this for log files. +- _RotatingFileHandler_: Logs records to a file and creates one logfile per day. + It will also delete files older than `$maxFiles`. You should use + [logrotate](http://linuxcommand.org/man_pages/logrotate8.html) for high profile + setups though, this is just meant as a quick and dirty solution. +- _SyslogHandler_: Logs records to the syslog. +- _ErrorLogHandler_: Logs records to PHP's + [`error_log()`](http://docs.php.net/manual/en/function.error-log.php) function. + +### Send alerts and emails + +- _NativeMailerHandler_: Sends emails using PHP's + [`mail()`](http://php.net/manual/en/function.mail.php) function. +- _SwiftMailerHandler_: Sends emails using a [`Swift_Mailer`](http://swiftmailer.org/) instance. +- _PushoverHandler_: Sends mobile notifications via the [Pushover](https://www.pushover.net/) API. +- _HipChatHandler_: Logs records to a [HipChat](http://hipchat.com) chat room using its API. +- _FlowdockHandler_: Logs records to a [Flowdock](https://www.flowdock.com/) account. +- _SlackHandler_: Logs records to a [Slack](https://www.slack.com/) account. +- _MandrillHandler_: Sends emails via the Mandrill API using a [`Swift_Message`](http://swiftmailer.org/) instance. +- _FleepHookHandler_: Logs records to a [Fleep](https://fleep.io/) conversation using Webhooks. + +### Log specific servers and networked logging + +- _SocketHandler_: Logs records to [sockets](http://php.net/fsockopen), use this + for UNIX and TCP sockets. See an [example](https://github.com/Seldaek/monolog/blob/master/doc/sockets.md). +- _AmqpHandler_: Logs records to an [amqp](http://www.amqp.org/) compatible + server. Requires the [php-amqp](http://pecl.php.net/package/amqp) extension (1.0+). +- _GelfHandler_: Logs records to a [Graylog2](http://www.graylog2.org) server. +- _CubeHandler_: Logs records to a [Cube](http://square.github.com/cube/) server. +- _RavenHandler_: Logs records to a [Sentry](http://getsentry.com/) server using + [raven](https://packagist.org/packages/raven/raven). +- _ZendMonitorHandler_: Logs records to the Zend Monitor present in Zend Server. +- _NewRelicHandler_: Logs records to a [NewRelic](http://newrelic.com/) application. +- _LogglyHandler_: Logs records to a [Loggly](http://www.loggly.com/) account. +- _RollbarHandler_: Logs records to a [Rollbar](https://rollbar.com/) account. +- _SyslogUdpHandler_: Logs records to a remote [Syslogd](http://www.rsyslog.com/) server. +- _LogEntriesHandler_: Logs records to a [LogEntries](http://logentries.com/) account. + +### Logging in development + +- _FirePHPHandler_: Handler for [FirePHP](http://www.firephp.org/), providing + inline `console` messages within [FireBug](http://getfirebug.com/). +- _ChromePHPHandler_: Handler for [ChromePHP](http://www.chromephp.com/), providing + inline `console` messages within Chrome. +- _BrowserConsoleHandler_: Handler to send logs to browser's Javascript `console` with + no browser extension required. Most browsers supporting `console` API are supported. +- _PHPConsoleHandler_: Handler for [PHP Console](https://chrome.google.com/webstore/detail/php-console/nfhmhhlpfleoednkpnnnkolmclajemef), providing + inline `console` and notification popup messages within Chrome. + +### Log to databases + +- _RedisHandler_: Logs records to a [redis](http://redis.io) server. +- _MongoDBHandler_: Handler to write records in MongoDB via a + [Mongo](http://pecl.php.net/package/mongo) extension connection. +- _CouchDBHandler_: Logs records to a CouchDB server. +- _DoctrineCouchDBHandler_: Logs records to a CouchDB server via the Doctrine CouchDB ODM. +- _ElasticSearchHandler_: Logs records to an Elastic Search server. +- _DynamoDbHandler_: Logs records to a DynamoDB table with the [AWS SDK](https://github.com/aws/aws-sdk-php). + +### Wrappers / Special Handlers + +- _FingersCrossedHandler_: A very interesting wrapper. It takes a logger as + parameter and will accumulate log records of all levels until a record + exceeds the defined severity level. At which point it delivers all records, + including those of lower severity, to the handler it wraps. This means that + until an error actually happens you will not see anything in your logs, but + when it happens you will have the full information, including debug and info + records. This provides you with all the information you need, but only when + you need it. +- _WhatFailureGroupHandler_: This handler extends the _GroupHandler_ ignoring + exceptions raised by each child handler. This allows you to ignore issues + where a remote tcp connection may have died but you do not want your entire + application to crash and may wish to continue to log to other handlers. +- _BufferHandler_: This handler will buffer all the log records it receives + until `close()` is called at which point it will call `handleBatch()` on the + handler it wraps with all the log messages at once. This is very useful to + send an email with all records at once for example instead of having one mail + for every log record. +- _GroupHandler_: This handler groups other handlers. Every record received is + sent to all the handlers it is configured with. +- _FilterHandler_: This handler only lets records of the given levels through + to the wrapped handler. +- _SamplingHandler_: Wraps around another handler and lets you sample records + if you only want to store some of them. +- _NullHandler_: Any record it can handle will be thrown away. This can be used + to put on top of an existing handler stack to disable it temporarily. +- _PsrHandler_: Can be used to forward log records to an existing PSR-3 logger +- _TestHandler_: Used for testing, it records everything that is sent to it and + has accessors to read out the information. + +Formatters +---------- + +- _LineFormatter_: Formats a log record into a one-line string. +- _HtmlFormatter_: Used to format log records into a human readable html table, mainly suitable for emails. +- _NormalizerFormatter_: Normalizes objects/resources down to strings so a record can easily be serialized/encoded. +- _ScalarFormatter_: Used to format log records into an associative array of scalar values. +- _JsonFormatter_: Encodes a log record into json. +- _WildfireFormatter_: Used to format log records into the Wildfire/FirePHP protocol, only useful for the FirePHPHandler. +- _ChromePHPFormatter_: Used to format log records into the ChromePHP format, only useful for the ChromePHPHandler. +- _GelfMessageFormatter_: Used to format log records into Gelf message instances, only useful for the GelfHandler. +- _LogstashFormatter_: Used to format log records into [logstash](http://logstash.net/) event json, useful for any handler listed under inputs [here](http://logstash.net/docs/latest). +- _ElasticaFormatter_: Used to format log records into an Elastica\Document object, only useful for the ElasticSearchHandler. +- _LogglyFormatter_: Used to format log records into Loggly messages, only useful for the LogglyHandler. +- _FlowdockFormatter_: Used to format log records into Flowdock messages, only useful for the FlowdockHandler. +- _MongoDBFormatter_: Converts \DateTime instances to \MongoDate and objects recursively to arrays, only useful with the MongoDBHandler. + +Processors +---------- + +- _IntrospectionProcessor_: Adds the line/file/class/method from which the log call originated. +- _WebProcessor_: Adds the current request URI, request method and client IP to a log record. +- _MemoryUsageProcessor_: Adds the current memory usage to a log record. +- _MemoryPeakUsageProcessor_: Adds the peak memory usage to a log record. +- _ProcessIdProcessor_: Adds the process id to a log record. +- _UidProcessor_: Adds a unique identifier to a log record. +- _GitProcessor_: Adds the current git branch and commit to a log record. +- _TagProcessor_: Adds an array of predefined tags to a log record. + +Utilities +--------- + +- _Registry_: The `Monolog\Registry` class lets you configure global loggers that you + can then statically access from anywhere. It is not really a best practice but can + help in some older codebases or for ease of use. +- _ErrorHandler_: The `Monolog\ErrorHandler` class allows you to easily register + a Logger instance as an exception handler, error handler or fatal error handler. +- _ErrorLevelActivationStrategy_: Activates a FingersCrossedHandler when a certain log + level is reached. +- _ChannelLevelActivationStrategy_: Activates a FingersCrossedHandler when a certain + log level is reached, depending on which channel received the log record. + +Third Party Packages +-------------------- + +Third party handlers, formatters and processors are +[listed in the wiki](https://github.com/Seldaek/monolog/wiki/Third-Party-Packages). You +can also add your own there if you publish one. + +About +===== + +Requirements +------------ + +- Monolog works with PHP 5.3 or above, and is also tested to work with HHVM. + +Submitting bugs and feature requests +------------------------------------ + +Bugs and feature request are tracked on [GitHub](https://github.com/Seldaek/monolog/issues) + +Frameworks Integration +---------------------- + +- Frameworks and libraries using [PSR-3](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-3-logger-interface.md) + can be used very easily with Monolog since it implements the interface. +- [Symfony2](http://symfony.com) comes out of the box with Monolog. +- [Silex](http://silex.sensiolabs.org/) comes out of the box with Monolog. +- [Laravel 4 & 5](http://laravel.com/) come out of the box with Monolog. +- [Lumen](http://lumen.laravel.com/) comes out of the box with Monolog. +- [PPI](http://www.ppi.io/) comes out of the box with Monolog. +- [CakePHP](http://cakephp.org/) is usable with Monolog via the [cakephp-monolog](https://github.com/jadb/cakephp-monolog) plugin. +- [Slim](http://www.slimframework.com/) is usable with Monolog via the [Slim-Monolog](https://github.com/Flynsarmy/Slim-Monolog) log writer. +- [XOOPS 2.6](http://xoops.org/) comes out of the box with Monolog. +- [Aura.Web_Project](https://github.com/auraphp/Aura.Web_Project) comes out of the box with Monolog. +- [Nette Framework](http://nette.org/en/) can be used with Monolog via [Kdyby/Monolog](https://github.com/Kdyby/Monolog) extension. +- [Proton Micro Framework](https://github.com/alexbilbie/Proton) comes out of the box with Monolog. + +Author +------ + +Jordi Boggiano - <j.boggiano@seld.be> - <http://twitter.com/seldaek><br /> +See also the list of [contributors](https://github.com/Seldaek/monolog/contributors) which participated in this project. + +License +------- + +Monolog is licensed under the MIT License - see the `LICENSE` file for details + +Acknowledgements +---------------- + +This library is heavily inspired by Python's [Logbook](http://packages.python.org/Logbook/) +library, although most concepts have been adjusted to fit to the PHP world. diff --git a/vendor/monolog/monolog/composer.json b/vendor/monolog/monolog/composer.json new file mode 100644 index 00000000..239484b3 --- /dev/null +++ b/vendor/monolog/monolog/composer.json @@ -0,0 +1,61 @@ +{ + "name": "monolog/monolog", + "description": "Sends your logs to files, sockets, inboxes, databases and various web services", + "keywords": ["log", "logging", "psr-3"], + "homepage": "http://github.com/Seldaek/monolog", + "type": "library", + "license": "MIT", + "authors": [ + { + "name": "Jordi Boggiano", + "email": "j.boggiano@seld.be", + "homepage": "http://seld.be" + } + ], + "require": { + "php": ">=5.3.0", + "psr/log": "~1.0" + }, + "require-dev": { + "phpunit/phpunit": "~4.5", + "graylog2/gelf-php": "~1.0", + "raven/raven": "~0.8", + "ruflin/elastica": ">=0.90 <3.0", + "doctrine/couchdb": "~1.0@dev", + "aws/aws-sdk-php": "^2.4.9", + "videlalvaro/php-amqplib": "~2.4", + "swiftmailer/swiftmailer": "~5.3", + "php-console/php-console": "^3.1.3", + "phpunit/phpunit-mock-objects": "2.3.0" + }, + "_": "phpunit/phpunit-mock-objects required in 2.3.0 due to https://github.com/sebastianbergmann/phpunit-mock-objects/issues/223", + "suggest": { + "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server", + "raven/raven": "Allow sending log messages to a Sentry server", + "doctrine/couchdb": "Allow sending log messages to a CouchDB server", + "ruflin/elastica": "Allow sending log messages to an Elastic Search server", + "videlalvaro/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib", + "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)", + "ext-mongo": "Allow sending log messages to a MongoDB server", + "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB", + "rollbar/rollbar": "Allow sending log messages to Rollbar", + "php-console/php-console": "Allow sending log messages to Google Chrome" + }, + "autoload": { + "psr-4": {"Monolog\\": "src/Monolog"} + }, + "autoload-dev": { + "psr-4": {"Monolog\\": "tests/Monolog"} + }, + "provide": { + "psr/log-implementation": "1.0.0" + }, + "extra": { + "branch-alias": { + "dev-master": "1.14.x-dev" + } + }, + "scripts": { + "test": "phpunit" + } +} diff --git a/vendor/monolog/monolog/doc/extending.md b/vendor/monolog/monolog/doc/extending.md new file mode 100644 index 00000000..bb39ddcf --- /dev/null +++ b/vendor/monolog/monolog/doc/extending.md @@ -0,0 +1,76 @@ +Extending Monolog +================= + +Monolog is fully extensible, allowing you to adapt your logger to your needs. + +Writing your own handler +------------------------ + +Monolog provides many built-in handlers. But if the one you need does not +exist, you can write it and use it in your logger. The only requirement is +to implement `Monolog\Handler\HandlerInterface`. + +Let's write a PDOHandler to log records to a database. We will extend the +abstract class provided by Monolog to keep things DRY. + +```php +<?php + +use Monolog\Logger; +use Monolog\Handler\AbstractProcessingHandler; + +class PDOHandler extends AbstractProcessingHandler +{ + private $initialized = false; + private $pdo; + private $statement; + + public function __construct(PDO $pdo, $level = Logger::DEBUG, $bubble = true) + { + $this->pdo = $pdo; + parent::__construct($level, $bubble); + } + + protected function write(array $record) + { + if (!$this->initialized) { + $this->initialize(); + } + + $this->statement->execute(array( + 'channel' => $record['channel'], + 'level' => $record['level'], + 'message' => $record['formatted'], + 'time' => $record['datetime']->format('U'), + )); + } + + private function initialize() + { + $this->pdo->exec( + 'CREATE TABLE IF NOT EXISTS monolog ' + .'(channel VARCHAR(255), level INTEGER, message LONGTEXT, time INTEGER UNSIGNED)' + ); + $this->statement = $this->pdo->prepare( + 'INSERT INTO monolog (channel, level, message, time) VALUES (:channel, :level, :message, :time)' + ); + + $this->initialized = true; + } +} +``` + +You can now use this handler in your logger: + +```php +<?php + +$logger->pushHandler(new PDOHandler(new PDO('sqlite:logs.sqlite'))); + +// You can now use your logger +$logger->addInfo('My logger is now ready'); +``` + +The `Monolog\Handler\AbstractProcessingHandler` class provides most of the +logic needed for the handler, including the use of processors and the formatting +of the record (which is why we use ``$record['formatted']`` instead of ``$record['message']``). diff --git a/vendor/monolog/monolog/doc/sockets.md b/vendor/monolog/monolog/doc/sockets.md new file mode 100644 index 00000000..fad30a9f --- /dev/null +++ b/vendor/monolog/monolog/doc/sockets.md @@ -0,0 +1,37 @@ +Sockets Handler +=============== + +This handler allows you to write your logs to sockets using [fsockopen](http://php.net/fsockopen) +or [pfsockopen](http://php.net/pfsockopen). + +Persistent sockets are mainly useful in web environments where you gain some performance not closing/opening +the connections between requests. + +Basic Example +------------- + +```php +<?php + +use Monolog\Logger; +use Monolog\Handler\SocketHandler; + +// Create the logger +$logger = new Logger('my_logger'); + +// Create the handler +$handler = new SocketHandler('unix:///var/log/httpd_app_log.socket'); +$handler->setPersistent(true); + +// Now add the handler +$logger->pushHandler($handler, Logger::DEBUG); + +// You can now use your logger +$logger->addInfo('My logger is now ready'); + +``` + +In this example, using syslog-ng, you should see the log on the log server: + + cweb1 [2012-02-26 00:12:03] my_logger.INFO: My logger is now ready [] [] + diff --git a/vendor/monolog/monolog/doc/usage.md b/vendor/monolog/monolog/doc/usage.md new file mode 100644 index 00000000..7585fa2a --- /dev/null +++ b/vendor/monolog/monolog/doc/usage.md @@ -0,0 +1,162 @@ +Using Monolog +============= + +Installation +------------ + +Monolog is available on Packagist ([monolog/monolog](http://packagist.org/packages/monolog/monolog)) +and as such installable via [Composer](http://getcomposer.org/). + +```bash +php composer.phar require monolog/monolog +``` + +If you do not use Composer, you can grab the code from GitHub, and use any +PSR-0 compatible autoloader (e.g. the [Symfony2 ClassLoader component](https://github.com/symfony/ClassLoader)) +to load Monolog classes. + +Configuring a logger +-------------------- + +Here is a basic setup to log to a file and to firephp on the DEBUG level: + +```php +<?php + +use Monolog\Logger; +use Monolog\Handler\StreamHandler; +use Monolog\Handler\FirePHPHandler; + +// Create the logger +$logger = new Logger('my_logger'); +// Now add some handlers +$logger->pushHandler(new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG)); +$logger->pushHandler(new FirePHPHandler()); + +// You can now use your logger +$logger->addInfo('My logger is now ready'); +``` + +Let's explain it. The first step is to create the logger instance which will +be used in your code. The argument is a channel name, which is useful when +you use several loggers (see below for more details about it). + +The logger itself does not know how to handle a record. It delegates it to +some handlers. The code above registers two handlers in the stack to allow +handling records in two different ways. + +Note that the FirePHPHandler is called first as it is added on top of the +stack. This allows you to temporarily add a logger with bubbling disabled if +you want to override other configured loggers. + +Adding extra data in the records +-------------------------------- + +Monolog provides two different ways to add extra informations along the simple +textual message. + +### Using the logging context + +The first way is the context, allowing to pass an array of data along the +record: + +```php +<?php + +$logger->addInfo('Adding a new user', array('username' => 'Seldaek')); +``` + +Simple handlers (like the StreamHandler for instance) will simply format +the array to a string but richer handlers can take advantage of the context +(FirePHP is able to display arrays in pretty way for instance). + +### Using processors + +The second way is to add extra data for all records by using a processor. +Processors can be any callable. They will get the record as parameter and +must return it after having eventually changed the `extra` part of it. Let's +write a processor adding some dummy data in the record: + +```php +<?php + +$logger->pushProcessor(function ($record) { + $record['extra']['dummy'] = 'Hello world!'; + + return $record; +}); +``` + +Monolog provides some built-in processors that can be used in your project. +Look at the [README file](https://github.com/Seldaek/monolog/blob/master/README.mdown) for the list. + +> Tip: processors can also be registered on a specific handler instead of + the logger to apply only for this handler. + +Leveraging channels +------------------- + +Channels are a great way to identify to which part of the application a record +is related. This is useful in big applications (and is leveraged by +MonologBundle in Symfony2). + +Picture two loggers sharing a handler that writes to a single log file. +Channels would allow you to identify the logger that issued every record. +You can easily grep through the log files filtering this or that channel. + +```php +<?php + +use Monolog\Logger; +use Monolog\Handler\StreamHandler; +use Monolog\Handler\FirePHPHandler; + +// Create some handlers +$stream = new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG); +$firephp = new FirePHPHandler(); + +// Create the main logger of the app +$logger = new Logger('my_logger'); +$logger->pushHandler($stream); +$logger->pushHandler($firephp); + +// Create a logger for the security-related stuff with a different channel +$securityLogger = new Logger('security'); +$securityLogger->pushHandler($stream); +$securityLogger->pushHandler($firephp); +``` + +Customizing log format +---------------------- + +In Monolog it's easy to customize the format of the logs written into files, +sockets, mails, databases and other handlers. Most of the handlers use the + +```php +$record['formatted'] +``` + +value to be automatically put into the log device. This value depends on the +formatter settings. You can choose between predefined formatter classes or +write your own (e.g. a multiline text file for human-readable output). + +To configure a predefined formatter class, just set it as the handler's field: + +```php +// the default date format is "Y-m-d H:i:s" +$dateFormat = "Y n j, g:i a"; +// the default output format is "[%datetime%] %channel%.%level_name%: %message% %context% %extra%\n" +$output = "%datetime% > %level_name% > %message% %context% %extra%\n"; +// finally, create a formatter +$formatter = new LineFormatter($output, $dateFormat); + +// Create a handler +$stream = new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG); +$stream->setFormatter($formatter); +// bind it to a logger object +$securityLogger = new Logger('security'); +$securityLogger->pushHandler($stream); +``` + +You may also reuse the same formatter between multiple handlers and share those +handlers between multiple loggers. diff --git a/vendor/monolog/monolog/phpunit.xml.dist b/vendor/monolog/monolog/phpunit.xml.dist new file mode 100644 index 00000000..20d82b63 --- /dev/null +++ b/vendor/monolog/monolog/phpunit.xml.dist @@ -0,0 +1,19 @@ +<?xml version="1.0" encoding="UTF-8"?> + +<phpunit bootstrap="vendor/autoload.php" colors="true"> + <testsuites> + <testsuite name="Monolog Test Suite"> + <directory>tests/Monolog/</directory> + </testsuite> + </testsuites> + + <filter> + <whitelist> + <directory suffix=".php">src/Monolog/</directory> + </whitelist> + </filter> + + <php> + <ini name="date.timezone" value="UTC"/> + </php> +</phpunit> diff --git a/vendor/monolog/monolog/src/Monolog/ErrorHandler.php b/vendor/monolog/monolog/src/Monolog/ErrorHandler.php new file mode 100644 index 00000000..c8923354 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/ErrorHandler.php @@ -0,0 +1,208 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use Psr\Log\LoggerInterface; +use Psr\Log\LogLevel; + +/** + * Monolog error handler + * + * A facility to enable logging of runtime errors, exceptions and fatal errors. + * + * Quick setup: <code>ErrorHandler::register($logger);</code> + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class ErrorHandler +{ + private $logger; + + private $previousExceptionHandler; + private $uncaughtExceptionLevel; + + private $previousErrorHandler; + private $errorLevelMap; + + private $fatalLevel; + private $reservedMemory; + private static $fatalErrors = array(E_ERROR, E_PARSE, E_CORE_ERROR, E_COMPILE_ERROR, E_USER_ERROR); + + public function __construct(LoggerInterface $logger) + { + $this->logger = $logger; + } + + /** + * Registers a new ErrorHandler for a given Logger + * + * By default it will handle errors, exceptions and fatal errors + * + * @param LoggerInterface $logger + * @param array|false $errorLevelMap an array of E_* constant to LogLevel::* constant mapping, or false to disable error handling + * @param int|false $exceptionLevel a LogLevel::* constant, or false to disable exception handling + * @param int|false $fatalLevel a LogLevel::* constant, or false to disable fatal error handling + * @return ErrorHandler + */ + public static function register(LoggerInterface $logger, $errorLevelMap = array(), $exceptionLevel = null, $fatalLevel = null) + { + $handler = new static($logger); + if ($errorLevelMap !== false) { + $handler->registerErrorHandler($errorLevelMap); + } + if ($exceptionLevel !== false) { + $handler->registerExceptionHandler($exceptionLevel); + } + if ($fatalLevel !== false) { + $handler->registerFatalHandler($fatalLevel); + } + + return $handler; + } + + public function registerExceptionHandler($level = null, $callPrevious = true) + { + $prev = set_exception_handler(array($this, 'handleException')); + $this->uncaughtExceptionLevel = $level; + if ($callPrevious && $prev) { + $this->previousExceptionHandler = $prev; + } + } + + public function registerErrorHandler(array $levelMap = array(), $callPrevious = true, $errorTypes = -1) + { + $prev = set_error_handler(array($this, 'handleError'), $errorTypes); + $this->errorLevelMap = array_replace($this->defaultErrorLevelMap(), $levelMap); + if ($callPrevious) { + $this->previousErrorHandler = $prev ?: true; + } + } + + public function registerFatalHandler($level = null, $reservedMemorySize = 20) + { + register_shutdown_function(array($this, 'handleFatalError')); + + $this->reservedMemory = str_repeat(' ', 1024 * $reservedMemorySize); + $this->fatalLevel = $level; + } + + protected function defaultErrorLevelMap() + { + return array( + E_ERROR => LogLevel::CRITICAL, + E_WARNING => LogLevel::WARNING, + E_PARSE => LogLevel::ALERT, + E_NOTICE => LogLevel::NOTICE, + E_CORE_ERROR => LogLevel::CRITICAL, + E_CORE_WARNING => LogLevel::WARNING, + E_COMPILE_ERROR => LogLevel::ALERT, + E_COMPILE_WARNING => LogLevel::WARNING, + E_USER_ERROR => LogLevel::ERROR, + E_USER_WARNING => LogLevel::WARNING, + E_USER_NOTICE => LogLevel::NOTICE, + E_STRICT => LogLevel::NOTICE, + E_RECOVERABLE_ERROR => LogLevel::ERROR, + E_DEPRECATED => LogLevel::NOTICE, + E_USER_DEPRECATED => LogLevel::NOTICE, + ); + } + + /** + * @private + */ + public function handleException(\Exception $e) + { + $this->logger->log( + $this->uncaughtExceptionLevel === null ? LogLevel::ERROR : $this->uncaughtExceptionLevel, + sprintf('Uncaught Exception %s: "%s" at %s line %s', get_class($e), $e->getMessage(), $e->getFile(), $e->getLine()), + array('exception' => $e) + ); + + if ($this->previousExceptionHandler) { + call_user_func($this->previousExceptionHandler, $e); + } + } + + /** + * @private + */ + public function handleError($code, $message, $file = '', $line = 0, $context = array()) + { + if (!(error_reporting() & $code)) { + return; + } + + $level = isset($this->errorLevelMap[$code]) ? $this->errorLevelMap[$code] : LogLevel::CRITICAL; + $this->logger->log($level, self::codeToString($code).': '.$message, array('code' => $code, 'message' => $message, 'file' => $file, 'line' => $line)); + + if ($this->previousErrorHandler === true) { + return false; + } elseif ($this->previousErrorHandler) { + return call_user_func($this->previousErrorHandler, $code, $message, $file, $line, $context); + } + } + + /** + * @private + */ + public function handleFatalError() + { + $this->reservedMemory = null; + + $lastError = error_get_last(); + if ($lastError && in_array($lastError['type'], self::$fatalErrors)) { + $this->logger->log( + $this->fatalLevel === null ? LogLevel::ALERT : $this->fatalLevel, + 'Fatal Error ('.self::codeToString($lastError['type']).'): '.$lastError['message'], + array('code' => $lastError['type'], 'message' => $lastError['message'], 'file' => $lastError['file'], 'line' => $lastError['line']) + ); + } + } + + private static function codeToString($code) + { + switch ($code) { + case E_ERROR: + return 'E_ERROR'; + case E_WARNING: + return 'E_WARNING'; + case E_PARSE: + return 'E_PARSE'; + case E_NOTICE: + return 'E_NOTICE'; + case E_CORE_ERROR: + return 'E_CORE_ERROR'; + case E_CORE_WARNING: + return 'E_CORE_WARNING'; + case E_COMPILE_ERROR: + return 'E_COMPILE_ERROR'; + case E_COMPILE_WARNING: + return 'E_COMPILE_WARNING'; + case E_USER_ERROR: + return 'E_USER_ERROR'; + case E_USER_WARNING: + return 'E_USER_WARNING'; + case E_USER_NOTICE: + return 'E_USER_NOTICE'; + case E_STRICT: + return 'E_STRICT'; + case E_RECOVERABLE_ERROR: + return 'E_RECOVERABLE_ERROR'; + case E_DEPRECATED: + return 'E_DEPRECATED'; + case E_USER_DEPRECATED: + return 'E_USER_DEPRECATED'; + } + + return 'Unknown PHP error'; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php new file mode 100644 index 00000000..56d3e278 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php @@ -0,0 +1,79 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +/** + * Formats a log message according to the ChromePHP array format + * + * @author Christophe Coevoet <stof@notk.org> + */ +class ChromePHPFormatter implements FormatterInterface +{ + /** + * Translates Monolog log levels to Wildfire levels. + */ + private $logLevels = array( + Logger::DEBUG => 'log', + Logger::INFO => 'info', + Logger::NOTICE => 'info', + Logger::WARNING => 'warn', + Logger::ERROR => 'error', + Logger::CRITICAL => 'error', + Logger::ALERT => 'error', + Logger::EMERGENCY => 'error', + ); + + /** + * {@inheritdoc} + */ + public function format(array $record) + { + // Retrieve the line and file if set and remove them from the formatted extra + $backtrace = 'unknown'; + if (isset($record['extra']['file']) && isset($record['extra']['line'])) { + $backtrace = $record['extra']['file'].' : '.$record['extra']['line']; + unset($record['extra']['file']); + unset($record['extra']['line']); + } + + $message = array('message' => $record['message']); + if ($record['context']) { + $message['context'] = $record['context']; + } + if ($record['extra']) { + $message['extra'] = $record['extra']; + } + if (count($message) === 1) { + $message = reset($message); + } + + return array( + $record['channel'], + $message, + $backtrace, + $this->logLevels[$record['level']], + ); + } + + public function formatBatch(array $records) + { + $formatted = array(); + + foreach ($records as $record) { + $formatted[] = $this->format($record); + } + + return $formatted; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/ElasticaFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/ElasticaFormatter.php new file mode 100644 index 00000000..b0b0cf06 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/ElasticaFormatter.php @@ -0,0 +1,87 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Elastica\Document; + +/** + * Format a log message into an Elastica Document + * + * @author Jelle Vink <jelle.vink@gmail.com> + */ +class ElasticaFormatter extends NormalizerFormatter +{ + /** + * @var string Elastic search index name + */ + protected $index; + + /** + * @var string Elastic search document type + */ + protected $type; + + /** + * @param string $index Elastic Search index name + * @param string $type Elastic Search document type + */ + public function __construct($index, $type) + { + parent::__construct(\DateTime::ISO8601); + $this->index = $index; + $this->type = $type; + } + + /** + * {@inheritdoc} + */ + public function format(array $record) + { + $record = parent::format($record); + + return $this->getDocument($record); + } + + /** + * Getter index + * @return string + */ + public function getIndex() + { + return $this->index; + } + + /** + * Getter type + * @return string + */ + public function getType() + { + return $this->type; + } + + /** + * Convert a log message into an Elastica Document + * + * @param array $record Log message + * @return Document + */ + protected function getDocument($record) + { + $document = new Document(); + $document->setData($record); + $document->setType($this->type); + $document->setIndex($this->index); + + return $document; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/FlowdockFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/FlowdockFormatter.php new file mode 100644 index 00000000..af63d011 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/FlowdockFormatter.php @@ -0,0 +1,104 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * formats the record to be used in the FlowdockHandler + * + * @author Dominik Liebler <liebler.dominik@gmail.com> + */ +class FlowdockFormatter implements FormatterInterface +{ + /** + * @var string + */ + private $source; + + /** + * @var string + */ + private $sourceEmail; + + /** + * @param string $source + * @param string $sourceEmail + */ + public function __construct($source, $sourceEmail) + { + $this->source = $source; + $this->sourceEmail = $sourceEmail; + } + + /** + * {@inheritdoc} + */ + public function format(array $record) + { + $tags = array( + '#logs', + '#' . strtolower($record['level_name']), + '#' . $record['channel'], + ); + + foreach ($record['extra'] as $value) { + $tags[] = '#' . $value; + } + + $subject = sprintf( + 'in %s: %s - %s', + $this->source, + $record['level_name'], + $this->getShortMessage($record['message']) + ); + + $record['flowdock'] = array( + 'source' => $this->source, + 'from_address' => $this->sourceEmail, + 'subject' => $subject, + 'content' => $record['message'], + 'tags' => $tags, + 'project' => $this->source, + ); + + return $record; + } + + /** + * {@inheritdoc} + */ + public function formatBatch(array $records) + { + $formatted = array(); + + foreach ($records as $record) { + $formatted[] = $this->format($record); + } + + return $formatted; + } + + /** + * @param string $message + * + * @return string + */ + public function getShortMessage($message) + { + $maxLength = 45; + + if (strlen($message) > $maxLength) { + $message = substr($message, 0, $maxLength - 4) . ' ...'; + } + + return $message; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php b/vendor/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php new file mode 100644 index 00000000..b5de7511 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php @@ -0,0 +1,36 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * Interface for formatters + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +interface FormatterInterface +{ + /** + * Formats a log record. + * + * @param array $record A record to format + * @return mixed The formatted record + */ + public function format(array $record); + + /** + * Formats a set of log records. + * + * @param array $records A set of records to format + * @return mixed The formatted set of records + */ + public function formatBatch(array $records); +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php new file mode 100644 index 00000000..1e431750 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php @@ -0,0 +1,111 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; +use Gelf\Message; + +/** + * Serializes a log message to GELF + * @see http://www.graylog2.org/about/gelf + * + * @author Matt Lehner <mlehner@gmail.com> + */ +class GelfMessageFormatter extends NormalizerFormatter +{ + /** + * @var string the name of the system for the Gelf log message + */ + protected $systemName; + + /** + * @var string a prefix for 'extra' fields from the Monolog record (optional) + */ + protected $extraPrefix; + + /** + * @var string a prefix for 'context' fields from the Monolog record (optional) + */ + protected $contextPrefix; + + /** + * Translates Monolog log levels to Graylog2 log priorities. + */ + private $logLevels = array( + Logger::DEBUG => 7, + Logger::INFO => 6, + Logger::NOTICE => 5, + Logger::WARNING => 4, + Logger::ERROR => 3, + Logger::CRITICAL => 2, + Logger::ALERT => 1, + Logger::EMERGENCY => 0, + ); + + public function __construct($systemName = null, $extraPrefix = null, $contextPrefix = 'ctxt_') + { + parent::__construct('U.u'); + + $this->systemName = $systemName ?: gethostname(); + + $this->extraPrefix = $extraPrefix; + $this->contextPrefix = $contextPrefix; + } + + /** + * {@inheritdoc} + */ + public function format(array $record) + { + $record = parent::format($record); + + if (!isset($record['datetime'], $record['message'], $record['level'])) { + throw new \InvalidArgumentException('The record should at least contain datetime, message and level keys, '.var_export($record, true).' given'); + } + + $message = new Message(); + $message + ->setTimestamp($record['datetime']) + ->setShortMessage((string) $record['message']) + ->setHost($this->systemName) + ->setLevel($this->logLevels[$record['level']]); + + if (isset($record['channel'])) { + $message->setFacility($record['channel']); + } + if (isset($record['extra']['line'])) { + $message->setLine($record['extra']['line']); + unset($record['extra']['line']); + } + if (isset($record['extra']['file'])) { + $message->setFile($record['extra']['file']); + unset($record['extra']['file']); + } + + foreach ($record['extra'] as $key => $val) { + $message->setAdditional($this->extraPrefix . $key, is_scalar($val) ? $val : $this->toJson($val)); + } + + foreach ($record['context'] as $key => $val) { + $message->setAdditional($this->contextPrefix . $key, is_scalar($val) ? $val : $this->toJson($val)); + } + + if (null === $message->getFile() && isset($record['context']['exception']['file'])) { + if (preg_match("/^(.+):([0-9]+)$/", $record['context']['exception']['file'], $matches)) { + $message->setFile($matches[1]); + $message->setLine($matches[2]); + } + } + + return $message; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/HtmlFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/HtmlFormatter.php new file mode 100644 index 00000000..255d2887 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/HtmlFormatter.php @@ -0,0 +1,140 @@ +<?php +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +/** + * Formats incoming records into an HTML table + * + * This is especially useful for html email logging + * + * @author Tiago Brito <tlfbrito@gmail.com> + */ +class HtmlFormatter extends NormalizerFormatter +{ + /** + * Translates Monolog log levels to html color priorities. + */ + private $logLevels = array( + Logger::DEBUG => '#cccccc', + Logger::INFO => '#468847', + Logger::NOTICE => '#3a87ad', + Logger::WARNING => '#c09853', + Logger::ERROR => '#f0ad4e', + Logger::CRITICAL => '#FF7708', + Logger::ALERT => '#C12A19', + Logger::EMERGENCY => '#000000', + ); + + /** + * @param string $dateFormat The format of the timestamp: one supported by DateTime::format + */ + public function __construct($dateFormat = null) + { + parent::__construct($dateFormat); + } + + /** + * Creates an HTML table row + * + * @param string $th Row header content + * @param string $td Row standard cell content + * @param bool $escapeTd false if td content must not be html escaped + * @return string + */ + private function addRow($th, $td = ' ', $escapeTd = true) + { + $th = htmlspecialchars($th, ENT_NOQUOTES, 'UTF-8'); + if ($escapeTd) { + $td = '<pre>'.htmlspecialchars($td, ENT_NOQUOTES, 'UTF-8').'</pre>'; + } + + return "<tr style=\"padding: 4px;spacing: 0;text-align: left;\">\n<th style=\"background: #cccccc\" width=\"100px\">$th:</th>\n<td style=\"padding: 4px;spacing: 0;text-align: left;background: #eeeeee\">".$td."</td>\n</tr>"; + } + + /** + * Create a HTML h1 tag + * + * @param string $title Text to be in the h1 + * @param integer $level Error level + * @return string + */ + private function addTitle($title, $level) + { + $title = htmlspecialchars($title, ENT_NOQUOTES, 'UTF-8'); + + return '<h1 style="background: '.$this->logLevels[$level].';color: #ffffff;padding: 5px;" class="monolog-output">'.$title.'</h1>'; + } + /** + * Formats a log record. + * + * @param array $record A record to format + * @return mixed The formatted record + */ + public function format(array $record) + { + $output = $this->addTitle($record['level_name'], $record['level']); + $output .= '<table cellspacing="1" width="100%" class="monolog-output">'; + + $output .= $this->addRow('Message', (string) $record['message']); + $output .= $this->addRow('Time', $record['datetime']->format($this->dateFormat)); + $output .= $this->addRow('Channel', $record['channel']); + if ($record['context']) { + $embeddedTable = '<table cellspacing="1" width="100%">'; + foreach ($record['context'] as $key => $value) { + $embeddedTable .= $this->addRow($key, $this->convertToString($value)); + } + $embeddedTable .= '</table>'; + $output .= $this->addRow('Context', $embeddedTable, false); + } + if ($record['extra']) { + $embeddedTable = '<table cellspacing="1" width="100%">'; + foreach ($record['extra'] as $key => $value) { + $embeddedTable .= $this->addRow($key, $this->convertToString($value)); + } + $embeddedTable .= '</table>'; + $output .= $this->addRow('Extra', $embeddedTable, false); + } + + return $output.'</table>'; + } + + /** + * Formats a set of log records. + * + * @param array $records A set of records to format + * @return mixed The formatted set of records + */ + public function formatBatch(array $records) + { + $message = ''; + foreach ($records as $record) { + $message .= $this->format($record); + } + + return $message; + } + + protected function convertToString($data) + { + if (null === $data || is_scalar($data)) { + return (string) $data; + } + + $data = $this->normalize($data); + if (version_compare(PHP_VERSION, '5.4.0', '>=')) { + return json_encode($data, JSON_PRETTY_PRINT | JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE); + } + + return str_replace('\\/', '/', json_encode($data)); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php new file mode 100644 index 00000000..e5a1d2c4 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php @@ -0,0 +1,116 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * Encodes whatever record data is passed to it as json + * + * This can be useful to log to databases or remote APIs + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class JsonFormatter implements FormatterInterface +{ + const BATCH_MODE_JSON = 1; + const BATCH_MODE_NEWLINES = 2; + + protected $batchMode; + protected $appendNewline; + + /** + * @param int $batchMode + */ + public function __construct($batchMode = self::BATCH_MODE_JSON, $appendNewline = true) + { + $this->batchMode = $batchMode; + $this->appendNewline = $appendNewline; + } + + /** + * The batch mode option configures the formatting style for + * multiple records. By default, multiple records will be + * formatted as a JSON-encoded array. However, for + * compatibility with some API endpoints, alternative styles + * are available. + * + * @return int + */ + public function getBatchMode() + { + return $this->batchMode; + } + + /** + * True if newlines are appended to every formatted record + * + * @return bool + */ + public function isAppendingNewlines() + { + return $this->appendNewline; + } + + /** + * {@inheritdoc} + */ + public function format(array $record) + { + return json_encode($record) . ($this->appendNewline ? "\n" : ''); + } + + /** + * {@inheritdoc} + */ + public function formatBatch(array $records) + { + switch ($this->batchMode) { + case static::BATCH_MODE_NEWLINES: + return $this->formatBatchNewlines($records); + + case static::BATCH_MODE_JSON: + default: + return $this->formatBatchJson($records); + } + } + + /** + * Return a JSON-encoded array of records. + * + * @param array $records + * @return string + */ + protected function formatBatchJson(array $records) + { + return json_encode($records); + } + + /** + * Use new lines to separate records instead of a + * JSON-encoded array. + * + * @param array $records + * @return string + */ + protected function formatBatchNewlines(array $records) + { + $instance = $this; + + $oldNewline = $this->appendNewline; + $this->appendNewline = false; + array_walk($records, function (&$value, $key) use ($instance) { + $value = $instance->format($value); + }); + $this->appendNewline = $oldNewline; + + return implode("\n", $records); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php new file mode 100644 index 00000000..388e2266 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php @@ -0,0 +1,159 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Exception; + +/** + * Formats incoming records into a one-line string + * + * This is especially useful for logging to files + * + * @author Jordi Boggiano <j.boggiano@seld.be> + * @author Christophe Coevoet <stof@notk.org> + */ +class LineFormatter extends NormalizerFormatter +{ + const SIMPLE_FORMAT = "[%datetime%] %channel%.%level_name%: %message% %context% %extra%\n"; + + protected $format; + protected $allowInlineLineBreaks; + protected $ignoreEmptyContextAndExtra; + protected $includeStacktraces; + + /** + * @param string $format The format of the message + * @param string $dateFormat The format of the timestamp: one supported by DateTime::format + * @param bool $allowInlineLineBreaks Whether to allow inline line breaks in log entries + * @param bool $ignoreEmptyContextAndExtra + */ + public function __construct($format = null, $dateFormat = null, $allowInlineLineBreaks = false, $ignoreEmptyContextAndExtra = false) + { + $this->format = $format ?: static::SIMPLE_FORMAT; + $this->allowInlineLineBreaks = $allowInlineLineBreaks; + $this->ignoreEmptyContextAndExtra = $ignoreEmptyContextAndExtra; + parent::__construct($dateFormat); + } + + public function includeStacktraces($include = true) + { + $this->includeStacktraces = $include; + if ($this->includeStacktraces) { + $this->allowInlineLineBreaks = true; + } + } + + public function allowInlineLineBreaks($allow = true) + { + $this->allowInlineLineBreaks = $allow; + } + + public function ignoreEmptyContextAndExtra($ignore = true) + { + $this->ignoreEmptyContextAndExtra = $ignore; + } + + /** + * {@inheritdoc} + */ + public function format(array $record) + { + $vars = parent::format($record); + + $output = $this->format; + + foreach ($vars['extra'] as $var => $val) { + if (false !== strpos($output, '%extra.'.$var.'%')) { + $output = str_replace('%extra.'.$var.'%', $this->stringify($val), $output); + unset($vars['extra'][$var]); + } + } + + if ($this->ignoreEmptyContextAndExtra) { + if (empty($vars['context'])) { + unset($vars['context']); + $output = str_replace('%context%', '', $output); + } + + if (empty($vars['extra'])) { + unset($vars['extra']); + $output = str_replace('%extra%', '', $output); + } + } + + foreach ($vars as $var => $val) { + if (false !== strpos($output, '%'.$var.'%')) { + $output = str_replace('%'.$var.'%', $this->stringify($val), $output); + } + } + + return $output; + } + + public function formatBatch(array $records) + { + $message = ''; + foreach ($records as $record) { + $message .= $this->format($record); + } + + return $message; + } + + public function stringify($value) + { + return $this->replaceNewlines($this->convertToString($value)); + } + + protected function normalizeException(Exception $e) + { + $previousText = ''; + if ($previous = $e->getPrevious()) { + do { + $previousText .= ', '.get_class($previous).'(code: '.$previous->getCode().'): '.$previous->getMessage().' at '.$previous->getFile().':'.$previous->getLine(); + } while ($previous = $previous->getPrevious()); + } + + $str = '[object] ('.get_class($e).'(code: '.$e->getCode().'): '.$e->getMessage().' at '.$e->getFile().':'.$e->getLine().$previousText.')'; + if ($this->includeStacktraces) { + $str .= "\n[stacktrace]\n".$e->getTraceAsString(); + } + + return $str; + } + + protected function convertToString($data) + { + if (null === $data || is_bool($data)) { + return var_export($data, true); + } + + if (is_scalar($data)) { + return (string) $data; + } + + if (version_compare(PHP_VERSION, '5.4.0', '>=')) { + return $this->toJson($data, true); + } + + return str_replace('\\/', '/', @json_encode($data)); + } + + protected function replaceNewlines($str) + { + if ($this->allowInlineLineBreaks) { + return $str; + } + + return str_replace(array("\r\n", "\r", "\n"), ' ', $str); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php new file mode 100644 index 00000000..f02bceb0 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/LogglyFormatter.php @@ -0,0 +1,47 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * Encodes message information into JSON in a format compatible with Loggly. + * + * @author Adam Pancutt <adam@pancutt.com> + */ +class LogglyFormatter extends JsonFormatter +{ + /** + * Overrides the default batch mode to new lines for compatibility with the + * Loggly bulk API. + * + * @param integer $batchMode + */ + public function __construct($batchMode = self::BATCH_MODE_NEWLINES, $appendNewline = false) + { + parent::__construct($batchMode, $appendNewline); + } + + /** + * Appends the 'timestamp' parameter for indexing by Loggly. + * + * @see https://www.loggly.com/docs/automated-parsing/#json + * @see \Monolog\Formatter\JsonFormatter::format() + */ + public function format(array $record) + { + if (isset($record["datetime"]) && ($record["datetime"] instanceof \DateTime)) { + $record["timestamp"] = $record["datetime"]->format("Y-m-d\TH:i:s.uO"); + // TODO 2.0 unset the 'datetime' parameter, retained for BC + } + + return parent::format($record); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php new file mode 100644 index 00000000..7a7b3b3c --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php @@ -0,0 +1,165 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * Serializes a log message to Logstash Event Format + * + * @see http://logstash.net/ + * @see https://github.com/logstash/logstash/blob/master/lib/logstash/event.rb + * + * @author Tim Mower <timothy.mower@gmail.com> + */ +class LogstashFormatter extends NormalizerFormatter +{ + const V0 = 0; + const V1 = 1; + + /** + * @var string the name of the system for the Logstash log message, used to fill the @source field + */ + protected $systemName; + + /** + * @var string an application name for the Logstash log message, used to fill the @type field + */ + protected $applicationName; + + /** + * @var string a prefix for 'extra' fields from the Monolog record (optional) + */ + protected $extraPrefix; + + /** + * @var string a prefix for 'context' fields from the Monolog record (optional) + */ + protected $contextPrefix; + + /** + * @var integer logstash format version to use + */ + protected $version; + + /** + * @param string $applicationName the application that sends the data, used as the "type" field of logstash + * @param string $systemName the system/machine name, used as the "source" field of logstash, defaults to the hostname of the machine + * @param string $extraPrefix prefix for extra keys inside logstash "fields" + * @param string $contextPrefix prefix for context keys inside logstash "fields", defaults to ctxt_ + */ + public function __construct($applicationName, $systemName = null, $extraPrefix = null, $contextPrefix = 'ctxt_', $version = self::V0) + { + // logstash requires a ISO 8601 format date with optional millisecond precision. + parent::__construct('Y-m-d\TH:i:s.uP'); + + $this->systemName = $systemName ?: gethostname(); + $this->applicationName = $applicationName; + $this->extraPrefix = $extraPrefix; + $this->contextPrefix = $contextPrefix; + $this->version = $version; + } + + /** + * {@inheritdoc} + */ + public function format(array $record) + { + $record = parent::format($record); + + if ($this->version === self::V1) { + $message = $this->formatV1($record); + } else { + $message = $this->formatV0($record); + } + + return $this->toJson($message) . "\n"; + } + + protected function formatV0(array $record) + { + if (empty($record['datetime'])) { + $record['datetime'] = gmdate('c'); + } + $message = array( + '@timestamp' => $record['datetime'], + '@source' => $this->systemName, + '@fields' => array() + ); + if (isset($record['message'])) { + $message['@message'] = $record['message']; + } + if (isset($record['channel'])) { + $message['@tags'] = array($record['channel']); + $message['@fields']['channel'] = $record['channel']; + } + if (isset($record['level'])) { + $message['@fields']['level'] = $record['level']; + } + if ($this->applicationName) { + $message['@type'] = $this->applicationName; + } + if (isset($record['extra']['server'])) { + $message['@source_host'] = $record['extra']['server']; + } + if (isset($record['extra']['url'])) { + $message['@source_path'] = $record['extra']['url']; + } + if (!empty($record['extra'])) { + foreach ($record['extra'] as $key => $val) { + $message['@fields'][$this->extraPrefix . $key] = $val; + } + } + if (!empty($record['context'])) { + foreach ($record['context'] as $key => $val) { + $message['@fields'][$this->contextPrefix . $key] = $val; + } + } + + return $message; + } + + protected function formatV1(array $record) + { + if (empty($record['datetime'])) { + $record['datetime'] = gmdate('c'); + } + $message = array( + '@timestamp' => $record['datetime'], + '@version' => 1, + 'host' => $this->systemName, + ); + if (isset($record['message'])) { + $message['message'] = $record['message']; + } + if (isset($record['channel'])) { + $message['type'] = $record['channel']; + $message['channel'] = $record['channel']; + } + if (isset($record['level_name'])) { + $message['level'] = $record['level_name']; + } + if ($this->applicationName) { + $message['type'] = $this->applicationName; + } + if (!empty($record['extra'])) { + foreach ($record['extra'] as $key => $val) { + $message[$this->extraPrefix . $key] = $val; + } + } + if (!empty($record['context'])) { + foreach ($record['context'] as $key => $val) { + $message[$this->contextPrefix . $key] = $val; + } + } + + return $message; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php new file mode 100644 index 00000000..eb067bb7 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/MongoDBFormatter.php @@ -0,0 +1,105 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * Formats a record for use with the MongoDBHandler. + * + * @author Florian Plattner <me@florianplattner.de> + */ +class MongoDBFormatter implements FormatterInterface +{ + private $exceptionTraceAsString; + private $maxNestingLevel; + + /** + * @param int $maxNestingLevel 0 means infinite nesting, the $record itself is level 1, $record['context'] is 2 + * @param bool $exceptionTraceAsString set to false to log exception traces as a sub documents instead of strings + */ + public function __construct($maxNestingLevel = 3, $exceptionTraceAsString = true) + { + $this->maxNestingLevel = max($maxNestingLevel, 0); + $this->exceptionTraceAsString = (bool) $exceptionTraceAsString; + } + + /** + * {@inheritDoc} + */ + public function format(array $record) + { + return $this->formatArray($record); + } + + /** + * {@inheritDoc} + */ + public function formatBatch(array $records) + { + foreach ($records as $key => $record) { + $records[$key] = $this->format($record); + } + + return $records; + } + + protected function formatArray(array $record, $nestingLevel = 0) + { + if ($this->maxNestingLevel == 0 || $nestingLevel <= $this->maxNestingLevel) { + foreach ($record as $name => $value) { + if ($value instanceof \DateTime) { + $record[$name] = $this->formatDate($value, $nestingLevel + 1); + } elseif ($value instanceof \Exception) { + $record[$name] = $this->formatException($value, $nestingLevel + 1); + } elseif (is_array($value)) { + $record[$name] = $this->formatArray($value, $nestingLevel + 1); + } elseif (is_object($value)) { + $record[$name] = $this->formatObject($value, $nestingLevel + 1); + } + } + } else { + $record = '[...]'; + } + + return $record; + } + + protected function formatObject($value, $nestingLevel) + { + $objectVars = get_object_vars($value); + $objectVars['class'] = get_class($value); + + return $this->formatArray($objectVars, $nestingLevel); + } + + protected function formatException(\Exception $exception, $nestingLevel) + { + $formattedException = array( + 'class' => get_class($exception), + 'message' => $exception->getMessage(), + 'code' => $exception->getCode(), + 'file' => $exception->getFile() . ':' . $exception->getLine(), + ); + + if ($this->exceptionTraceAsString === true) { + $formattedException['trace'] = $exception->getTraceAsString(); + } else { + $formattedException['trace'] = $exception->getTrace(); + } + + return $this->formatArray($formattedException, $nestingLevel); + } + + protected function formatDate(\DateTime $value, $nestingLevel) + { + return new \MongoDate($value->getTimestamp()); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php new file mode 100644 index 00000000..46bf41b3 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php @@ -0,0 +1,158 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Exception; + +/** + * Normalizes incoming records to remove objects/resources so it's easier to dump to various targets + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class NormalizerFormatter implements FormatterInterface +{ + const SIMPLE_DATE = "Y-m-d H:i:s"; + + protected $dateFormat; + + /** + * @param string $dateFormat The format of the timestamp: one supported by DateTime::format + */ + public function __construct($dateFormat = null) + { + $this->dateFormat = $dateFormat ?: static::SIMPLE_DATE; + if (!function_exists('json_encode')) { + throw new \RuntimeException('PHP\'s json extension is required to use Monolog\'s NormalizerFormatter'); + } + } + + /** + * {@inheritdoc} + */ + public function format(array $record) + { + return $this->normalize($record); + } + + /** + * {@inheritdoc} + */ + public function formatBatch(array $records) + { + foreach ($records as $key => $record) { + $records[$key] = $this->format($record); + } + + return $records; + } + + protected function normalize($data) + { + if (null === $data || is_scalar($data)) { + if (is_float($data)) { + if (is_infinite($data)) { + return ($data > 0 ? '' : '-') . 'INF'; + } + if (is_nan($data)) { + return 'NaN'; + } + } + + return $data; + } + + if (is_array($data) || $data instanceof \Traversable) { + $normalized = array(); + + $count = 1; + foreach ($data as $key => $value) { + if ($count++ >= 1000) { + $normalized['...'] = 'Over 1000 items, aborting normalization'; + break; + } + $normalized[$key] = $this->normalize($value); + } + + return $normalized; + } + + if ($data instanceof \DateTime) { + return $data->format($this->dateFormat); + } + + if (is_object($data)) { + if ($data instanceof Exception) { + return $this->normalizeException($data); + } + + // non-serializable objects that implement __toString stringified + if (method_exists($data, '__toString') && !$data instanceof \JsonSerializable) { + $value = (string) $data; + } else { + // the rest is json-serialized in some way + $value = $this->toJson($data, true); + } + + return sprintf("[object] (%s: %s)", get_class($data), $value); + } + + if (is_resource($data)) { + return '[resource]'; + } + + return '[unknown('.gettype($data).')]'; + } + + protected function normalizeException(Exception $e) + { + $data = array( + 'class' => get_class($e), + 'message' => $e->getMessage(), + 'code' => $e->getCode(), + 'file' => $e->getFile().':'.$e->getLine(), + ); + + $trace = $e->getTrace(); + foreach ($trace as $frame) { + if (isset($frame['file'])) { + $data['trace'][] = $frame['file'].':'.$frame['line']; + } else { + // We should again normalize the frames, because it might contain invalid items + $data['trace'][] = $this->toJson($this->normalize($frame), true); + } + } + + if ($previous = $e->getPrevious()) { + $data['previous'] = $this->normalizeException($previous); + } + + return $data; + } + + protected function toJson($data, $ignoreErrors = false) + { + // suppress json_encode errors since it's twitchy with some inputs + if ($ignoreErrors) { + if (version_compare(PHP_VERSION, '5.4.0', '>=')) { + return @json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE); + } + + return @json_encode($data); + } + + if (version_compare(PHP_VERSION, '5.4.0', '>=')) { + return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE); + } + + return json_encode($data); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php new file mode 100644 index 00000000..5d345d53 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/ScalarFormatter.php @@ -0,0 +1,48 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * Formats data into an associative array of scalar values. + * Objects and arrays will be JSON encoded. + * + * @author Andrew Lawson <adlawson@gmail.com> + */ +class ScalarFormatter extends NormalizerFormatter +{ + /** + * {@inheritdoc} + */ + public function format(array $record) + { + foreach ($record as $key => $value) { + $record[$key] = $this->normalizeValue($value); + } + + return $record; + } + + /** + * @param mixed $value + * @return mixed + */ + protected function normalizeValue($value) + { + $normalized = $this->normalize($value); + + if (is_array($normalized) || is_object($normalized)) { + return $this->toJson($normalized, true); + } + + return $normalized; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php b/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php new file mode 100644 index 00000000..654710a8 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php @@ -0,0 +1,113 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +/** + * Serializes a log message according to Wildfire's header requirements + * + * @author Eric Clemmons (@ericclemmons) <eric@uxdriven.com> + * @author Christophe Coevoet <stof@notk.org> + * @author Kirill chEbba Chebunin <iam@chebba.org> + */ +class WildfireFormatter extends NormalizerFormatter +{ + const TABLE = 'table'; + + /** + * Translates Monolog log levels to Wildfire levels. + */ + private $logLevels = array( + Logger::DEBUG => 'LOG', + Logger::INFO => 'INFO', + Logger::NOTICE => 'INFO', + Logger::WARNING => 'WARN', + Logger::ERROR => 'ERROR', + Logger::CRITICAL => 'ERROR', + Logger::ALERT => 'ERROR', + Logger::EMERGENCY => 'ERROR', + ); + + /** + * {@inheritdoc} + */ + public function format(array $record) + { + // Retrieve the line and file if set and remove them from the formatted extra + $file = $line = ''; + if (isset($record['extra']['file'])) { + $file = $record['extra']['file']; + unset($record['extra']['file']); + } + if (isset($record['extra']['line'])) { + $line = $record['extra']['line']; + unset($record['extra']['line']); + } + + $record = $this->normalize($record); + $message = array('message' => $record['message']); + $handleError = false; + if ($record['context']) { + $message['context'] = $record['context']; + $handleError = true; + } + if ($record['extra']) { + $message['extra'] = $record['extra']; + $handleError = true; + } + if (count($message) === 1) { + $message = reset($message); + } + + if (isset($record['context'][self::TABLE])) { + $type = 'TABLE'; + $label = $record['channel'] .': '. $record['message']; + $message = $record['context'][self::TABLE]; + } else { + $type = $this->logLevels[$record['level']]; + $label = $record['channel']; + } + + // Create JSON object describing the appearance of the message in the console + $json = $this->toJson(array( + array( + 'Type' => $type, + 'File' => $file, + 'Line' => $line, + 'Label' => $label, + ), + $message, + ), $handleError); + + // The message itself is a serialization of the above JSON object + it's length + return sprintf( + '%s|%s|', + strlen($json), + $json + ); + } + + public function formatBatch(array $records) + { + throw new \BadMethodCallException('Batch formatting does not make sense for the WildfireFormatter'); + } + + protected function normalize($data) + { + if (is_object($data) && !$data instanceof \DateTime) { + return $data; + } + + return parent::normalize($data); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php new file mode 100644 index 00000000..69ede49a --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php @@ -0,0 +1,184 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\Formatter\FormatterInterface; +use Monolog\Formatter\LineFormatter; + +/** + * Base Handler class providing the Handler structure + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +abstract class AbstractHandler implements HandlerInterface +{ + protected $level = Logger::DEBUG; + protected $bubble = true; + + /** + * @var FormatterInterface + */ + protected $formatter; + protected $processors = array(); + + /** + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct($level = Logger::DEBUG, $bubble = true) + { + $this->setLevel($level); + $this->bubble = $bubble; + } + + /** + * {@inheritdoc} + */ + public function isHandling(array $record) + { + return $record['level'] >= $this->level; + } + + /** + * {@inheritdoc} + */ + public function handleBatch(array $records) + { + foreach ($records as $record) { + $this->handle($record); + } + } + + /** + * Closes the handler. + * + * This will be called automatically when the object is destroyed + */ + public function close() + { + } + + /** + * {@inheritdoc} + */ + public function pushProcessor($callback) + { + if (!is_callable($callback)) { + throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given'); + } + array_unshift($this->processors, $callback); + + return $this; + } + + /** + * {@inheritdoc} + */ + public function popProcessor() + { + if (!$this->processors) { + throw new \LogicException('You tried to pop from an empty processor stack.'); + } + + return array_shift($this->processors); + } + + /** + * {@inheritdoc} + */ + public function setFormatter(FormatterInterface $formatter) + { + $this->formatter = $formatter; + + return $this; + } + + /** + * {@inheritdoc} + */ + public function getFormatter() + { + if (!$this->formatter) { + $this->formatter = $this->getDefaultFormatter(); + } + + return $this->formatter; + } + + /** + * Sets minimum logging level at which this handler will be triggered. + * + * @param integer $level + * @return self + */ + public function setLevel($level) + { + $this->level = Logger::toMonologLevel($level); + + return $this; + } + + /** + * Gets minimum logging level at which this handler will be triggered. + * + * @return integer + */ + public function getLevel() + { + return $this->level; + } + + /** + * Sets the bubbling behavior. + * + * @param Boolean $bubble true means that this handler allows bubbling. + * false means that bubbling is not permitted. + * @return self + */ + public function setBubble($bubble) + { + $this->bubble = $bubble; + + return $this; + } + + /** + * Gets the bubbling behavior. + * + * @return Boolean true means that this handler allows bubbling. + * false means that bubbling is not permitted. + */ + public function getBubble() + { + return $this->bubble; + } + + public function __destruct() + { + try { + $this->close(); + } catch (\Exception $e) { + // do nothing + } + } + + /** + * Gets the default formatter. + * + * @return FormatterInterface + */ + protected function getDefaultFormatter() + { + return new LineFormatter(); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php new file mode 100644 index 00000000..6f18f72e --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php @@ -0,0 +1,66 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +/** + * Base Handler class providing the Handler structure + * + * Classes extending it should (in most cases) only implement write($record) + * + * @author Jordi Boggiano <j.boggiano@seld.be> + * @author Christophe Coevoet <stof@notk.org> + */ +abstract class AbstractProcessingHandler extends AbstractHandler +{ + /** + * {@inheritdoc} + */ + public function handle(array $record) + { + if (!$this->isHandling($record)) { + return false; + } + + $record = $this->processRecord($record); + + $record['formatted'] = $this->getFormatter()->format($record); + + $this->write($record); + + return false === $this->bubble; + } + + /** + * Writes the record down to the log of the implementing handler + * + * @param array $record + * @return void + */ + abstract protected function write(array $record); + + /** + * Processes a record. + * + * @param array $record + * @return array + */ + protected function processRecord(array $record) + { + if ($this->processors) { + foreach ($this->processors as $processor) { + $record = call_user_func($processor, $record); + } + } + + return $record; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php new file mode 100644 index 00000000..3eb83bd4 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/AbstractSyslogHandler.php @@ -0,0 +1,92 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; + +/** + * Common syslog functionality + */ +abstract class AbstractSyslogHandler extends AbstractProcessingHandler +{ + protected $facility; + + /** + * Translates Monolog log levels to syslog log priorities. + */ + protected $logLevels = array( + Logger::DEBUG => LOG_DEBUG, + Logger::INFO => LOG_INFO, + Logger::NOTICE => LOG_NOTICE, + Logger::WARNING => LOG_WARNING, + Logger::ERROR => LOG_ERR, + Logger::CRITICAL => LOG_CRIT, + Logger::ALERT => LOG_ALERT, + Logger::EMERGENCY => LOG_EMERG, + ); + + /** + * List of valid log facility names. + */ + protected $facilities = array( + 'auth' => LOG_AUTH, + 'authpriv' => LOG_AUTHPRIV, + 'cron' => LOG_CRON, + 'daemon' => LOG_DAEMON, + 'kern' => LOG_KERN, + 'lpr' => LOG_LPR, + 'mail' => LOG_MAIL, + 'news' => LOG_NEWS, + 'syslog' => LOG_SYSLOG, + 'user' => LOG_USER, + 'uucp' => LOG_UUCP, + ); + + /** + * @param mixed $facility + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct($facility = LOG_USER, $level = Logger::DEBUG, $bubble = true) + { + parent::__construct($level, $bubble); + + if (!defined('PHP_WINDOWS_VERSION_BUILD')) { + $this->facilities['local0'] = LOG_LOCAL0; + $this->facilities['local1'] = LOG_LOCAL1; + $this->facilities['local2'] = LOG_LOCAL2; + $this->facilities['local3'] = LOG_LOCAL3; + $this->facilities['local4'] = LOG_LOCAL4; + $this->facilities['local5'] = LOG_LOCAL5; + $this->facilities['local6'] = LOG_LOCAL6; + $this->facilities['local7'] = LOG_LOCAL7; + } + + // convert textual description of facility to syslog constant + if (array_key_exists(strtolower($facility), $this->facilities)) { + $facility = $this->facilities[strtolower($facility)]; + } elseif (!in_array($facility, array_values($this->facilities), true)) { + throw new \UnexpectedValueException('Unknown facility value "'.$facility.'" given'); + } + + $this->facility = $facility; + } + + /** + * {@inheritdoc} + */ + protected function getDefaultFormatter() + { + return new LineFormatter('%channel%.%level_name%: %message% %context% %extra%'); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php new file mode 100644 index 00000000..a28ba02a --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php @@ -0,0 +1,98 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\Formatter\JsonFormatter; +use PhpAmqpLib\Message\AMQPMessage; +use PhpAmqpLib\Channel\AMQPChannel; +use AMQPExchange; + +class AmqpHandler extends AbstractProcessingHandler +{ + /** + * @var AMQPExchange|AMQPChannel $exchange + */ + protected $exchange; + + /** + * @var string + */ + protected $exchangeName; + + /** + * @param AMQPExchange|AMQPChannel $exchange AMQPExchange (php AMQP ext) or PHP AMQP lib channel, ready for use + * @param string $exchangeName + * @param int $level + * @param bool $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct($exchange, $exchangeName = 'log', $level = Logger::DEBUG, $bubble = true) + { + if ($exchange instanceof AMQPExchange) { + $exchange->setName($exchangeName); + } elseif ($exchange instanceof AMQPChannel) { + $this->exchangeName = $exchangeName; + } else { + throw new \InvalidArgumentException('PhpAmqpLib\Channel\AMQPChannel or AMQPExchange instance required'); + } + $this->exchange = $exchange; + + parent::__construct($level, $bubble); + } + + /** + * {@inheritDoc} + */ + protected function write(array $record) + { + $data = $record["formatted"]; + + $routingKey = sprintf( + '%s.%s', + // TODO 2.0 remove substr call + substr($record['level_name'], 0, 4), + $record['channel'] + ); + + if ($this->exchange instanceof AMQPExchange) { + $this->exchange->publish( + $data, + strtolower($routingKey), + 0, + array( + 'delivery_mode' => 2, + 'Content-type' => 'application/json' + ) + ); + } else { + $this->exchange->basic_publish( + new AMQPMessage( + (string) $data, + array( + 'delivery_mode' => 2, + 'content_type' => 'application/json' + ) + ), + $this->exchangeName, + strtolower($routingKey) + ); + } + } + + /** + * {@inheritDoc} + */ + protected function getDefaultFormatter() + { + return new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php new file mode 100644 index 00000000..589ff779 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/BrowserConsoleHandler.php @@ -0,0 +1,184 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\LineFormatter; + +/** + * Handler sending logs to browser's javascript console with no browser extension required + * + * @author Olivier Poitrey <rs@dailymotion.com> + */ +class BrowserConsoleHandler extends AbstractProcessingHandler +{ + protected static $initialized = false; + protected static $records = array(); + + /** + * {@inheritDoc} + * + * Formatted output may contain some formatting markers to be transferred to `console.log` using the %c format. + * + * Example of formatted string: + * + * You can do [[blue text]]{color: blue} or [[green background]]{background-color: green; color: white} + * + */ + protected function getDefaultFormatter() + { + return new LineFormatter('[[%channel%]]{macro: autolabel} [[%level_name%]]{font-weight: bold} %message%'); + } + + /** + * {@inheritDoc} + */ + protected function write(array $record) + { + // Accumulate records + self::$records[] = $record; + + // Register shutdown handler if not already done + if (PHP_SAPI !== 'cli' && !self::$initialized) { + self::$initialized = true; + register_shutdown_function(array('Monolog\Handler\BrowserConsoleHandler', 'send')); + } + } + + /** + * Convert records to javascript console commands and send it to the browser. + * This method is automatically called on PHP shutdown if output is HTML. + */ + public static function send() + { + // Check content type + foreach (headers_list() as $header) { + if (stripos($header, 'content-type:') === 0) { + if (stripos($header, 'text/html') === false) { + // This handler only works with HTML outputs + return; + } + break; + } + } + + if (count(self::$records)) { + echo '<script>' , self::generateScript() , '</script>'; + self::reset(); + } + } + + /** + * Forget all logged records + */ + public static function reset() + { + self::$records = array(); + } + + private static function generateScript() + { + $script = array(); + foreach (self::$records as $record) { + $context = self::dump('Context', $record['context']); + $extra = self::dump('Extra', $record['extra']); + + if (empty($context) && empty($extra)) { + $script[] = self::call_array('log', self::handleStyles($record['formatted'])); + } else { + $script = array_merge($script, + array(self::call_array('groupCollapsed', self::handleStyles($record['formatted']))), + $context, + $extra, + array(self::call('groupEnd')) + ); + } + } + + return "(function (c) {if (c && c.groupCollapsed) {\n" . implode("\n", $script) . "\n}})(console);"; + } + + private static function handleStyles($formatted) + { + $args = array(self::quote('font-weight: normal')); + $format = '%c' . $formatted; + preg_match_all('/\[\[(.*?)\]\]\{([^}]*)\}/s', $format, $matches, PREG_OFFSET_CAPTURE | PREG_SET_ORDER); + + foreach (array_reverse($matches) as $match) { + $args[] = self::quote(self::handleCustomStyles($match[2][0], $match[1][0])); + $args[] = '"font-weight: normal"'; + + $pos = $match[0][1]; + $format = substr($format, 0, $pos) . '%c' . $match[1][0] . '%c' . substr($format, $pos + strlen($match[0][0])); + } + + array_unshift($args, self::quote($format)); + + return $args; + } + + private static function handleCustomStyles($style, $string) + { + static $colors = array('blue', 'green', 'red', 'magenta', 'orange', 'black', 'grey'); + static $labels = array(); + + return preg_replace_callback('/macro\s*:(.*?)(?:;|$)/', function ($m) use ($string, &$colors, &$labels) { + if (trim($m[1]) === 'autolabel') { + // Format the string as a label with consistent auto assigned background color + if (!isset($labels[$string])) { + $labels[$string] = $colors[count($labels) % count($colors)]; + } + $color = $labels[$string]; + + return "background-color: $color; color: white; border-radius: 3px; padding: 0 2px 0 2px"; + } + + return $m[1]; + }, $style); + } + + private static function dump($title, array $dict) + { + $script = array(); + $dict = array_filter($dict); + if (empty($dict)) { + return $script; + } + $script[] = self::call('log', self::quote('%c%s'), self::quote('font-weight: bold'), self::quote($title)); + foreach ($dict as $key => $value) { + $value = json_encode($value); + if (empty($value)) { + $value = self::quote(''); + } + $script[] = self::call('log', self::quote('%s: %o'), self::quote($key), $value); + } + + return $script; + } + + private static function quote($arg) + { + return '"' . addcslashes($arg, "\"\n") . '"'; + } + + private static function call() + { + $args = func_get_args(); + $method = array_shift($args); + + return self::call_array($method, $args); + } + + private static function call_array($method, array $args) + { + return 'c.' . $method . '(' . implode(', ', $args) . ');'; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php new file mode 100644 index 00000000..6d8136f7 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php @@ -0,0 +1,117 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * Buffers all records until closing the handler and then pass them as batch. + * + * This is useful for a MailHandler to send only one mail per request instead of + * sending one per log message. + * + * @author Christophe Coevoet <stof@notk.org> + */ +class BufferHandler extends AbstractHandler +{ + protected $handler; + protected $bufferSize = 0; + protected $bufferLimit; + protected $flushOnOverflow; + protected $buffer = array(); + protected $initialized = false; + + /** + * @param HandlerInterface $handler Handler. + * @param integer $bufferLimit How many entries should be buffered at most, beyond that the oldest items are removed from the buffer. + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + * @param Boolean $flushOnOverflow If true, the buffer is flushed when the max size has been reached, by default oldest entries are discarded + */ + public function __construct(HandlerInterface $handler, $bufferLimit = 0, $level = Logger::DEBUG, $bubble = true, $flushOnOverflow = false) + { + parent::__construct($level, $bubble); + $this->handler = $handler; + $this->bufferLimit = (int) $bufferLimit; + $this->flushOnOverflow = $flushOnOverflow; + } + + /** + * {@inheritdoc} + */ + public function handle(array $record) + { + if ($record['level'] < $this->level) { + return false; + } + + if (!$this->initialized) { + // __destructor() doesn't get called on Fatal errors + register_shutdown_function(array($this, 'close')); + $this->initialized = true; + } + + if ($this->bufferLimit > 0 && $this->bufferSize === $this->bufferLimit) { + if ($this->flushOnOverflow) { + $this->flush(); + } else { + array_shift($this->buffer); + $this->bufferSize--; + } + } + + if ($this->processors) { + foreach ($this->processors as $processor) { + $record = call_user_func($processor, $record); + } + } + + $this->buffer[] = $record; + $this->bufferSize++; + + return false === $this->bubble; + } + + public function flush() + { + if ($this->bufferSize === 0) { + return; + } + + $this->handler->handleBatch($this->buffer); + $this->clear(); + } + + public function __destruct() + { + // suppress the parent behavior since we already have register_shutdown_function() + // to call close(), and the reference contained there will prevent this from being + // GC'd until the end of the request + } + + /** + * {@inheritdoc} + */ + public function close() + { + $this->flush(); + } + + /** + * Clears the buffer without flushing any messages down to the wrapped handler. + */ + public function clear() + { + $this->bufferSize = 0; + $this->buffer = array(); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php new file mode 100644 index 00000000..bc659349 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php @@ -0,0 +1,204 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\ChromePHPFormatter; +use Monolog\Logger; + +/** + * Handler sending logs to the ChromePHP extension (http://www.chromephp.com/) + * + * @author Christophe Coevoet <stof@notk.org> + */ +class ChromePHPHandler extends AbstractProcessingHandler +{ + /** + * Version of the extension + */ + const VERSION = '4.0'; + + /** + * Header name + */ + const HEADER_NAME = 'X-ChromeLogger-Data'; + + protected static $initialized = false; + + /** + * Tracks whether we sent too much data + * + * Chrome limits the headers to 256KB, so when we sent 240KB we stop sending + * + * @var Boolean + */ + protected static $overflowed = false; + + protected static $json = array( + 'version' => self::VERSION, + 'columns' => array('label', 'log', 'backtrace', 'type'), + 'rows' => array(), + ); + + protected static $sendHeaders = true; + + /** + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct($level = Logger::DEBUG, $bubble = true) + { + parent::__construct($level, $bubble); + if (!function_exists('json_encode')) { + throw new \RuntimeException('PHP\'s json extension is required to use Monolog\'s ChromePHPHandler'); + } + } + + /** + * {@inheritdoc} + */ + public function handleBatch(array $records) + { + $messages = array(); + + foreach ($records as $record) { + if ($record['level'] < $this->level) { + continue; + } + $messages[] = $this->processRecord($record); + } + + if (!empty($messages)) { + $messages = $this->getFormatter()->formatBatch($messages); + self::$json['rows'] = array_merge(self::$json['rows'], $messages); + $this->send(); + } + } + + /** + * {@inheritDoc} + */ + protected function getDefaultFormatter() + { + return new ChromePHPFormatter(); + } + + /** + * Creates & sends header for a record + * + * @see sendHeader() + * @see send() + * @param array $record + */ + protected function write(array $record) + { + self::$json['rows'][] = $record['formatted']; + + $this->send(); + } + + /** + * Sends the log header + * + * @see sendHeader() + */ + protected function send() + { + if (self::$overflowed || !self::$sendHeaders) { + return; + } + + if (!self::$initialized) { + self::$initialized = true; + + self::$sendHeaders = $this->headersAccepted(); + if (!self::$sendHeaders) { + return; + } + + self::$json['request_uri'] = isset($_SERVER['REQUEST_URI']) ? $_SERVER['REQUEST_URI'] : ''; + } + + $json = @json_encode(self::$json); + $data = base64_encode(utf8_encode($json)); + if (strlen($data) > 240*1024) { + self::$overflowed = true; + + $record = array( + 'message' => 'Incomplete logs, chrome header size limit reached', + 'context' => array(), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'monolog', + 'datetime' => new \DateTime(), + 'extra' => array(), + ); + self::$json['rows'][count(self::$json['rows']) - 1] = $this->getFormatter()->format($record); + $json = @json_encode(self::$json); + $data = base64_encode(utf8_encode($json)); + } + + if (trim($data) !== '') { + $this->sendHeader(self::HEADER_NAME, $data); + } + } + + /** + * Send header string to the client + * + * @param string $header + * @param string $content + */ + protected function sendHeader($header, $content) + { + if (!headers_sent() && self::$sendHeaders) { + header(sprintf('%s: %s', $header, $content)); + } + } + + /** + * Verifies if the headers are accepted by the current user agent + * + * @return Boolean + */ + protected function headersAccepted() + { + if (empty($_SERVER['HTTP_USER_AGENT'])) { + return false; + } + + return preg_match('{\bChrome/\d+[\.\d+]*\b}', $_SERVER['HTTP_USER_AGENT']); + } + + /** + * BC getter for the sendHeaders property that has been made static + */ + public function __get($property) + { + if ('sendHeaders' !== $property) { + throw new \InvalidArgumentException('Undefined property '.$property); + } + + return static::$sendHeaders; + } + + /** + * BC setter for the sendHeaders property that has been made static + */ + public function __set($property, $value) + { + if ('sendHeaders' !== $property) { + throw new \InvalidArgumentException('Undefined property '.$property); + } + + static::$sendHeaders = $value; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php new file mode 100644 index 00000000..b3687c3d --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php @@ -0,0 +1,72 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\JsonFormatter; +use Monolog\Logger; + +/** + * CouchDB handler + * + * @author Markus Bachmann <markus.bachmann@bachi.biz> + */ +class CouchDBHandler extends AbstractProcessingHandler +{ + private $options; + + public function __construct(array $options = array(), $level = Logger::DEBUG, $bubble = true) + { + $this->options = array_merge(array( + 'host' => 'localhost', + 'port' => 5984, + 'dbname' => 'logger', + 'username' => null, + 'password' => null, + ), $options); + + parent::__construct($level, $bubble); + } + + /** + * {@inheritDoc} + */ + protected function write(array $record) + { + $basicAuth = null; + if ($this->options['username']) { + $basicAuth = sprintf('%s:%s@', $this->options['username'], $this->options['password']); + } + + $url = 'http://'.$basicAuth.$this->options['host'].':'.$this->options['port'].'/'.$this->options['dbname']; + $context = stream_context_create(array( + 'http' => array( + 'method' => 'POST', + 'content' => $record['formatted'], + 'ignore_errors' => true, + 'max_redirects' => 0, + 'header' => 'Content-type: application/json', + ) + )); + + if (false === @file_get_contents($url, null, $context)) { + throw new \RuntimeException(sprintf('Could not connect to %s', $url)); + } + } + + /** + * {@inheritDoc} + */ + protected function getDefaultFormatter() + { + return new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php new file mode 100644 index 00000000..db8e6552 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php @@ -0,0 +1,151 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * Logs to Cube. + * + * @link http://square.github.com/cube/ + * @author Wan Chen <kami@kamisama.me> + */ +class CubeHandler extends AbstractProcessingHandler +{ + private $udpConnection = null; + private $httpConnection = null; + private $scheme = null; + private $host = null; + private $port = null; + private $acceptedSchemes = array('http', 'udp'); + + /** + * Create a Cube handler + * + * @throws UnexpectedValueException when given url is not a valid url. + * A valid url must consists of three parts : protocol://host:port + * Only valid protocol used by Cube are http and udp + */ + public function __construct($url, $level = Logger::DEBUG, $bubble = true) + { + $urlInfos = parse_url($url); + + if (!isset($urlInfos['scheme']) || !isset($urlInfos['host']) || !isset($urlInfos['port'])) { + throw new \UnexpectedValueException('URL "'.$url.'" is not valid'); + } + + if (!in_array($urlInfos['scheme'], $this->acceptedSchemes)) { + throw new \UnexpectedValueException( + 'Invalid protocol (' . $urlInfos['scheme'] . ').' + . ' Valid options are ' . implode(', ', $this->acceptedSchemes)); + } + + $this->scheme = $urlInfos['scheme']; + $this->host = $urlInfos['host']; + $this->port = $urlInfos['port']; + + parent::__construct($level, $bubble); + } + + /** + * Establish a connection to an UDP socket + * + * @throws LogicException when unable to connect to the socket + */ + protected function connectUdp() + { + if (!extension_loaded('sockets')) { + throw new MissingExtensionException('The sockets extension is required to use udp URLs with the CubeHandler'); + } + + $this->udpConnection = socket_create(AF_INET, SOCK_DGRAM, 0); + if (!$this->udpConnection) { + throw new \LogicException('Unable to create a socket'); + } + + if (!socket_connect($this->udpConnection, $this->host, $this->port)) { + throw new \LogicException('Unable to connect to the socket at ' . $this->host . ':' . $this->port); + } + } + + /** + * Establish a connection to a http server + */ + protected function connectHttp() + { + if (!extension_loaded('curl')) { + throw new \LogicException('The curl extension is needed to use http URLs with the CubeHandler'); + } + + $this->httpConnection = curl_init('http://'.$this->host.':'.$this->port.'/1.0/event/put'); + + if (!$this->httpConnection) { + throw new \LogicException('Unable to connect to ' . $this->host . ':' . $this->port); + } + + curl_setopt($this->httpConnection, CURLOPT_CUSTOMREQUEST, "POST"); + curl_setopt($this->httpConnection, CURLOPT_RETURNTRANSFER, true); + } + + /** + * {@inheritdoc} + */ + protected function write(array $record) + { + $date = $record['datetime']; + + $data = array('time' => $date->format('Y-m-d\TH:i:s.uO')); + unset($record['datetime']); + + if (isset($record['context']['type'])) { + $data['type'] = $record['context']['type']; + unset($record['context']['type']); + } else { + $data['type'] = $record['channel']; + } + + $data['data'] = $record['context']; + $data['data']['level'] = $record['level']; + + if ($this->scheme === 'http') { + $this->writeHttp(json_encode($data)); + } else { + $this->writeUdp(json_encode($data)); + } + } + + private function writeUdp($data) + { + if (!$this->udpConnection) { + $this->connectUdp(); + } + + socket_send($this->udpConnection, $data, strlen($data), 0); + } + + private function writeHttp($data) + { + if (!$this->httpConnection) { + $this->connectHttp(); + } + + curl_setopt($this->httpConnection, CURLOPT_POSTFIELDS, '['.$data.']'); + curl_setopt($this->httpConnection, CURLOPT_HTTPHEADER, array( + 'Content-Type: application/json', + 'Content-Length: ' . strlen('['.$data.']')) + ); + + if (curl_exec($this->httpConnection) === false) { + throw new \RuntimeException(sprintf('Curl error (code %s): %s', curl_errno($ch), curl_error($ch))); + } + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php new file mode 100644 index 00000000..b91ffec9 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php @@ -0,0 +1,45 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\Formatter\NormalizerFormatter; +use Doctrine\CouchDB\CouchDBClient; + +/** + * CouchDB handler for Doctrine CouchDB ODM + * + * @author Markus Bachmann <markus.bachmann@bachi.biz> + */ +class DoctrineCouchDBHandler extends AbstractProcessingHandler +{ + private $client; + + public function __construct(CouchDBClient $client, $level = Logger::DEBUG, $bubble = true) + { + $this->client = $client; + parent::__construct($level, $bubble); + } + + /** + * {@inheritDoc} + */ + protected function write(array $record) + { + $this->client->postDocument($record['formatted']); + } + + protected function getDefaultFormatter() + { + return new NormalizerFormatter; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php new file mode 100644 index 00000000..e7f843c8 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/DynamoDbHandler.php @@ -0,0 +1,89 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Aws\Common\Aws; +use Aws\DynamoDb\DynamoDbClient; +use Monolog\Formatter\ScalarFormatter; +use Monolog\Logger; + +/** + * Amazon DynamoDB handler (http://aws.amazon.com/dynamodb/) + * + * @link https://github.com/aws/aws-sdk-php/ + * @author Andrew Lawson <adlawson@gmail.com> + */ +class DynamoDbHandler extends AbstractProcessingHandler +{ + const DATE_FORMAT = 'Y-m-d\TH:i:s.uO'; + + /** + * @var DynamoDbClient + */ + protected $client; + + /** + * @var string + */ + protected $table; + + /** + * @param DynamoDbClient $client + * @param string $table + * @param integer $level + * @param boolean $bubble + */ + public function __construct(DynamoDbClient $client, $table, $level = Logger::DEBUG, $bubble = true) + { + if (!defined('Aws\Common\Aws::VERSION') || version_compare('3.0', Aws::VERSION, '<=')) { + throw new \RuntimeException('The DynamoDbHandler is only known to work with the AWS SDK 2.x releases'); + } + + $this->client = $client; + $this->table = $table; + + parent::__construct($level, $bubble); + } + + /** + * {@inheritdoc} + */ + protected function write(array $record) + { + $filtered = $this->filterEmptyFields($record['formatted']); + $formatted = $this->client->formatAttributes($filtered); + + $this->client->putItem(array( + 'TableName' => $this->table, + 'Item' => $formatted + )); + } + + /** + * @param array $record + * @return array + */ + protected function filterEmptyFields(array $record) + { + return array_filter($record, function ($value) { + return !empty($value) || false === $value || 0 === $value; + }); + } + + /** + * {@inheritdoc} + */ + protected function getDefaultFormatter() + { + return new ScalarFormatter(self::DATE_FORMAT); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php new file mode 100644 index 00000000..96e5d57f --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/ElasticSearchHandler.php @@ -0,0 +1,128 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\FormatterInterface; +use Monolog\Formatter\ElasticaFormatter; +use Monolog\Logger; +use Elastica\Client; +use Elastica\Exception\ExceptionInterface; + +/** + * Elastic Search handler + * + * Usage example: + * + * $client = new \Elastica\Client(); + * $options = array( + * 'index' => 'elastic_index_name', + * 'type' => 'elastic_doc_type', + * ); + * $handler = new ElasticSearchHandler($client, $options); + * $log = new Logger('application'); + * $log->pushHandler($handler); + * + * @author Jelle Vink <jelle.vink@gmail.com> + */ +class ElasticSearchHandler extends AbstractProcessingHandler +{ + /** + * @var Client + */ + protected $client; + + /** + * @var array Handler config options + */ + protected $options = array(); + + /** + * @param Client $client Elastica Client object + * @param array $options Handler configuration + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct(Client $client, array $options = array(), $level = Logger::DEBUG, $bubble = true) + { + parent::__construct($level, $bubble); + $this->client = $client; + $this->options = array_merge( + array( + 'index' => 'monolog', // Elastic index name + 'type' => 'record', // Elastic document type + 'ignore_error' => false, // Suppress Elastica exceptions + ), + $options + ); + } + + /** + * {@inheritDoc} + */ + protected function write(array $record) + { + $this->bulkSend(array($record['formatted'])); + } + + /** + * {@inheritdoc} + */ + public function setFormatter(FormatterInterface $formatter) + { + if ($formatter instanceof ElasticaFormatter) { + return parent::setFormatter($formatter); + } + throw new \InvalidArgumentException('ElasticSearchHandler is only compatible with ElasticaFormatter'); + } + + /** + * Getter options + * @return array + */ + public function getOptions() + { + return $this->options; + } + + /** + * {@inheritDoc} + */ + protected function getDefaultFormatter() + { + return new ElasticaFormatter($this->options['index'], $this->options['type']); + } + + /** + * {@inheritdoc} + */ + public function handleBatch(array $records) + { + $documents = $this->getFormatter()->formatBatch($records); + $this->bulkSend($documents); + } + + /** + * Use Elasticsearch bulk API to send list of documents + * @param array $documents + * @throws \RuntimeException + */ + protected function bulkSend(array $documents) + { + try { + $this->client->addDocuments($documents); + } catch (ExceptionInterface $e) { + if (!$this->options['ignore_error']) { + throw new \RuntimeException("Error sending messages to Elasticsearch", 0, $e); + } + } + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php new file mode 100644 index 00000000..d1e1ee60 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php @@ -0,0 +1,82 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\LineFormatter; +use Monolog\Logger; + +/** + * Stores to PHP error_log() handler. + * + * @author Elan Ruusamäe <glen@delfi.ee> + */ +class ErrorLogHandler extends AbstractProcessingHandler +{ + const OPERATING_SYSTEM = 0; + const SAPI = 4; + + protected $messageType; + protected $expandNewlines; + + /** + * @param integer $messageType Says where the error should go. + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + * @param Boolean $expandNewlines If set to true, newlines in the message will be expanded to be take multiple log entries + */ + public function __construct($messageType = self::OPERATING_SYSTEM, $level = Logger::DEBUG, $bubble = true, $expandNewlines = false) + { + parent::__construct($level, $bubble); + + if (false === in_array($messageType, self::getAvailableTypes())) { + $message = sprintf('The given message type "%s" is not supported', print_r($messageType, true)); + throw new \InvalidArgumentException($message); + } + + $this->messageType = $messageType; + $this->expandNewlines = $expandNewlines; + } + + /** + * @return array With all available types + */ + public static function getAvailableTypes() + { + return array( + self::OPERATING_SYSTEM, + self::SAPI, + ); + } + + /** + * {@inheritDoc} + */ + protected function getDefaultFormatter() + { + return new LineFormatter('[%datetime%] %channel%.%level_name%: %message% %context% %extra%'); + } + + /** + * {@inheritdoc} + */ + protected function write(array $record) + { + if ($this->expandNewlines) { + $lines = preg_split('{[\r\n]+}', (string) $record['formatted']); + foreach ($lines as $line) { + error_log($line, $this->messageType); + } + } else { + error_log((string) $record['formatted'], $this->messageType); + } + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php new file mode 100644 index 00000000..dad82273 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/FilterHandler.php @@ -0,0 +1,140 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * Simple handler wrapper that filters records based on a list of levels + * + * It can be configured with an exact list of levels to allow, or a min/max level. + * + * @author Hennadiy Verkh + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class FilterHandler extends AbstractHandler +{ + /** + * Handler or factory callable($record, $this) + * + * @var callable|\Monolog\Handler\HandlerInterface + */ + protected $handler; + + /** + * Minimum level for logs that are passes to handler + * + * @var int[] + */ + protected $acceptedLevels; + + /** + * Whether the messages that are handled can bubble up the stack or not + * + * @var Boolean + */ + protected $bubble; + + /** + * @param callable|HandlerInterface $handler Handler or factory callable($record, $this). + * @param int|array $minLevelOrList A list of levels to accept or a minimum level if maxLevel is provided + * @param int $maxLevel Maximum level to accept, only used if $minLevelOrList is not an array + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct($handler, $minLevelOrList = Logger::DEBUG, $maxLevel = Logger::EMERGENCY, $bubble = true) + { + $this->handler = $handler; + $this->bubble = $bubble; + $this->setAcceptedLevels($minLevelOrList, $maxLevel); + + if (!$this->handler instanceof HandlerInterface && !is_callable($this->handler)) { + throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object"); + } + } + + /** + * @return array + */ + public function getAcceptedLevels() + { + return array_flip($this->acceptedLevels); + } + + /** + * @param int|array $minLevelOrList A list of levels to accept or a minimum level if maxLevel is provided + * @param int $maxLevel Maximum level to accept, only used if $minLevelOrList is not an array + */ + public function setAcceptedLevels($minLevelOrList = Logger::DEBUG, $maxLevel = Logger::EMERGENCY) + { + if (is_array($minLevelOrList)) { + $acceptedLevels = array_map('Monolog\Logger::toMonologLevel', $minLevelOrList); + } else { + $minLevelOrList = Logger::toMonologLevel($minLevelOrList); + $maxLevel = Logger::toMonologLevel($maxLevel); + $acceptedLevels = array_values(array_filter(Logger::getLevels(), function ($level) use ($minLevelOrList, $maxLevel) { + return $level >= $minLevelOrList && $level <= $maxLevel; + })); + } + $this->acceptedLevels = array_flip($acceptedLevels); + } + + /** + * {@inheritdoc} + */ + public function isHandling(array $record) + { + return isset($this->acceptedLevels[$record['level']]); + } + + /** + * {@inheritdoc} + */ + public function handle(array $record) + { + if (!$this->isHandling($record)) { + return false; + } + + // The same logic as in FingersCrossedHandler + if (!$this->handler instanceof HandlerInterface) { + $this->handler = call_user_func($this->handler, $record, $this); + if (!$this->handler instanceof HandlerInterface) { + throw new \RuntimeException("The factory callable should return a HandlerInterface"); + } + } + + if ($this->processors) { + foreach ($this->processors as $processor) { + $record = call_user_func($processor, $record); + } + } + + $this->handler->handle($record); + + return false === $this->bubble; + } + + /** + * {@inheritdoc} + */ + public function handleBatch(array $records) + { + $filtered = array(); + foreach ($records as $record) { + if ($this->isHandling($record)) { + $filtered[] = $record; + } + } + + $this->handler->handleBatch($filtered); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php new file mode 100644 index 00000000..c3e42efe --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php @@ -0,0 +1,28 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler\FingersCrossed; + +/** + * Interface for activation strategies for the FingersCrossedHandler. + * + * @author Johannes M. Schmitt <schmittjoh@gmail.com> + */ +interface ActivationStrategyInterface +{ + /** + * Returns whether the given record activates the handler. + * + * @param array $record + * @return Boolean + */ + public function isHandlerActivated(array $record); +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php new file mode 100644 index 00000000..e3b403f6 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php @@ -0,0 +1,59 @@ +<?php + +/* + * This file is part of the Monolog package. +* +* (c) Jordi Boggiano <j.boggiano@seld.be> +* +* For the full copyright and license information, please view the LICENSE +* file that was distributed with this source code. +*/ + +namespace Monolog\Handler\FingersCrossed; + +use Monolog\Logger; + +/** + * Channel and Error level based monolog activation strategy. Allows to trigger activation + * based on level per channel. e.g. trigger activation on level 'ERROR' by default, except + * for records of the 'sql' channel; those should trigger activation on level 'WARN'. + * + * Example: + * + * <code> + * $activationStrategy = new ChannelLevelActivationStrategy( + * Logger::CRITICAL, + * array( + * 'request' => Logger::ALERT, + * 'sensitive' => Logger::ERROR, + * ) + * ); + * $handler = new FingersCrossedHandler(new StreamHandler('php://stderr'), $activationStrategy); + * </code> + * + * @author Mike Meessen <netmikey@gmail.com> + */ +class ChannelLevelActivationStrategy implements ActivationStrategyInterface +{ + private $defaultActionLevel; + private $channelToActionLevel; + + /** + * @param int $defaultActionLevel The default action level to be used if the record's category doesn't match any + * @param array $channelToActionLevel An array that maps channel names to action levels. + */ + public function __construct($defaultActionLevel, $channelToActionLevel = array()) + { + $this->defaultActionLevel = Logger::toMonologLevel($defaultActionLevel); + $this->channelToActionLevel = array_map('Monolog\Logger::toMonologLevel', $channelToActionLevel); + } + + public function isHandlerActivated(array $record) + { + if (isset($this->channelToActionLevel[$record['channel']])) { + return $record['level'] >= $this->channelToActionLevel[$record['channel']]; + } + + return $record['level'] >= $this->defaultActionLevel; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php new file mode 100644 index 00000000..6e630852 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php @@ -0,0 +1,34 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler\FingersCrossed; + +use Monolog\Logger; + +/** + * Error level based activation strategy. + * + * @author Johannes M. Schmitt <schmittjoh@gmail.com> + */ +class ErrorLevelActivationStrategy implements ActivationStrategyInterface +{ + private $actionLevel; + + public function __construct($actionLevel) + { + $this->actionLevel = Logger::toMonologLevel($actionLevel); + } + + public function isHandlerActivated(array $record) + { + return $record['level'] >= $this->actionLevel; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php new file mode 100644 index 00000000..30a85dd6 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php @@ -0,0 +1,153 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy; +use Monolog\Handler\FingersCrossed\ActivationStrategyInterface; +use Monolog\Logger; + +/** + * Buffers all records until a certain level is reached + * + * The advantage of this approach is that you don't get any clutter in your log files. + * Only requests which actually trigger an error (or whatever your actionLevel is) will be + * in the logs, but they will contain all records, not only those above the level threshold. + * + * You can find the various activation strategies in the + * Monolog\Handler\FingersCrossed\ namespace. + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class FingersCrossedHandler extends AbstractHandler +{ + protected $handler; + protected $activationStrategy; + protected $buffering = true; + protected $bufferSize; + protected $buffer = array(); + protected $stopBuffering; + protected $passthruLevel; + + /** + * @param callable|HandlerInterface $handler Handler or factory callable($record, $fingersCrossedHandler). + * @param int|ActivationStrategyInterface $activationStrategy Strategy which determines when this handler takes action + * @param int $bufferSize How many entries should be buffered at most, beyond that the oldest items are removed from the buffer. + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + * @param Boolean $stopBuffering Whether the handler should stop buffering after being triggered (default true) + * @param int $passthruLevel Minimum level to always flush to handler on close, even if strategy not triggered + */ + public function __construct($handler, $activationStrategy = null, $bufferSize = 0, $bubble = true, $stopBuffering = true, $passthruLevel = null) + { + if (null === $activationStrategy) { + $activationStrategy = new ErrorLevelActivationStrategy(Logger::WARNING); + } + + // convert simple int activationStrategy to an object + if (!$activationStrategy instanceof ActivationStrategyInterface) { + $activationStrategy = new ErrorLevelActivationStrategy($activationStrategy); + } + + $this->handler = $handler; + $this->activationStrategy = $activationStrategy; + $this->bufferSize = $bufferSize; + $this->bubble = $bubble; + $this->stopBuffering = $stopBuffering; + + if ($passthruLevel !== null) { + $this->passthruLevel = Logger::toMonologLevel($passthruLevel); + } + + if (!$this->handler instanceof HandlerInterface && !is_callable($this->handler)) { + throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object"); + } + } + + /** + * {@inheritdoc} + */ + public function isHandling(array $record) + { + return true; + } + + /** + * {@inheritdoc} + */ + public function handle(array $record) + { + if ($this->processors) { + foreach ($this->processors as $processor) { + $record = call_user_func($processor, $record); + } + } + + if ($this->buffering) { + $this->buffer[] = $record; + if ($this->bufferSize > 0 && count($this->buffer) > $this->bufferSize) { + array_shift($this->buffer); + } + if ($this->activationStrategy->isHandlerActivated($record)) { + if ($this->stopBuffering) { + $this->buffering = false; + } + if (!$this->handler instanceof HandlerInterface) { + $this->handler = call_user_func($this->handler, $record, $this); + if (!$this->handler instanceof HandlerInterface) { + throw new \RuntimeException("The factory callable should return a HandlerInterface"); + } + } + $this->handler->handleBatch($this->buffer); + $this->buffer = array(); + } + } else { + $this->handler->handle($record); + } + + return false === $this->bubble; + } + + /** + * {@inheritdoc} + */ + public function close() + { + if (null !== $this->passthruLevel) { + $level = $this->passthruLevel; + $this->buffer = array_filter($this->buffer, function ($record) use ($level) { + return $record['level'] >= $level; + }); + if (count($this->buffer) > 0) { + $this->handler->handleBatch($this->buffer); + $this->buffer = array(); + } + } + } + + /** + * Resets the state of the handler. Stops forwarding records to the wrapped handler. + */ + public function reset() + { + $this->buffering = true; + } + + /** + * Clears the buffer without flushing any messages down to the wrapped handler. + * + * It also resets the handler to its initial buffering state. + */ + public function clear() + { + $this->buffer = array(); + $this->reset(); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php new file mode 100644 index 00000000..fee47950 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php @@ -0,0 +1,195 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\WildfireFormatter; + +/** + * Simple FirePHP Handler (http://www.firephp.org/), which uses the Wildfire protocol. + * + * @author Eric Clemmons (@ericclemmons) <eric@uxdriven.com> + */ +class FirePHPHandler extends AbstractProcessingHandler +{ + /** + * WildFire JSON header message format + */ + const PROTOCOL_URI = 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2'; + + /** + * FirePHP structure for parsing messages & their presentation + */ + const STRUCTURE_URI = 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1'; + + /** + * Must reference a "known" plugin, otherwise headers won't display in FirePHP + */ + const PLUGIN_URI = 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3'; + + /** + * Header prefix for Wildfire to recognize & parse headers + */ + const HEADER_PREFIX = 'X-Wf'; + + /** + * Whether or not Wildfire vendor-specific headers have been generated & sent yet + */ + protected static $initialized = false; + + /** + * Shared static message index between potentially multiple handlers + * @var int + */ + protected static $messageIndex = 1; + + protected static $sendHeaders = true; + + /** + * Base header creation function used by init headers & record headers + * + * @param array $meta Wildfire Plugin, Protocol & Structure Indexes + * @param string $message Log message + * @return array Complete header string ready for the client as key and message as value + */ + protected function createHeader(array $meta, $message) + { + $header = sprintf('%s-%s', self::HEADER_PREFIX, join('-', $meta)); + + return array($header => $message); + } + + /** + * Creates message header from record + * + * @see createHeader() + * @param array $record + * @return string + */ + protected function createRecordHeader(array $record) + { + // Wildfire is extensible to support multiple protocols & plugins in a single request, + // but we're not taking advantage of that (yet), so we're using "1" for simplicity's sake. + return $this->createHeader( + array(1, 1, 1, self::$messageIndex++), + $record['formatted'] + ); + } + + /** + * {@inheritDoc} + */ + protected function getDefaultFormatter() + { + return new WildfireFormatter(); + } + + /** + * Wildfire initialization headers to enable message parsing + * + * @see createHeader() + * @see sendHeader() + * @return array + */ + protected function getInitHeaders() + { + // Initial payload consists of required headers for Wildfire + return array_merge( + $this->createHeader(array('Protocol', 1), self::PROTOCOL_URI), + $this->createHeader(array(1, 'Structure', 1), self::STRUCTURE_URI), + $this->createHeader(array(1, 'Plugin', 1), self::PLUGIN_URI) + ); + } + + /** + * Send header string to the client + * + * @param string $header + * @param string $content + */ + protected function sendHeader($header, $content) + { + if (!headers_sent() && self::$sendHeaders) { + header(sprintf('%s: %s', $header, $content)); + } + } + + /** + * Creates & sends header for a record, ensuring init headers have been sent prior + * + * @see sendHeader() + * @see sendInitHeaders() + * @param array $record + */ + protected function write(array $record) + { + if (!self::$sendHeaders) { + return; + } + + // WildFire-specific headers must be sent prior to any messages + if (!self::$initialized) { + self::$initialized = true; + + self::$sendHeaders = $this->headersAccepted(); + if (!self::$sendHeaders) { + return; + } + + foreach ($this->getInitHeaders() as $header => $content) { + $this->sendHeader($header, $content); + } + } + + $header = $this->createRecordHeader($record); + if (trim(current($header)) !== '') { + $this->sendHeader(key($header), current($header)); + } + } + + /** + * Verifies if the headers are accepted by the current user agent + * + * @return Boolean + */ + protected function headersAccepted() + { + if (!empty($_SERVER['HTTP_USER_AGENT']) && preg_match('{\bFirePHP/\d+\.\d+\b}', $_SERVER['HTTP_USER_AGENT'])) { + return true; + } + + return isset($_SERVER['HTTP_X_FIREPHP_VERSION']); + } + + /** + * BC getter for the sendHeaders property that has been made static + */ + public function __get($property) + { + if ('sendHeaders' !== $property) { + throw new \InvalidArgumentException('Undefined property '.$property); + } + + return static::$sendHeaders; + } + + /** + * BC setter for the sendHeaders property that has been made static + */ + public function __set($property, $value) + { + if ('sendHeaders' !== $property) { + throw new \InvalidArgumentException('Undefined property '.$property); + } + + static::$sendHeaders = $value; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php new file mode 100644 index 00000000..388692c4 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/FleepHookHandler.php @@ -0,0 +1,126 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\LineFormatter; +use Monolog\Logger; + +/** + * Sends logs to Fleep.io using Webhook integrations + * + * You'll need a Fleep.io account to use this handler. + * + * @see https://fleep.io/integrations/webhooks/ Fleep Webhooks Documentation + * @author Ando Roots <ando@sqroot.eu> + */ +class FleepHookHandler extends SocketHandler +{ + const FLEEP_HOST = 'fleep.io'; + + const FLEEP_HOOK_URI = '/hook/'; + + /** + * @var string Webhook token (specifies the conversation where logs are sent) + */ + protected $token; + + /** + * Construct a new Fleep.io Handler. + * + * For instructions on how to create a new web hook in your conversations + * see https://fleep.io/integrations/webhooks/ + * + * @param string $token Webhook token + * @param bool|int $level The minimum logging level at which this handler will be triggered + * @param bool $bubble Whether the messages that are handled can bubble up the stack or not + * @throws MissingExtensionException + */ + public function __construct($token, $level = Logger::DEBUG, $bubble = true) + { + if (!extension_loaded('openssl')) { + throw new MissingExtensionException('The OpenSSL PHP extension is required to use the FleepHookHandler'); + } + + $this->token = $token; + + $connectionString = 'ssl://' . self::FLEEP_HOST . ':443'; + parent::__construct($connectionString, $level, $bubble); + } + + /** + * Returns the default formatter to use with this handler + * + * Overloaded to remove empty context and extra arrays from the end of the log message. + * + * @return LineFormatter + */ + protected function getDefaultFormatter() + { + return new LineFormatter(null, null, true, true); + } + + /** + * Handles a log record + * + * @param array $record + */ + public function write(array $record) + { + parent::write($record); + $this->closeSocket(); + } + + /** + * {@inheritdoc} + * + * @param array $record + * @return string + */ + protected function generateDataStream($record) + { + $content = $this->buildContent($record); + + return $this->buildHeader($content) . $content; + } + + /** + * Builds the header of the API Call + * + * @param string $content + * @return string + */ + private function buildHeader($content) + { + $header = "POST " . self::FLEEP_HOOK_URI . $this->token . " HTTP/1.1\r\n"; + $header .= "Host: " . self::FLEEP_HOST . "\r\n"; + $header .= "Content-Type: application/x-www-form-urlencoded\r\n"; + $header .= "Content-Length: " . strlen($content) . "\r\n"; + $header .= "\r\n"; + + return $header; + } + + /** + * Builds the body of API call + * + * @param array $record + * @return string + */ + private function buildContent($record) + { + $dataArray = array( + 'message' => $record['formatted'] + ); + + return http_build_query($dataArray); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php new file mode 100644 index 00000000..6eaaa9d4 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/FlowdockHandler.php @@ -0,0 +1,103 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * Sends notifications through the Flowdock push API + * + * This must be configured with a FlowdockFormatter instance via setFormatter() + * + * Notes: + * API token - Flowdock API token + * + * @author Dominik Liebler <liebler.dominik@gmail.com> + * @see https://www.flowdock.com/api/push + */ +class FlowdockHandler extends SocketHandler +{ + /** + * @var string + */ + protected $apiToken; + + /** + * @param string $apiToken + * @param bool|int $level The minimum logging level at which this handler will be triggered + * @param bool $bubble Whether the messages that are handled can bubble up the stack or not + * + * @throws MissingExtensionException if OpenSSL is missing + */ + public function __construct($apiToken, $level = Logger::DEBUG, $bubble = true) + { + if (!extension_loaded('openssl')) { + throw new MissingExtensionException('The OpenSSL PHP extension is required to use the FlowdockHandler'); + } + + parent::__construct('ssl://api.flowdock.com:443', $level, $bubble); + $this->apiToken = $apiToken; + } + + /** + * {@inheritdoc} + * + * @param array $record + */ + protected function write(array $record) + { + parent::write($record); + + $this->closeSocket(); + } + + /** + * {@inheritdoc} + * + * @param array $record + * @return string + */ + protected function generateDataStream($record) + { + $content = $this->buildContent($record); + + return $this->buildHeader($content) . $content; + } + + /** + * Builds the body of API call + * + * @param array $record + * @return string + */ + private function buildContent($record) + { + return json_encode($record['formatted']['flowdock']); + } + + /** + * Builds the header of the API Call + * + * @param string $content + * @return string + */ + private function buildHeader($content) + { + $header = "POST /v1/messages/team_inbox/" . $this->apiToken . " HTTP/1.1\r\n"; + $header .= "Host: api.flowdock.com\r\n"; + $header .= "Content-Type: application/json\r\n"; + $header .= "Content-Length: " . strlen($content) . "\r\n"; + $header .= "\r\n"; + + return $header; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php new file mode 100644 index 00000000..28c7b55f --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php @@ -0,0 +1,73 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Gelf\IMessagePublisher; +use Gelf\PublisherInterface; +use Gelf\Publisher; +use InvalidArgumentException; +use Monolog\Logger; +use Monolog\Formatter\GelfMessageFormatter; + +/** + * Handler to send messages to a Graylog2 (http://www.graylog2.org) server + * + * @author Matt Lehner <mlehner@gmail.com> + * @author Benjamin Zikarsky <benjamin@zikarsky.de> + */ +class GelfHandler extends AbstractProcessingHandler +{ + /** + * @var Publisher the publisher object that sends the message to the server + */ + protected $publisher; + + /** + * @param PublisherInterface|IMessagePublisher|Publisher $publisher a publisher object + * @param integer $level The minimum logging level at which this handler will be triggered + * @param boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct($publisher, $level = Logger::DEBUG, $bubble = true) + { + parent::__construct($level, $bubble); + + if (!$publisher instanceof Publisher && !$publisher instanceof IMessagePublisher && !$publisher instanceof PublisherInterface) { + throw new InvalidArgumentException("Invalid publisher, expected a Gelf\Publisher, Gelf\IMessagePublisher or Gelf\PublisherInterface instance"); + } + + $this->publisher = $publisher; + } + + /** + * {@inheritdoc} + */ + public function close() + { + $this->publisher = null; + } + + /** + * {@inheritdoc} + */ + protected function write(array $record) + { + $this->publisher->publish($record['formatted']); + } + + /** + * {@inheritDoc} + */ + protected function getDefaultFormatter() + { + return new GelfMessageFormatter(); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php new file mode 100644 index 00000000..99384d35 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php @@ -0,0 +1,80 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +/** + * Forwards records to multiple handlers + * + * @author Lenar Lõhmus <lenar@city.ee> + */ +class GroupHandler extends AbstractHandler +{ + protected $handlers; + + /** + * @param array $handlers Array of Handlers. + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct(array $handlers, $bubble = true) + { + foreach ($handlers as $handler) { + if (!$handler instanceof HandlerInterface) { + throw new \InvalidArgumentException('The first argument of the GroupHandler must be an array of HandlerInterface instances.'); + } + } + + $this->handlers = $handlers; + $this->bubble = $bubble; + } + + /** + * {@inheritdoc} + */ + public function isHandling(array $record) + { + foreach ($this->handlers as $handler) { + if ($handler->isHandling($record)) { + return true; + } + } + + return false; + } + + /** + * {@inheritdoc} + */ + public function handle(array $record) + { + if ($this->processors) { + foreach ($this->processors as $processor) { + $record = call_user_func($processor, $record); + } + } + + foreach ($this->handlers as $handler) { + $handler->handle($record); + } + + return false === $this->bubble; + } + + /** + * {@inheritdoc} + */ + public function handleBatch(array $records) + { + foreach ($this->handlers as $handler) { + $handler->handleBatch($records); + } + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php b/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php new file mode 100644 index 00000000..d920c4ba --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php @@ -0,0 +1,90 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\FormatterInterface; + +/** + * Interface that all Monolog Handlers must implement + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +interface HandlerInterface +{ + /** + * Checks whether the given record will be handled by this handler. + * + * This is mostly done for performance reasons, to avoid calling processors for nothing. + * + * Handlers should still check the record levels within handle(), returning false in isHandling() + * is no guarantee that handle() will not be called, and isHandling() might not be called + * for a given record. + * + * @param array $record Partial log record containing only a level key + * + * @return Boolean + */ + public function isHandling(array $record); + + /** + * Handles a record. + * + * All records may be passed to this method, and the handler should discard + * those that it does not want to handle. + * + * The return value of this function controls the bubbling process of the handler stack. + * Unless the bubbling is interrupted (by returning true), the Logger class will keep on + * calling further handlers in the stack with a given log record. + * + * @param array $record The record to handle + * @return Boolean true means that this handler handled the record, and that bubbling is not permitted. + * false means the record was either not processed or that this handler allows bubbling. + */ + public function handle(array $record); + + /** + * Handles a set of records at once. + * + * @param array $records The records to handle (an array of record arrays) + */ + public function handleBatch(array $records); + + /** + * Adds a processor in the stack. + * + * @param callable $callback + * @return self + */ + public function pushProcessor($callback); + + /** + * Removes the processor on top of the stack and returns it. + * + * @return callable + */ + public function popProcessor(); + + /** + * Sets the formatter. + * + * @param FormatterInterface $formatter + * @return self + */ + public function setFormatter(FormatterInterface $formatter); + + /** + * Gets the formatter. + * + * @return FormatterInterface + */ + public function getFormatter(); +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php new file mode 100644 index 00000000..34d3437f --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php @@ -0,0 +1,337 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * Sends notifications through the hipchat api to a hipchat room + * + * Notes: + * API token - HipChat API token + * Room - HipChat Room Id or name, where messages are sent + * Name - Name used to send the message (from) + * notify - Should the message trigger a notification in the clients + * version - The API version to use (HipChatHandler::API_V1 | HipChatHandler::API_V2) + * + * @author Rafael Dohms <rafael@doh.ms> + * @see https://www.hipchat.com/docs/api + */ +class HipChatHandler extends SocketHandler +{ + /** + * Use API version 1 + */ + const API_V1 = 'v1'; + + /** + * Use API version v2 + */ + const API_V2 = 'v2'; + + /** + * The maximum allowed length for the name used in the "from" field. + */ + const MAXIMUM_NAME_LENGTH = 15; + + /** + * The maximum allowed length for the message. + */ + const MAXIMUM_MESSAGE_LENGTH = 9500; + + /** + * @var string + */ + private $token; + + /** + * @var string + */ + private $room; + + /** + * @var string + */ + private $name; + + /** + * @var bool + */ + private $notify; + + /** + * @var string + */ + private $format; + + /** + * @var string + */ + private $host; + + /** + * @var string + */ + private $version; + + /** + * @param string $token HipChat API Token + * @param string $room The room that should be alerted of the message (Id or Name) + * @param string $name Name used in the "from" field. Not used for v2 + * @param bool $notify Trigger a notification in clients or not + * @param int $level The minimum logging level at which this handler will be triggered + * @param bool $bubble Whether the messages that are handled can bubble up the stack or not + * @param bool $useSSL Whether to connect via SSL. + * @param string $format The format of the messages (default to text, can be set to html if you have html in the messages) + * @param string $host The HipChat server hostname. + * @param string $version The HipChat API version (default HipChatHandler::API_V1) + */ + public function __construct($token, $room, $name = 'Monolog', $notify = false, $level = Logger::CRITICAL, $bubble = true, $useSSL = true, $format = 'text', $host = 'api.hipchat.com', $version = self::API_V1) + { + if ($version == self::API_V1 && !$this->validateStringLength($name, static::MAXIMUM_NAME_LENGTH)) { + throw new \InvalidArgumentException('The supplied name is too long. HipChat\'s v1 API supports names up to 15 UTF-8 characters.'); + } + + $connectionString = $useSSL ? 'ssl://'.$host.':443' : $host.':80'; + parent::__construct($connectionString, $level, $bubble); + + $this->token = $token; + $this->name = $name; + $this->notify = $notify; + $this->room = $room; + $this->format = $format; + $this->host = $host; + $this->version = $version; + } + + /** + * {@inheritdoc} + * + * @param array $record + * @return string + */ + protected function generateDataStream($record) + { + $content = $this->buildContent($record); + + return $this->buildHeader($content) . $content; + } + + /** + * Builds the body of API call + * + * @param array $record + * @return string + */ + private function buildContent($record) + { + $dataArray = array( + 'notify' => $this->version == self::API_V1 ? + ($this->notify ? 1 : 0) : + ($this->notify ? 'true' : 'false'), + 'message' => $record['formatted'], + 'message_format' => $this->format, + 'color' => $this->getAlertColor($record['level']), + ); + + // if we are using the legacy API then we need to send some additional information + if ($this->version == self::API_V1) { + $dataArray['room_id'] = $this->room; + $dataArray['from'] = $this->name; + } + + return http_build_query($dataArray); + } + + /** + * Builds the header of the API Call + * + * @param string $content + * @return string + */ + private function buildHeader($content) + { + if ($this->version == self::API_V1) { + $header = "POST /v1/rooms/message?format=json&auth_token={$this->token} HTTP/1.1\r\n"; + } else { + // needed for rooms with special (spaces, etc) characters in the name + $room = rawurlencode($this->room); + $header = "POST /v2/room/{$room}/notification?auth_token={$this->token} HTTP/1.1\r\n"; + } + + $header .= "Host: {$this->host}\r\n"; + $header .= "Content-Type: application/x-www-form-urlencoded\r\n"; + $header .= "Content-Length: " . strlen($content) . "\r\n"; + $header .= "\r\n"; + + return $header; + } + + /** + * Assigns a color to each level of log records. + * + * @param integer $level + * @return string + */ + protected function getAlertColor($level) + { + switch (true) { + case $level >= Logger::ERROR: + return 'red'; + case $level >= Logger::WARNING: + return 'yellow'; + case $level >= Logger::INFO: + return 'green'; + case $level == Logger::DEBUG: + return 'gray'; + default: + return 'yellow'; + } + } + + /** + * {@inheritdoc} + * + * @param array $record + */ + protected function write(array $record) + { + parent::write($record); + $this->closeSocket(); + } + + /** + * {@inheritdoc} + */ + public function handleBatch(array $records) + { + if (count($records) == 0) { + return true; + } + + $batchRecords = $this->combineRecords($records); + + $handled = false; + foreach ($batchRecords as $batchRecord) { + if ($this->isHandling($batchRecord)) { + $this->write($batchRecord); + $handled = true; + } + } + + if (!$handled) { + return false; + } + + return false === $this->bubble; + } + + /** + * Combines multiple records into one. Error level of the combined record + * will be the highest level from the given records. Datetime will be taken + * from the first record. + * + * @param $records + * @return array + */ + private function combineRecords($records) + { + $batchRecord = null; + $batchRecords = array(); + $messages = array(); + $formattedMessages = array(); + $level = 0; + $levelName = null; + $datetime = null; + + foreach ($records as $record) { + $record = $this->processRecord($record); + + if ($record['level'] > $level) { + $level = $record['level']; + $levelName = $record['level_name']; + } + + if (null === $datetime) { + $datetime = $record['datetime']; + } + + $messages[] = $record['message']; + $messageStr = implode(PHP_EOL, $messages); + $formattedMessages[] = $this->getFormatter()->format($record); + $formattedMessageStr = implode('', $formattedMessages); + + $batchRecord = array( + 'message' => $messageStr, + 'formatted' => $formattedMessageStr, + 'context' => array(), + 'extra' => array(), + ); + + if (!$this->validateStringLength($batchRecord['formatted'], static::MAXIMUM_MESSAGE_LENGTH)) { + // Pop the last message and implode the remaining messages + $lastMessage = array_pop($messages); + $lastFormattedMessage = array_pop($formattedMessages); + $batchRecord['message'] = implode(PHP_EOL, $messages); + $batchRecord['formatted'] = implode('', $formattedMessages); + + $batchRecords[] = $batchRecord; + $messages = array($lastMessage); + $formattedMessages = array($lastFormattedMessage); + + $batchRecord = null; + } + } + + if (null !== $batchRecord) { + $batchRecords[] = $batchRecord; + } + + // Set the max level and datetime for all records + foreach ($batchRecords as &$batchRecord) { + $batchRecord = array_merge( + $batchRecord, + array( + 'level' => $level, + 'level_name' => $levelName, + 'datetime' => $datetime + ) + ); + } + + return $batchRecords; + } + + /** + * Validates the length of a string. + * + * If the `mb_strlen()` function is available, it will use that, as HipChat + * allows UTF-8 characters. Otherwise, it will fall back to `strlen()`. + * + * Note that this might cause false failures in the specific case of using + * a valid name with less than 16 characters, but 16 or more bytes, on a + * system where `mb_strlen()` is unavailable. + * + * @param string $str + * @param int $length + * + * @return bool + */ + private function validateStringLength($str, $length) + { + if (function_exists('mb_strlen')) { + return (mb_strlen($str) <= $length); + } + + return (strlen($str) <= $length); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php new file mode 100644 index 00000000..bd56230f --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/LogEntriesHandler.php @@ -0,0 +1,55 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * @author Robert Kaufmann III <rok3@rok3.me> + */ +class LogEntriesHandler extends SocketHandler +{ + /** + * @var string + */ + protected $logToken; + + /** + * @param string $token Log token supplied by LogEntries + * @param boolean $useSSL Whether or not SSL encryption should be used. + * @param int $level The minimum logging level to trigger this handler + * @param boolean $bubble Whether or not messages that are handled should bubble up the stack. + * + * @throws MissingExtensionException If SSL encryption is set to true and OpenSSL is missing + */ + public function __construct($token, $useSSL = true, $level = Logger::DEBUG, $bubble = true) + { + if ($useSSL && !extension_loaded('openssl')) { + throw new MissingExtensionException('The OpenSSL PHP plugin is required to use SSL encrypted connection for LogEntriesHandler'); + } + + $endpoint = $useSSL ? 'ssl://data.logentries.com:443' : 'data.logentries.com:80'; + parent::__construct($endpoint, $level, $bubble); + $this->logToken = $token; + } + + /** + * {@inheritdoc} + * + * @param array $record + * @return string + */ + protected function generateDataStream($record) + { + return $this->logToken . ' ' . $record['formatted']; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php new file mode 100644 index 00000000..9785cec0 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/LogglyHandler.php @@ -0,0 +1,106 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\Formatter\LogglyFormatter; + +/** + * Sends errors to Loggly. + * + * @author Przemek Sobstel <przemek@sobstel.org> + * @author Adam Pancutt <adam@pancutt.com> + * @author Gregory Barchard <gregory@barchard.net> + */ +class LogglyHandler extends AbstractProcessingHandler +{ + const HOST = 'logs-01.loggly.com'; + const ENDPOINT_SINGLE = 'inputs'; + const ENDPOINT_BATCH = 'bulk'; + + protected $token; + + protected $tag = array(); + + public function __construct($token, $level = Logger::DEBUG, $bubble = true) + { + if (!extension_loaded('curl')) { + throw new \LogicException('The curl extension is needed to use the LogglyHandler'); + } + + $this->token = $token; + + parent::__construct($level, $bubble); + } + + public function setTag($tag) + { + $tag = !empty($tag) ? $tag : array(); + $this->tag = is_array($tag) ? $tag : array($tag); + } + + public function addTag($tag) + { + if (!empty($tag)) { + $tag = is_array($tag) ? $tag : array($tag); + $this->tag = array_unique(array_merge($this->tag, $tag)); + } + } + + protected function write(array $record) + { + $this->send($record["formatted"], self::ENDPOINT_SINGLE); + } + + public function handleBatch(array $records) + { + $level = $this->level; + + $records = array_filter($records, function ($record) use ($level) { + return ($record['level'] >= $level); + }); + + if ($records) { + $this->send($this->getFormatter()->formatBatch($records), self::ENDPOINT_BATCH); + } + } + + protected function send($data, $endpoint) + { + $url = sprintf("https://%s/%s/%s/", self::HOST, $endpoint, $this->token); + + $headers = array('Content-Type: application/json'); + + if (!empty($this->tag)) { + $headers[] = 'X-LOGGLY-TAG: '.implode(',', $this->tag); + } + + $ch = curl_init(); + + curl_setopt($ch, CURLOPT_URL, $url); + curl_setopt($ch, CURLOPT_POST, true); + curl_setopt($ch, CURLOPT_POSTFIELDS, $data); + curl_setopt($ch, CURLOPT_HTTPHEADER, $headers); + curl_setopt($ch, CURLOPT_RETURNTRANSFER, true); + + if (curl_exec($ch) === false) { + throw new \RuntimeException(sprintf('Curl error (code %s): %s', curl_errno($ch), curl_error($ch))); + } + + curl_close($ch); + } + + protected function getDefaultFormatter() + { + return new LogglyFormatter(); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php new file mode 100644 index 00000000..50ed6380 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php @@ -0,0 +1,55 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +/** + * Base class for all mail handlers + * + * @author Gyula Sallai + */ +abstract class MailHandler extends AbstractProcessingHandler +{ + /** + * {@inheritdoc} + */ + public function handleBatch(array $records) + { + $messages = array(); + + foreach ($records as $record) { + if ($record['level'] < $this->level) { + continue; + } + $messages[] = $this->processRecord($record); + } + + if (!empty($messages)) { + $this->send((string) $this->getFormatter()->formatBatch($messages), $messages); + } + } + + /** + * Send a mail with the given content + * + * @param string $content formatted email body to be sent + * @param array $records the array of log records that formed this content + */ + abstract protected function send($content, array $records); + + /** + * {@inheritdoc} + */ + protected function write(array $record) + { + $this->send((string) $record['formatted'], array($record)); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php new file mode 100644 index 00000000..6726e1e4 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/MandrillHandler.php @@ -0,0 +1,71 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * MandrillHandler uses cURL to send the emails to the Mandrill API + * + * @author Adam Nicholson <adamnicholson10@gmail.com> + */ +class MandrillHandler extends MailHandler +{ + protected $client; + protected $message; + + /** + * @param string $apiKey A valid Mandrill API key + * @param callable|\Swift_Message $message An example message for real messages, only the body will be replaced + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct($apiKey, $message, $level = Logger::ERROR, $bubble = true) + { + parent::__construct($level, $bubble); + + if (!$message instanceof \Swift_Message && is_callable($message)) { + $message = call_user_func($message); + } + if (!$message instanceof \Swift_Message) { + throw new \InvalidArgumentException('You must provide either a Swift_Message instance or a callable returning it'); + } + $this->message = $message; + $this->apiKey = $apiKey; + } + + /** + * {@inheritdoc} + */ + protected function send($content, array $records) + { + $message = clone $this->message; + $message->setBody($content); + $message->setDate(time()); + + $ch = curl_init(); + + curl_setopt($ch, CURLOPT_URL, 'https://mandrillapp.com/api/1.0/messages/send-raw.json'); + curl_setopt($ch, CURLOPT_POST, 1); + curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1); + curl_setopt($ch, CURLOPT_POSTFIELDS, http_build_query(array( + 'key' => $this->apiKey, + 'raw_message' => (string) $message, + 'async' => false, + ))); + + if (curl_exec($ch) === false) { + throw new \RuntimeException(sprintf('Curl error (code %s): %s', curl_errno($ch), curl_error($ch))); + } + curl_close($ch); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php b/vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php new file mode 100644 index 00000000..4724a7e2 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php @@ -0,0 +1,21 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +/** + * Exception can be thrown if an extension for an handler is missing + * + * @author Christian Bergau <cbergau86@gmail.com> + */ +class MissingExtensionException extends \Exception +{ +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php new file mode 100644 index 00000000..6c431f2b --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php @@ -0,0 +1,55 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\Formatter\NormalizerFormatter; + +/** + * Logs to a MongoDB database. + * + * usage example: + * + * $log = new Logger('application'); + * $mongodb = new MongoDBHandler(new \Mongo("mongodb://localhost:27017"), "logs", "prod"); + * $log->pushHandler($mongodb); + * + * @author Thomas Tourlourat <thomas@tourlourat.com> + */ +class MongoDBHandler extends AbstractProcessingHandler +{ + protected $mongoCollection; + + public function __construct($mongo, $database, $collection, $level = Logger::DEBUG, $bubble = true) + { + if (!($mongo instanceof \MongoClient || $mongo instanceof \Mongo)) { + throw new \InvalidArgumentException('MongoClient or Mongo instance required'); + } + + $this->mongoCollection = $mongo->selectCollection($database, $collection); + + parent::__construct($level, $bubble); + } + + protected function write(array $record) + { + $this->mongoCollection->save($record["formatted"]); + } + + /** + * {@inheritDoc} + */ + protected function getDefaultFormatter() + { + return new NormalizerFormatter(); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php new file mode 100644 index 00000000..5118a0e2 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php @@ -0,0 +1,176 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * NativeMailerHandler uses the mail() function to send the emails + * + * @author Christophe Coevoet <stof@notk.org> + * @author Mark Garrett <mark@moderndeveloperllc.com> + */ +class NativeMailerHandler extends MailHandler +{ + /** + * The email addresses to which the message will be sent + * @var array + */ + protected $to; + + /** + * The subject of the email + * @var string + */ + protected $subject; + + /** + * Optional headers for the message + * @var array + */ + protected $headers = array(); + + /** + * Optional parameters for the message + * @var array + */ + protected $parameters = array(); + + /** + * The wordwrap length for the message + * @var integer + */ + protected $maxColumnWidth; + + /** + * The Content-type for the message + * @var string + */ + protected $contentType = 'text/plain'; + + /** + * The encoding for the message + * @var string + */ + protected $encoding = 'utf-8'; + + /** + * @param string|array $to The receiver of the mail + * @param string $subject The subject of the mail + * @param string $from The sender of the mail + * @param integer $level The minimum logging level at which this handler will be triggered + * @param boolean $bubble Whether the messages that are handled can bubble up the stack or not + * @param int $maxColumnWidth The maximum column width that the message lines will have + */ + public function __construct($to, $subject, $from, $level = Logger::ERROR, $bubble = true, $maxColumnWidth = 70) + { + parent::__construct($level, $bubble); + $this->to = is_array($to) ? $to : array($to); + $this->subject = $subject; + $this->addHeader(sprintf('From: %s', $from)); + $this->maxColumnWidth = $maxColumnWidth; + } + + /** + * Add headers to the message + * + * @param string|array $headers Custom added headers + * @return self + */ + public function addHeader($headers) + { + foreach ((array) $headers as $header) { + if (strpos($header, "\n") !== false || strpos($header, "\r") !== false) { + throw new \InvalidArgumentException('Headers can not contain newline characters for security reasons'); + } + $this->headers[] = $header; + } + + return $this; + } + + /** + * Add parameters to the message + * + * @param string|array $parameters Custom added parameters + * @return self + */ + public function addParameter($parameters) + { + $this->parameters = array_merge($this->parameters, (array) $parameters); + + return $this; + } + + /** + * {@inheritdoc} + */ + protected function send($content, array $records) + { + $content = wordwrap($content, $this->maxColumnWidth); + $headers = ltrim(implode("\r\n", $this->headers) . "\r\n", "\r\n"); + $headers .= 'Content-type: ' . $this->getContentType() . '; charset=' . $this->getEncoding() . "\r\n"; + if ($this->getContentType() == 'text/html' && false === strpos($headers, 'MIME-Version:')) { + $headers .= 'MIME-Version: 1.0' . "\r\n"; + } + foreach ($this->to as $to) { + mail($to, $this->subject, $content, $headers, implode(' ', $this->parameters)); + } + } + + /** + * @return string $contentType + */ + public function getContentType() + { + return $this->contentType; + } + + /** + * @return string $encoding + */ + public function getEncoding() + { + return $this->encoding; + } + + /** + * @param string $contentType The content type of the email - Defaults to text/plain. Use text/html for HTML + * messages. + * @return self + */ + public function setContentType($contentType) + { + if (strpos($contentType, "\n") !== false || strpos($contentType, "\r") !== false) { + throw new \InvalidArgumentException('The content type can not contain newline characters to prevent email header injection'); + } + + $this->contentType = $contentType; + + return $this; + } + + /** + * @param string $encoding + * @return self + */ + public function setEncoding($encoding) + { + if (strpos($encoding, "\n") !== false || strpos($encoding, "\r") !== false) { + throw new \InvalidArgumentException('The encoding can not contain newline characters to prevent email header injection'); + } + + $this->encoding = $encoding; + + return $this; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php new file mode 100644 index 00000000..8cb4ab38 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php @@ -0,0 +1,198 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\Formatter\NormalizerFormatter; + +/** + * Class to record a log on a NewRelic application. + * Enabling New Relic High Security mode may prevent capture of useful information. + * + * @see https://docs.newrelic.com/docs/agents/php-agent + * @see https://docs.newrelic.com/docs/accounts-partnerships/accounts/security/high-security + */ +class NewRelicHandler extends AbstractProcessingHandler +{ + /** + * Name of the New Relic application that will receive logs from this handler. + * + * @var string + */ + protected $appName; + + /** + * Name of the current transaction + * + * @var string + */ + protected $transactionName; + + /** + * Some context and extra data is passed into the handler as arrays of values. Do we send them as is + * (useful if we are using the API), or explode them for display on the NewRelic RPM website? + * + * @var boolean + */ + protected $explodeArrays; + + /** + * {@inheritDoc} + * + * @param string $appName + * @param boolean $explodeArrays + * @param string $transactionName + */ + public function __construct( + $level = Logger::ERROR, + $bubble = true, + $appName = null, + $explodeArrays = false, + $transactionName = null + ) { + parent::__construct($level, $bubble); + + $this->appName = $appName; + $this->explodeArrays = $explodeArrays; + $this->transactionName = $transactionName; + } + + /** + * {@inheritDoc} + */ + protected function write(array $record) + { + if (!$this->isNewRelicEnabled()) { + throw new MissingExtensionException('The newrelic PHP extension is required to use the NewRelicHandler'); + } + + if ($appName = $this->getAppName($record['context'])) { + $this->setNewRelicAppName($appName); + } + + if ($transactionName = $this->getTransactionName($record['context'])) { + $this->setNewRelicTransactionName($transactionName); + unset($record['formatted']['context']['transaction_name']); + } + + if (isset($record['context']['exception']) && $record['context']['exception'] instanceof \Exception) { + newrelic_notice_error($record['message'], $record['context']['exception']); + unset($record['formatted']['context']['exception']); + } else { + newrelic_notice_error($record['message']); + } + + foreach ($record['formatted']['context'] as $key => $parameter) { + if (is_array($parameter) && $this->explodeArrays) { + foreach ($parameter as $paramKey => $paramValue) { + $this->setNewRelicParameter('context_' . $key . '_' . $paramKey, $paramValue); + } + } else { + $this->setNewRelicParameter('context_' . $key, $parameter); + } + } + + foreach ($record['formatted']['extra'] as $key => $parameter) { + if (is_array($parameter) && $this->explodeArrays) { + foreach ($parameter as $paramKey => $paramValue) { + $this->setNewRelicParameter('extra_' . $key . '_' . $paramKey, $paramValue); + } + } else { + $this->setNewRelicParameter('extra_' . $key, $parameter); + } + } + } + + /** + * Checks whether the NewRelic extension is enabled in the system. + * + * @return bool + */ + protected function isNewRelicEnabled() + { + return extension_loaded('newrelic'); + } + + /** + * Returns the appname where this log should be sent. Each log can override the default appname, set in this + * handler's constructor, by providing the appname in it's context. + * + * @param array $context + * @return null|string + */ + protected function getAppName(array $context) + { + if (isset($context['appname'])) { + return $context['appname']; + } + + return $this->appName; + } + + /** + * Returns the name of the current transaction. Each log can override the default transaction name, set in this + * handler's constructor, by providing the transaction_name in it's context + * + * @param array $context + * + * @return null|string + */ + protected function getTransactionName(array $context) + { + if (isset($context['transaction_name'])) { + return $context['transaction_name']; + } + + return $this->transactionName; + } + + /** + * Sets the NewRelic application that should receive this log. + * + * @param string $appName + */ + protected function setNewRelicAppName($appName) + { + newrelic_set_appname($appName); + } + + /** + * Overwrites the name of the current transaction + * + * @param string $transactionName + */ + protected function setNewRelicTransactionName($transactionName) + { + newrelic_name_transaction($transactionName); + } + + /** + * @param string $key + * @param mixed $value + */ + protected function setNewRelicParameter($key, $value) + { + if (null === $value || is_scalar($value)) { + newrelic_add_custom_parameter($key, $value); + } else { + newrelic_add_custom_parameter($key, @json_encode($value)); + } + } + + /** + * {@inheritDoc} + */ + protected function getDefaultFormatter() + { + return new NormalizerFormatter(); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php new file mode 100644 index 00000000..3754e45d --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php @@ -0,0 +1,45 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * Blackhole + * + * Any record it can handle will be thrown away. This can be used + * to put on top of an existing stack to override it temporarily. + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class NullHandler extends AbstractHandler +{ + /** + * @param integer $level The minimum logging level at which this handler will be triggered + */ + public function __construct($level = Logger::DEBUG) + { + parent::__construct($level, false); + } + + /** + * {@inheritdoc} + */ + public function handle(array $record) + { + if ($record['level'] < $this->level) { + return false; + } + + return true; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/PHPConsoleHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/PHPConsoleHandler.php new file mode 100644 index 00000000..169bea0e --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/PHPConsoleHandler.php @@ -0,0 +1,243 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Exception; +use Monolog\Formatter\LineFormatter; +use Monolog\Logger; +use PhpConsole\Connector; +use PhpConsole\Handler; +use PhpConsole\Helper; + +/** + * Monolog handler for Google Chrome extension "PHP Console" + * + * Display PHP error/debug log messages in Google Chrome console and notification popups, executes PHP code remotely + * + * Usage: + * 1. Install Google Chrome extension https://chrome.google.com/webstore/detail/php-console/nfhmhhlpfleoednkpnnnkolmclajemef + * 2. See overview https://github.com/barbushin/php-console#overview + * 3. Install PHP Console library https://github.com/barbushin/php-console#installation + * 4. Example (result will looks like http://i.hizliresim.com/vg3Pz4.png) + * + * $logger = new \Monolog\Logger('all', array(new \Monolog\Handler\PHPConsoleHandler())); + * \Monolog\ErrorHandler::register($logger); + * echo $undefinedVar; + * $logger->addDebug('SELECT * FROM users', array('db', 'time' => 0.012)); + * PC::debug($_SERVER); // PHP Console debugger for any type of vars + * + * @author Sergey Barbushin https://www.linkedin.com/in/barbushin + */ +class PHPConsoleHandler extends AbstractProcessingHandler +{ + private $options = array( + 'enabled' => true, // bool Is PHP Console server enabled + 'classesPartialsTraceIgnore' => array('Monolog\\'), // array Hide calls of classes started with... + 'debugTagsKeysInContext' => array(0, 'tag'), // bool Is PHP Console server enabled + 'useOwnErrorsHandler' => false, // bool Enable errors handling + 'useOwnExceptionsHandler' => false, // bool Enable exceptions handling + 'sourcesBasePath' => null, // string Base path of all project sources to strip in errors source paths + 'registerHelper' => true, // bool Register PhpConsole\Helper that allows short debug calls like PC::debug($var, 'ta.g.s') + 'serverEncoding' => null, // string|null Server internal encoding + 'headersLimit' => null, // int|null Set headers size limit for your web-server + 'password' => null, // string|null Protect PHP Console connection by password + 'enableSslOnlyMode' => false, // bool Force connection by SSL for clients with PHP Console installed + 'ipMasks' => array(), // array Set IP masks of clients that will be allowed to connect to PHP Console: array('192.168.*.*', '127.0.0.1') + 'enableEvalListener' => false, // bool Enable eval request to be handled by eval dispatcher(if enabled, 'password' option is also required) + 'dumperDetectCallbacks' => false, // bool Convert callback items in dumper vars to (callback SomeClass::someMethod) strings + 'dumperLevelLimit' => 5, // int Maximum dumped vars array or object nested dump level + 'dumperItemsCountLimit' => 100, // int Maximum dumped var same level array items or object properties number + 'dumperItemSizeLimit' => 5000, // int Maximum length of any string or dumped array item + 'dumperDumpSizeLimit' => 500000, // int Maximum approximate size of dumped vars result formatted in JSON + 'detectDumpTraceAndSource' => false, // bool Autodetect and append trace data to debug + 'dataStorage' => null, // PhpConsole\Storage|null Fixes problem with custom $_SESSION handler(see http://goo.gl/Ne8juJ) + ); + + /** @var Connector */ + private $connector; + + /** + * @param array $options See \Monolog\Handler\PHPConsoleHandler::$options for more details + * @param Connector|null $connector Instance of \PhpConsole\Connector class (optional) + * @param int $level + * @param bool $bubble + * @throws Exception + */ + public function __construct(array $options = array(), Connector $connector = null, $level = Logger::DEBUG, $bubble = true) + { + if (!class_exists('PhpConsole\Connector')) { + throw new Exception('PHP Console library not found. See https://github.com/barbushin/php-console#installation'); + } + parent::__construct($level, $bubble); + $this->options = $this->initOptions($options); + $this->connector = $this->initConnector($connector); + } + + private function initOptions(array $options) + { + $wrongOptions = array_diff(array_keys($options), array_keys($this->options)); + if ($wrongOptions) { + throw new Exception('Unknown options: ' . implode(', ', $wrongOptions)); + } + + return array_replace($this->options, $options); + } + + private function initConnector(Connector $connector = null) + { + if (!$connector) { + if ($this->options['dataStorage']) { + Connector::setPostponeStorage($this->options['dataStorage']); + } + $connector = Connector::getInstance(); + } + + if ($this->options['registerHelper'] && !Helper::isRegistered()) { + Helper::register(); + } + + if ($this->options['enabled'] && $connector->isActiveClient()) { + if ($this->options['useOwnErrorsHandler'] || $this->options['useOwnExceptionsHandler']) { + $handler = Handler::getInstance(); + $handler->setHandleErrors($this->options['useOwnErrorsHandler']); + $handler->setHandleExceptions($this->options['useOwnExceptionsHandler']); + $handler->start(); + } + if ($this->options['sourcesBasePath']) { + $connector->setSourcesBasePath($this->options['sourcesBasePath']); + } + if ($this->options['serverEncoding']) { + $connector->setServerEncoding($this->options['serverEncoding']); + } + if ($this->options['password']) { + $connector->setPassword($this->options['password']); + } + if ($this->options['enableSslOnlyMode']) { + $connector->enableSslOnlyMode(); + } + if ($this->options['ipMasks']) { + $connector->setAllowedIpMasks($this->options['ipMasks']); + } + if ($this->options['headersLimit']) { + $connector->setHeadersLimit($this->options['headersLimit']); + } + if ($this->options['detectDumpTraceAndSource']) { + $connector->getDebugDispatcher()->detectTraceAndSource = true; + } + $dumper = $connector->getDumper(); + $dumper->levelLimit = $this->options['dumperLevelLimit']; + $dumper->itemsCountLimit = $this->options['dumperItemsCountLimit']; + $dumper->itemSizeLimit = $this->options['dumperItemSizeLimit']; + $dumper->dumpSizeLimit = $this->options['dumperDumpSizeLimit']; + $dumper->detectCallbacks = $this->options['dumperDetectCallbacks']; + if ($this->options['enableEvalListener']) { + $connector->startEvalRequestsListener(); + } + } + + return $connector; + } + + public function getConnector() + { + return $this->connector; + } + + public function getOptions() + { + return $this->options; + } + + public function handle(array $record) + { + if ($this->options['enabled'] && $this->connector->isActiveClient()) { + return parent::handle($record); + } + + return !$this->bubble; + } + + /** + * Writes the record down to the log of the implementing handler + * + * @param array $record + * @return void + */ + protected function write(array $record) + { + if ($record['level'] < Logger::NOTICE) { + $this->handleDebugRecord($record); + } elseif (isset($record['context']['exception']) && $record['context']['exception'] instanceof Exception) { + $this->handleExceptionRecord($record); + } else { + $this->handleErrorRecord($record); + } + } + + private function handleDebugRecord(array $record) + { + $tags = $this->getRecordTags($record); + $message = $record['message']; + if ($record['context']) { + $message .= ' ' . json_encode($this->connector->getDumper()->dump(array_filter($record['context']))); + } + $this->connector->getDebugDispatcher()->dispatchDebug($message, $tags, $this->options['classesPartialsTraceIgnore']); + } + + private function handleExceptionRecord(array $record) + { + $this->connector->getErrorsDispatcher()->dispatchException($record['context']['exception']); + } + + private function handleErrorRecord(array $record) + { + $context = $record['context']; + + $this->connector->getErrorsDispatcher()->dispatchError( + isset($context['code']) ? $context['code'] : null, + isset($context['message']) ? $context['message'] : $record['message'], + isset($context['file']) ? $context['file'] : null, + isset($context['line']) ? $context['line'] : null, + $this->options['classesPartialsTraceIgnore'] + ); + } + + private function getRecordTags(array &$record) + { + $tags = null; + if (!empty($record['context'])) { + $context =& $record['context']; + foreach ($this->options['debugTagsKeysInContext'] as $key) { + if (!empty($context[$key])) { + $tags = $context[$key]; + if ($key === 0) { + array_shift($context); + } else { + unset($context[$key]); + } + break; + } + } + } + + return $tags ?: strtolower($record['level_name']); + } + + /** + * {@inheritDoc} + */ + protected function getDefaultFormatter() + { + return new LineFormatter('%message%'); + } +} + diff --git a/vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php new file mode 100644 index 00000000..1ae85845 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/PsrHandler.php @@ -0,0 +1,56 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Psr\Log\LoggerInterface; + +/** + * Proxies log messages to an existing PSR-3 compliant logger. + * + * @author Michael Moussa <michael.moussa@gmail.com> + */ +class PsrHandler extends AbstractHandler +{ + /** + * PSR-3 compliant logger + * + * @var LoggerInterface + */ + protected $logger; + + /** + * @param LoggerInterface $logger The underlying PSR-3 compliant logger to which messages will be proxied + * @param int $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct(LoggerInterface $logger, $level = Logger::DEBUG, $bubble = true) + { + parent::__construct($level, $bubble); + + $this->logger = $logger; + } + + /** + * {@inheritDoc} + */ + public function handle(array $record) + { + if (!$this->isHandling($record)) { + return false; + } + + $this->logger->log(strtolower($record['level_name']), $record['message'], $record['context']); + + return false === $this->bubble; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php new file mode 100644 index 00000000..9917b649 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php @@ -0,0 +1,185 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * Sends notifications through the pushover api to mobile phones + * + * @author Sebastian Göttschkes <sebastian.goettschkes@googlemail.com> + * @see https://www.pushover.net/api + */ +class PushoverHandler extends SocketHandler +{ + private $token; + private $users; + private $title; + private $user; + private $retry; + private $expire; + + private $highPriorityLevel; + private $emergencyLevel; + private $useFormattedMessage = false; + + /** + * All parameters that can be sent to Pushover + * @see https://pushover.net/api + * @var array + */ + private $parameterNames = array( + 'token' => true, + 'user' => true, + 'message' => true, + 'device' => true, + 'title' => true, + 'url' => true, + 'url_title' => true, + 'priority' => true, + 'timestamp' => true, + 'sound' => true, + 'retry' => true, + 'expire' => true, + 'callback' => true, + ); + + /** + * Sounds the api supports by default + * @see https://pushover.net/api#sounds + * @var array + */ + private $sounds = array( + 'pushover', 'bike', 'bugle', 'cashregister', 'classical', 'cosmic', 'falling', 'gamelan', 'incoming', + 'intermission', 'magic', 'mechanical', 'pianobar', 'siren', 'spacealarm', 'tugboat', 'alien', 'climb', + 'persistent', 'echo', 'updown', 'none', + ); + + /** + * @param string $token Pushover api token + * @param string|array $users Pushover user id or array of ids the message will be sent to + * @param string $title Title sent to the Pushover API + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + * @param Boolean $useSSL Whether to connect via SSL. Required when pushing messages to users that are not + * the pushover.net app owner. OpenSSL is required for this option. + * @param integer $highPriorityLevel The minimum logging level at which this handler will start + * sending "high priority" requests to the Pushover API + * @param integer $emergencyLevel The minimum logging level at which this handler will start + * sending "emergency" requests to the Pushover API + * @param integer $retry The retry parameter specifies how often (in seconds) the Pushover servers will send the same notification to the user. + * @param integer $expire The expire parameter specifies how many seconds your notification will continue to be retried for (every retry seconds). + */ + public function __construct($token, $users, $title = null, $level = Logger::CRITICAL, $bubble = true, $useSSL = true, $highPriorityLevel = Logger::CRITICAL, $emergencyLevel = Logger::EMERGENCY, $retry = 30, $expire = 25200) + { + $connectionString = $useSSL ? 'ssl://api.pushover.net:443' : 'api.pushover.net:80'; + parent::__construct($connectionString, $level, $bubble); + + $this->token = $token; + $this->users = (array) $users; + $this->title = $title ?: gethostname(); + $this->highPriorityLevel = Logger::toMonologLevel($highPriorityLevel); + $this->emergencyLevel = Logger::toMonologLevel($emergencyLevel); + $this->retry = $retry; + $this->expire = $expire; + } + + protected function generateDataStream($record) + { + $content = $this->buildContent($record); + + return $this->buildHeader($content) . $content; + } + + private function buildContent($record) + { + // Pushover has a limit of 512 characters on title and message combined. + $maxMessageLength = 512 - strlen($this->title); + + $message = ($this->useFormattedMessage) ? $record['formatted'] : $record['message']; + $message = substr($message, 0, $maxMessageLength); + + $timestamp = $record['datetime']->getTimestamp(); + + $dataArray = array( + 'token' => $this->token, + 'user' => $this->user, + 'message' => $message, + 'title' => $this->title, + 'timestamp' => $timestamp + ); + + if (isset($record['level']) && $record['level'] >= $this->emergencyLevel) { + $dataArray['priority'] = 2; + $dataArray['retry'] = $this->retry; + $dataArray['expire'] = $this->expire; + } elseif (isset($record['level']) && $record['level'] >= $this->highPriorityLevel) { + $dataArray['priority'] = 1; + } + + // First determine the available parameters + $context = array_intersect_key($record['context'], $this->parameterNames); + $extra = array_intersect_key($record['extra'], $this->parameterNames); + + // Least important info should be merged with subsequent info + $dataArray = array_merge($extra, $context, $dataArray); + + // Only pass sounds that are supported by the API + if (isset($dataArray['sound']) && !in_array($dataArray['sound'], $this->sounds)) { + unset($dataArray['sound']); + } + + return http_build_query($dataArray); + } + + private function buildHeader($content) + { + $header = "POST /1/messages.json HTTP/1.1\r\n"; + $header .= "Host: api.pushover.net\r\n"; + $header .= "Content-Type: application/x-www-form-urlencoded\r\n"; + $header .= "Content-Length: " . strlen($content) . "\r\n"; + $header .= "\r\n"; + + return $header; + } + + protected function write(array $record) + { + foreach ($this->users as $user) { + $this->user = $user; + + parent::write($record); + $this->closeSocket(); + } + + $this->user = null; + } + + public function setHighPriorityLevel($value) + { + $this->highPriorityLevel = $value; + } + + public function setEmergencyLevel($value) + { + $this->emergencyLevel = $value; + } + + /** + * Use the formatted message? + * @param boolean $value + */ + public function useFormattedMessage($value) + { + $this->useFormattedMessage = (boolean) $value; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php new file mode 100644 index 00000000..7fedc16f --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php @@ -0,0 +1,190 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\LineFormatter; +use Monolog\Formatter\FormatterInterface; +use Monolog\Logger; +use Raven_Client; + +/** + * Handler to send messages to a Sentry (https://github.com/getsentry/sentry) server + * using raven-php (https://github.com/getsentry/raven-php) + * + * @author Marc Abramowitz <marc@marc-abramowitz.com> + */ +class RavenHandler extends AbstractProcessingHandler +{ + /** + * Translates Monolog log levels to Raven log levels. + */ + private $logLevels = array( + Logger::DEBUG => Raven_Client::DEBUG, + Logger::INFO => Raven_Client::INFO, + Logger::NOTICE => Raven_Client::INFO, + Logger::WARNING => Raven_Client::WARNING, + Logger::ERROR => Raven_Client::ERROR, + Logger::CRITICAL => Raven_Client::FATAL, + Logger::ALERT => Raven_Client::FATAL, + Logger::EMERGENCY => Raven_Client::FATAL, + ); + + /** + * @var Raven_Client the client object that sends the message to the server + */ + protected $ravenClient; + + /** + * @var LineFormatter The formatter to use for the logs generated via handleBatch() + */ + protected $batchFormatter; + + /** + * @param Raven_Client $ravenClient + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct(Raven_Client $ravenClient, $level = Logger::DEBUG, $bubble = true) + { + parent::__construct($level, $bubble); + + $this->ravenClient = $ravenClient; + } + + /** + * {@inheritdoc} + */ + public function handleBatch(array $records) + { + $level = $this->level; + + // filter records based on their level + $records = array_filter($records, function ($record) use ($level) { + return $record['level'] >= $level; + }); + + if (!$records) { + return; + } + + // the record with the highest severity is the "main" one + $record = array_reduce($records, function ($highest, $record) { + if ($record['level'] >= $highest['level']) { + return $record; + } + + return $highest; + }); + + // the other ones are added as a context item + $logs = array(); + foreach ($records as $r) { + $logs[] = $this->processRecord($r); + } + + if ($logs) { + $record['context']['logs'] = (string) $this->getBatchFormatter()->formatBatch($logs); + } + + $this->handle($record); + } + + /** + * Sets the formatter for the logs generated by handleBatch(). + * + * @param FormatterInterface $formatter + */ + public function setBatchFormatter(FormatterInterface $formatter) + { + $this->batchFormatter = $formatter; + } + + /** + * Gets the formatter for the logs generated by handleBatch(). + * + * @return FormatterInterface + */ + public function getBatchFormatter() + { + if (!$this->batchFormatter) { + $this->batchFormatter = $this->getDefaultBatchFormatter(); + } + + return $this->batchFormatter; + } + + /** + * {@inheritdoc} + */ + protected function write(array $record) + { + $previousUserContext = false; + $options = array(); + $options['level'] = $this->logLevels[$record['level']]; + $options['tags'] = array(); + if (!empty($record['extra']['tags'])) { + $options['tags'] = array_merge($options['tags'], $record['extra']['tags']); + unset($record['extra']['tags']); + } + if (!empty($record['context']['tags'])) { + $options['tags'] = array_merge($options['tags'], $record['context']['tags']); + unset($record['context']['tags']); + } + if (!empty($record['context']['logger'])) { + $options['logger'] = $record['context']['logger']; + unset($record['context']['logger']); + } else { + $options['logger'] = $record['channel']; + } + if (!empty($record['context'])) { + $options['extra']['context'] = $record['context']; + if (!empty($record['context']['user'])) { + $previousUserContext = $this->ravenClient->context->user; + $this->ravenClient->user_context($record['context']['user']); + unset($options['extra']['context']['user']); + } + } + if (!empty($record['extra'])) { + $options['extra']['extra'] = $record['extra']; + } + + if (isset($record['context']['exception']) && $record['context']['exception'] instanceof \Exception) { + $options['extra']['message'] = $record['formatted']; + $this->ravenClient->captureException($record['context']['exception'], $options); + } else { + $this->ravenClient->captureMessage($record['formatted'], array(), $options); + } + + if ($previousUserContext !== false) { + $this->ravenClient->user_context($previousUserContext); + } + + } + + /** + * {@inheritDoc} + */ + protected function getDefaultFormatter() + { + return new LineFormatter('[%channel%] %message%'); + } + + /** + * Gets the default formatter for the logs generated by handleBatch(). + * + * @return FormatterInterface + */ + protected function getDefaultBatchFormatter() + { + return new LineFormatter(); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php new file mode 100644 index 00000000..ee8c2363 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php @@ -0,0 +1,63 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\LineFormatter; +use Monolog\Logger; + +/** + * Logs to a Redis key using rpush + * + * usage example: + * + * $log = new Logger('application'); + * $redis = new RedisHandler(new Predis\Client("tcp://localhost:6379"), "logs", "prod"); + * $log->pushHandler($redis); + * + * @author Thomas Tourlourat <thomas@tourlourat.com> + */ +class RedisHandler extends AbstractProcessingHandler +{ + private $redisClient; + private $redisKey; + + /** + * @param \Predis\Client|\Redis $redis The redis instance + * @param string $key The key name to push records to + * @param integer $level The minimum logging level at which this handler will be triggered + * @param boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct($redis, $key, $level = Logger::DEBUG, $bubble = true) + { + if (!(($redis instanceof \Predis\Client) || ($redis instanceof \Redis))) { + throw new \InvalidArgumentException('Predis\Client or Redis instance required'); + } + + $this->redisClient = $redis; + $this->redisKey = $key; + + parent::__construct($level, $bubble); + } + + protected function write(array $record) + { + $this->redisClient->rpush($this->redisKey, $record["formatted"]); + } + + /** + * {@inheritDoc} + */ + protected function getDefaultFormatter() + { + return new LineFormatter(); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php new file mode 100644 index 00000000..81abf086 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/RollbarHandler.php @@ -0,0 +1,73 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use RollbarNotifier; +use Exception; +use Monolog\Logger; + +/** + * Sends errors to Rollbar + * + * @author Paul Statezny <paulstatezny@gmail.com> + */ +class RollbarHandler extends AbstractProcessingHandler +{ + /** + * Rollbar notifier + * + * @var RollbarNotifier + */ + protected $rollbarNotifier; + + /** + * @param RollbarNotifier $rollbarNotifier RollbarNotifier object constructed with valid token + * @param integer $level The minimum logging level at which this handler will be triggered + * @param boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct(RollbarNotifier $rollbarNotifier, $level = Logger::ERROR, $bubble = true) + { + $this->rollbarNotifier = $rollbarNotifier; + + parent::__construct($level, $bubble); + } + + /** + * {@inheritdoc} + */ + protected function write(array $record) + { + if (isset($record['context']['exception']) && $record['context']['exception'] instanceof Exception) { + $this->rollbarNotifier->report_exception($record['context']['exception']); + } else { + $extraData = array( + 'level' => $record['level'], + 'channel' => $record['channel'], + 'datetime' => $record['datetime']->format('U'), + ); + + $this->rollbarNotifier->report_message( + $record['message'], + $record['level_name'], + array_merge($record['context'], $record['extra'], $extraData) + ); + } + } + + /** + * {@inheritdoc} + */ + public function close() + { + $this->rollbarNotifier->flush(); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php new file mode 100644 index 00000000..4168c32f --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php @@ -0,0 +1,153 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * Stores logs to files that are rotated every day and a limited number of files are kept. + * + * This rotation is only intended to be used as a workaround. Using logrotate to + * handle the rotation is strongly encouraged when you can use it. + * + * @author Christophe Coevoet <stof@notk.org> + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class RotatingFileHandler extends StreamHandler +{ + protected $filename; + protected $maxFiles; + protected $mustRotate; + protected $nextRotation; + protected $filenameFormat; + protected $dateFormat; + + /** + * @param string $filename + * @param integer $maxFiles The maximal amount of files to keep (0 means unlimited) + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + * @param int|null $filePermission Optional file permissions (default (0644) are only for owner read/write) + * @param Boolean $useLocking Try to lock log file before doing any writes + */ + public function __construct($filename, $maxFiles = 0, $level = Logger::DEBUG, $bubble = true, $filePermission = null, $useLocking = false) + { + $this->filename = $filename; + $this->maxFiles = (int) $maxFiles; + $this->nextRotation = new \DateTime('tomorrow'); + $this->filenameFormat = '{filename}-{date}'; + $this->dateFormat = 'Y-m-d'; + + parent::__construct($this->getTimedFilename(), $level, $bubble, $filePermission, $useLocking); + } + + /** + * {@inheritdoc} + */ + public function close() + { + parent::close(); + + if (true === $this->mustRotate) { + $this->rotate(); + } + } + + public function setFilenameFormat($filenameFormat, $dateFormat) + { + $this->filenameFormat = $filenameFormat; + $this->dateFormat = $dateFormat; + $this->url = $this->getTimedFilename(); + $this->close(); + } + + /** + * {@inheritdoc} + */ + protected function write(array $record) + { + // on the first record written, if the log is new, we should rotate (once per day) + if (null === $this->mustRotate) { + $this->mustRotate = !file_exists($this->url); + } + + if ($this->nextRotation < $record['datetime']) { + $this->mustRotate = true; + $this->close(); + } + + parent::write($record); + } + + /** + * Rotates the files. + */ + protected function rotate() + { + // update filename + $this->url = $this->getTimedFilename(); + $this->nextRotation = new \DateTime('tomorrow'); + + // skip GC of old logs if files are unlimited + if (0 === $this->maxFiles) { + return; + } + + $logFiles = glob($this->getGlobPattern()); + if ($this->maxFiles >= count($logFiles)) { + // no files to remove + return; + } + + // Sorting the files by name to remove the older ones + usort($logFiles, function ($a, $b) { + return strcmp($b, $a); + }); + + foreach (array_slice($logFiles, $this->maxFiles) as $file) { + if (is_writable($file)) { + unlink($file); + } + } + } + + protected function getTimedFilename() + { + $fileInfo = pathinfo($this->filename); + $timedFilename = str_replace( + array('{filename}', '{date}'), + array($fileInfo['filename'], date($this->dateFormat)), + $fileInfo['dirname'] . '/' . $this->filenameFormat + ); + + if (!empty($fileInfo['extension'])) { + $timedFilename .= '.'.$fileInfo['extension']; + } + + return $timedFilename; + } + + protected function getGlobPattern() + { + $fileInfo = pathinfo($this->filename); + $glob = str_replace( + array('{filename}', '{date}'), + array($fileInfo['filename'], '*'), + $fileInfo['dirname'] . '/' . $this->filenameFormat + ); + if (!empty($fileInfo['extension'])) { + $glob .= '.'.$fileInfo['extension']; + } + + return $glob; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php new file mode 100644 index 00000000..9509ae37 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/SamplingHandler.php @@ -0,0 +1,82 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +/** + * Sampling handler + * + * A sampled event stream can be useful for logging high frequency events in + * a production environment where you only need an idea of what is happening + * and are not concerned with capturing every occurrence. Since the decision to + * handle or not handle a particular event is determined randomly, the + * resulting sampled log is not guaranteed to contain 1/N of the events that + * occurred in the application, but based on the Law of large numbers, it will + * tend to be close to this ratio with a large number of attempts. + * + * @author Bryan Davis <bd808@wikimedia.org> + * @author Kunal Mehta <legoktm@gmail.com> + */ +class SamplingHandler extends AbstractHandler +{ + /** + * @var callable|HandlerInterface $handler + */ + protected $handler; + + /** + * @var int $factor + */ + protected $factor; + + /** + * @param callable|HandlerInterface $handler Handler or factory callable($record, $fingersCrossedHandler). + * @param int $factor Sample factor + */ + public function __construct($handler, $factor) + { + parent::__construct(); + $this->handler = $handler; + $this->factor = $factor; + + if (!$this->handler instanceof HandlerInterface && !is_callable($this->handler)) { + throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object"); + } + } + + public function isHandling(array $record) + { + return $this->handler->isHandling($record); + } + + public function handle(array $record) + { + if ($this->isHandling($record) && mt_rand(1, $this->factor) === 1) { + // The same logic as in FingersCrossedHandler + if (!$this->handler instanceof HandlerInterface) { + $this->handler = call_user_func($this->handler, $record, $this); + if (!$this->handler instanceof HandlerInterface) { + throw new \RuntimeException("The factory callable should return a HandlerInterface"); + } + } + + if ($this->processors) { + foreach ($this->processors as $processor) { + $record = call_user_func($processor, $record); + } + } + + $this->handler->handle($record); + } + + return false === $this->bubble; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php new file mode 100644 index 00000000..c7a1c7e9 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/SlackHandler.php @@ -0,0 +1,292 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; + +/** + * Sends notifications through Slack API + * + * @author Greg Kedzierski <greg@gregkedzierski.com> + * @see https://api.slack.com/ + */ +class SlackHandler extends SocketHandler +{ + /** + * Slack API token + * @var string + */ + private $token; + + /** + * Slack channel (encoded ID or name) + * @var string + */ + private $channel; + + /** + * Name of a bot + * @var string + */ + private $username; + + /** + * Emoji icon name + * @var string + */ + private $iconEmoji; + + /** + * Whether the message should be added to Slack as attachment (plain text otherwise) + * @var bool + */ + private $useAttachment; + + /** + * Whether the the context/extra messages added to Slack as attachments are in a short style + * @var bool + */ + private $useShortAttachment; + + /** + * Whether the attachment should include context and extra data + * @var bool + */ + private $includeContextAndExtra; + + /** + * @var LineFormatter + */ + private $lineFormatter; + + /** + * @param string $token Slack API token + * @param string $channel Slack channel (encoded ID or name) + * @param string $username Name of a bot + * @param bool $useAttachment Whether the message should be added to Slack as attachment (plain text otherwise) + * @param string|null $iconEmoji The emoji name to use (or null) + * @param int $level The minimum logging level at which this handler will be triggered + * @param bool $bubble Whether the messages that are handled can bubble up the stack or not + * @param bool $useShortAttachment Whether the the context/extra messages added to Slack as attachments are in a short style + * @param bool $includeContextAndExtra Whether the attachment should include context and extra data + */ + public function __construct($token, $channel, $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $level = Logger::CRITICAL, $bubble = true, $useShortAttachment = false, $includeContextAndExtra = false) + { + if (!extension_loaded('openssl')) { + throw new MissingExtensionException('The OpenSSL PHP extension is required to use the SlackHandler'); + } + + parent::__construct('ssl://slack.com:443', $level, $bubble); + + $this->token = $token; + $this->channel = $channel; + $this->username = $username; + $this->iconEmoji = trim($iconEmoji, ':'); + $this->useAttachment = $useAttachment; + $this->useShortAttachment = $useShortAttachment; + $this->includeContextAndExtra = $includeContextAndExtra; + if ($this->includeContextAndExtra) { + $this->lineFormatter = new LineFormatter; + } + } + + /** + * {@inheritdoc} + * + * @param array $record + * @return string + */ + protected function generateDataStream($record) + { + $content = $this->buildContent($record); + + return $this->buildHeader($content) . $content; + } + + /** + * Builds the body of API call + * + * @param array $record + * @return string + */ + private function buildContent($record) + { + $dataArray = $this->prepareContentData($record); + + return http_build_query($dataArray); + } + + /** + * Prepares content data + * + * @param array $record + * @return array + */ + protected function prepareContentData($record) + { + $dataArray = array( + 'token' => $this->token, + 'channel' => $this->channel, + 'username' => $this->username, + 'text' => '', + 'attachments' => array() + ); + + if ($this->useAttachment) { + $attachment = array( + 'fallback' => $record['message'], + 'color' => $this->getAttachmentColor($record['level']) + ); + + if ($this->useShortAttachment) { + $attachment['fields'] = array( + array( + 'title' => $record['level_name'], + 'value' => $record['message'], + 'short' => false + ) + ); + } else { + $attachment['fields'] = array( + array( + 'title' => 'Message', + 'value' => $record['message'], + 'short' => false + ), + array( + 'title' => 'Level', + 'value' => $record['level_name'], + 'short' => true + ) + ); + } + + if ($this->includeContextAndExtra) { + if (!empty($record['extra'])) { + if ($this->useShortAttachment) { + $attachment['fields'][] = array( + 'title' => "Extra", + 'value' => $this->stringify($record['extra']), + 'short' => $this->useShortAttachment + ); + } else { + // Add all extra fields as individual fields in attachment + foreach ($record['extra'] as $var => $val) { + $attachment['fields'][] = array( + 'title' => $var, + 'value' => $val, + 'short' => $this->useShortAttachment + ); + } + } + } + + if (!empty($record['context'])) { + if ($this->useShortAttachment) { + $attachment['fields'][] = array( + 'title' => "Context", + 'value' => $this->stringify($record['context']), + 'short' => $this->useShortAttachment + ); + } else { + // Add all context fields as individual fields in attachment + foreach ($record['context'] as $var => $val) { + $attachment['fields'][] = array( + 'title' => $var, + 'value' => $val, + 'short' => $this->useShortAttachment + ); + } + } + } + } + + $dataArray['attachments'] = json_encode(array($attachment)); + } else { + $dataArray['text'] = $record['message']; + } + + if ($this->iconEmoji) { + $dataArray['icon_emoji'] = ":{$this->iconEmoji}:"; + } + return $dataArray; + } + + /** + * Builds the header of the API Call + * + * @param string $content + * @return string + */ + private function buildHeader($content) + { + $header = "POST /api/chat.postMessage HTTP/1.1\r\n"; + $header .= "Host: slack.com\r\n"; + $header .= "Content-Type: application/x-www-form-urlencoded\r\n"; + $header .= "Content-Length: " . strlen($content) . "\r\n"; + $header .= "\r\n"; + + return $header; + } + + /** + * {@inheritdoc} + * + * @param array $record + */ + protected function write(array $record) + { + parent::write($record); + $this->closeSocket(); + } + + /** + * Returned a Slack message attachment color associated with + * provided level. + * + * @param int $level + * @return string + */ + protected function getAttachmentColor($level) + { + switch (true) { + case $level >= Logger::ERROR: + return 'danger'; + case $level >= Logger::WARNING: + return 'warning'; + case $level >= Logger::INFO: + return 'good'; + default: + return '#e3e4e6'; + } + } + + /** + * Stringifies an array of key/value pairs to be used in attachment fields + * + * @param array $fields + * @access protected + * @return string + */ + protected function stringify($fields) + { + $string = ''; + foreach ($fields as $var => $val) { + $string .= $var.': '.$this->lineFormatter->stringify($val)." | "; + } + + $string = rtrim($string, " |"); + + return $string; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php new file mode 100644 index 00000000..ee486f69 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php @@ -0,0 +1,284 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * Stores to any socket - uses fsockopen() or pfsockopen(). + * + * @author Pablo de Leon Belloc <pablolb@gmail.com> + * @see http://php.net/manual/en/function.fsockopen.php + */ +class SocketHandler extends AbstractProcessingHandler +{ + private $connectionString; + private $connectionTimeout; + private $resource; + private $timeout = 0; + private $persistent = false; + private $errno; + private $errstr; + + /** + * @param string $connectionString Socket connection string + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct($connectionString, $level = Logger::DEBUG, $bubble = true) + { + parent::__construct($level, $bubble); + $this->connectionString = $connectionString; + $this->connectionTimeout = (float) ini_get('default_socket_timeout'); + } + + /** + * Connect (if necessary) and write to the socket + * + * @param array $record + * + * @throws \UnexpectedValueException + * @throws \RuntimeException + */ + protected function write(array $record) + { + $this->connectIfNotConnected(); + $data = $this->generateDataStream($record); + $this->writeToSocket($data); + } + + /** + * We will not close a PersistentSocket instance so it can be reused in other requests. + */ + public function close() + { + if (!$this->isPersistent()) { + $this->closeSocket(); + } + } + + /** + * Close socket, if open + */ + public function closeSocket() + { + if (is_resource($this->resource)) { + fclose($this->resource); + $this->resource = null; + } + } + + /** + * Set socket connection to nbe persistent. It only has effect before the connection is initiated. + * + * @param type $boolean + */ + public function setPersistent($boolean) + { + $this->persistent = (boolean) $boolean; + } + + /** + * Set connection timeout. Only has effect before we connect. + * + * @param float $seconds + * + * @see http://php.net/manual/en/function.fsockopen.php + */ + public function setConnectionTimeout($seconds) + { + $this->validateTimeout($seconds); + $this->connectionTimeout = (float) $seconds; + } + + /** + * Set write timeout. Only has effect before we connect. + * + * @param float $seconds + * + * @see http://php.net/manual/en/function.stream-set-timeout.php + */ + public function setTimeout($seconds) + { + $this->validateTimeout($seconds); + $this->timeout = (float) $seconds; + } + + /** + * Get current connection string + * + * @return string + */ + public function getConnectionString() + { + return $this->connectionString; + } + + /** + * Get persistent setting + * + * @return boolean + */ + public function isPersistent() + { + return $this->persistent; + } + + /** + * Get current connection timeout setting + * + * @return float + */ + public function getConnectionTimeout() + { + return $this->connectionTimeout; + } + + /** + * Get current in-transfer timeout + * + * @return float + */ + public function getTimeout() + { + return $this->timeout; + } + + /** + * Check to see if the socket is currently available. + * + * UDP might appear to be connected but might fail when writing. See http://php.net/fsockopen for details. + * + * @return boolean + */ + public function isConnected() + { + return is_resource($this->resource) + && !feof($this->resource); // on TCP - other party can close connection. + } + + /** + * Wrapper to allow mocking + */ + protected function pfsockopen() + { + return @pfsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout); + } + + /** + * Wrapper to allow mocking + */ + protected function fsockopen() + { + return @fsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout); + } + + /** + * Wrapper to allow mocking + * + * @see http://php.net/manual/en/function.stream-set-timeout.php + */ + protected function streamSetTimeout() + { + $seconds = floor($this->timeout); + $microseconds = round(($this->timeout - $seconds)*1e6); + + return stream_set_timeout($this->resource, $seconds, $microseconds); + } + + /** + * Wrapper to allow mocking + */ + protected function fwrite($data) + { + return @fwrite($this->resource, $data); + } + + /** + * Wrapper to allow mocking + */ + protected function streamGetMetadata() + { + return stream_get_meta_data($this->resource); + } + + private function validateTimeout($value) + { + $ok = filter_var($value, FILTER_VALIDATE_FLOAT); + if ($ok === false || $value < 0) { + throw new \InvalidArgumentException("Timeout must be 0 or a positive float (got $value)"); + } + } + + private function connectIfNotConnected() + { + if ($this->isConnected()) { + return; + } + $this->connect(); + } + + protected function generateDataStream($record) + { + return (string) $record['formatted']; + } + + private function connect() + { + $this->createSocketResource(); + $this->setSocketTimeout(); + } + + private function createSocketResource() + { + if ($this->isPersistent()) { + $resource = $this->pfsockopen(); + } else { + $resource = $this->fsockopen(); + } + if (!$resource) { + throw new \UnexpectedValueException("Failed connecting to $this->connectionString ($this->errno: $this->errstr)"); + } + $this->resource = $resource; + } + + private function setSocketTimeout() + { + if (!$this->streamSetTimeout()) { + throw new \UnexpectedValueException("Failed setting timeout with stream_set_timeout()"); + } + } + + private function writeToSocket($data) + { + $length = strlen($data); + $sent = 0; + while ($this->isConnected() && $sent < $length) { + if (0 == $sent) { + $chunk = $this->fwrite($data); + } else { + $chunk = $this->fwrite(substr($data, $sent)); + } + if ($chunk === false) { + throw new \RuntimeException("Could not write to socket"); + } + $sent += $chunk; + $socketInfo = $this->streamGetMetadata(); + if ($socketInfo['timed_out']) { + throw new \RuntimeException("Write timed-out"); + } + } + if (!$this->isConnected() && $sent < $length) { + throw new \RuntimeException("End-of-file reached, probably we got disconnected (sent $sent of $length)"); + } + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php new file mode 100644 index 00000000..7965db74 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php @@ -0,0 +1,104 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * Stores to any stream resource + * + * Can be used to store into php://stderr, remote and local files, etc. + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class StreamHandler extends AbstractProcessingHandler +{ + protected $stream; + protected $url; + private $errorMessage; + protected $filePermission; + protected $useLocking; + + /** + * @param resource|string $stream + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + * @param int|null $filePermission Optional file permissions (default (0644) are only for owner read/write) + * @param Boolean $useLocking Try to lock log file before doing any writes + * + * @throws \InvalidArgumentException If stream is not a resource or string + */ + public function __construct($stream, $level = Logger::DEBUG, $bubble = true, $filePermission = null, $useLocking = false) + { + parent::__construct($level, $bubble); + if (is_resource($stream)) { + $this->stream = $stream; + } elseif (is_string($stream)) { + $this->url = $stream; + } else { + throw new \InvalidArgumentException('A stream must either be a resource or a string.'); + } + + $this->filePermission = $filePermission; + $this->useLocking = $useLocking; + } + + /** + * {@inheritdoc} + */ + public function close() + { + if (is_resource($this->stream)) { + fclose($this->stream); + } + $this->stream = null; + } + + /** + * {@inheritdoc} + */ + protected function write(array $record) + { + if (!is_resource($this->stream)) { + if (!$this->url) { + throw new \LogicException('Missing stream url, the stream can not be opened. This may be caused by a premature call to close().'); + } + $this->errorMessage = null; + set_error_handler(array($this, 'customErrorHandler')); + $this->stream = fopen($this->url, 'a'); + if ($this->filePermission !== null) { + @chmod($this->url, $this->filePermission); + } + restore_error_handler(); + if (!is_resource($this->stream)) { + $this->stream = null; + throw new \UnexpectedValueException(sprintf('The stream or file "%s" could not be opened: '.$this->errorMessage, $this->url)); + } + } + + if ($this->useLocking) { + // ignoring errors here, there's not much we can do about them + flock($this->stream, LOCK_EX); + } + + fwrite($this->stream, (string) $record['formatted']); + + if ($this->useLocking) { + flock($this->stream, LOCK_UN); + } + } + + private function customErrorHandler($code, $msg) + { + $this->errorMessage = preg_replace('{^fopen\(.*?\): }', '', $msg); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php new file mode 100644 index 00000000..003a1a2a --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php @@ -0,0 +1,87 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * SwiftMailerHandler uses Swift_Mailer to send the emails + * + * @author Gyula Sallai + */ +class SwiftMailerHandler extends MailHandler +{ + protected $mailer; + private $messageTemplate; + + /** + * @param \Swift_Mailer $mailer The mailer to use + * @param callable|\Swift_Message $message An example message for real messages, only the body will be replaced + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct(\Swift_Mailer $mailer, $message, $level = Logger::ERROR, $bubble = true) + { + parent::__construct($level, $bubble); + + $this->mailer = $mailer; + $this->messageTemplate = $message; + } + + /** + * {@inheritdoc} + */ + protected function send($content, array $records) + { + $this->mailer->send($this->buildMessage($content, $records)); + } + + /** + * Creates instance of Swift_Message to be sent + * + * @param string $content formatted email body to be sent + * @param array $records Log records that formed the content + * @return \Swift_Message + */ + protected function buildMessage($content, array $records) + { + $message = null; + if ($this->messageTemplate instanceof \Swift_Message) { + $message = clone $this->messageTemplate; + } else if (is_callable($this->messageTemplate)) { + $message = call_user_func($this->messageTemplate, $content, $records); + } + + if (!$message instanceof \Swift_Message) { + throw new \InvalidArgumentException('Could not resolve message as instance of Swift_Message or a callable returning it'); + } + + $message->setBody($content); + $message->setDate(time()); + + return $message; + } + + /** + * BC getter, to be removed in 2.0 + */ + public function __get($name) + { + if ($name === 'message') { + trigger_error('SwiftMailerHandler->message is deprecated, use ->buildMessage() instead to retrieve the message', E_USER_DEPRECATED); + + return $this->buildMessage(null, array()); + } + + throw new \InvalidArgumentException('Invalid property '.$name); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php new file mode 100644 index 00000000..47c73e12 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php @@ -0,0 +1,67 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * Logs to syslog service. + * + * usage example: + * + * $log = new Logger('application'); + * $syslog = new SyslogHandler('myfacility', 'local6'); + * $formatter = new LineFormatter("%channel%.%level_name%: %message% %extra%"); + * $syslog->setFormatter($formatter); + * $log->pushHandler($syslog); + * + * @author Sven Paulus <sven@karlsruhe.org> + */ +class SyslogHandler extends AbstractSyslogHandler +{ + protected $ident; + protected $logopts; + + /** + * @param string $ident + * @param mixed $facility + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + * @param int $logopts Option flags for the openlog() call, defaults to LOG_PID + */ + public function __construct($ident, $facility = LOG_USER, $level = Logger::DEBUG, $bubble = true, $logopts = LOG_PID) + { + parent::__construct($facility, $level, $bubble); + + $this->ident = $ident; + $this->logopts = $logopts; + } + + /** + * {@inheritdoc} + */ + public function close() + { + closelog(); + } + + /** + * {@inheritdoc} + */ + protected function write(array $record) + { + if (!openlog($this->ident, $this->logopts, $this->facility)) { + throw new \LogicException('Can\'t open syslog for ident "'.$this->ident.'" and facility "'.$this->facility.'"'); + } + syslog($this->logLevels[$record['level']], (string) $record['formatted']); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php new file mode 100644 index 00000000..dcf3f1f9 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdp/UdpSocket.php @@ -0,0 +1,46 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler\SyslogUdp; + +class UdpSocket +{ + const DATAGRAM_MAX_LENGTH = 65023; + + public function __construct($ip, $port = 514) + { + $this->ip = $ip; + $this->port = $port; + $this->socket = socket_create(AF_INET, SOCK_DGRAM, SOL_UDP); + } + + public function write($line, $header = "") + { + $this->send($this->assembleMessage($line, $header)); + } + + public function close() + { + socket_close($this->socket); + } + + protected function send($chunk) + { + socket_sendto($this->socket, $chunk, strlen($chunk), $flags = 0, $this->ip, $this->port); + } + + protected function assembleMessage($line, $header) + { + $chunkSize = self::DATAGRAM_MAX_LENGTH - strlen($header); + + return $header . substr($line, 0, $chunkSize); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php new file mode 100644 index 00000000..aa047c07 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/SyslogUdpHandler.php @@ -0,0 +1,80 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\Handler\SyslogUdp\UdpSocket; + +/** + * A Handler for logging to a remote syslogd server. + * + * @author Jesper Skovgaard Nielsen <nulpunkt@gmail.com> + */ +class SyslogUdpHandler extends AbstractSyslogHandler +{ + /** + * @param string $host + * @param int $port + * @param mixed $facility + * @param integer $level The minimum logging level at which this handler will be triggered + * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not + */ + public function __construct($host, $port = 514, $facility = LOG_USER, $level = Logger::DEBUG, $bubble = true) + { + parent::__construct($facility, $level, $bubble); + + $this->socket = new UdpSocket($host, $port ?: 514); + } + + protected function write(array $record) + { + $lines = $this->splitMessageIntoLines($record['formatted']); + + $header = $this->makeCommonSyslogHeader($this->logLevels[$record['level']]); + + foreach ($lines as $line) { + $this->socket->write($line, $header); + } + } + + public function close() + { + $this->socket->close(); + } + + private function splitMessageIntoLines($message) + { + if (is_array($message)) { + $message = implode("\n", $message); + } + + return preg_split('/$\R?^/m', $message); + } + + /** + * Make common syslog header (see rfc5424) + */ + protected function makeCommonSyslogHeader($severity) + { + $priority = $severity + $this->facility; + + return "<$priority>1 "; + } + + /** + * Inject your own socket, mainly used for testing + */ + public function setSocket($socket) + { + $this->socket = $socket; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php new file mode 100644 index 00000000..80b7f283 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php @@ -0,0 +1,195 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +/** + * Used for testing purposes. + * + * It records all records and gives you access to them for verification. + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class TestHandler extends AbstractProcessingHandler +{ + protected $records = array(); + protected $recordsByLevel = array(); + + public function getRecords() + { + return $this->records; + } + + public function hasEmergency($record) + { + return $this->hasRecord($record, Logger::EMERGENCY); + } + + public function hasAlert($record) + { + return $this->hasRecord($record, Logger::ALERT); + } + + public function hasCritical($record) + { + return $this->hasRecord($record, Logger::CRITICAL); + } + + public function hasError($record) + { + return $this->hasRecord($record, Logger::ERROR); + } + + public function hasWarning($record) + { + return $this->hasRecord($record, Logger::WARNING); + } + + public function hasNotice($record) + { + return $this->hasRecord($record, Logger::NOTICE); + } + + public function hasInfo($record) + { + return $this->hasRecord($record, Logger::INFO); + } + + public function hasDebug($record) + { + return $this->hasRecord($record, Logger::DEBUG); + } + + public function hasEmergencyRecords() + { + return isset($this->recordsByLevel[Logger::EMERGENCY]); + } + + public function hasAlertRecords() + { + return isset($this->recordsByLevel[Logger::ALERT]); + } + + public function hasCriticalRecords() + { + return isset($this->recordsByLevel[Logger::CRITICAL]); + } + + public function hasErrorRecords() + { + return isset($this->recordsByLevel[Logger::ERROR]); + } + + public function hasWarningRecords() + { + return isset($this->recordsByLevel[Logger::WARNING]); + } + + public function hasNoticeRecords() + { + return isset($this->recordsByLevel[Logger::NOTICE]); + } + + public function hasInfoRecords() + { + return isset($this->recordsByLevel[Logger::INFO]); + } + + public function hasDebugRecords() + { + return isset($this->recordsByLevel[Logger::DEBUG]); + } + + protected function hasRecord($record, $level) + { + if (!isset($this->recordsByLevel[$level])) { + return false; + } + + if (is_array($record)) { + $record = $record['message']; + } + + foreach ($this->recordsByLevel[$level] as $rec) { + if ($rec['message'] === $record) { + return true; + } + } + + return false; + } + + public function hasEmergencyThatContains($message) + { + return $this->hasRecordThatContains($message, Logger::EMERGENCY); + } + + public function hasAlertThatContains($message) + { + return $this->hasRecordThatContains($message, Logger::ALERT); + } + + public function hasCriticalThatContains($message) + { + return $this->hasRecordThatContains($message, Logger::CRITICAL); + } + + public function hasErrorThatContains($message) + { + return $this->hasRecordThatContains($message, Logger::ERROR); + } + + public function hasWarningThatContains($message) + { + return $this->hasRecordThatContains($message, Logger::WARNING); + } + + public function hasNoticeThatContains($message) + { + return $this->hasRecordThatContains($message, Logger::NOTICE); + } + + public function hasInfoThatContains($message) + { + return $this->hasRecordThatContains($message, Logger::INFO); + } + + public function hasDebugThatContains($message) + { + return $this->hasRecordThatContains($message, Logger::DEBUG); + } + + public function hasRecordThatContains($message, $level) + { + if (!isset($this->recordsByLevel[$level])) { + return false; + } + + foreach ($this->recordsByLevel[$level] as $rec) { + if (strpos($rec['message'], $message) !== false) { + return true; + } + } + + return false; + } + + /** + * {@inheritdoc} + */ + protected function write(array $record) + { + $this->recordsByLevel[$record['level']][] = $record; + $this->records[] = $record; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php new file mode 100644 index 00000000..05a88173 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/WhatFailureGroupHandler.php @@ -0,0 +1,57 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +/** + * Forwards records to multiple handlers suppressing failures of each handler + * and continuing through to give every handler a chance to succeed. + * + * @author Craig D'Amelio <craig@damelio.ca> + */ +class WhatFailureGroupHandler extends GroupHandler +{ + /** + * {@inheritdoc} + */ + public function handle(array $record) + { + if ($this->processors) { + foreach ($this->processors as $processor) { + $record = call_user_func($processor, $record); + } + } + + foreach ($this->handlers as $handler) { + try { + $handler->handle($record); + } catch (\Exception $e) { + // What failure? + } + } + + return false === $this->bubble; + } + + /** + * {@inheritdoc} + */ + public function handleBatch(array $records) + { + foreach ($this->handlers as $handler) { + try { + $handler->handleBatch($records); + } catch (\Exception $e) { + // What failure? + } + } + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php b/vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php new file mode 100644 index 00000000..f22cf218 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php @@ -0,0 +1,95 @@ +<?php +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\NormalizerFormatter; +use Monolog\Logger; + +/** + * Handler sending logs to Zend Monitor + * + * @author Christian Bergau <cbergau86@gmail.com> + */ +class ZendMonitorHandler extends AbstractProcessingHandler +{ + /** + * Monolog level / ZendMonitor Custom Event priority map + * + * @var array + */ + protected $levelMap = array( + Logger::DEBUG => 1, + Logger::INFO => 2, + Logger::NOTICE => 3, + Logger::WARNING => 4, + Logger::ERROR => 5, + Logger::CRITICAL => 6, + Logger::ALERT => 7, + Logger::EMERGENCY => 0, + ); + + /** + * Construct + * + * @param int $level + * @param bool $bubble + * @throws MissingExtensionException + */ + public function __construct($level = Logger::DEBUG, $bubble = true) + { + if (!function_exists('zend_monitor_custom_event')) { + throw new MissingExtensionException('You must have Zend Server installed in order to use this handler'); + } + parent::__construct($level, $bubble); + } + + /** + * {@inheritdoc} + */ + protected function write(array $record) + { + $this->writeZendMonitorCustomEvent( + $this->levelMap[$record['level']], + $record['message'], + $record['formatted'] + ); + } + + /** + * Write a record to Zend Monitor + * + * @param int $level + * @param string $message + * @param array $formatted + */ + protected function writeZendMonitorCustomEvent($level, $message, $formatted) + { + zend_monitor_custom_event($level, $message, $formatted); + } + + /** + * {@inheritdoc} + */ + public function getDefaultFormatter() + { + return new NormalizerFormatter(); + } + + /** + * Get the level map + * + * @return array + */ + public function getLevelMap() + { + return $this->levelMap; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Logger.php b/vendor/monolog/monolog/src/Monolog/Logger.php new file mode 100644 index 00000000..32e3dd92 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Logger.php @@ -0,0 +1,629 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use Monolog\Handler\HandlerInterface; +use Monolog\Handler\StreamHandler; +use Psr\Log\LoggerInterface; +use Psr\Log\InvalidArgumentException; + +/** + * Monolog log channel + * + * It contains a stack of Handlers and a stack of Processors, + * and uses them to store records that are added to it. + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class Logger implements LoggerInterface +{ + /** + * Detailed debug information + */ + const DEBUG = 100; + + /** + * Interesting events + * + * Examples: User logs in, SQL logs. + */ + const INFO = 200; + + /** + * Uncommon events + */ + const NOTICE = 250; + + /** + * Exceptional occurrences that are not errors + * + * Examples: Use of deprecated APIs, poor use of an API, + * undesirable things that are not necessarily wrong. + */ + const WARNING = 300; + + /** + * Runtime errors + */ + const ERROR = 400; + + /** + * Critical conditions + * + * Example: Application component unavailable, unexpected exception. + */ + const CRITICAL = 500; + + /** + * Action must be taken immediately + * + * Example: Entire website down, database unavailable, etc. + * This should trigger the SMS alerts and wake you up. + */ + const ALERT = 550; + + /** + * Urgent alert. + */ + const EMERGENCY = 600; + + /** + * Monolog API version + * + * This is only bumped when API breaks are done and should + * follow the major version of the library + * + * @var int + */ + const API = 1; + + /** + * Logging levels from syslog protocol defined in RFC 5424 + * + * @var array $levels Logging levels + */ + protected static $levels = array( + 100 => 'DEBUG', + 200 => 'INFO', + 250 => 'NOTICE', + 300 => 'WARNING', + 400 => 'ERROR', + 500 => 'CRITICAL', + 550 => 'ALERT', + 600 => 'EMERGENCY', + ); + + /** + * @var \DateTimeZone + */ + protected static $timezone; + + /** + * @var string + */ + protected $name; + + /** + * The handler stack + * + * @var HandlerInterface[] + */ + protected $handlers; + + /** + * Processors that will process all log records + * + * To process records of a single handler instead, add the processor on that specific handler + * + * @var callable[] + */ + protected $processors; + + /** + * @param string $name The logging channel + * @param HandlerInterface[] $handlers Optional stack of handlers, the first one in the array is called first, etc. + * @param callable[] $processors Optional array of processors + */ + public function __construct($name, array $handlers = array(), array $processors = array()) + { + $this->name = $name; + $this->handlers = $handlers; + $this->processors = $processors; + } + + /** + * @return string + */ + public function getName() + { + return $this->name; + } + + /** + * Pushes a handler on to the stack. + * + * @param HandlerInterface $handler + * @return $this + */ + public function pushHandler(HandlerInterface $handler) + { + array_unshift($this->handlers, $handler); + return $this; + } + + /** + * Pops a handler from the stack + * + * @return HandlerInterface + */ + public function popHandler() + { + if (!$this->handlers) { + throw new \LogicException('You tried to pop from an empty handler stack.'); + } + + return array_shift($this->handlers); + } + + /** + * @return HandlerInterface[] + */ + public function getHandlers() + { + return $this->handlers; + } + + /** + * Adds a processor on to the stack. + * + * @param callable $callback + * @return $this + */ + public function pushProcessor($callback) + { + if (!is_callable($callback)) { + throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given'); + } + array_unshift($this->processors, $callback); + return $this; + } + + /** + * Removes the processor on top of the stack and returns it. + * + * @return callable + */ + public function popProcessor() + { + if (!$this->processors) { + throw new \LogicException('You tried to pop from an empty processor stack.'); + } + + return array_shift($this->processors); + } + + /** + * @return callable[] + */ + public function getProcessors() + { + return $this->processors; + } + + /** + * Adds a log record. + * + * @param integer $level The logging level + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function addRecord($level, $message, array $context = array()) + { + if (!$this->handlers) { + $this->pushHandler(new StreamHandler('php://stderr', static::DEBUG)); + } + + $levelName = static::getLevelName($level); + + // check if any handler will handle this message so we can return early and save cycles + $handlerKey = null; + foreach ($this->handlers as $key => $handler) { + if ($handler->isHandling(array('level' => $level))) { + $handlerKey = $key; + break; + } + } + + if (null === $handlerKey) { + return false; + } + + if (!static::$timezone) { + static::$timezone = new \DateTimeZone(date_default_timezone_get() ?: 'UTC'); + } + + $record = array( + 'message' => (string) $message, + 'context' => $context, + 'level' => $level, + 'level_name' => $levelName, + 'channel' => $this->name, + 'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true)), static::$timezone)->setTimezone(static::$timezone), + 'extra' => array(), + ); + + foreach ($this->processors as $processor) { + $record = call_user_func($processor, $record); + } + while (isset($this->handlers[$handlerKey]) && + false === $this->handlers[$handlerKey]->handle($record)) { + $handlerKey++; + } + + return true; + } + + /** + * Adds a log record at the DEBUG level. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function addDebug($message, array $context = array()) + { + return $this->addRecord(static::DEBUG, $message, $context); + } + + /** + * Adds a log record at the INFO level. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function addInfo($message, array $context = array()) + { + return $this->addRecord(static::INFO, $message, $context); + } + + /** + * Adds a log record at the NOTICE level. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function addNotice($message, array $context = array()) + { + return $this->addRecord(static::NOTICE, $message, $context); + } + + /** + * Adds a log record at the WARNING level. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function addWarning($message, array $context = array()) + { + return $this->addRecord(static::WARNING, $message, $context); + } + + /** + * Adds a log record at the ERROR level. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function addError($message, array $context = array()) + { + return $this->addRecord(static::ERROR, $message, $context); + } + + /** + * Adds a log record at the CRITICAL level. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function addCritical($message, array $context = array()) + { + return $this->addRecord(static::CRITICAL, $message, $context); + } + + /** + * Adds a log record at the ALERT level. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function addAlert($message, array $context = array()) + { + return $this->addRecord(static::ALERT, $message, $context); + } + + /** + * Adds a log record at the EMERGENCY level. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function addEmergency($message, array $context = array()) + { + return $this->addRecord(static::EMERGENCY, $message, $context); + } + + /** + * Gets all supported logging levels. + * + * @return array Assoc array with human-readable level names => level codes. + */ + public static function getLevels() + { + return array_flip(static::$levels); + } + + /** + * Gets the name of the logging level. + * + * @param integer $level + * @return string + */ + public static function getLevelName($level) + { + if (!isset(static::$levels[$level])) { + throw new InvalidArgumentException('Level "'.$level.'" is not defined, use one of: '.implode(', ', array_keys(static::$levels))); + } + + return static::$levels[$level]; + } + + /** + * Converts PSR-3 levels to Monolog ones if necessary + * + * @param string|int Level number (monolog) or name (PSR-3) + * @return int + */ + public static function toMonologLevel($level) + { + if (is_string($level) && defined(__CLASS__.'::'.strtoupper($level))) { + return constant(__CLASS__.'::'.strtoupper($level)); + } + + return $level; + } + + /** + * Checks whether the Logger has a handler that listens on the given level + * + * @param integer $level + * @return Boolean + */ + public function isHandling($level) + { + $record = array( + 'level' => $level, + ); + + foreach ($this->handlers as $handler) { + if ($handler->isHandling($record)) { + return true; + } + } + + return false; + } + + /** + * Adds a log record at an arbitrary level. + * + * This method allows for compatibility with common interfaces. + * + * @param mixed $level The log level + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function log($level, $message, array $context = array()) + { + $level = static::toMonologLevel($level); + + return $this->addRecord($level, $message, $context); + } + + /** + * Adds a log record at the DEBUG level. + * + * This method allows for compatibility with common interfaces. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function debug($message, array $context = array()) + { + return $this->addRecord(static::DEBUG, $message, $context); + } + + /** + * Adds a log record at the INFO level. + * + * This method allows for compatibility with common interfaces. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function info($message, array $context = array()) + { + return $this->addRecord(static::INFO, $message, $context); + } + + /** + * Adds a log record at the NOTICE level. + * + * This method allows for compatibility with common interfaces. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function notice($message, array $context = array()) + { + return $this->addRecord(static::NOTICE, $message, $context); + } + + /** + * Adds a log record at the WARNING level. + * + * This method allows for compatibility with common interfaces. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function warn($message, array $context = array()) + { + return $this->addRecord(static::WARNING, $message, $context); + } + + /** + * Adds a log record at the WARNING level. + * + * This method allows for compatibility with common interfaces. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function warning($message, array $context = array()) + { + return $this->addRecord(static::WARNING, $message, $context); + } + + /** + * Adds a log record at the ERROR level. + * + * This method allows for compatibility with common interfaces. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function err($message, array $context = array()) + { + return $this->addRecord(static::ERROR, $message, $context); + } + + /** + * Adds a log record at the ERROR level. + * + * This method allows for compatibility with common interfaces. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function error($message, array $context = array()) + { + return $this->addRecord(static::ERROR, $message, $context); + } + + /** + * Adds a log record at the CRITICAL level. + * + * This method allows for compatibility with common interfaces. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function crit($message, array $context = array()) + { + return $this->addRecord(static::CRITICAL, $message, $context); + } + + /** + * Adds a log record at the CRITICAL level. + * + * This method allows for compatibility with common interfaces. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function critical($message, array $context = array()) + { + return $this->addRecord(static::CRITICAL, $message, $context); + } + + /** + * Adds a log record at the ALERT level. + * + * This method allows for compatibility with common interfaces. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function alert($message, array $context = array()) + { + return $this->addRecord(static::ALERT, $message, $context); + } + + /** + * Adds a log record at the EMERGENCY level. + * + * This method allows for compatibility with common interfaces. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function emerg($message, array $context = array()) + { + return $this->addRecord(static::EMERGENCY, $message, $context); + } + + /** + * Adds a log record at the EMERGENCY level. + * + * This method allows for compatibility with common interfaces. + * + * @param string $message The log message + * @param array $context The log context + * @return Boolean Whether the record has been processed + */ + public function emergency($message, array $context = array()) + { + return $this->addRecord(static::EMERGENCY, $message, $context); + } + + /** + * Set the timezone to be used for the timestamp of log records. + * + * This is stored globally for all Logger instances + * + * @param \DateTimeZone $tz Timezone object + */ + public static function setTimezone(\DateTimeZone $tz) + { + self::$timezone = $tz; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php new file mode 100644 index 00000000..1899400d --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Processor/GitProcessor.php @@ -0,0 +1,64 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\Logger; + +/** + * Injects Git branch and Git commit SHA in all records + * + * @author Nick Otter + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class GitProcessor +{ + private $level; + private static $cache; + + public function __construct($level = Logger::DEBUG) + { + $this->level = Logger::toMonologLevel($level); + } + + /** + * @param array $record + * @return array + */ + public function __invoke(array $record) + { + // return if the level is not high enough + if ($record['level'] < $this->level) { + return $record; + } + + $record['extra']['git'] = self::getGitInfo(); + + return $record; + } + + private static function getGitInfo() + { + if (self::$cache) { + return self::$cache; + } + + $branches = `git branch -v --no-abbrev`; + if (preg_match('{^\* (.+?)\s+([a-f0-9]{40})(?:\s|$)}m', $branches, $matches)) { + return self::$cache = array( + 'branch' => $matches[1], + 'commit' => $matches[2], + ); + } + + return self::$cache = array(); + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php new file mode 100644 index 00000000..294a295c --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php @@ -0,0 +1,82 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\Logger; + +/** + * Injects line/file:class/function where the log message came from + * + * Warning: This only works if the handler processes the logs directly. + * If you put the processor on a handler that is behind a FingersCrossedHandler + * for example, the processor will only be called once the trigger level is reached, + * and all the log records will have the same file/line/.. data from the call that + * triggered the FingersCrossedHandler. + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class IntrospectionProcessor +{ + private $level; + + private $skipClassesPartials; + + public function __construct($level = Logger::DEBUG, array $skipClassesPartials = array('Monolog\\')) + { + $this->level = Logger::toMonologLevel($level); + $this->skipClassesPartials = $skipClassesPartials; + } + + /** + * @param array $record + * @return array + */ + public function __invoke(array $record) + { + // return if the level is not high enough + if ($record['level'] < $this->level) { + return $record; + } + + $trace = debug_backtrace(); + + // skip first since it's always the current method + array_shift($trace); + // the call_user_func call is also skipped + array_shift($trace); + + $i = 0; + + while (isset($trace[$i]['class'])) { + foreach ($this->skipClassesPartials as $part) { + if (strpos($trace[$i]['class'], $part) !== false) { + $i++; + continue 2; + } + } + break; + } + + // we should have the call source now + $record['extra'] = array_merge( + $record['extra'], + array( + 'file' => isset($trace[$i-1]['file']) ? $trace[$i-1]['file'] : null, + 'line' => isset($trace[$i-1]['line']) ? $trace[$i-1]['line'] : null, + 'class' => isset($trace[$i]['class']) ? $trace[$i]['class'] : null, + 'function' => isset($trace[$i]['function']) ? $trace[$i]['function'] : null, + ) + ); + + return $record; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php new file mode 100644 index 00000000..552fd709 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php @@ -0,0 +1,40 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +/** + * Injects memory_get_peak_usage in all records + * + * @see Monolog\Processor\MemoryProcessor::__construct() for options + * @author Rob Jensen + */ +class MemoryPeakUsageProcessor extends MemoryProcessor +{ + /** + * @param array $record + * @return array + */ + public function __invoke(array $record) + { + $bytes = memory_get_peak_usage($this->realUsage); + $formatted = $this->formatBytes($bytes); + + $record['extra'] = array_merge( + $record['extra'], + array( + 'memory_peak_usage' => $formatted, + ) + ); + + return $record; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php new file mode 100644 index 00000000..0820def4 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php @@ -0,0 +1,63 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +/** + * Some methods that are common for all memory processors + * + * @author Rob Jensen + */ +abstract class MemoryProcessor +{ + /** + * @var boolean If true, get the real size of memory allocated from system. Else, only the memory used by emalloc() is reported. + */ + protected $realUsage; + + /** + * @var boolean If true, then format memory size to human readable string (MB, KB, B depending on size) + */ + protected $useFormatting; + + /** + * @param boolean $realUsage Set this to true to get the real size of memory allocated from system. + * @param boolean $useFormatting If true, then format memory size to human readable string (MB, KB, B depending on size) + */ + public function __construct($realUsage = true, $useFormatting = true) + { + $this->realUsage = (boolean) $realUsage; + $this->useFormatting = (boolean) $useFormatting; + } + + /** + * Formats bytes into a human readable string if $this->useFormatting is true, otherwise return $bytes as is + * + * @param int $bytes + * @return string|int Formatted string if $this->useFormatting is true, otherwise return $bytes as is + */ + protected function formatBytes($bytes) + { + $bytes = (int) $bytes; + + if (!$this->useFormatting) { + return $bytes; + } + + if ($bytes > 1024*1024) { + return round($bytes/1024/1024, 2).' MB'; + } elseif ($bytes > 1024) { + return round($bytes/1024, 2).' KB'; + } + + return $bytes . ' B'; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php new file mode 100644 index 00000000..0c4dd9ab --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php @@ -0,0 +1,40 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +/** + * Injects memory_get_usage in all records + * + * @see Monolog\Processor\MemoryProcessor::__construct() for options + * @author Rob Jensen + */ +class MemoryUsageProcessor extends MemoryProcessor +{ + /** + * @param array $record + * @return array + */ + public function __invoke(array $record) + { + $bytes = memory_get_usage($this->realUsage); + $formatted = $this->formatBytes($bytes); + + $record['extra'] = array_merge( + $record['extra'], + array( + 'memory_usage' => $formatted, + ) + ); + + return $record; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php new file mode 100644 index 00000000..9d3f5590 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php @@ -0,0 +1,31 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +/** + * Adds value of getmypid into records + * + * @author Andreas Hörnicke + */ +class ProcessIdProcessor +{ + /** + * @param array $record + * @return array + */ + public function __invoke(array $record) + { + $record['extra']['process_id'] = getmypid(); + + return $record; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php new file mode 100644 index 00000000..c2686ce5 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php @@ -0,0 +1,48 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +/** + * Processes a record's message according to PSR-3 rules + * + * It replaces {foo} with the value from $context['foo'] + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class PsrLogMessageProcessor +{ + /** + * @param array $record + * @return array + */ + public function __invoke(array $record) + { + if (false === strpos($record['message'], '{')) { + return $record; + } + + $replacements = array(); + foreach ($record['context'] as $key => $val) { + if (is_null($val) || is_scalar($val) || (is_object($val) && method_exists($val, "__toString"))) { + $replacements['{'.$key.'}'] = $val; + } elseif (is_object($val)) { + $replacements['{'.$key.'}'] = '[object '.get_class($val).']'; + } else { + $replacements['{'.$key.'}'] = '['.gettype($val).']'; + } + } + + $record['message'] = strtr($record['message'], $replacements); + + return $record; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php new file mode 100644 index 00000000..2784cef4 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Processor/TagProcessor.php @@ -0,0 +1,34 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +/** + * Adds a tags array into record + * + * @author Martijn Riemers + */ +class TagProcessor +{ + private $tags; + + public function __construct(array $tags = array()) + { + $this->tags = $tags; + } + + public function __invoke(array $record) + { + $record['extra']['tags'] = $this->tags; + + return $record; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php new file mode 100644 index 00000000..80270d08 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php @@ -0,0 +1,38 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +/** + * Adds a unique identifier into records + * + * @author Simon Mönch <sm@webfactory.de> + */ +class UidProcessor +{ + private $uid; + + public function __construct($length = 7) + { + if (!is_int($length) || $length > 32 || $length < 1) { + throw new \InvalidArgumentException('The uid length must be an integer between 1 and 32'); + } + + $this->uid = substr(hash('md5', uniqid('', true)), 0, $length); + } + + public function __invoke(array $record) + { + $record['extra']['uid'] = $this->uid; + + return $record; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php b/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php new file mode 100644 index 00000000..21f22a6e --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php @@ -0,0 +1,105 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +/** + * Injects url/method and remote IP of the current web request in all records + * + * @author Jordi Boggiano <j.boggiano@seld.be> + */ +class WebProcessor +{ + /** + * @var array|\ArrayAccess + */ + protected $serverData; + + /** + * @var array + */ + protected $extraFields = array( + 'url' => 'REQUEST_URI', + 'ip' => 'REMOTE_ADDR', + 'http_method' => 'REQUEST_METHOD', + 'server' => 'SERVER_NAME', + 'referrer' => 'HTTP_REFERER', + ); + + /** + * @param array|\ArrayAccess $serverData Array or object w/ ArrayAccess that provides access to the $_SERVER data + * @param array|null $extraFields Extra field names to be added (all available by default) + */ + public function __construct($serverData = null, array $extraFields = null) + { + if (null === $serverData) { + $this->serverData = &$_SERVER; + } elseif (is_array($serverData) || $serverData instanceof \ArrayAccess) { + $this->serverData = $serverData; + } else { + throw new \UnexpectedValueException('$serverData must be an array or object implementing ArrayAccess.'); + } + + if (null !== $extraFields) { + foreach (array_keys($this->extraFields) as $fieldName) { + if (!in_array($fieldName, $extraFields)) { + unset($this->extraFields[$fieldName]); + } + } + } + } + + /** + * @param array $record + * @return array + */ + public function __invoke(array $record) + { + // skip processing if for some reason request data + // is not present (CLI or wonky SAPIs) + if (!isset($this->serverData['REQUEST_URI'])) { + return $record; + } + + $record['extra'] = $this->appendExtraFields($record['extra']); + + return $record; + } + + /** + * @param string $extraName + * @param string $serverName + * @return $this + */ + public function addExtraField($extraName, $serverName) + { + $this->extraFields[$extraName] = $serverName; + + return $this; + } + + /** + * @param array $extra + * @return array + */ + private function appendExtraFields(array $extra) + { + foreach ($this->extraFields as $extraName => $serverName) { + $extra[$extraName] = isset($this->serverData[$serverName]) ? $this->serverData[$serverName] : null; + } + + if (isset($this->serverData['UNIQUE_ID'])) { + $extra['unique_id'] = $this->serverData['UNIQUE_ID']; + } + + return $extra; + } +} diff --git a/vendor/monolog/monolog/src/Monolog/Registry.php b/vendor/monolog/monolog/src/Monolog/Registry.php new file mode 100644 index 00000000..a33cb7c4 --- /dev/null +++ b/vendor/monolog/monolog/src/Monolog/Registry.php @@ -0,0 +1,134 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use InvalidArgumentException; + +/** + * Monolog log registry + * + * Allows to get `Logger` instances in the global scope + * via static method calls on this class. + * + * <code> + * $application = new Monolog\Logger('application'); + * $api = new Monolog\Logger('api'); + * + * Monolog\Registry::addLogger($application); + * Monolog\Registry::addLogger($api); + * + * function testLogger() + * { + * Monolog\Registry::api()->addError('Sent to $api Logger instance'); + * Monolog\Registry::application()->addError('Sent to $application Logger instance'); + * } + * </code> + * + * @author Tomas Tatarko <tomas@tatarko.sk> + */ +class Registry +{ + /** + * List of all loggers in the registry (by named indexes) + * + * @var Logger[] + */ + private static $loggers = array(); + + /** + * Adds new logging channel to the registry + * + * @param Logger $logger Instance of the logging channel + * @param string|null $name Name of the logging channel ($logger->getName() by default) + * @param boolean $overwrite Overwrite instance in the registry if the given name already exists? + * @throws \InvalidArgumentException If $overwrite set to false and named Logger instance already exists + */ + public static function addLogger(Logger $logger, $name = null, $overwrite = false) + { + $name = $name ?: $logger->getName(); + + if (isset(self::$loggers[$name]) && !$overwrite) { + throw new InvalidArgumentException('Logger with the given name already exists'); + } + + self::$loggers[$name] = $logger; + } + + /** + * Checks if such logging channel exists by name or instance + * + * @param string|Logger $logger Name or logger instance + */ + public static function hasLogger($logger) + { + if ($logger instanceof Logger) { + $index = array_search($logger, self::$loggers, true); + + return false !== $index; + } else { + return isset(self::$loggers[$logger]); + } + } + + /** + * Removes instance from registry by name or instance + * + * @param string|Logger $logger Name or logger instance + */ + public static function removeLogger($logger) + { + if ($logger instanceof Logger) { + if (false !== ($idx = array_search($logger, self::$loggers, true))) { + unset(self::$loggers[$idx]); + } + } else { + unset(self::$loggers[$logger]); + } + } + + /** + * Clears the registry + */ + public static function clear() + { + self::$loggers = array(); + } + + /** + * Gets Logger instance from the registry + * + * @param string $name Name of the requested Logger instance + * @return Logger Requested instance of Logger + * @throws \InvalidArgumentException If named Logger instance is not in the registry + */ + public static function getInstance($name) + { + if (!isset(self::$loggers[$name])) { + throw new InvalidArgumentException(sprintf('Requested "%s" logger instance is not in the registry', $name)); + } + + return self::$loggers[$name]; + } + + /** + * Gets Logger instance from the registry via static method call + * + * @param string $name Name of the requested Logger instance + * @param array $arguments Arguments passed to static method call + * @return Logger Requested instance of Logger + * @throws \InvalidArgumentException If named Logger instance is not in the registry + */ + public static function __callStatic($name, $arguments) + { + return self::getInstance($name); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php new file mode 100644 index 00000000..a9a3f301 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php @@ -0,0 +1,31 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use Monolog\Handler\TestHandler; + +class ErrorHandlerTest extends \PHPUnit_Framework_TestCase +{ + public function testHandleError() + { + $logger = new Logger('test', array($handler = new TestHandler)); + $errHandler = new ErrorHandler($logger); + + $errHandler->registerErrorHandler(array(E_USER_NOTICE => Logger::EMERGENCY), false); + trigger_error('Foo', E_USER_ERROR); + $this->assertCount(1, $handler->getRecords()); + $this->assertTrue($handler->hasErrorRecords()); + trigger_error('Foo', E_USER_NOTICE); + $this->assertCount(2, $handler->getRecords()); + $this->assertTrue($handler->hasEmergencyRecords()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php new file mode 100644 index 00000000..e7f7334e --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php @@ -0,0 +1,158 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class ChromePHPFormatterTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Formatter\ChromePHPFormatter::format + */ + public function testDefaultFormat() + { + $formatter = new ChromePHPFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('ip' => '127.0.0.1'), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertEquals( + array( + 'meh', + array( + 'message' => 'log', + 'context' => array('from' => 'logger'), + 'extra' => array('ip' => '127.0.0.1'), + ), + 'unknown', + 'error' + ), + $message + ); + } + + /** + * @covers Monolog\Formatter\ChromePHPFormatter::format + */ + public function testFormatWithFileAndLine() + { + $formatter = new ChromePHPFormatter(); + $record = array( + 'level' => Logger::CRITICAL, + 'level_name' => 'CRITICAL', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertEquals( + array( + 'meh', + array( + 'message' => 'log', + 'context' => array('from' => 'logger'), + 'extra' => array('ip' => '127.0.0.1'), + ), + 'test : 14', + 'error' + ), + $message + ); + } + + /** + * @covers Monolog\Formatter\ChromePHPFormatter::format + */ + public function testFormatWithoutContext() + { + $formatter = new ChromePHPFormatter(); + $record = array( + 'level' => Logger::DEBUG, + 'level_name' => 'DEBUG', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertEquals( + array( + 'meh', + 'log', + 'unknown', + 'log' + ), + $message + ); + } + + /** + * @covers Monolog\Formatter\ChromePHPFormatter::formatBatch + */ + public function testBatchFormatThrowException() + { + $formatter = new ChromePHPFormatter(); + $records = array( + array( + 'level' => Logger::INFO, + 'level_name' => 'INFO', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ), + array( + 'level' => Logger::WARNING, + 'level_name' => 'WARNING', + 'channel' => 'foo', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log2', + ), + ); + + $this->assertEquals( + array( + array( + 'meh', + 'log', + 'unknown', + 'info' + ), + array( + 'foo', + 'log2', + 'unknown', + 'warn' + ), + ), + $formatter->formatBatch($records) + ); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php new file mode 100644 index 00000000..546e5c26 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php @@ -0,0 +1,79 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class ElasticaFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function setUp() + { + if (!class_exists("Elastica\Document")) { + $this->markTestSkipped("ruflin/elastica not installed"); + } + } + + /** + * @covers Monolog\Formatter\ElasticaFormatter::__construct + * @covers Monolog\Formatter\ElasticaFormatter::format + * @covers Monolog\Formatter\ElasticaFormatter::getDocument + */ + public function testFormat() + { + // test log message + $msg = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + // expected values + $expected = $msg; + $expected['datetime'] = '1970-01-01T00:00:00+0000'; + $expected['context'] = array( + 'class' => '[object] (stdClass: {})', + 'foo' => 7, + 0 => 'bar', + ); + + // format log message + $formatter = new ElasticaFormatter('my_index', 'doc_type'); + $doc = $formatter->format($msg); + $this->assertInstanceOf('Elastica\Document', $doc); + + // Document parameters + $params = $doc->getParams(); + $this->assertEquals('my_index', $params['_index']); + $this->assertEquals('doc_type', $params['_type']); + + // Document data values + $data = $doc->getData(); + foreach (array_keys($expected) as $key) { + $this->assertEquals($expected[$key], $data[$key]); + } + } + + /** + * @covers Monolog\Formatter\ElasticaFormatter::getIndex + * @covers Monolog\Formatter\ElasticaFormatter::getType + */ + public function testGetters() + { + $formatter = new ElasticaFormatter('my_index', 'doc_type'); + $this->assertEquals('my_index', $formatter->getIndex()); + $this->assertEquals('doc_type', $formatter->getType()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php new file mode 100644 index 00000000..1b2fd97a --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php @@ -0,0 +1,55 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; +use Monolog\TestCase; + +class FlowdockFormatterTest extends TestCase +{ + /** + * @covers Monolog\Formatter\FlowdockFormatter::format + */ + public function testFormat() + { + $formatter = new FlowdockFormatter('test_source', 'source@test.com'); + $record = $this->getRecord(); + + $expected = array( + 'source' => 'test_source', + 'from_address' => 'source@test.com', + 'subject' => 'in test_source: WARNING - test', + 'content' => 'test', + 'tags' => array('#logs', '#warning', '#test'), + 'project' => 'test_source', + ); + $formatted = $formatter->format($record); + + $this->assertEquals($expected, $formatted['flowdock']); + } + + /** + * @ covers Monolog\Formatter\FlowdockFormatter::formatBatch + */ + public function testFormatBatch() + { + $formatter = new FlowdockFormatter('test_source', 'source@test.com'); + $records = array( + $this->getRecord(Logger::WARNING), + $this->getRecord(Logger::DEBUG), + ); + $formatted = $formatter->formatBatch($records); + + $this->assertArrayHasKey('flowdock', $formatted[0]); + $this->assertArrayHasKey('flowdock', $formatted[1]); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php new file mode 100644 index 00000000..6ac14854 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php @@ -0,0 +1,204 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class GelfMessageFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function setUp() + { + if (!class_exists('\Gelf\Message')) { + $this->markTestSkipped("graylog2/gelf-php or mlehner/gelf-php is not installed"); + } + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testDefaultFormatter() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + $this->assertEquals(0, $message->getTimestamp()); + $this->assertEquals('log', $message->getShortMessage()); + $this->assertEquals('meh', $message->getFacility()); + $this->assertEquals(null, $message->getLine()); + $this->assertEquals(null, $message->getFile()); + $this->assertEquals($this->isLegacy() ? 3 : 'error', $message->getLevel()); + $this->assertNotEmpty($message->getHost()); + + $formatter = new GelfMessageFormatter('mysystem'); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + $this->assertEquals('mysystem', $message->getHost()); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testFormatWithFileAndLine() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + $this->assertEquals('test', $message->getFile()); + $this->assertEquals(14, $message->getLine()); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + * @expectedException InvalidArgumentException + */ + public function testFormatInvalidFails() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + ); + + $formatter->format($record); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testFormatWithContext() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $message_array = $message->toArray(); + + $this->assertArrayHasKey('_ctxt_from', $message_array); + $this->assertEquals('logger', $message_array['_ctxt_from']); + + // Test with extraPrefix + $formatter = new GelfMessageFormatter(null, null, 'CTX'); + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $message_array = $message->toArray(); + + $this->assertArrayHasKey('_CTXfrom', $message_array); + $this->assertEquals('logger', $message_array['_CTXfrom']); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testFormatWithContextContainingException() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger', 'exception' => array( + 'class' => '\Exception', + 'file' => '/some/file/in/dir.php:56', + 'trace' => array('/some/file/1.php:23', '/some/file/2.php:3') + )), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log' + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $this->assertEquals("/some/file/in/dir.php", $message->getFile()); + $this->assertEquals("56", $message->getLine()); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testFormatWithExtra() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $message_array = $message->toArray(); + + $this->assertArrayHasKey('_key', $message_array); + $this->assertEquals('pair', $message_array['_key']); + + // Test with extraPrefix + $formatter = new GelfMessageFormatter(null, 'EXT'); + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $message_array = $message->toArray(); + + $this->assertArrayHasKey('_EXTkey', $message_array); + $this->assertEquals('pair', $message_array['_EXTkey']); + } + + private function isLegacy() + { + return interface_exists('\Gelf\IMessagePublisher'); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php new file mode 100644 index 00000000..69e20077 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php @@ -0,0 +1,78 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; +use Monolog\TestCase; + +class JsonFormatterTest extends TestCase +{ + /** + * @covers Monolog\Formatter\JsonFormatter::__construct + * @covers Monolog\Formatter\JsonFormatter::getBatchMode + * @covers Monolog\Formatter\JsonFormatter::isAppendingNewlines + */ + public function testConstruct() + { + $formatter = new JsonFormatter(); + $this->assertEquals(JsonFormatter::BATCH_MODE_JSON, $formatter->getBatchMode()); + $this->assertEquals(true, $formatter->isAppendingNewlines()); + $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES, false); + $this->assertEquals(JsonFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode()); + $this->assertEquals(false, $formatter->isAppendingNewlines()); + } + + /** + * @covers Monolog\Formatter\JsonFormatter::format + */ + public function testFormat() + { + $formatter = new JsonFormatter(); + $record = $this->getRecord(); + $this->assertEquals(json_encode($record)."\n", $formatter->format($record)); + + $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false); + $record = $this->getRecord(); + $this->assertEquals(json_encode($record), $formatter->format($record)); + } + + /** + * @covers Monolog\Formatter\JsonFormatter::formatBatch + * @covers Monolog\Formatter\JsonFormatter::formatBatchJson + */ + public function testFormatBatch() + { + $formatter = new JsonFormatter(); + $records = array( + $this->getRecord(Logger::WARNING), + $this->getRecord(Logger::DEBUG), + ); + $this->assertEquals(json_encode($records), $formatter->formatBatch($records)); + } + + /** + * @covers Monolog\Formatter\JsonFormatter::formatBatch + * @covers Monolog\Formatter\JsonFormatter::formatBatchNewlines + */ + public function testFormatBatchNewlines() + { + $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES); + $records = $expected = array( + $this->getRecord(Logger::WARNING), + $this->getRecord(Logger::DEBUG), + ); + array_walk($expected, function (&$value, $key) { + $value = json_encode($value); + }); + $this->assertEquals(implode("\n", $expected), $formatter->formatBatch($records)); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php new file mode 100644 index 00000000..c1b2e0ee --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php @@ -0,0 +1,208 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * @covers Monolog\Formatter\LineFormatter + */ +class LineFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function testDefFormatWithString() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'WARNING', + 'channel' => 'log', + 'context' => array(), + 'message' => 'foo', + 'datetime' => new \DateTime, + 'extra' => array(), + )); + $this->assertEquals('['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message); + } + + public function testDefFormatWithArrayContext() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'message' => 'foo', + 'datetime' => new \DateTime, + 'extra' => array(), + 'context' => array( + 'foo' => 'bar', + 'baz' => 'qux', + 'bool' => false, + 'null' => null, + ) + )); + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foo {"foo":"bar","baz":"qux","bool":false,"null":null} []'."\n", $message); + } + + public function testDefFormatExtras() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array('ip' => '127.0.0.1'), + 'message' => 'log', + )); + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] {"ip":"127.0.0.1"}'."\n", $message); + } + + public function testFormatExtras() + { + $formatter = new LineFormatter("[%datetime%] %channel%.%level_name%: %message% %context% %extra.file% %extra%\n", 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array('ip' => '127.0.0.1', 'file' => 'test'), + 'message' => 'log', + )); + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] test {"ip":"127.0.0.1"}'."\n", $message); + } + + public function testContextAndExtraOptionallyNotShownIfEmpty() + { + $formatter = new LineFormatter(null, 'Y-m-d', false, true); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + 'message' => 'log', + )); + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log '."\n", $message); + } + + public function testDefFormatWithObject() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array('foo' => new TestFoo, 'bar' => new TestBar, 'baz' => array(), 'res' => fopen('php://memory', 'rb')), + 'message' => 'foobar', + )); + + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foobar [] {"foo":"[object] (Monolog\\\\Formatter\\\\TestFoo: {\\"foo\\":\\"foo\\"})","bar":"[object] (Monolog\\\\Formatter\\\\TestBar: bar)","baz":[],"res":"[resource]"}'."\n", $message); + } + + public function testDefFormatWithException() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'CRITICAL', + 'channel' => 'core', + 'context' => array('exception' => new \RuntimeException('Foo')), + 'datetime' => new \DateTime, + 'extra' => array(), + 'message' => 'foobar', + )); + + $path = str_replace('\\/', '/', json_encode(__FILE__)); + + $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__-8).')"} []'."\n", $message); + } + + public function testDefFormatWithPreviousException() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $previous = new \LogicException('Wut?'); + $message = $formatter->format(array( + 'level_name' => 'CRITICAL', + 'channel' => 'core', + 'context' => array('exception' => new \RuntimeException('Foo', 0, $previous)), + 'datetime' => new \DateTime, + 'extra' => array(), + 'message' => 'foobar', + )); + + $path = str_replace('\\/', '/', json_encode(__FILE__)); + + $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__-8).', LogicException(code: 0): Wut? at '.substr($path, 1, -1).':'.(__LINE__-12).')"} []'."\n", $message); + } + + public function testBatchFormat() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->formatBatch(array( + array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + ), + array( + 'level_name' => 'WARNING', + 'channel' => 'log', + 'message' => 'foo', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + ), + )); + $this->assertEquals('['.date('Y-m-d').'] test.CRITICAL: bar [] []'."\n".'['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message); + } + + public function testFormatShouldStripInlineLineBreaks() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format( + array( + 'message' => "foo\nbar", + 'context' => array(), + 'extra' => array(), + ) + ); + + $this->assertRegExp('/foo bar/', $message); + } + + public function testFormatShouldNotStripInlineLineBreaksWhenFlagIsSet() + { + $formatter = new LineFormatter(null, 'Y-m-d', true); + $message = $formatter->format( + array( + 'message' => "foo\nbar", + 'context' => array(), + 'extra' => array(), + ) + ); + + $this->assertRegExp('/foo\nbar/', $message); + } +} + +class TestFoo +{ + public $foo = 'foo'; +} + +class TestBar +{ + public function __toString() + { + return 'bar'; + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php new file mode 100644 index 00000000..6d59b3f3 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php @@ -0,0 +1,40 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\TestCase; + +class LogglyFormatterTest extends TestCase +{ + /** + * @covers Monolog\Formatter\LogglyFormatter::__construct + */ + public function testConstruct() + { + $formatter = new LogglyFormatter(); + $this->assertEquals(LogglyFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode()); + $formatter = new LogglyFormatter(LogglyFormatter::BATCH_MODE_JSON); + $this->assertEquals(LogglyFormatter::BATCH_MODE_JSON, $formatter->getBatchMode()); + } + + /** + * @covers Monolog\Formatter\LogglyFormatter::format + */ + public function testFormat() + { + $formatter = new LogglyFormatter(); + $record = $this->getRecord(); + $formatted_decoded = json_decode($formatter->format($record), true); + $this->assertArrayHasKey("timestamp", $formatted_decoded); + $this->assertEquals(new \DateTime($formatted_decoded["timestamp"]), $record["datetime"]); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php new file mode 100644 index 00000000..de4a3c2c --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php @@ -0,0 +1,289 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class LogstashFormatterTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testDefaultFormatter() + { + $formatter = new LogstashFormatter('test', 'hostname'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']); + $this->assertEquals('log', $message['@message']); + $this->assertEquals('meh', $message['@fields']['channel']); + $this->assertContains('meh', $message['@tags']); + $this->assertEquals(Logger::ERROR, $message['@fields']['level']); + $this->assertEquals('test', $message['@type']); + $this->assertEquals('hostname', $message['@source']); + + $formatter = new LogstashFormatter('mysystem'); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals('mysystem', $message['@type']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithFileAndLine() + { + $formatter = new LogstashFormatter('test'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals('test', $message['@fields']['file']); + $this->assertEquals(14, $message['@fields']['line']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithContext() + { + $formatter = new LogstashFormatter('test'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = json_decode($formatter->format($record), true); + + $message_array = $message['@fields']; + + $this->assertArrayHasKey('ctxt_from', $message_array); + $this->assertEquals('logger', $message_array['ctxt_from']); + + // Test with extraPrefix + $formatter = new LogstashFormatter('test', null, null, 'CTX'); + $message = json_decode($formatter->format($record), true); + + $message_array = $message['@fields']; + + $this->assertArrayHasKey('CTXfrom', $message_array); + $this->assertEquals('logger', $message_array['CTXfrom']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithExtra() + { + $formatter = new LogstashFormatter('test'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = json_decode($formatter->format($record), true); + + $message_array = $message['@fields']; + + $this->assertArrayHasKey('key', $message_array); + $this->assertEquals('pair', $message_array['key']); + + // Test with extraPrefix + $formatter = new LogstashFormatter('test', null, 'EXT'); + $message = json_decode($formatter->format($record), true); + + $message_array = $message['@fields']; + + $this->assertArrayHasKey('EXTkey', $message_array); + $this->assertEquals('pair', $message_array['EXTkey']); + } + + public function testFormatWithApplicationName() + { + $formatter = new LogstashFormatter('app', 'test'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('@type', $message); + $this->assertEquals('app', $message['@type']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testDefaultFormatterV1() + { + $formatter = new LogstashFormatter('test', 'hostname', null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']); + $this->assertEquals("1", $message['@version']); + $this->assertEquals('log', $message['message']); + $this->assertEquals('meh', $message['channel']); + $this->assertEquals('ERROR', $message['level']); + $this->assertEquals('test', $message['type']); + $this->assertEquals('hostname', $message['host']); + + $formatter = new LogstashFormatter('mysystem', null, null, 'ctxt_', LogstashFormatter::V1); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals('mysystem', $message['type']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithFileAndLineV1() + { + $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals('test', $message['file']); + $this->assertEquals(14, $message['line']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithContextV1() + { + $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('ctxt_from', $message); + $this->assertEquals('logger', $message['ctxt_from']); + + // Test with extraPrefix + $formatter = new LogstashFormatter('test', null, null, 'CTX', LogstashFormatter::V1); + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('CTXfrom', $message); + $this->assertEquals('logger', $message['CTXfrom']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithExtraV1() + { + $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('key', $message); + $this->assertEquals('pair', $message['key']); + + // Test with extraPrefix + $formatter = new LogstashFormatter('test', null, 'EXT', 'ctxt_', LogstashFormatter::V1); + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('EXTkey', $message); + $this->assertEquals('pair', $message['EXTkey']); + } + + public function testFormatWithApplicationNameV1() + { + $formatter = new LogstashFormatter('app', 'test', null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log' + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('type', $message); + $this->assertEquals('app', $message['type']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php new file mode 100644 index 00000000..1554ef46 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php @@ -0,0 +1,253 @@ +<?php + +namespace Monolog\Formatter; + +use Monolog\Logger; + +/** + * @author Florian Plattner <me@florianplattner.de> + */ +class MongoDBFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function setUp() + { + if (!class_exists('MongoDate')) { + $this->markTestSkipped('mongo extension not installed'); + } + } + + public function constructArgumentProvider() + { + return array( + array(1, true, 1, true), + array(0, false, 0, false), + ); + } + + /** + * @param $traceDepth + * @param $traceAsString + * @param $expectedTraceDepth + * @param $expectedTraceAsString + * + * @dataProvider constructArgumentProvider + */ + public function testConstruct($traceDepth, $traceAsString, $expectedTraceDepth, $expectedTraceAsString) + { + $formatter = new MongoDBFormatter($traceDepth, $traceAsString); + + $reflTrace = new \ReflectionProperty($formatter, 'exceptionTraceAsString'); + $reflTrace->setAccessible(true); + $this->assertEquals($expectedTraceAsString, $reflTrace->getValue($formatter)); + + $reflDepth = new\ReflectionProperty($formatter, 'maxNestingLevel'); + $reflDepth->setAccessible(true); + $this->assertEquals($expectedTraceDepth, $reflDepth->getValue($formatter)); + } + + public function testSimpleFormat() + { + $record = array( + 'message' => 'some log message', + 'context' => array(), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(); + $formattedRecord = $formatter->format($record); + + $this->assertCount(7, $formattedRecord); + $this->assertEquals('some log message', $formattedRecord['message']); + $this->assertEquals(array(), $formattedRecord['context']); + $this->assertEquals(Logger::WARNING, $formattedRecord['level']); + $this->assertEquals(Logger::getLevelName(Logger::WARNING), $formattedRecord['level_name']); + $this->assertEquals('test', $formattedRecord['channel']); + $this->assertInstanceOf('\MongoDate', $formattedRecord['datetime']); + $this->assertEquals('0.00000000 1391212800', $formattedRecord['datetime']->__toString()); + $this->assertEquals(array(), $formattedRecord['extra']); + } + + public function testRecursiveFormat() + { + $someObject = new \stdClass(); + $someObject->foo = 'something'; + $someObject->bar = 'stuff'; + + $record = array( + 'message' => 'some log message', + 'context' => array( + 'stuff' => new \DateTime('2014-02-01 02:31:33'), + 'some_object' => $someObject, + 'context_string' => 'some string', + 'context_int' => 123456, + 'except' => new \Exception('exception message', 987), + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(); + $formattedRecord = $formatter->format($record); + + $this->assertCount(5, $formattedRecord['context']); + $this->assertInstanceOf('\MongoDate', $formattedRecord['context']['stuff']); + $this->assertEquals('0.00000000 1391221893', $formattedRecord['context']['stuff']->__toString()); + $this->assertEquals( + array( + 'foo' => 'something', + 'bar' => 'stuff', + 'class' => 'stdClass', + ), + $formattedRecord['context']['some_object'] + ); + $this->assertEquals('some string', $formattedRecord['context']['context_string']); + $this->assertEquals(123456, $formattedRecord['context']['context_int']); + + $this->assertCount(5, $formattedRecord['context']['except']); + $this->assertEquals('exception message', $formattedRecord['context']['except']['message']); + $this->assertEquals(987, $formattedRecord['context']['except']['code']); + $this->assertInternalType('string', $formattedRecord['context']['except']['file']); + $this->assertInternalType('integer', $formattedRecord['context']['except']['code']); + $this->assertInternalType('string', $formattedRecord['context']['except']['trace']); + $this->assertEquals('Exception', $formattedRecord['context']['except']['class']); + } + + public function testFormatDepthArray() + { + $record = array( + 'message' => 'some log message', + 'context' => array( + 'nest2' => array( + 'property' => 'anything', + 'nest3' => array( + 'nest4' => 'value', + 'property' => 'nothing' + ) + ) + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(2); + $formattedResult = $formatter->format($record); + + $this->assertEquals( + array( + 'nest2' => array( + 'property' => 'anything', + 'nest3' => '[...]', + ) + ), + $formattedResult['context'] + ); + } + + public function testFormatDepthArrayInfiniteNesting() + { + $record = array( + 'message' => 'some log message', + 'context' => array( + 'nest2' => array( + 'property' => 'something', + 'nest3' => array( + 'property' => 'anything', + 'nest4' => array( + 'property' => 'nothing', + ), + ) + ) + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(0); + $formattedResult = $formatter->format($record); + + $this->assertEquals( + array( + 'nest2' => array( + 'property' => 'something', + 'nest3' => array( + 'property' => 'anything', + 'nest4' => array( + 'property' => 'nothing', + ) + ), + ) + ), + $formattedResult['context'] + ); + } + + public function testFormatDepthObjects() + { + $someObject = new \stdClass(); + $someObject->property = 'anything'; + $someObject->nest3 = new \stdClass(); + $someObject->nest3->property = 'nothing'; + $someObject->nest3->nest4 = 'invisible'; + + $record = array( + 'message' => 'some log message', + 'context' => array( + 'nest2' => $someObject + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(2, true); + $formattedResult = $formatter->format($record); + + $this->assertEquals( + array( + 'nest2' => array( + 'property' => 'anything', + 'nest3' => '[...]', + 'class' => 'stdClass', + ), + ), + $formattedResult['context'] + ); + } + + public function testFormatDepthException() + { + $record = array( + 'message' => 'some log message', + 'context' => array( + 'nest2' => new \Exception('exception message', 987), + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(2, false); + $formattedRecord = $formatter->format($record); + + $this->assertEquals('exception message', $formattedRecord['context']['nest2']['message']); + $this->assertEquals(987, $formattedRecord['context']['nest2']['code']); + $this->assertEquals('[...]', $formattedRecord['context']['nest2']['trace']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php new file mode 100644 index 00000000..4ffeded0 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php @@ -0,0 +1,254 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * @covers Monolog\Formatter\NormalizerFormatter + */ +class NormalizerFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function testFormat() + { + $formatter = new NormalizerFormatter('Y-m-d'); + $formatted = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'message' => 'foo', + 'datetime' => new \DateTime, + 'extra' => array('foo' => new TestFooNorm, 'bar' => new TestBarNorm, 'baz' => array(), 'res' => fopen('php://memory', 'rb')), + 'context' => array( + 'foo' => 'bar', + 'baz' => 'qux', + 'inf' => INF, + '-inf' => -INF, + 'nan' => acos(4), + ), + )); + + $this->assertEquals(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'message' => 'foo', + 'datetime' => date('Y-m-d'), + 'extra' => array( + 'foo' => '[object] (Monolog\\Formatter\\TestFooNorm: {"foo":"foo"})', + 'bar' => '[object] (Monolog\\Formatter\\TestBarNorm: bar)', + 'baz' => array(), + 'res' => '[resource]', + ), + 'context' => array( + 'foo' => 'bar', + 'baz' => 'qux', + 'inf' => 'INF', + '-inf' => '-INF', + 'nan' => 'NaN', + ) + ), $formatted); + } + + public function testFormatExceptions() + { + $formatter = new NormalizerFormatter('Y-m-d'); + $e = new \LogicException('bar'); + $e2 = new \RuntimeException('foo', 0, $e); + $formatted = $formatter->format(array( + 'exception' => $e2, + )); + + $this->assertGreaterThan(5, count($formatted['exception']['trace'])); + $this->assertTrue(isset($formatted['exception']['previous'])); + unset($formatted['exception']['trace'], $formatted['exception']['previous']); + + $this->assertEquals(array( + 'exception' => array( + 'class' => get_class($e2), + 'message' => $e2->getMessage(), + 'code' => $e2->getCode(), + 'file' => $e2->getFile().':'.$e2->getLine(), + ) + ), $formatted); + } + + public function testBatchFormat() + { + $formatter = new NormalizerFormatter('Y-m-d'); + $formatted = $formatter->formatBatch(array( + array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + ), + array( + 'level_name' => 'WARNING', + 'channel' => 'log', + 'message' => 'foo', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + ), + )); + $this->assertEquals(array( + array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array(), + 'datetime' => date('Y-m-d'), + 'extra' => array(), + ), + array( + 'level_name' => 'WARNING', + 'channel' => 'log', + 'message' => 'foo', + 'context' => array(), + 'datetime' => date('Y-m-d'), + 'extra' => array(), + ), + ), $formatted); + } + + /** + * Test issue #137 + */ + public function testIgnoresRecursiveObjectReferences() + { + // set up the recursion + $foo = new \stdClass(); + $bar = new \stdClass(); + + $foo->bar = $bar; + $bar->foo = $foo; + + // set an error handler to assert that the error is not raised anymore + $that = $this; + set_error_handler(function ($level, $message, $file, $line, $context) use ($that) { + if (error_reporting() & $level) { + restore_error_handler(); + $that->fail("$message should not be raised"); + } + }); + + $formatter = new NormalizerFormatter(); + $reflMethod = new \ReflectionMethod($formatter, 'toJson'); + $reflMethod->setAccessible(true); + $res = $reflMethod->invoke($formatter, array($foo, $bar), true); + + restore_error_handler(); + + $this->assertEquals(@json_encode(array($foo, $bar)), $res); + } + + public function testIgnoresInvalidTypes() + { + // set up the recursion + $resource = fopen(__FILE__, 'r'); + + // set an error handler to assert that the error is not raised anymore + $that = $this; + set_error_handler(function ($level, $message, $file, $line, $context) use ($that) { + if (error_reporting() & $level) { + restore_error_handler(); + $that->fail("$message should not be raised"); + } + }); + + $formatter = new NormalizerFormatter(); + $reflMethod = new \ReflectionMethod($formatter, 'toJson'); + $reflMethod->setAccessible(true); + $res = $reflMethod->invoke($formatter, array($resource), true); + + restore_error_handler(); + + $this->assertEquals(@json_encode(array($resource)), $res); + } + + public function testExceptionTraceWithArgs() + { + if (defined('HHVM_VERSION')) { + $this->markTestSkipped('Not supported in HHVM since it detects errors differently'); + } + + // This happens i.e. in React promises or Guzzle streams where stream wrappers are registered + // and no file or line are included in the trace because it's treated as internal function + set_error_handler(function ($errno, $errstr, $errfile, $errline) { + throw new \ErrorException($errstr, 0, $errno, $errfile, $errline); + }); + + try { + // This will contain $resource and $wrappedResource as arguments in the trace item + $resource = fopen('php://memory', 'rw+'); + fwrite($resource, 'test_resource'); + $wrappedResource = new TestFooNorm; + $wrappedResource->foo = $resource; + // Just do something stupid with a resource/wrapped resource as argument + array_keys($wrappedResource); + } catch (\Exception $e) { + restore_error_handler(); + } + + $formatter = new NormalizerFormatter(); + $record = array('context' => array('exception' => $e)); + $result = $formatter->format($record); + + $this->assertRegExp( + '%"resource":"\[resource\]"%', + $result['context']['exception']['trace'][0] + ); + + if (version_compare(PHP_VERSION, '5.5.0', '>=')) { + $pattern = '%"wrappedResource":"\[object\] \(Monolog\\\\\\\\Formatter\\\\\\\\TestFooNorm: \)"%'; + } else { + $pattern = '%\\\\"foo\\\\":null%'; + } + + // Tests that the wrapped resource is ignored while encoding, only works for PHP <= 5.4 + $this->assertRegExp( + $pattern, + $result['context']['exception']['trace'][0] + ); + } +} + +class TestFooNorm +{ + public $foo = 'foo'; +} + +class TestBarNorm +{ + public function __toString() + { + return 'bar'; + } +} + +class TestStreamFoo +{ + public $foo; + public $resource; + + public function __construct($resource) + { + $this->resource = $resource; + $this->foo = 'BAR'; + } + + public function __toString() + { + fseek($this->resource, 0); + + return $this->foo . ' - ' . (string) stream_get_contents($this->resource); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php new file mode 100644 index 00000000..c5a4ebb5 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php @@ -0,0 +1,98 @@ +<?php +namespace Monolog\Formatter; + +class ScalarFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function setUp() + { + $this->formatter = new ScalarFormatter(); + } + + public function buildTrace(\Exception $e) + { + $data = array(); + $trace = $e->getTrace(); + foreach ($trace as $frame) { + if (isset($frame['file'])) { + $data[] = $frame['file'].':'.$frame['line']; + } else { + $data[] = json_encode($frame); + } + } + + return $data; + } + + public function encodeJson($data) + { + if (version_compare(PHP_VERSION, '5.4.0', '>=')) { + return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE); + } + + return json_encode($data); + } + + public function testFormat() + { + $exception = new \Exception('foo'); + $formatted = $this->formatter->format(array( + 'foo' => 'string', + 'bar' => 1, + 'baz' => false, + 'bam' => array(1, 2, 3), + 'bat' => array('foo' => 'bar'), + 'bap' => \DateTime::createFromFormat(\DateTime::ISO8601, '1970-01-01T00:00:00+0000'), + 'ban' => $exception + )); + + $this->assertSame(array( + 'foo' => 'string', + 'bar' => 1, + 'baz' => false, + 'bam' => $this->encodeJson(array(1, 2, 3)), + 'bat' => $this->encodeJson(array('foo' => 'bar')), + 'bap' => '1970-01-01 00:00:00', + 'ban' => $this->encodeJson(array( + 'class' => get_class($exception), + 'message' => $exception->getMessage(), + 'code' => $exception->getCode(), + 'file' => $exception->getFile() . ':' . $exception->getLine(), + 'trace' => $this->buildTrace($exception) + )) + ), $formatted); + } + + public function testFormatWithErrorContext() + { + $context = array('file' => 'foo', 'line' => 1); + $formatted = $this->formatter->format(array( + 'context' => $context + )); + + $this->assertSame(array( + 'context' => $this->encodeJson($context) + ), $formatted); + } + + public function testFormatWithExceptionContext() + { + $exception = new \Exception('foo'); + $formatted = $this->formatter->format(array( + 'context' => array( + 'exception' => $exception + ) + )); + + $this->assertSame(array( + 'context' => $this->encodeJson(array( + 'exception' => array( + 'class' => get_class($exception), + 'message' => $exception->getMessage(), + 'code' => $exception->getCode(), + 'file' => $exception->getFile() . ':' . $exception->getLine(), + 'trace' => $this->buildTrace($exception) + ) + )) + ), $formatted); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php b/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php new file mode 100644 index 00000000..52f15a36 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php @@ -0,0 +1,142 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class WildfireFormatterTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Formatter\WildfireFormatter::format + */ + public function testDefaultFormat() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('ip' => '127.0.0.1'), + 'message' => 'log', + ); + + $message = $wildfire->format($record); + + $this->assertEquals( + '125|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},' + .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|', + $message + ); + } + + /** + * @covers Monolog\Formatter\WildfireFormatter::format + */ + public function testFormatWithFileAndLine() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = $wildfire->format($record); + + $this->assertEquals( + '129|[{"Type":"ERROR","File":"test","Line":14,"Label":"meh"},' + .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|', + $message + ); + } + + /** + * @covers Monolog\Formatter\WildfireFormatter::format + */ + public function testFormatWithoutContext() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = $wildfire->format($record); + + $this->assertEquals( + '58|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},"log"]|', + $message + ); + } + + /** + * @covers Monolog\Formatter\WildfireFormatter::formatBatch + * @expectedException BadMethodCallException + */ + public function testBatchFormatThrowException() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $wildfire->formatBatch(array($record)); + } + + /** + * @covers Monolog\Formatter\WildfireFormatter::format + */ + public function testTableFormat() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'table-channel', + 'context' => array( + WildfireFormatter::TABLE => array( + array('col1', 'col2', 'col3'), + array('val1', 'val2', 'val3'), + array('foo1', 'foo2', 'foo3'), + array('bar1', 'bar2', 'bar3'), + ), + ), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'table-message', + ); + + $message = $wildfire->format($record); + + $this->assertEquals( + '171|[{"Type":"TABLE","File":"","Line":"","Label":"table-channel: table-message"},[["col1","col2","col3"],["val1","val2","val3"],["foo1","foo2","foo3"],["bar1","bar2","bar3"]]]|', + $message + ); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php new file mode 100644 index 00000000..568eb9da --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php @@ -0,0 +1,115 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; +use Monolog\Processor\WebProcessor; + +class AbstractHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\AbstractHandler::__construct + * @covers Monolog\Handler\AbstractHandler::getLevel + * @covers Monolog\Handler\AbstractHandler::setLevel + * @covers Monolog\Handler\AbstractHandler::getBubble + * @covers Monolog\Handler\AbstractHandler::setBubble + * @covers Monolog\Handler\AbstractHandler::getFormatter + * @covers Monolog\Handler\AbstractHandler::setFormatter + */ + public function testConstructAndGetSet() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false)); + $this->assertEquals(Logger::WARNING, $handler->getLevel()); + $this->assertEquals(false, $handler->getBubble()); + + $handler->setLevel(Logger::ERROR); + $handler->setBubble(true); + $handler->setFormatter($formatter = new LineFormatter); + $this->assertEquals(Logger::ERROR, $handler->getLevel()); + $this->assertEquals(true, $handler->getBubble()); + $this->assertSame($formatter, $handler->getFormatter()); + } + + /** + * @covers Monolog\Handler\AbstractHandler::handleBatch + */ + public function testHandleBatch() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); + $handler->expects($this->exactly(2)) + ->method('handle'); + $handler->handleBatch(array($this->getRecord(), $this->getRecord())); + } + + /** + * @covers Monolog\Handler\AbstractHandler::isHandling + */ + public function testIsHandling() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false)); + $this->assertTrue($handler->isHandling($this->getRecord())); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\AbstractHandler::__construct + */ + public function testHandlesPsrStyleLevels() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array('warning', false)); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + $handler->setLevel('debug'); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\AbstractHandler::getFormatter + * @covers Monolog\Handler\AbstractHandler::getDefaultFormatter + */ + public function testGetFormatterInitializesDefault() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); + $this->assertInstanceOf('Monolog\Formatter\LineFormatter', $handler->getFormatter()); + } + + /** + * @covers Monolog\Handler\AbstractHandler::pushProcessor + * @covers Monolog\Handler\AbstractHandler::popProcessor + * @expectedException LogicException + */ + public function testPushPopProcessor() + { + $logger = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); + $processor1 = new WebProcessor; + $processor2 = new WebProcessor; + + $logger->pushProcessor($processor1); + $logger->pushProcessor($processor2); + + $this->assertEquals($processor2, $logger->popProcessor()); + $this->assertEquals($processor1, $logger->popProcessor()); + $logger->popProcessor(); + } + + /** + * @covers Monolog\Handler\AbstractHandler::pushProcessor + * @expectedException InvalidArgumentException + */ + public function testPushProcessorWithNonCallable() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); + + $handler->pushProcessor(new \stdClass()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php new file mode 100644 index 00000000..24d4f63c --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php @@ -0,0 +1,80 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Processor\WebProcessor; + +class AbstractProcessingHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\AbstractProcessingHandler::handle + */ + public function testHandleLowerLevelMessage() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, true)); + $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\AbstractProcessingHandler::handle + */ + public function testHandleBubbling() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, true)); + $this->assertFalse($handler->handle($this->getRecord())); + } + + /** + * @covers Monolog\Handler\AbstractProcessingHandler::handle + */ + public function testHandleNotBubbling() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, false)); + $this->assertTrue($handler->handle($this->getRecord())); + } + + /** + * @covers Monolog\Handler\AbstractProcessingHandler::handle + */ + public function testHandleIsFalseWhenNotHandled() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, false)); + $this->assertTrue($handler->handle($this->getRecord())); + $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\AbstractProcessingHandler::processRecord + */ + public function testProcessRecord() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler'); + $handler->pushProcessor(new WebProcessor(array( + 'REQUEST_URI' => '', + 'REQUEST_METHOD' => '', + 'REMOTE_ADDR' => '', + 'SERVER_NAME' => '', + 'UNIQUE_ID' => '', + ))); + $handledRecord = null; + $handler->expects($this->once()) + ->method('write') + ->will($this->returnCallback(function ($record) use (&$handledRecord) { + $handledRecord = $record; + })) + ; + $handler->handle($this->getRecord()); + $this->assertEquals(6, count($handledRecord['extra'])); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php new file mode 100644 index 00000000..a71d6251 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php @@ -0,0 +1,136 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use PhpAmqpLib\Message\AMQPMessage; +use PhpAmqpLib\Connection\AMQPConnection; + +/** + * @covers Monolog\Handler\RotatingFileHandler + */ +class AmqpHandlerTest extends TestCase +{ + public function testHandleAmqpExt() + { + if (!class_exists('AMQPConnection') || !class_exists('AMQPExchange')) { + $this->markTestSkipped("amqp-php not installed"); + } + + if (!class_exists('AMQPChannel')) { + $this->markTestSkipped("Please update AMQP to version >= 1.0"); + } + + $messages = array(); + + $exchange = $this->getMock('AMQPExchange', array('publish', 'setName'), array(), '', false); + $exchange->expects($this->once()) + ->method('setName') + ->with('log') + ; + $exchange->expects($this->any()) + ->method('publish') + ->will($this->returnCallback(function ($message, $routing_key, $flags = 0, $attributes = array()) use (&$messages) { + $messages[] = array($message, $routing_key, $flags, $attributes); + })) + ; + + $handler = new AmqpHandler($exchange, 'log'); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + array( + 'message' => 'test', + 'context' => array( + 'data' => array(), + 'foo' => 34, + ), + 'level' => 300, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'extra' => array(), + ), + 'warn.test', + 0, + array( + 'delivery_mode' => 2, + 'Content-type' => 'application/json' + ) + ); + + $handler->handle($record); + + $this->assertCount(1, $messages); + $messages[0][0] = json_decode($messages[0][0], true); + unset($messages[0][0]['datetime']); + $this->assertEquals($expected, $messages[0]); + } + + public function testHandlePhpAmqpLib() + { + if (!class_exists('PhpAmqpLib\Connection\AMQPConnection')) { + $this->markTestSkipped("php-amqplib not installed"); + } + + $messages = array(); + + $exchange = $this->getMock('PhpAmqpLib\Channel\AMQPChannel', array('basic_publish', '__destruct'), array(), '', false); + + $exchange->expects($this->any()) + ->method('basic_publish') + ->will($this->returnCallback(function (AMQPMessage $msg, $exchange = "", $routing_key = "", $mandatory = false, $immediate = false, $ticket = null) use (&$messages) { + $messages[] = array($msg, $exchange, $routing_key, $mandatory, $immediate, $ticket); + })) + ; + + $handler = new AmqpHandler($exchange, 'log'); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + array( + 'message' => 'test', + 'context' => array( + 'data' => array(), + 'foo' => 34, + ), + 'level' => 300, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'extra' => array(), + ), + 'log', + 'warn.test', + false, + false, + null, + array( + 'delivery_mode' => 2, + 'content_type' => 'application/json' + ) + ); + + $handler->handle($record); + + $this->assertCount(1, $messages); + + /* @var $msg AMQPMessage */ + $msg = $messages[0][0]; + $messages[0][0] = json_decode($msg->body, true); + $messages[0][] = $msg->get_properties(); + unset($messages[0][0]['datetime']); + + $this->assertEquals($expected, $messages[0]); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php new file mode 100644 index 00000000..ffb1d746 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php @@ -0,0 +1,130 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\BrowserConsoleHandlerTest + */ +class BrowserConsoleHandlerTest extends TestCase +{ + protected function setUp() + { + BrowserConsoleHandler::reset(); + } + + protected function generateScript() + { + $reflMethod = new \ReflectionMethod('Monolog\Handler\BrowserConsoleHandler', 'generateScript'); + $reflMethod->setAccessible(true); + + return $reflMethod->invoke(null); + } + + public function testStyling() + { + $handler = new BrowserConsoleHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + + $handler->handle($this->getRecord(Logger::DEBUG, 'foo[[bar]]{color: red}')); + + $expected = <<<EOF +(function (c) {if (c && c.groupCollapsed) { +c.log("%cfoo%cbar%c", "font-weight: normal", "color: red", "font-weight: normal"); +}})(console); +EOF; + + $this->assertEquals($expected, $this->generateScript()); + } + + public function testEscaping() + { + $handler = new BrowserConsoleHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + + $handler->handle($this->getRecord(Logger::DEBUG, "[foo] [[\"bar\n[baz]\"]]{color: red}")); + + $expected = <<<EOF +(function (c) {if (c && c.groupCollapsed) { +c.log("%c[foo] %c\"bar\\n[baz]\"%c", "font-weight: normal", "color: red", "font-weight: normal"); +}})(console); +EOF; + + $this->assertEquals($expected, $this->generateScript()); + } + + public function testAutolabel() + { + $handler = new BrowserConsoleHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + + $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}')); + $handler->handle($this->getRecord(Logger::DEBUG, '[[bar]]{macro: autolabel}')); + $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}')); + + $expected = <<<EOF +(function (c) {if (c && c.groupCollapsed) { +c.log("%c%cfoo%c", "font-weight: normal", "background-color: blue; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal"); +c.log("%c%cbar%c", "font-weight: normal", "background-color: green; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal"); +c.log("%c%cfoo%c", "font-weight: normal", "background-color: blue; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal"); +}})(console); +EOF; + + $this->assertEquals($expected, $this->generateScript()); + } + + public function testContext() + { + $handler = new BrowserConsoleHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + + $handler->handle($this->getRecord(Logger::DEBUG, 'test', array('foo' => 'bar'))); + + $expected = <<<EOF +(function (c) {if (c && c.groupCollapsed) { +c.groupCollapsed("%ctest", "font-weight: normal"); +c.log("%c%s", "font-weight: bold", "Context"); +c.log("%s: %o", "foo", "bar"); +c.groupEnd(); +}})(console); +EOF; + + $this->assertEquals($expected, $this->generateScript()); + } + + public function testConcurrentHandlers() + { + $handler1 = new BrowserConsoleHandler(); + $handler1->setFormatter($this->getIdentityFormatter()); + + $handler2 = new BrowserConsoleHandler(); + $handler2->setFormatter($this->getIdentityFormatter()); + + $handler1->handle($this->getRecord(Logger::DEBUG, 'test1')); + $handler2->handle($this->getRecord(Logger::DEBUG, 'test2')); + $handler1->handle($this->getRecord(Logger::DEBUG, 'test3')); + $handler2->handle($this->getRecord(Logger::DEBUG, 'test4')); + + $expected = <<<EOF +(function (c) {if (c && c.groupCollapsed) { +c.log("%ctest1", "font-weight: normal"); +c.log("%ctest2", "font-weight: normal"); +c.log("%ctest3", "font-weight: normal"); +c.log("%ctest4", "font-weight: normal"); +}})(console); +EOF; + + $this->assertEquals($expected, $this->generateScript()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php new file mode 100644 index 00000000..da8b3c39 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php @@ -0,0 +1,158 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class BufferHandlerTest extends TestCase +{ + private $shutdownCheckHandler; + + /** + * @covers Monolog\Handler\BufferHandler::__construct + * @covers Monolog\Handler\BufferHandler::handle + * @covers Monolog\Handler\BufferHandler::close + */ + public function testHandleBuffers() + { + $test = new TestHandler(); + $handler = new BufferHandler($test); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + $handler->close(); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + + /** + * @covers Monolog\Handler\BufferHandler::close + * @covers Monolog\Handler\BufferHandler::flush + */ + public function testPropagatesRecordsAtEndOfRequest() + { + $test = new TestHandler(); + $handler = new BufferHandler($test); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->shutdownCheckHandler = $test; + register_shutdown_function(array($this, 'checkPropagation')); + } + + public function checkPropagation() + { + if (!$this->shutdownCheckHandler->hasWarningRecords() || !$this->shutdownCheckHandler->hasDebugRecords()) { + echo '!!! BufferHandlerTest::testPropagatesRecordsAtEndOfRequest failed to verify that the messages have been propagated' . PHP_EOL; + exit(1); + } + } + + /** + * @covers Monolog\Handler\BufferHandler::handle + */ + public function testHandleBufferLimit() + { + $test = new TestHandler(); + $handler = new BufferHandler($test, 2); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertFalse($test->hasDebugRecords()); + } + + /** + * @covers Monolog\Handler\BufferHandler::handle + */ + public function testHandleBufferLimitWithFlushOnOverflow() + { + $test = new TestHandler(); + $handler = new BufferHandler($test, 3, Logger::DEBUG, true, true); + + // send two records + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertCount(0, $test->getRecords()); + + // overflow + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertTrue($test->hasDebugRecords()); + $this->assertCount(3, $test->getRecords()); + + // should buffer again + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertCount(3, $test->getRecords()); + + $handler->close(); + $this->assertCount(5, $test->getRecords()); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\BufferHandler::handle + */ + public function testHandleLevel() + { + $test = new TestHandler(); + $handler = new BufferHandler($test, 0, Logger::INFO); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertFalse($test->hasDebugRecords()); + } + + /** + * @covers Monolog\Handler\BufferHandler::flush + */ + public function testFlush() + { + $test = new TestHandler(); + $handler = new BufferHandler($test, 0); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->flush(); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue($test->hasDebugRecords()); + $this->assertFalse($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\BufferHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new BufferHandler($test); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->flush(); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php new file mode 100644 index 00000000..2f55faf8 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php @@ -0,0 +1,141 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\ChromePHPHandler + */ +class ChromePHPHandlerTest extends TestCase +{ + protected function setUp() + { + TestChromePHPHandler::reset(); + $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; Chrome/1.0'; + } + + public function testHeaders() + { + $handler = new TestChromePHPHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + + $expected = array( + 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array( + 'version' => ChromePHPHandler::VERSION, + 'columns' => array('label', 'log', 'backtrace', 'type'), + 'rows' => array( + 'test', + 'test', + ), + 'request_uri' => '', + )))) + ); + + $this->assertEquals($expected, $handler->getHeaders()); + } + + public function testHeadersOverflow() + { + $handler = new TestChromePHPHandler(); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 150*1024))); + + // overflow chrome headers limit + $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 100*1024))); + + $expected = array( + 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array( + 'version' => ChromePHPHandler::VERSION, + 'columns' => array('label', 'log', 'backtrace', 'type'), + 'rows' => array( + array( + 'test', + 'test', + 'unknown', + 'log', + ), + array( + 'test', + str_repeat('a', 150*1024), + 'unknown', + 'warn', + ), + array( + 'monolog', + 'Incomplete logs, chrome header size limit reached', + 'unknown', + 'warn', + ), + ), + 'request_uri' => '', + )))) + ); + + $this->assertEquals($expected, $handler->getHeaders()); + } + + public function testConcurrentHandlers() + { + $handler = new TestChromePHPHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + + $handler2 = new TestChromePHPHandler(); + $handler2->setFormatter($this->getIdentityFormatter()); + $handler2->handle($this->getRecord(Logger::DEBUG)); + $handler2->handle($this->getRecord(Logger::WARNING)); + + $expected = array( + 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array( + 'version' => ChromePHPHandler::VERSION, + 'columns' => array('label', 'log', 'backtrace', 'type'), + 'rows' => array( + 'test', + 'test', + 'test', + 'test', + ), + 'request_uri' => '', + )))) + ); + + $this->assertEquals($expected, $handler2->getHeaders()); + } +} + +class TestChromePHPHandler extends ChromePHPHandler +{ + protected $headers = array(); + + public static function reset() + { + self::$initialized = false; + self::$overflowed = false; + self::$sendHeaders = true; + self::$json['rows'] = array(); + } + + protected function sendHeader($header, $content) + { + $this->headers[$header] = $content; + } + + public function getHeaders() + { + return $this->headers; + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php new file mode 100644 index 00000000..9fc4b388 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php @@ -0,0 +1,31 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class CouchDBHandlerTest extends TestCase +{ + public function testHandle() + { + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $handler = new CouchDBHandler(); + + try { + $handler->handle($record); + } catch (\RuntimeException $e) { + $this->markTestSkipped('Could not connect to couchdb server on http://localhost:5984'); + } + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php new file mode 100644 index 00000000..d67da90a --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php @@ -0,0 +1,52 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class DoctrineCouchDBHandlerTest extends TestCase +{ + protected function setup() + { + if (!class_exists('Doctrine\CouchDB\CouchDBClient')) { + $this->markTestSkipped('The "doctrine/couchdb" package is not installed'); + } + } + + public function testHandle() + { + $client = $this->getMockBuilder('Doctrine\\CouchDB\\CouchDBClient') + ->setMethods(array('postDocument')) + ->disableOriginalConstructor() + ->getMock(); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + 'message' => 'test', + 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34), + 'level' => Logger::WARNING, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'datetime' => $record['datetime']->format('Y-m-d H:i:s'), + 'extra' => array(), + ); + + $client->expects($this->once()) + ->method('postDocument') + ->with($expected); + + $handler = new DoctrineCouchDBHandler($client); + $handler->handle($record); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php new file mode 100644 index 00000000..a38a8cb7 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php @@ -0,0 +1,73 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +class DynamoDbHandlerTest extends TestCase +{ + public function setUp() + { + if (!class_exists('Aws\DynamoDb\DynamoDbClient')) { + $this->markTestSkipped('aws/aws-sdk-php not installed'); + } + + $this->client = $this->getMockBuilder('Aws\DynamoDb\DynamoDbClient') + ->setMethods(array('formatAttributes', '__call')) + ->disableOriginalConstructor()->getMock(); + } + + public function testConstruct() + { + $this->assertInstanceOf('Monolog\Handler\DynamoDbHandler', new DynamoDbHandler($this->client, 'foo')); + } + + public function testInterface() + { + $this->assertInstanceOf('Monolog\Handler\HandlerInterface', new DynamoDbHandler($this->client, 'foo')); + } + + public function testGetFormatter() + { + $handler = new DynamoDbHandler($this->client, 'foo'); + $this->assertInstanceOf('Monolog\Formatter\ScalarFormatter', $handler->getFormatter()); + } + + public function testHandle() + { + $record = $this->getRecord(); + $formatter = $this->getMock('Monolog\Formatter\FormatterInterface'); + $formatted = array('foo' => 1, 'bar' => 2); + $handler = new DynamoDbHandler($this->client, 'foo'); + $handler->setFormatter($formatter); + + $formatter + ->expects($this->once()) + ->method('format') + ->with($record) + ->will($this->returnValue($formatted)); + $this->client + ->expects($this->once()) + ->method('formatAttributes') + ->with($this->isType('array')) + ->will($this->returnValue($formatted)); + $this->client + ->expects($this->once()) + ->method('__call') + ->with('putItem', array(array( + 'TableName' => 'foo', + 'Item' => $formatted + ))); + + $handler->handle($record); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php new file mode 100644 index 00000000..1687074b --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php @@ -0,0 +1,239 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\ElasticaFormatter; +use Monolog\Formatter\NormalizerFormatter; +use Monolog\TestCase; +use Monolog\Logger; +use Elastica\Client; +use Elastica\Request; +use Elastica\Response; + +class ElasticSearchHandlerTest extends TestCase +{ + /** + * @var Client mock + */ + protected $client; + + /** + * @var array Default handler options + */ + protected $options = array( + 'index' => 'my_index', + 'type' => 'doc_type', + ); + + public function setUp() + { + // Elastica lib required + if (!class_exists("Elastica\Client")) { + $this->markTestSkipped("ruflin/elastica not installed"); + } + + // base mock Elastica Client object + $this->client = $this->getMockBuilder('Elastica\Client') + ->setMethods(array('addDocuments')) + ->disableOriginalConstructor() + ->getMock(); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::write + * @covers Monolog\Handler\ElasticSearchHandler::handleBatch + * @covers Monolog\Handler\ElasticSearchHandler::bulkSend + * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter + */ + public function testHandle() + { + // log message + $msg = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + // format expected result + $formatter = new ElasticaFormatter($this->options['index'], $this->options['type']); + $expected = array($formatter->format($msg)); + + // setup ES client mock + $this->client->expects($this->any()) + ->method('addDocuments') + ->with($expected); + + // perform tests + $handler = new ElasticSearchHandler($this->client, $this->options); + $handler->handle($msg); + $handler->handleBatch(array($msg)); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::setFormatter + */ + public function testSetFormatter() + { + $handler = new ElasticSearchHandler($this->client); + $formatter = new ElasticaFormatter('index_new', 'type_new'); + $handler->setFormatter($formatter); + $this->assertInstanceOf('Monolog\Formatter\ElasticaFormatter', $handler->getFormatter()); + $this->assertEquals('index_new', $handler->getFormatter()->getIndex()); + $this->assertEquals('type_new', $handler->getFormatter()->getType()); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::setFormatter + * @expectedException InvalidArgumentException + * @expectedExceptionMessage ElasticSearchHandler is only compatible with ElasticaFormatter + */ + public function testSetFormatterInvalid() + { + $handler = new ElasticSearchHandler($this->client); + $formatter = new NormalizerFormatter(); + $handler->setFormatter($formatter); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::__construct + * @covers Monolog\Handler\ElasticSearchHandler::getOptions + */ + public function testOptions() + { + $expected = array( + 'index' => $this->options['index'], + 'type' => $this->options['type'], + 'ignore_error' => false, + ); + $handler = new ElasticSearchHandler($this->client, $this->options); + $this->assertEquals($expected, $handler->getOptions()); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::bulkSend + * @dataProvider providerTestConnectionErrors + */ + public function testConnectionErrors($ignore, $expectedError) + { + $clientOpts = array('host' => '127.0.0.1', 'port' => 1); + $client = new Client($clientOpts); + $handlerOpts = array('ignore_error' => $ignore); + $handler = new ElasticSearchHandler($client, $handlerOpts); + + if ($expectedError) { + $this->setExpectedException($expectedError[0], $expectedError[1]); + $handler->handle($this->getRecord()); + } else { + $this->assertFalse($handler->handle($this->getRecord())); + } + } + + /** + * @return array + */ + public function providerTestConnectionErrors() + { + return array( + array(false, array('RuntimeException', 'Error sending messages to Elasticsearch')), + array(true, false), + ); + } + + /** + * Integration test using localhost Elastic Search server + * + * @covers Monolog\Handler\ElasticSearchHandler::__construct + * @covers Monolog\Handler\ElasticSearchHandler::handleBatch + * @covers Monolog\Handler\ElasticSearchHandler::bulkSend + * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter + */ + public function testHandleIntegration() + { + $msg = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $expected = $msg; + $expected['datetime'] = $msg['datetime']->format(\DateTime::ISO8601); + $expected['context'] = array( + 'class' => '[object] (stdClass: {})', + 'foo' => 7, + 0 => 'bar', + ); + + $client = new Client(); + $handler = new ElasticSearchHandler($client, $this->options); + try { + $handler->handleBatch(array($msg)); + } catch (\RuntimeException $e) { + $this->markTestSkipped("Cannot connect to Elastic Search server on localhost"); + } + + // check document id from ES server response + $documentId = $this->getCreatedDocId($client->getLastResponse()); + $this->assertNotEmpty($documentId, 'No elastic document id received'); + + // retrieve document source from ES and validate + $document = $this->getDocSourceFromElastic( + $client, + $this->options['index'], + $this->options['type'], + $documentId + ); + $this->assertEquals($expected, $document); + + // remove test index from ES + $client->request("/{$this->options['index']}", Request::DELETE); + } + + /** + * Return last created document id from ES response + * @param Response $response Elastica Response object + * @return string|null + */ + protected function getCreatedDocId(Response $response) + { + $data = $response->getData(); + if (!empty($data['items'][0]['create']['_id'])) { + return $data['items'][0]['create']['_id']; + } + } + + /** + * Retrieve document by id from Elasticsearch + * @param Client $client Elastica client + * @param string $index + * @param string $type + * @param string $documentId + * @return array + */ + protected function getDocSourceFromElastic(Client $client, $index, $type, $documentId) + { + $resp = $client->request("/{$index}/{$type}/{$documentId}", Request::GET); + $data = $resp->getData(); + if (!empty($data['_source'])) { + return $data['_source']; + } + + return array(); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php new file mode 100644 index 00000000..99785cbb --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php @@ -0,0 +1,66 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; + +function error_log() +{ + $GLOBALS['error_log'][] = func_get_args(); +} + +class ErrorLogHandlerTest extends TestCase +{ + protected function setUp() + { + $GLOBALS['error_log'] = array(); + } + + /** + * @covers Monolog\Handler\ErrorLogHandler::__construct + * @expectedException InvalidArgumentException + * @expectedExceptionMessage The given message type "42" is not supported + */ + public function testShouldNotAcceptAnInvalidTypeOnContructor() + { + new ErrorLogHandler(42); + } + + /** + * @covers Monolog\Handler\ErrorLogHandler::write + */ + public function testShouldLogMessagesUsingErrorLogFuncion() + { + $type = ErrorLogHandler::OPERATING_SYSTEM; + $handler = new ErrorLogHandler($type); + $handler->setFormatter(new LineFormatter('%channel%.%level_name%: %message% %context% %extra%', null, true)); + $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz")); + + $this->assertSame("test.ERROR: Foo\nBar\r\n\r\nBaz [] []", $GLOBALS['error_log'][0][0]); + $this->assertSame($GLOBALS['error_log'][0][1], $type); + + $handler = new ErrorLogHandler($type, Logger::DEBUG, true, true); + $handler->setFormatter(new LineFormatter(null, null, true)); + $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz")); + + $this->assertStringMatchesFormat('[%s] test.ERROR: Foo', $GLOBALS['error_log'][1][0]); + $this->assertSame($GLOBALS['error_log'][1][1], $type); + + $this->assertStringMatchesFormat('Bar', $GLOBALS['error_log'][2][0]); + $this->assertSame($GLOBALS['error_log'][2][1], $type); + + $this->assertStringMatchesFormat('Baz [] []', $GLOBALS['error_log'][3][0]); + $this->assertSame($GLOBALS['error_log'][3][1], $type); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php new file mode 100644 index 00000000..31b7686a --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php @@ -0,0 +1,170 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\TestCase; + +class FilterHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\FilterHandler::isHandling + */ + public function testIsHandling() + { + $test = new TestHandler(); + $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::INFO))); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::NOTICE))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::WARNING))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::ERROR))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::CRITICAL))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::ALERT))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::EMERGENCY))); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + * @covers Monolog\Handler\FilterHandler::setAcceptedLevels + * @covers Monolog\Handler\FilterHandler::isHandling + */ + public function testHandleProcessOnlyNeededLevels() + { + $test = new TestHandler(); + $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE); + + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertTrue($test->hasInfoRecords()); + $handler->handle($this->getRecord(Logger::NOTICE)); + $this->assertTrue($test->hasNoticeRecords()); + + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertFalse($test->hasWarningRecords()); + $handler->handle($this->getRecord(Logger::ERROR)); + $this->assertFalse($test->hasErrorRecords()); + $handler->handle($this->getRecord(Logger::CRITICAL)); + $this->assertFalse($test->hasCriticalRecords()); + $handler->handle($this->getRecord(Logger::ALERT)); + $this->assertFalse($test->hasAlertRecords()); + $handler->handle($this->getRecord(Logger::EMERGENCY)); + $this->assertFalse($test->hasEmergencyRecords()); + + $test = new TestHandler(); + $handler = new FilterHandler($test, array(Logger::INFO, Logger::ERROR)); + + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertTrue($test->hasInfoRecords()); + $handler->handle($this->getRecord(Logger::NOTICE)); + $this->assertFalse($test->hasNoticeRecords()); + $handler->handle($this->getRecord(Logger::ERROR)); + $this->assertTrue($test->hasErrorRecords()); + $handler->handle($this->getRecord(Logger::CRITICAL)); + $this->assertFalse($test->hasCriticalRecords()); + } + + /** + * @covers Monolog\Handler\FilterHandler::setAcceptedLevels + * @covers Monolog\Handler\FilterHandler::getAcceptedLevels + */ + public function testAcceptedLevelApi() + { + $test = new TestHandler(); + $handler = new FilterHandler($test); + + $levels = array(Logger::INFO, Logger::ERROR); + $handler->setAcceptedLevels($levels); + $this->assertSame($levels, $handler->getAcceptedLevels()); + + $handler->setAcceptedLevels(array('info', 'error')); + $this->assertSame($levels, $handler->getAcceptedLevels()); + + $levels = array(Logger::CRITICAL, Logger::ALERT, Logger::EMERGENCY); + $handler->setAcceptedLevels(Logger::CRITICAL, Logger::EMERGENCY); + $this->assertSame($levels, $handler->getAcceptedLevels()); + + $handler->setAcceptedLevels('critical', 'emergency'); + $this->assertSame($levels, $handler->getAcceptedLevels()); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new FilterHandler($test, Logger::DEBUG, Logger::EMERGENCY); + $handler->pushProcessor( + function ($record) { + $record['extra']['foo'] = true; + + return $record; + } + ); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + */ + public function testHandleRespectsBubble() + { + $test = new TestHandler(); + + $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, false); + $this->assertTrue($handler->handle($this->getRecord(Logger::INFO))); + $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING))); + + $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, true); + $this->assertFalse($handler->handle($this->getRecord(Logger::INFO))); + $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING))); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + */ + public function testHandleWithCallback() + { + $test = new TestHandler(); + $handler = new FilterHandler( + function ($record, $handler) use ($test) { + return $test; + }, Logger::INFO, Logger::NOTICE, false + ); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + * @expectedException \RuntimeException + */ + public function testHandleWithBadCallbackThrowsException() + { + $handler = new FilterHandler( + function ($record, $handler) { + return 'foo'; + } + ); + $handler->handle($this->getRecord(Logger::WARNING)); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php new file mode 100644 index 00000000..8e31e9b8 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php @@ -0,0 +1,255 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy; +use Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy; +use Psr\Log\LogLevel; + +class FingersCrossedHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\FingersCrossedHandler::__construct + * @covers Monolog\Handler\FingersCrossedHandler::handle + */ + public function testHandleBuffers() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->close(); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 3); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + */ + public function testHandleStopsBufferingAfterTrigger() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasDebugRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + * @covers Monolog\Handler\FingersCrossedHandler::reset + */ + public function testHandleRestartBufferingAfterReset() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->reset(); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + */ + public function testHandleRestartBufferingAfterBeingTriggeredWhenStopBufferingIsDisabled() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, Logger::WARNING, 0, false, false); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + */ + public function testHandleBufferLimit() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, Logger::WARNING, 2); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertFalse($test->hasDebugRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + */ + public function testHandleWithCallback() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler(function ($record, $handler) use ($test) { + return $test; + }); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 3); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + * @expectedException RuntimeException + */ + public function testHandleWithBadCallbackThrowsException() + { + $handler = new FingersCrossedHandler(function ($record, $handler) { + return 'foo'; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::isHandling + */ + public function testIsHandlingAlways() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, Logger::ERROR); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::__construct + * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct + * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated + */ + public function testErrorLevelActivationStrategy() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::__construct + * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct + * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated + */ + public function testErrorLevelActivationStrategyWithPsrLevel() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy('warning')); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct + * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated + */ + public function testChannelLevelActivationStrategy() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy(Logger::ERROR, array('othertest' => Logger::DEBUG))); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertFalse($test->hasWarningRecords()); + $record = $this->getRecord(Logger::DEBUG); + $record['channel'] = 'othertest'; + $handler->handle($record); + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct + * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated + */ + public function testChannelLevelActivationStrategyWithPsrLevels() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy('error', array('othertest' => 'debug'))); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertFalse($test->hasWarningRecords()); + $record = $this->getRecord(Logger::DEBUG); + $record['channel'] = 'othertest'; + $handler->handle($record); + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, Logger::INFO); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::close + */ + public function testPassthruOnClose() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, Logger::INFO); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->close(); + $this->assertFalse($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::close + */ + public function testPsrLevelPassthruOnClose() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, LogLevel::INFO); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->close(); + $this->assertFalse($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php new file mode 100644 index 00000000..0eb10a63 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php @@ -0,0 +1,96 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\FirePHPHandler + */ +class FirePHPHandlerTest extends TestCase +{ + public function setUp() + { + TestFirePHPHandler::reset(); + $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; FirePHP/1.0'; + } + + public function testHeaders() + { + $handler = new TestFirePHPHandler; + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + + $expected = array( + 'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2', + 'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1', + 'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3', + 'X-Wf-1-1-1-1' => 'test', + 'X-Wf-1-1-1-2' => 'test', + ); + + $this->assertEquals($expected, $handler->getHeaders()); + } + + public function testConcurrentHandlers() + { + $handler = new TestFirePHPHandler; + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + + $handler2 = new TestFirePHPHandler; + $handler2->setFormatter($this->getIdentityFormatter()); + $handler2->handle($this->getRecord(Logger::DEBUG)); + $handler2->handle($this->getRecord(Logger::WARNING)); + + $expected = array( + 'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2', + 'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1', + 'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3', + 'X-Wf-1-1-1-1' => 'test', + 'X-Wf-1-1-1-2' => 'test', + ); + + $expected2 = array( + 'X-Wf-1-1-1-3' => 'test', + 'X-Wf-1-1-1-4' => 'test', + ); + + $this->assertEquals($expected, $handler->getHeaders()); + $this->assertEquals($expected2, $handler2->getHeaders()); + } +} + +class TestFirePHPHandler extends FirePHPHandler +{ + protected $headers = array(); + + public static function reset() + { + self::$initialized = false; + self::$sendHeaders = true; + self::$messageIndex = 1; + } + + protected function sendHeader($header, $content) + { + $this->headers[$header] = $content; + } + + public function getHeaders() + { + return $this->headers; + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php new file mode 100644 index 00000000..91cdd312 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php @@ -0,0 +1,85 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\LineFormatter; +use Monolog\Logger; +use Monolog\TestCase; + +/** + * @coversDefaultClass \Monolog\Handler\FleepHookHandler + */ +class FleepHookHandlerTest extends TestCase +{ + /** + * Default token to use in tests + */ + const TOKEN = '123abc'; + + /** + * @var FleepHookHandler + */ + private $handler; + + public function setUp() + { + parent::setUp(); + + if (!extension_loaded('openssl')) { + $this->markTestSkipped('This test requires openssl extension to run'); + } + + // Create instances of the handler and logger for convenience + $this->handler = new FleepHookHandler(self::TOKEN); + } + + /** + * @covers ::__construct + */ + public function testConstructorSetsExpectedDefaults() + { + $this->assertEquals(Logger::DEBUG, $this->handler->getLevel()); + $this->assertEquals(true, $this->handler->getBubble()); + } + + /** + * @covers ::getDefaultFormatter + */ + public function testHandlerUsesLineFormatterWhichIgnoresEmptyArrays() + { + $record = array( + 'message' => 'msg', + 'context' => array(), + 'level' => Logger::DEBUG, + 'level_name' => Logger::getLevelName(Logger::DEBUG), + 'channel' => 'channel', + 'datetime' => new \DateTime(), + 'extra' => array(), + ); + + $expectedFormatter = new LineFormatter(null, null, true, true); + $expected = $expectedFormatter->format($record); + + $handlerFormatter = $this->handler->getFormatter(); + $actual = $handlerFormatter->format($record); + + $this->assertEquals($expected, $actual, 'Empty context and extra arrays should not be rendered'); + } + + /** + * @covers ::__construct + */ + public function testConnectionStringisConstructedCorrectly() + { + $this->assertEquals('ssl://' . FleepHookHandler::FLEEP_HOST . ':443', $this->handler->getConnectionString()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php new file mode 100644 index 00000000..4b120d51 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php @@ -0,0 +1,88 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\FlowdockFormatter; +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Dominik Liebler <liebler.dominik@gmail.com> + * @see https://www.hipchat.com/docs/api + */ +class FlowdockHandlerTest extends TestCase +{ + /** + * @var resource + */ + private $res; + + /** + * @var FlowdockHandler + */ + private $handler; + + public function setUp() + { + if (!extension_loaded('openssl')) { + $this->markTestSkipped('This test requires openssl to run'); + } + } + + public function testWriteHeader() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v1\/messages\/team_inbox\/.* HTTP\/1.1\\r\\nHost: api.flowdock.com\\r\\nContent-Type: application\/json\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + /** + * @depends testWriteHeader + */ + public function testWriteContent($content) + { + $this->assertRegexp('/"source":"test_source"/', $content); + $this->assertRegexp('/"from_address":"source@test\.com"/', $content); + } + + private function createHandler($token = 'myToken') + { + $constructorArgs = array($token, Logger::DEBUG); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\FlowdockHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $constructorArgs + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + + $this->handler->setFormatter(new FlowdockFormatter('test_source', 'source@test.com')); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php new file mode 100644 index 00000000..9d007b13 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php @@ -0,0 +1,95 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Gelf\Message; +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\GelfMessageFormatter; + +class GelfHandlerLegacyTest extends TestCase +{ + public function setUp() + { + if (!class_exists('Gelf\MessagePublisher') || !class_exists('Gelf\Message')) { + $this->markTestSkipped("mlehner/gelf-php not installed"); + } + + require_once __DIR__ . '/GelfMockMessagePublisher.php'; + } + + /** + * @covers Monolog\Handler\GelfHandler::__construct + */ + public function testConstruct() + { + $handler = new GelfHandler($this->getMessagePublisher()); + $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler); + } + + protected function getHandler($messagePublisher) + { + $handler = new GelfHandler($messagePublisher); + + return $handler; + } + + protected function getMessagePublisher() + { + return new GelfMockMessagePublisher('localhost'); + } + + public function testDebug() + { + $messagePublisher = $this->getMessagePublisher(); + $handler = $this->getHandler($messagePublisher); + + $record = $this->getRecord(Logger::DEBUG, "A test debug message"); + $handler->handle($record); + + $this->assertEquals(7, $messagePublisher->lastMessage->getLevel()); + $this->assertEquals('test', $messagePublisher->lastMessage->getFacility()); + $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage()); + $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage()); + } + + public function testWarning() + { + $messagePublisher = $this->getMessagePublisher(); + $handler = $this->getHandler($messagePublisher); + + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $handler->handle($record); + + $this->assertEquals(4, $messagePublisher->lastMessage->getLevel()); + $this->assertEquals('test', $messagePublisher->lastMessage->getFacility()); + $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage()); + $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage()); + } + + public function testInjectedGelfMessageFormatter() + { + $messagePublisher = $this->getMessagePublisher(); + $handler = $this->getHandler($messagePublisher); + + $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX')); + + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $record['extra']['blarg'] = 'yep'; + $record['context']['from'] = 'logger'; + $handler->handle($record); + + $this->assertEquals('mysystem', $messagePublisher->lastMessage->getHost()); + $this->assertArrayHasKey('_EXTblarg', $messagePublisher->lastMessage->toArray()); + $this->assertArrayHasKey('_CTXfrom', $messagePublisher->lastMessage->toArray()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php new file mode 100644 index 00000000..8cdd64f4 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php @@ -0,0 +1,117 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Gelf\Message; +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\GelfMessageFormatter; + +class GelfHandlerTest extends TestCase +{ + public function setUp() + { + if (!class_exists('Gelf\Publisher') || !class_exists('Gelf\Message')) { + $this->markTestSkipped("graylog2/gelf-php not installed"); + } + } + + /** + * @covers Monolog\Handler\GelfHandler::__construct + */ + public function testConstruct() + { + $handler = new GelfHandler($this->getMessagePublisher()); + $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler); + } + + protected function getHandler($messagePublisher) + { + $handler = new GelfHandler($messagePublisher); + + return $handler; + } + + protected function getMessagePublisher() + { + return $this->getMock('Gelf\Publisher', array('publish'), array(), '', false); + } + + public function testDebug() + { + $record = $this->getRecord(Logger::DEBUG, "A test debug message"); + $expectedMessage = new Message(); + $expectedMessage + ->setLevel(7) + ->setFacility("test") + ->setShortMessage($record['message']) + ->setTimestamp($record['datetime']) + ; + + $messagePublisher = $this->getMessagePublisher(); + $messagePublisher->expects($this->once()) + ->method('publish') + ->with($expectedMessage); + + $handler = $this->getHandler($messagePublisher); + + $handler->handle($record); + } + + public function testWarning() + { + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $expectedMessage = new Message(); + $expectedMessage + ->setLevel(4) + ->setFacility("test") + ->setShortMessage($record['message']) + ->setTimestamp($record['datetime']) + ; + + $messagePublisher = $this->getMessagePublisher(); + $messagePublisher->expects($this->once()) + ->method('publish') + ->with($expectedMessage); + + $handler = $this->getHandler($messagePublisher); + + $handler->handle($record); + } + + public function testInjectedGelfMessageFormatter() + { + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $record['extra']['blarg'] = 'yep'; + $record['context']['from'] = 'logger'; + + $expectedMessage = new Message(); + $expectedMessage + ->setLevel(4) + ->setFacility("test") + ->setHost("mysystem") + ->setShortMessage($record['message']) + ->setTimestamp($record['datetime']) + ->setAdditional("EXTblarg", 'yep') + ->setAdditional("CTXfrom", 'logger') + ; + + $messagePublisher = $this->getMessagePublisher(); + $messagePublisher->expects($this->once()) + ->method('publish') + ->with($expectedMessage); + + $handler = $this->getHandler($messagePublisher); + $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX')); + $handler->handle($record); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php b/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php new file mode 100644 index 00000000..873d92fb --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php @@ -0,0 +1,25 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Gelf\MessagePublisher; +use Gelf\Message; + +class GelfMockMessagePublisher extends MessagePublisher +{ + public function publish(Message $message) + { + $this->lastMessage = $message; + } + + public $lastMessage = null; +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php new file mode 100644 index 00000000..c6298a6e --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php @@ -0,0 +1,89 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class GroupHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\GroupHandler::__construct + * @expectedException InvalidArgumentException + */ + public function testConstructorOnlyTakesHandler() + { + new GroupHandler(array(new TestHandler(), "foo")); + } + + /** + * @covers Monolog\Handler\GroupHandler::__construct + * @covers Monolog\Handler\GroupHandler::handle + */ + public function testHandle() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new GroupHandler($testHandlers); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + } + + /** + * @covers Monolog\Handler\GroupHandler::handleBatch + */ + public function testHandleBatch() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new GroupHandler($testHandlers); + $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO))); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + } + + /** + * @covers Monolog\Handler\GroupHandler::isHandling + */ + public function testIsHandling() + { + $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING)); + $handler = new GroupHandler($testHandlers); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR))); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\GroupHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new GroupHandler(array($test)); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php new file mode 100644 index 00000000..ff773c98 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php @@ -0,0 +1,240 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Rafael Dohms <rafael@doh.ms> + * @see https://www.hipchat.com/docs/api + */ +class HipChatHandlerTest extends TestCase +{ + private $res; + private $handler; + + public function testWriteHeader() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: api.hipchat.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + public function testWriteCustomHostHeader() + { + $this->createHandler('myToken', 'room1', 'Monolog', true, 'hipchat.foo.bar'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + public function testWriteV2() { + $this->createHandler('myToken', 'room1', 'Monolog', false, 'hipchat.foo.bar', 'v2'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v2\/room\/room1\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + public function testWriteV2Notify() { + $this->createHandler('myToken', 'room1', 'Monolog', true, 'hipchat.foo.bar', 'v2'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v2\/room\/room1\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + public function testRoomSpaces() { + $this->createHandler('myToken', 'room name', 'Monolog', false, 'hipchat.foo.bar', 'v2'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v2\/room\/room%20name\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + /** + * @depends testWriteHeader + */ + public function testWriteContent($content) + { + $this->assertRegexp('/notify=0&message=test1&message_format=text&color=red&room_id=room1&from=Monolog$/', $content); + } + + /** + * @depends testWriteCustomHostHeader + */ + public function testWriteContentNotify($content) + { + $this->assertRegexp('/notify=1&message=test1&message_format=text&color=red&room_id=room1&from=Monolog$/', $content); + } + + /** + * @depends testWriteV2 + */ + public function testWriteContentV2($content) + { + $this->assertRegexp('/notify=false&message=test1&message_format=text&color=red$/', $content); + } + + /** + * @depends testWriteV2Notify + */ + public function testWriteContentV2Notify($content) + { + $this->assertRegexp('/notify=true&message=test1&message_format=text&color=red$/', $content); + } + + public function testWriteWithComplexMessage() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content); + } + + /** + * @dataProvider provideLevelColors + */ + public function testWriteWithErrorLevelsAndColors($level, $expectedColor) + { + $this->createHandler(); + $this->handler->handle($this->getRecord($level, 'Backup of database "example" finished in 16 minutes.')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/color='.$expectedColor.'/', $content); + } + + public function provideLevelColors() + { + return array( + array(Logger::DEBUG, 'gray'), + array(Logger::INFO, 'green'), + array(Logger::WARNING, 'yellow'), + array(Logger::ERROR, 'red'), + array(Logger::CRITICAL, 'red'), + array(Logger::ALERT, 'red'), + array(Logger::EMERGENCY,'red'), + array(Logger::NOTICE, 'green'), + ); + } + + /** + * @dataProvider provideBatchRecords + */ + public function testHandleBatch($records, $expectedColor) + { + $this->createHandler(); + + $this->handler->handleBatch($records); + + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/color='.$expectedColor.'/', $content); + } + + public function provideBatchRecords() + { + return array( + array( + array( + array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()), + array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()), + array('level' => Logger::CRITICAL, 'message' => 'Everything is broken!', 'level_name' => 'critical', 'datetime' => new \DateTime()) + ), + 'red', + ), + array( + array( + array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()), + array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()), + ), + 'yellow', + ), + array( + array( + array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()), + array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()), + ), + 'green', + ), + array( + array( + array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()), + ), + 'gray', + ), + ); + } + + private function createHandler($token = 'myToken', $room = 'room1', $name = 'Monolog', $notify = false, $host = 'api.hipchat.com', $version = 'v1') + { + $constructorArgs = array($token, $room, $name, $notify, Logger::DEBUG, true, true, 'text', $host, $version); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\HipChatHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $constructorArgs + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + + $this->handler->setFormatter($this->getIdentityFormatter()); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testCreateWithTooLongName() + { + $hipChatHandler = new \Monolog\Handler\HipChatHandler('token', 'room', 'SixteenCharsHere'); + } + + public function testCreateWithTooLongNameV2() { + // creating a handler with too long of a name but using the v2 api doesn't matter. + $hipChatHandler = new \Monolog\Handler\HipChatHandler('token', 'room', 'SixteenCharsHere', false, Logger::CRITICAL, true, true, 'test', 'api.hipchat.com', 'v2'); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php new file mode 100644 index 00000000..7af60be8 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php @@ -0,0 +1,84 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Robert Kaufmann III <rok3@rok3.me> + */ +class LogEntriesHandlerTest extends TestCase +{ + /** + * @var resource + */ + private $res; + + /** + * @var LogEntriesHandler + */ + private $handler; + + public function testWriteContent() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Critical write test')); + + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] test.CRITICAL: Critical write test/', $content); + } + + public function testWriteBatchContent() + { + $records = array( + $this->getRecord(), + $this->getRecord(), + $this->getRecord() + ); + $this->createHandler(); + $this->handler->handleBatch($records); + + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/(testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] .* \[\] \[\]\n){3}/', $content); + } + + private function createHandler() + { + $useSSL = extension_loaded('openssl'); + $args = array('testToken', $useSSL, Logger::DEBUG, true); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\LogEntriesHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $args + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php new file mode 100644 index 00000000..6754f3d6 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php @@ -0,0 +1,75 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\TestCase; + +class MailHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\MailHandler::handleBatch + */ + public function testHandleBatch() + { + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $formatter->expects($this->once()) + ->method('formatBatch'); // Each record is formatted + + $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler'); + $handler->expects($this->once()) + ->method('send'); + $handler->expects($this->never()) + ->method('write'); // write is for individual records + + $handler->setFormatter($formatter); + + $handler->handleBatch($this->getMultipleRecords()); + } + + /** + * @covers Monolog\Handler\MailHandler::handleBatch + */ + public function testHandleBatchNotSendsMailIfMessagesAreBelowLevel() + { + $records = array( + $this->getRecord(Logger::DEBUG, 'debug message 1'), + $this->getRecord(Logger::DEBUG, 'debug message 2'), + $this->getRecord(Logger::INFO, 'information'), + ); + + $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler'); + $handler->expects($this->never()) + ->method('send'); + $handler->setLevel(Logger::ERROR); + + $handler->handleBatch($records); + } + + /** + * @covers Monolog\Handler\MailHandler::write + */ + public function testHandle() + { + $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler'); + + $record = $this->getRecord(); + $records = array($record); + $records[0]['formatted'] = '['.$record['datetime']->format('Y-m-d H:i:s').'] test.WARNING: test [] []'."\n"; + + $handler->expects($this->once()) + ->method('send') + ->with($records[0]['formatted'], $records); + + $handler->handle($record); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php b/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php new file mode 100644 index 00000000..a0833225 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php @@ -0,0 +1,27 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Raven_Client; + +class MockRavenClient extends Raven_Client +{ + public function capture($data, $stack, $vars = null) + { + $data = array_merge($this->get_user_data(), $data); + $this->lastData = $data; + $this->lastStack = $stack; + } + + public $lastData; + public $lastStack; +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php new file mode 100644 index 00000000..0fdef63a --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php @@ -0,0 +1,65 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class MongoDBHandlerTest extends TestCase +{ + /** + * @expectedException InvalidArgumentException + */ + public function testConstructorShouldThrowExceptionForInvalidMongo() + { + new MongoDBHandler(new \stdClass(), 'DB', 'Collection'); + } + + public function testHandle() + { + $mongo = $this->getMock('Mongo', array('selectCollection'), array(), '', false); + $collection = $this->getMock('stdClass', array('save')); + + $mongo->expects($this->once()) + ->method('selectCollection') + ->with('DB', 'Collection') + ->will($this->returnValue($collection)); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + 'message' => 'test', + 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34), + 'level' => Logger::WARNING, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'datetime' => $record['datetime']->format('Y-m-d H:i:s'), + 'extra' => array(), + ); + + $collection->expects($this->once()) + ->method('save') + ->with($expected); + + $handler = new MongoDBHandler($mongo, 'DB', 'Collection'); + $handler->handle($record); + } +} + +if (!class_exists('Mongo')) { + class Mongo + { + public function selectCollection() + { + } + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php new file mode 100644 index 00000000..c2553ee4 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php @@ -0,0 +1,61 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +class NativeMailerHandlerTest extends TestCase +{ + /** + * @expectedException InvalidArgumentException + */ + public function testConstructorHeaderInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', "receiver@example.org\r\nFrom: faked@attacker.org"); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testSetterHeaderInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); + $mailer->addHeader("Content-Type: text/html\r\nFrom: faked@attacker.org"); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testSetterArrayHeaderInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); + $mailer->addHeader(array("Content-Type: text/html\r\nFrom: faked@attacker.org")); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testSetterContentTypeInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); + $mailer->setContentType("text/html\r\nFrom: faked@attacker.org"); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testSetterEncodingInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); + $mailer->setEncoding("utf-8\r\nFrom: faked@attacker.org"); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php new file mode 100644 index 00000000..4eda6155 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php @@ -0,0 +1,192 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class NewRelicHandlerTest extends TestCase +{ + public static $appname; + public static $customParameters; + public static $transactionName; + + public function setUp() + { + self::$appname = null; + self::$customParameters = array(); + self::$transactionName = null; + } + + /** + * @expectedException Monolog\Handler\MissingExtensionException + */ + public function testThehandlerThrowsAnExceptionIfTheNRExtensionIsNotLoaded() + { + $handler = new StubNewRelicHandlerWithoutExtension(); + $handler->handle($this->getRecord(Logger::ERROR)); + } + + public function testThehandlerCanHandleTheRecord() + { + $handler = new StubNewRelicHandler(); + $handler->handle($this->getRecord(Logger::ERROR)); + } + + public function testThehandlerCanAddContextParamsToTheNewRelicTrace() + { + $handler = new StubNewRelicHandler(); + $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('a' => 'b'))); + $this->assertEquals(array('context_a' => 'b'), self::$customParameters); + } + + public function testThehandlerCanAddExplodedContextParamsToTheNewRelicTrace() + { + $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true); + $handler->handle($this->getRecord( + Logger::ERROR, + 'log message', + array('a' => array('key1' => 'value1', 'key2' => 'value2')) + )); + $this->assertEquals( + array('context_a_key1' => 'value1', 'context_a_key2' => 'value2'), + self::$customParameters + ); + } + + public function testThehandlerCanAddExtraParamsToTheNewRelicTrace() + { + $record = $this->getRecord(Logger::ERROR, 'log message'); + $record['extra'] = array('c' => 'd'); + + $handler = new StubNewRelicHandler(); + $handler->handle($record); + + $this->assertEquals(array('extra_c' => 'd'), self::$customParameters); + } + + public function testThehandlerCanAddExplodedExtraParamsToTheNewRelicTrace() + { + $record = $this->getRecord(Logger::ERROR, 'log message'); + $record['extra'] = array('c' => array('key1' => 'value1', 'key2' => 'value2')); + + $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true); + $handler->handle($record); + + $this->assertEquals( + array('extra_c_key1' => 'value1', 'extra_c_key2' => 'value2'), + self::$customParameters + ); + } + + public function testThehandlerCanAddExtraContextAndParamsToTheNewRelicTrace() + { + $record = $this->getRecord(Logger::ERROR, 'log message', array('a' => 'b')); + $record['extra'] = array('c' => 'd'); + + $handler = new StubNewRelicHandler(); + $handler->handle($record); + + $expected = array( + 'context_a' => 'b', + 'extra_c' => 'd', + ); + + $this->assertEquals($expected, self::$customParameters); + } + + public function testTheAppNameIsNullByDefault() + { + $handler = new StubNewRelicHandler(); + $handler->handle($this->getRecord(Logger::ERROR, 'log message')); + + $this->assertEquals(null, self::$appname); + } + + public function testTheAppNameCanBeInjectedFromtheConstructor() + { + $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName'); + $handler->handle($this->getRecord(Logger::ERROR, 'log message')); + + $this->assertEquals('myAppName', self::$appname); + } + + public function testTheAppNameCanBeOverriddenFromEachLog() + { + $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName'); + $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('appname' => 'logAppName'))); + + $this->assertEquals('logAppName', self::$appname); + } + + public function testTheTransactionNameIsNullByDefault() + { + $handler = new StubNewRelicHandler(); + $handler->handle($this->getRecord(Logger::ERROR, 'log message')); + + $this->assertEquals(null, self::$transactionName); + } + + public function testTheTransactionNameCanBeInjectedFromTheConstructor() + { + $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction'); + $handler->handle($this->getRecord(Logger::ERROR, 'log message')); + + $this->assertEquals('myTransaction', self::$transactionName); + } + + public function testTheTransactionNameCanBeOverriddenFromEachLog() + { + $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction'); + $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('transaction_name' => 'logTransactName'))); + + $this->assertEquals('logTransactName', self::$transactionName); + } +} + +class StubNewRelicHandlerWithoutExtension extends NewRelicHandler +{ + protected function isNewRelicEnabled() + { + return false; + } +} + +class StubNewRelicHandler extends NewRelicHandler +{ + protected function isNewRelicEnabled() + { + return true; + } +} + +function newrelic_notice_error() +{ + return true; +} + +function newrelic_set_appname($appname) +{ + return NewRelicHandlerTest::$appname = $appname; +} + +function newrelic_name_transaction($transactionName) +{ + return NewRelicHandlerTest::$transactionName = $transactionName; +} + +function newrelic_add_custom_parameter($key, $value) +{ + NewRelicHandlerTest::$customParameters[$key] = $value; + + return true; +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php new file mode 100644 index 00000000..292df78c --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php @@ -0,0 +1,33 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\NullHandler::handle + */ +class NullHandlerTest extends TestCase +{ + public function testHandle() + { + $handler = new NullHandler(); + $this->assertTrue($handler->handle($this->getRecord())); + } + + public function testHandleLowerLevelRecord() + { + $handler = new NullHandler(Logger::WARNING); + $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG))); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php new file mode 100644 index 00000000..81684c5e --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php @@ -0,0 +1,271 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Exception; +use Monolog\ErrorHandler; +use Monolog\Logger; +use Monolog\TestCase; +use PhpConsole\Connector; +use PhpConsole\Dispatcher\Debug as DebugDispatcher; +use PhpConsole\Dispatcher\Errors as ErrorDispatcher; +use PhpConsole\Handler; +use PHPUnit_Framework_MockObject_MockObject; + +/** + * @covers Monolog\Handler\PHPConsoleHandler + * @author Sergey Barbushin https://www.linkedin.com/in/barbushin + */ +class PHPConsoleHandlerTest extends TestCase +{ + + /** @var Connector|PHPUnit_Framework_MockObject_MockObject */ + protected $connector; + /** @var DebugDispatcher|PHPUnit_Framework_MockObject_MockObject */ + protected $debugDispatcher; + /** @var ErrorDispatcher|PHPUnit_Framework_MockObject_MockObject */ + protected $errorDispatcher; + + protected function setUp() + { + if (!class_exists('PhpConsole\Connector')) { + $this->markTestSkipped('PHP Console library not found. See https://github.com/barbushin/php-console#installation'); + } + $this->connector = $this->initConnectorMock(); + + $this->debugDispatcher = $this->initDebugDispatcherMock($this->connector); + $this->connector->setDebugDispatcher($this->debugDispatcher); + + $this->errorDispatcher = $this->initErrorDispatcherMock($this->connector); + $this->connector->setErrorsDispatcher($this->errorDispatcher); + } + + protected function initDebugDispatcherMock(Connector $connector) + { + return $this->getMockBuilder('PhpConsole\Dispatcher\Debug') + ->disableOriginalConstructor() + ->setMethods(array('dispatchDebug')) + ->setConstructorArgs(array($connector, $connector->getDumper())) + ->getMock(); + } + + protected function initErrorDispatcherMock(Connector $connector) + { + return $this->getMockBuilder('PhpConsole\Dispatcher\Errors') + ->disableOriginalConstructor() + ->setMethods(array('dispatchError', 'dispatchException')) + ->setConstructorArgs(array($connector, $connector->getDumper())) + ->getMock(); + } + + protected function initConnectorMock() + { + $connector = $this->getMockBuilder('PhpConsole\Connector') + ->disableOriginalConstructor() + ->setMethods(array( + 'sendMessage', + 'onShutDown', + 'isActiveClient', + 'setSourcesBasePath', + 'setServerEncoding', + 'setPassword', + 'enableSslOnlyMode', + 'setAllowedIpMasks', + 'setHeadersLimit', + 'startEvalRequestsListener', + )) + ->getMock(); + + $connector->expects($this->any()) + ->method('isActiveClient') + ->will($this->returnValue(true)); + + return $connector; + } + + protected function getHandlerDefaultOption($name) + { + $handler = new PHPConsoleHandler(array(), $this->connector); + $options = $handler->getOptions(); + + return $options[$name]; + } + + protected function initLogger($handlerOptions = array(), $level = Logger::DEBUG) + { + return new Logger('test', array( + new PHPConsoleHandler($handlerOptions, $this->connector, $level) + )); + } + + public function testInitWithDefaultConnector() + { + $handler = new PHPConsoleHandler(); + $this->assertEquals(spl_object_hash(Connector::getInstance()), spl_object_hash($handler->getConnector())); + } + + public function testInitWithCustomConnector() + { + $handler = new PHPConsoleHandler(array(), $this->connector); + $this->assertEquals(spl_object_hash($this->connector), spl_object_hash($handler->getConnector())); + } + + public function testDebug() + { + $this->debugDispatcher->expects($this->once())->method('dispatchDebug')->with($this->equalTo('test')); + $this->initLogger()->addDebug('test'); + } + + public function testDebugContextInMessage() + { + $message = 'test'; + $tag = 'tag'; + $context = array($tag, 'custom' => mt_rand()); + $expectedMessage = $message . ' ' . json_encode(array_slice($context, 1)); + $this->debugDispatcher->expects($this->once())->method('dispatchDebug')->with( + $this->equalTo($expectedMessage), + $this->equalTo($tag) + ); + $this->initLogger()->addDebug($message, $context); + } + + public function testDebugTags($tagsContextKeys = null) + { + $expectedTags = mt_rand(); + $logger = $this->initLogger($tagsContextKeys ? array('debugTagsKeysInContext' => $tagsContextKeys) : array()); + if (!$tagsContextKeys) { + $tagsContextKeys = $this->getHandlerDefaultOption('debugTagsKeysInContext'); + } + foreach ($tagsContextKeys as $key) { + $debugDispatcher = $this->initDebugDispatcherMock($this->connector); + $debugDispatcher->expects($this->once())->method('dispatchDebug')->with( + $this->anything(), + $this->equalTo($expectedTags) + ); + $this->connector->setDebugDispatcher($debugDispatcher); + $logger->addDebug('test', array($key => $expectedTags)); + } + } + + public function testError($classesPartialsTraceIgnore = null) + { + $code = E_USER_NOTICE; + $message = 'message'; + $file = __FILE__; + $line = __LINE__; + $this->errorDispatcher->expects($this->once())->method('dispatchError')->with( + $this->equalTo($code), + $this->equalTo($message), + $this->equalTo($file), + $this->equalTo($line), + $classesPartialsTraceIgnore ?: $this->equalTo($this->getHandlerDefaultOption('classesPartialsTraceIgnore')) + ); + $errorHandler = ErrorHandler::register($this->initLogger($classesPartialsTraceIgnore ? array('classesPartialsTraceIgnore' => $classesPartialsTraceIgnore) : array()), false); + $errorHandler->registerErrorHandler(array(), false, E_USER_WARNING); + $errorHandler->handleError($code, $message, $file, $line); + } + + public function testException() + { + $exception = new Exception(); + $this->errorDispatcher->expects($this->once())->method('dispatchException')->with( + $this->equalTo($exception) + ); + $errorHandler = ErrorHandler::register($this->initLogger(), false, false); + $errorHandler->registerExceptionHandler(null, false); + $errorHandler->handleException($exception); + } + + /** + * @expectedException Exception + */ + public function testWrongOptionsThrowsException() + { + new PHPConsoleHandler(array('xxx' => 1)); + } + + public function testOptionEnabled() + { + $this->debugDispatcher->expects($this->never())->method('dispatchDebug'); + $this->initLogger(array('enabled' => false))->addDebug('test'); + } + + public function testOptionClassesPartialsTraceIgnore() + { + $this->testError(array('Class', 'Namespace\\')); + } + + public function testOptionDebugTagsKeysInContext() + { + $this->testDebugTags(array('key1', 'key2')); + } + + public function testOptionUseOwnErrorsAndExceptionsHandler() + { + $this->initLogger(array('useOwnErrorsHandler' => true, 'useOwnExceptionsHandler' => true)); + $this->assertEquals(array(Handler::getInstance(), 'handleError'), set_error_handler(function () { + })); + $this->assertEquals(array(Handler::getInstance(), 'handleException'), set_exception_handler(function () { + })); + } + + public static function provideConnectorMethodsOptionsSets() + { + return array( + array('sourcesBasePath', 'setSourcesBasePath', __DIR__), + array('serverEncoding', 'setServerEncoding', 'cp1251'), + array('password', 'setPassword', '******'), + array('enableSslOnlyMode', 'enableSslOnlyMode', true, false), + array('ipMasks', 'setAllowedIpMasks', array('127.0.0.*')), + array('headersLimit', 'setHeadersLimit', 2500), + array('enableEvalListener', 'startEvalRequestsListener', true, false), + ); + } + + /** + * @dataProvider provideConnectorMethodsOptionsSets + */ + public function testOptionCallsConnectorMethod($option, $method, $value, $isArgument = true) + { + $expectCall = $this->connector->expects($this->once())->method($method); + if ($isArgument) { + $expectCall->with($value); + } + new PHPConsoleHandler(array($option => $value), $this->connector); + } + + public function testOptionDetectDumpTraceAndSource() + { + new PHPConsoleHandler(array('detectDumpTraceAndSource' => true), $this->connector); + $this->assertTrue($this->connector->getDebugDispatcher()->detectTraceAndSource); + } + + public static function provideDumperOptionsValues() + { + return array( + array('dumperLevelLimit', 'levelLimit', 1001), + array('dumperItemsCountLimit', 'itemsCountLimit', 1002), + array('dumperItemSizeLimit', 'itemSizeLimit', 1003), + array('dumperDumpSizeLimit', 'dumpSizeLimit', 1004), + array('dumperDetectCallbacks', 'detectCallbacks', true), + ); + } + + /** + * @dataProvider provideDumperOptionsValues + */ + public function testDumperOptions($option, $dumperProperty, $value) + { + new PHPConsoleHandler(array($option => $value), $this->connector); + $this->assertEquals($value, $this->connector->getDumper()->$dumperProperty); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php new file mode 100644 index 00000000..64eaab16 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php @@ -0,0 +1,50 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\PsrHandler::handle + */ +class PsrHandlerTest extends TestCase +{ + public function logLevelProvider() + { + $levels = array(); + $monologLogger = new Logger(''); + + foreach ($monologLogger->getLevels() as $levelName => $level) { + $levels[] = array($levelName, $level); + } + + return $levels; + } + + /** + * @dataProvider logLevelProvider + */ + public function testHandlesAllLevels($levelName, $level) + { + $message = 'Hello, world! ' . $level; + $context = array('foo' => 'bar', 'level' => $level); + + $psrLogger = $this->getMock('Psr\Log\NullLogger'); + $psrLogger->expects($this->once()) + ->method('log') + ->with(strtolower($levelName), $message, $context); + + $handler = new PsrHandler($psrLogger); + $handler->handle(array('level' => $level, 'level_name' => $levelName, 'message' => $message, 'context' => $context)); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php new file mode 100644 index 00000000..89408236 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php @@ -0,0 +1,141 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * Almost all examples (expected header, titles, messages) taken from + * https://www.pushover.net/api + * @author Sebastian Göttschkes <sebastian.goettschkes@googlemail.com> + * @see https://www.pushover.net/api + */ +class PushoverHandlerTest extends TestCase +{ + private $res; + private $handler; + + public function testWriteHeader() + { + $this->createHandler(); + $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/1\/messages.json HTTP\/1.1\\r\\nHost: api.pushover.net\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + /** + * @depends testWriteHeader + */ + public function testWriteContent($content) + { + $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}$/', $content); + } + + public function testWriteWithComplexTitle() + { + $this->createHandler('myToken', 'myUser', 'Backup finished - SQL1', Logger::EMERGENCY); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/title=Backup\+finished\+-\+SQL1/', $content); + } + + public function testWriteWithComplexMessage() + { + $this->createHandler(); + $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content); + } + + public function testWriteWithTooLongMessage() + { + $message = str_pad('test', 520, 'a'); + $this->createHandler(); + $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications + $this->handler->handle($this->getRecord(Logger::CRITICAL, $message)); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $expectedMessage = substr($message, 0, 505); + + $this->assertRegexp('/message=' . $expectedMessage . '&title/', $content); + } + + public function testWriteWithHighPriority() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}&priority=1$/', $content); + } + + public function testWriteWithEmergencyPriority() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200$/', $content); + } + + public function testWriteToMultipleUsers() + { + $this->createHandler('myToken', array('userA', 'userB')); + $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/token=myToken&user=userA&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200POST/', $content); + $this->assertRegexp('/token=myToken&user=userB&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200$/', $content); + } + + private function createHandler($token = 'myToken', $user = 'myUser', $title = 'Monolog') + { + $constructorArgs = array($token, $user, $title); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\PushoverHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $constructorArgs + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + + $this->handler->setFormatter($this->getIdentityFormatter()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php new file mode 100644 index 00000000..9a9d1006 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php @@ -0,0 +1,185 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; + +class RavenHandlerTest extends TestCase +{ + public function setUp() + { + if (!class_exists('Raven_Client')) { + $this->markTestSkipped('raven/raven not installed'); + } + + require_once __DIR__ . '/MockRavenClient.php'; + } + + /** + * @covers Monolog\Handler\RavenHandler::__construct + */ + public function testConstruct() + { + $handler = new RavenHandler($this->getRavenClient()); + $this->assertInstanceOf('Monolog\Handler\RavenHandler', $handler); + } + + protected function getHandler($ravenClient) + { + $handler = new RavenHandler($ravenClient); + + return $handler; + } + + protected function getRavenClient() + { + $dsn = 'http://43f6017361224d098402974103bfc53d:a6a0538fc2934ba2bed32e08741b2cd3@marca.python.live.cheggnet.com:9000/1'; + + return new MockRavenClient($dsn); + } + + public function testDebug() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $record = $this->getRecord(Logger::DEBUG, 'A test debug message'); + $handler->handle($record); + + $this->assertEquals($ravenClient::DEBUG, $ravenClient->lastData['level']); + $this->assertContains($record['message'], $ravenClient->lastData['message']); + } + + public function testWarning() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $record = $this->getRecord(Logger::WARNING, 'A test warning message'); + $handler->handle($record); + + $this->assertEquals($ravenClient::WARNING, $ravenClient->lastData['level']); + $this->assertContains($record['message'], $ravenClient->lastData['message']); + } + + public function testTag() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $tags = array(1, 2, 'foo'); + $record = $this->getRecord(Logger::INFO, 'test', array('tags' => $tags)); + $handler->handle($record); + + $this->assertEquals($tags, $ravenClient->lastData['tags']); + } + + public function testUserContext() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $recordWithNoContext = $this->getRecord(Logger::INFO, 'test with default user context'); + // set user context 'externally' + + $user = array( + 'id' => '123', + 'email' => 'test@test.com' + ); + + $recordWithContext = $this->getRecord(Logger::INFO, 'test', array('user' => $user)); + + $ravenClient->user_context(array('id' => 'test_user_id')); + // handle context + $handler->handle($recordWithContext); + $this->assertEquals($user, $ravenClient->lastData['sentry.interfaces.User']); + + // check to see if its reset + $handler->handle($recordWithNoContext); + $this->assertInternalType('array', $ravenClient->context->user); + $this->assertSame('test_user_id', $ravenClient->context->user['id']); + + // handle with null context + $ravenClient->user_context(null); + $handler->handle($recordWithContext); + $this->assertEquals($user, $ravenClient->lastData['sentry.interfaces.User']); + + // check to see if its reset + $handler->handle($recordWithNoContext); + $this->assertNull($ravenClient->context->user); + } + + public function testException() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + try { + $this->methodThatThrowsAnException(); + } catch (\Exception $e) { + $record = $this->getRecord(Logger::ERROR, $e->getMessage(), array('exception' => $e)); + $handler->handle($record); + } + + $this->assertEquals($record['message'], $ravenClient->lastData['message']); + } + + public function testHandleBatch() + { + $records = $this->getMultipleRecords(); + $records[] = $this->getRecord(Logger::WARNING, 'warning'); + $records[] = $this->getRecord(Logger::WARNING, 'warning'); + + $logFormatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $logFormatter->expects($this->once())->method('formatBatch'); + + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $formatter->expects($this->once())->method('format')->with($this->callback(function ($record) { + return $record['level'] == 400; + })); + + $handler = $this->getHandler($this->getRavenClient()); + $handler->setBatchFormatter($logFormatter); + $handler->setFormatter($formatter); + $handler->handleBatch($records); + } + + public function testHandleBatchDoNothingIfRecordsAreBelowLevel() + { + $records = array( + $this->getRecord(Logger::DEBUG, 'debug message 1'), + $this->getRecord(Logger::DEBUG, 'debug message 2'), + $this->getRecord(Logger::INFO, 'information'), + ); + + $handler = $this->getMock('Monolog\Handler\RavenHandler', null, array($this->getRavenClient())); + $handler->expects($this->never())->method('handle'); + $handler->setLevel(Logger::ERROR); + $handler->handleBatch($records); + } + + public function testGetSetBatchFormatter() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $handler->setBatchFormatter($formatter = new LineFormatter()); + $this->assertSame($formatter, $handler->getBatchFormatter()); + } + + private function methodThatThrowsAnException() + { + throw new \Exception('This is an exception'); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php new file mode 100644 index 00000000..3629f8a2 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php @@ -0,0 +1,71 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; + +class RedisHandlerTest extends TestCase +{ + /** + * @expectedException InvalidArgumentException + */ + public function testConstructorShouldThrowExceptionForInvalidRedis() + { + new RedisHandler(new \stdClass(), 'key'); + } + + public function testConstructorShouldWorkWithPredis() + { + $redis = $this->getMock('Predis\Client'); + $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key')); + } + + public function testConstructorShouldWorkWithRedis() + { + $redis = $this->getMock('Redis'); + $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key')); + } + + public function testPredisHandle() + { + $redis = $this->getMock('Predis\Client', array('rpush')); + + // Predis\Client uses rpush + $redis->expects($this->once()) + ->method('rpush') + ->with('key', 'test'); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $handler = new RedisHandler($redis, 'key'); + $handler->setFormatter(new LineFormatter("%message%")); + $handler->handle($record); + } + + public function testRedisHandle() + { + $redis = $this->getMock('Redis', array('rpush')); + + // Redis uses rPush + $redis->expects($this->once()) + ->method('rPush') + ->with('key', 'test'); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $handler = new RedisHandler($redis, 'key'); + $handler->setFormatter(new LineFormatter("%message%")); + $handler->handle($record); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php new file mode 100644 index 00000000..f4cefda1 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php @@ -0,0 +1,99 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +/** + * @covers Monolog\Handler\RotatingFileHandler + */ +class RotatingFileHandlerTest extends TestCase +{ + public function setUp() + { + $dir = __DIR__.'/Fixtures'; + chmod($dir, 0777); + if (!is_writable($dir)) { + $this->markTestSkipped($dir.' must be writeable to test the RotatingFileHandler.'); + } + } + + public function testRotationCreatesNewFile() + { + touch(__DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot'); + + $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot'); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord()); + + $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot'; + $this->assertTrue(file_exists($log)); + $this->assertEquals('test', file_get_contents($log)); + } + + /** + * @dataProvider rotationTests + */ + public function testRotation($createFile) + { + touch($old1 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot'); + touch($old2 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 2).'.rot'); + touch($old3 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 3).'.rot'); + touch($old4 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 4).'.rot'); + + $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot'; + + if ($createFile) { + touch($log); + } + + $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord()); + + $handler->close(); + + $this->assertTrue(file_exists($log)); + $this->assertTrue(file_exists($old1)); + $this->assertEquals($createFile, file_exists($old2)); + $this->assertEquals($createFile, file_exists($old3)); + $this->assertEquals($createFile, file_exists($old4)); + $this->assertEquals('test', file_get_contents($log)); + } + + public function rotationTests() + { + return array( + 'Rotation is triggered when the file of the current day is not present' + => array(true), + 'Rotation is not triggered when the file is already present' + => array(false), + ); + } + + public function testReuseCurrentFile() + { + $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot'; + file_put_contents($log, "foo"); + $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot'); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord()); + $this->assertEquals('footest', file_get_contents($log)); + } + + public function tearDown() + { + foreach (glob(__DIR__.'/Fixtures/*.rot') as $file) { + unlink($file); + } + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php new file mode 100644 index 00000000..b354cee1 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php @@ -0,0 +1,33 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +/** + * @covers Monolog\Handler\SamplingHandler::handle + */ +class SamplingHandlerTest extends TestCase +{ + public function testHandle() + { + $testHandler = new TestHandler(); + $handler = new SamplingHandler($testHandler, 2); + for ($i = 0; $i < 10000; $i++) { + $handler->handle($this->getRecord()); + } + $count = count($testHandler->getRecords()); + // $count should be half of 10k, so between 4k and 6k + $this->assertLessThan(6000, $count); + $this->assertGreaterThan(4000, $count); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php new file mode 100644 index 00000000..d657fae3 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php @@ -0,0 +1,133 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Greg Kedzierski <greg@gregkedzierski.com> + * @see https://api.slack.com/ + */ +class SlackHandlerTest extends TestCase +{ + /** + * @var resource + */ + private $res; + + /** + * @var SlackHandler + */ + private $handler; + + public function setUp() + { + if (!extension_loaded('openssl')) { + $this->markTestSkipped('This test requires openssl to run'); + } + } + + public function testWriteHeader() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/api\/chat.postMessage HTTP\/1.1\\r\\nHost: slack.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + } + + public function testWriteContent() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/token=myToken&channel=channel1&username=Monolog&text=&attachments=.*$/', $content); + } + + public function testWriteContentWithEmoji() + { + $this->createHandler('myToken', 'channel1', 'Monolog', true, 'alien'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/icon_emoji=%3Aalien%3A$/', $content); + } + + /** + * @dataProvider provideLevelColors + */ + public function testWriteContentWithColors($level, $expectedColor) + { + $this->createHandler(); + $this->handler->handle($this->getRecord($level, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/color%22%3A%22'.$expectedColor.'/', $content); + } + + public function testWriteContentWithPlainTextMessage() + { + $this->createHandler('myToken', 'channel1', 'Monolog', false); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/text=test1/', $content); + } + + public function provideLevelColors() + { + return array( + array(Logger::DEBUG, '%23e3e4e6'), // escaped #e3e4e6 + array(Logger::INFO, 'good'), + array(Logger::NOTICE, 'good'), + array(Logger::WARNING, 'warning'), + array(Logger::ERROR, 'danger'), + array(Logger::CRITICAL, 'danger'), + array(Logger::ALERT, 'danger'), + array(Logger::EMERGENCY,'danger'), + ); + } + + private function createHandler($token = 'myToken', $channel = 'channel1', $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $useShortAttachment = false, $includeExtra = false) + { + $constructorArgs = array($token, $channel, $username, $useAttachment, $iconEmoji, Logger::DEBUG, true, $useShortAttachment, $includeExtra); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\SlackHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $constructorArgs + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + + $this->handler->setFormatter($this->getIdentityFormatter()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php new file mode 100644 index 00000000..2e3d504a --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php @@ -0,0 +1,282 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Pablo de Leon Belloc <pablolb@gmail.com> + */ +class SocketHandlerTest extends TestCase +{ + /** + * @var Monolog\Handler\SocketHandler + */ + private $handler; + + /** + * @var resource + */ + private $res; + + /** + * @expectedException UnexpectedValueException + */ + public function testInvalidHostname() + { + $this->createHandler('garbage://here'); + $this->writeRecord('data'); + } + + /** + * @expectedException \InvalidArgumentException + */ + public function testBadConnectionTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setConnectionTimeout(-1); + } + + public function testSetConnectionTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setConnectionTimeout(10.1); + $this->assertEquals(10.1, $this->handler->getConnectionTimeout()); + } + + /** + * @expectedException \InvalidArgumentException + */ + public function testBadTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setTimeout(-1); + } + + public function testSetTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setTimeout(10.25); + $this->assertEquals(10.25, $this->handler->getTimeout()); + } + + public function testSetConnectionString() + { + $this->createHandler('tcp://localhost:9090'); + $this->assertEquals('tcp://localhost:9090', $this->handler->getConnectionString()); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testExceptionIsThrownOnFsockopenError() + { + $this->setMockHandler(array('fsockopen')); + $this->handler->expects($this->once()) + ->method('fsockopen') + ->will($this->returnValue(false)); + $this->writeRecord('Hello world'); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testExceptionIsThrownOnPfsockopenError() + { + $this->setMockHandler(array('pfsockopen')); + $this->handler->expects($this->once()) + ->method('pfsockopen') + ->will($this->returnValue(false)); + $this->handler->setPersistent(true); + $this->writeRecord('Hello world'); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testExceptionIsThrownIfCannotSetTimeout() + { + $this->setMockHandler(array('streamSetTimeout')); + $this->handler->expects($this->once()) + ->method('streamSetTimeout') + ->will($this->returnValue(false)); + $this->writeRecord('Hello world'); + } + + /** + * @expectedException RuntimeException + */ + public function testWriteFailsOnIfFwriteReturnsFalse() + { + $this->setMockHandler(array('fwrite')); + + $callback = function ($arg) { + $map = array( + 'Hello world' => 6, + 'world' => false, + ); + + return $map[$arg]; + }; + + $this->handler->expects($this->exactly(2)) + ->method('fwrite') + ->will($this->returnCallback($callback)); + + $this->writeRecord('Hello world'); + } + + /** + * @expectedException RuntimeException + */ + public function testWriteFailsIfStreamTimesOut() + { + $this->setMockHandler(array('fwrite', 'streamGetMetadata')); + + $callback = function ($arg) { + $map = array( + 'Hello world' => 6, + 'world' => 5, + ); + + return $map[$arg]; + }; + + $this->handler->expects($this->exactly(1)) + ->method('fwrite') + ->will($this->returnCallback($callback)); + $this->handler->expects($this->exactly(1)) + ->method('streamGetMetadata') + ->will($this->returnValue(array('timed_out' => true))); + + $this->writeRecord('Hello world'); + } + + /** + * @expectedException RuntimeException + */ + public function testWriteFailsOnIncompleteWrite() + { + $this->setMockHandler(array('fwrite', 'streamGetMetadata')); + + $res = $this->res; + $callback = function ($string) use ($res) { + fclose($res); + + return strlen('Hello'); + }; + + $this->handler->expects($this->exactly(1)) + ->method('fwrite') + ->will($this->returnCallback($callback)); + $this->handler->expects($this->exactly(1)) + ->method('streamGetMetadata') + ->will($this->returnValue(array('timed_out' => false))); + + $this->writeRecord('Hello world'); + } + + public function testWriteWithMemoryFile() + { + $this->setMockHandler(); + $this->writeRecord('test1'); + $this->writeRecord('test2'); + $this->writeRecord('test3'); + fseek($this->res, 0); + $this->assertEquals('test1test2test3', fread($this->res, 1024)); + } + + public function testWriteWithMock() + { + $this->setMockHandler(array('fwrite')); + + $callback = function ($arg) { + $map = array( + 'Hello world' => 6, + 'world' => 5, + ); + + return $map[$arg]; + }; + + $this->handler->expects($this->exactly(2)) + ->method('fwrite') + ->will($this->returnCallback($callback)); + + $this->writeRecord('Hello world'); + } + + public function testClose() + { + $this->setMockHandler(); + $this->writeRecord('Hello world'); + $this->assertInternalType('resource', $this->res); + $this->handler->close(); + $this->assertFalse(is_resource($this->res), "Expected resource to be closed after closing handler"); + } + + public function testCloseDoesNotClosePersistentSocket() + { + $this->setMockHandler(); + $this->handler->setPersistent(true); + $this->writeRecord('Hello world'); + $this->assertTrue(is_resource($this->res)); + $this->handler->close(); + $this->assertTrue(is_resource($this->res)); + } + + private function createHandler($connectionString) + { + $this->handler = new SocketHandler($connectionString); + $this->handler->setFormatter($this->getIdentityFormatter()); + } + + private function writeRecord($string) + { + $this->handler->handle($this->getRecord(Logger::WARNING, $string)); + } + + private function setMockHandler(array $methods = array()) + { + $this->res = fopen('php://memory', 'a'); + + $defaultMethods = array('fsockopen', 'pfsockopen', 'streamSetTimeout'); + $newMethods = array_diff($methods, $defaultMethods); + + $finalMethods = array_merge($defaultMethods, $newMethods); + + $this->handler = $this->getMock( + '\Monolog\Handler\SocketHandler', $finalMethods, array('localhost:1234') + ); + + if (!in_array('fsockopen', $methods)) { + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + } + + if (!in_array('pfsockopen', $methods)) { + $this->handler->expects($this->any()) + ->method('pfsockopen') + ->will($this->returnValue($this->res)); + } + + if (!in_array('streamSetTimeout', $methods)) { + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + } + + $this->handler->setFormatter($this->getIdentityFormatter()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php new file mode 100644 index 00000000..44d3d9f1 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php @@ -0,0 +1,118 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class StreamHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWrite() + { + $handle = fopen('php://memory', 'a+'); + $handler = new StreamHandler($handle); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::WARNING, 'test')); + $handler->handle($this->getRecord(Logger::WARNING, 'test2')); + $handler->handle($this->getRecord(Logger::WARNING, 'test3')); + fseek($handle, 0); + $this->assertEquals('testtest2test3', fread($handle, 100)); + } + + /** + * @covers Monolog\Handler\StreamHandler::close + */ + public function testClose() + { + $handle = fopen('php://memory', 'a+'); + $handler = new StreamHandler($handle); + $this->assertTrue(is_resource($handle)); + $handler->close(); + $this->assertFalse(is_resource($handle)); + } + + /** + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteCreatesTheStreamResource() + { + $handler = new StreamHandler('php://memory'); + $handler->handle($this->getRecord()); + } + + /** + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteLocking() + { + $temp = sys_get_temp_dir() . DIRECTORY_SEPARATOR . 'monolog_locked_log'; + $handler = new StreamHandler($temp, Logger::DEBUG, true, null, true); + $handler->handle($this->getRecord()); + } + + /** + * @expectedException LogicException + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteMissingResource() + { + $handler = new StreamHandler(null); + $handler->handle($this->getRecord()); + } + + public function invalidArgumentProvider() + { + return array( + array(1), + array(array()), + array(array('bogus://url')), + ); + } + + /** + * @dataProvider invalidArgumentProvider + * @expectedException InvalidArgumentException + * @covers Monolog\Handler\StreamHandler::__construct + */ + public function testWriteInvalidArgument($invalidArgument) + { + $handler = new StreamHandler($invalidArgument); + } + + /** + * @expectedException UnexpectedValueException + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteInvalidResource() + { + $handler = new StreamHandler('bogus://url'); + $handler->handle($this->getRecord()); + } + + /** + * @expectedException UnexpectedValueException + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteNonExistingResource() + { + $handler = new StreamHandler('/foo/bar/baz/'.rand(0, 10000)); + $handler->handle($this->getRecord()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php new file mode 100644 index 00000000..ac885220 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php @@ -0,0 +1,65 @@ +<?php + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\TestCase; + +class SwiftMailerHandlerTest extends TestCase +{ + /** @var \Swift_Mailer|\PHPUnit_Framework_MockObject_MockObject */ + private $mailer; + + public function setUp() + { + $this->mailer = $this + ->getMockBuilder('Swift_Mailer') + ->disableOriginalConstructor() + ->getMock(); + } + + public function testMessageCreationIsLazyWhenUsingCallback() + { + $this->mailer->expects($this->never()) + ->method('send'); + + $callback = function () { + throw new \RuntimeException('Swift_Message creation callback should not have been called in this test'); + }; + $handler = new SwiftMailerHandler($this->mailer, $callback); + + $records = array( + $this->getRecord(Logger::DEBUG), + $this->getRecord(Logger::INFO), + ); + $handler->handleBatch($records); + } + + public function testMessageCanBeCustomizedGivenLoggedData() + { + // Wire Mailer to expect a specific Swift_Message with a customized Subject + $expectedMessage = new \Swift_Message(); + $this->mailer->expects($this->once()) + ->method('send') + ->with($this->callback(function ($value) use ($expectedMessage) { + return $value instanceof \Swift_Message + && $value->getSubject() === 'Emergency' + && $value === $expectedMessage; + })); + + // Callback dynamically changes subject based on number of logged records + $callback = function ($content, array $records) use ($expectedMessage) { + $subject = count($records) > 0 ? 'Emergency' : 'Normal'; + $expectedMessage->setSubject($subject); + + return $expectedMessage; + }; + $handler = new SwiftMailerHandler($this->mailer, $callback); + + // Logging 1 record makes this an Emergency + $records = array( + $this->getRecord(Logger::EMERGENCY), + ); + $handler->handleBatch($records); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php new file mode 100644 index 00000000..8f9e46bf --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php @@ -0,0 +1,44 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +class SyslogHandlerTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Handler\SyslogHandler::__construct + */ + public function testConstruct() + { + $handler = new SyslogHandler('test'); + $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); + + $handler = new SyslogHandler('test', LOG_USER); + $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); + + $handler = new SyslogHandler('test', 'user'); + $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); + + $handler = new SyslogHandler('test', LOG_USER, Logger::DEBUG, true, LOG_PERROR); + $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); + } + + /** + * @covers Monolog\Handler\SyslogHandler::__construct + */ + public function testConstructInvalidFacility() + { + $this->setExpectedException('UnexpectedValueException'); + $handler = new SyslogHandler('test', 'unknown'); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php new file mode 100644 index 00000000..497812b3 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php @@ -0,0 +1,49 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +/** + * @requires extension sockets + */ +class SyslogUdpHandlerTest extends \PHPUnit_Framework_TestCase +{ + /** + * @expectedException UnexpectedValueException + */ + public function testWeValidateFacilities() + { + $handler = new SyslogUdpHandler("ip", null, "invalidFacility"); + } + + public function testWeSplitIntoLines() + { + $handler = new SyslogUdpHandler("127.0.0.1", 514, "authpriv"); + $handler->setFormatter(new \Monolog\Formatter\ChromePHPFormatter()); + + $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('write'), array('lol', 'lol')); + $socket->expects($this->at(0)) + ->method('write') + ->with("lol", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 "); + $socket->expects($this->at(1)) + ->method('write') + ->with("hej", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 "); + + $handler->setSocket($socket); + + $handler->handle($this->getRecordWithMessage("hej\nlol")); + } + + protected function getRecordWithMessage($msg) + { + return array('message' => $msg, 'level' => \Monolog\Logger::WARNING, 'context' => null, 'extra' => array(), 'channel' => 'lol'); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php new file mode 100644 index 00000000..2a79fdc6 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php @@ -0,0 +1,58 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\TestHandler + */ +class TestHandlerTest extends TestCase +{ + /** + * @dataProvider methodProvider + */ + public function testHandler($method, $level) + { + $handler = new TestHandler; + $record = $this->getRecord($level, 'test'.$method); + $this->assertFalse($handler->{'has'.$method}($record)); + $this->assertFalse($handler->{'has'.$method.'ThatContains'}('test')); + $this->assertFalse($handler->{'has'.$method.'Records'}()); + $handler->handle($record); + + $this->assertFalse($handler->{'has'.$method}('bar')); + $this->assertTrue($handler->{'has'.$method}($record)); + $this->assertTrue($handler->{'has'.$method}('test'.$method)); + $this->assertTrue($handler->{'has'.$method.'ThatContains'}('test')); + $this->assertTrue($handler->{'has'.$method.'Records'}()); + + $records = $handler->getRecords(); + unset($records[0]['formatted']); + $this->assertEquals(array($record), $records); + } + + public function methodProvider() + { + return array( + array('Emergency', Logger::EMERGENCY), + array('Alert' , Logger::ALERT), + array('Critical' , Logger::CRITICAL), + array('Error' , Logger::ERROR), + array('Warning' , Logger::WARNING), + array('Info' , Logger::INFO), + array('Notice' , Logger::NOTICE), + array('Debug' , Logger::DEBUG), + ); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php new file mode 100644 index 00000000..bcaf52b3 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php @@ -0,0 +1,46 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +/** + * @requires extension sockets + */ +class UdpSocketTest extends TestCase +{ + public function testWeDoNotTruncateShortMessages() + { + $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol')); + + $socket->expects($this->at(0)) + ->method('send') + ->with("HEADER: The quick brown fox jumps over the lazy dog"); + + $socket->write("The quick brown fox jumps over the lazy dog", "HEADER: "); + } + + public function testLongMessagesAreTruncated() + { + $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol')); + + $truncatedString = str_repeat("derp", 16254).'d'; + + $socket->expects($this->exactly(1)) + ->method('send') + ->with("HEADER" . $truncatedString); + + $longString = str_repeat("derp", 20000); + + $socket->write($longString, "HEADER"); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php new file mode 100644 index 00000000..8d37a1fc --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php @@ -0,0 +1,121 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class WhatFailureGroupHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::__construct + * @expectedException InvalidArgumentException + */ + public function testConstructorOnlyTakesHandler() + { + new WhatFailureGroupHandler(array(new TestHandler(), "foo")); + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::__construct + * @covers Monolog\Handler\WhatFailureGroupHandler::handle + */ + public function testHandle() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new WhatFailureGroupHandler($testHandlers); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::handleBatch + */ + public function testHandleBatch() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new WhatFailureGroupHandler($testHandlers); + $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO))); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::isHandling + */ + public function testIsHandling() + { + $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING)); + $handler = new WhatFailureGroupHandler($testHandlers); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR))); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new WhatFailureGroupHandler(array($test)); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::handle + */ + public function testHandleException() + { + $test = new TestHandler(); + $exception = new ExceptionTestHandler(); + $handler = new WhatFailureGroupHandler(array($exception, $test, $exception)); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } +} + +class ExceptionTestHandler extends TestHandler +{ + /** + * {@inheritdoc} + */ + public function handle(array $record) + { + parent::handle($record); + + throw new \Exception("ExceptionTestHandler::handle"); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php b/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php new file mode 100644 index 00000000..416039e6 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php @@ -0,0 +1,69 @@ +<?php +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +class ZendMonitorHandlerTest extends TestCase +{ + protected $zendMonitorHandler; + + public function setUp() + { + if (!function_exists('zend_monitor_custom_event')) { + $this->markTestSkipped('ZendServer is not installed'); + } + } + + /** + * @covers Monolog\Handler\ZendMonitorHandler::write + */ + public function testWrite() + { + $record = $this->getRecord(); + $formatterResult = array( + 'message' => $record['message'] + ); + + $zendMonitor = $this->getMockBuilder('Monolog\Handler\ZendMonitorHandler') + ->setMethods(array('writeZendMonitorCustomEvent', 'getDefaultFormatter')) + ->getMock(); + + $formatterMock = $this->getMockBuilder('Monolog\Formatter\NormalizerFormatter') + ->disableOriginalConstructor() + ->getMock(); + + $formatterMock->expects($this->once()) + ->method('format') + ->will($this->returnValue($formatterResult)); + + $zendMonitor->expects($this->once()) + ->method('getDefaultFormatter') + ->will($this->returnValue($formatterMock)); + + $levelMap = $zendMonitor->getLevelMap(); + + $zendMonitor->expects($this->once()) + ->method('writeZendMonitorCustomEvent') + ->with($levelMap[$record['level']], $record['message'], $formatterResult); + + $zendMonitor->handle($record); + } + + /** + * @covers Monolog\Handler\ZendMonitorHandler::getDefaultFormatter + */ + public function testGetDefaultFormatterReturnsNormalizerFormatter() + { + $zendMonitor = new ZendMonitorHandler(); + $this->assertInstanceOf('Monolog\Formatter\NormalizerFormatter', $zendMonitor->getDefaultFormatter()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/LoggerTest.php b/vendor/monolog/monolog/tests/Monolog/LoggerTest.php new file mode 100644 index 00000000..146b6f1b --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/LoggerTest.php @@ -0,0 +1,447 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use Monolog\Processor\WebProcessor; +use Monolog\Handler\TestHandler; + +class LoggerTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Logger::getName + */ + public function testGetName() + { + $logger = new Logger('foo'); + $this->assertEquals('foo', $logger->getName()); + } + + /** + * @covers Monolog\Logger::getLevelName + */ + public function testGetLevelName() + { + $this->assertEquals('ERROR', Logger::getLevelName(Logger::ERROR)); + } + + /** + * @covers Monolog\Logger::toMonologLevel + */ + public function testConvertPSR3ToMonologLevel() + { + $this->assertEquals(Logger::toMonologLevel('debug'), 100); + $this->assertEquals(Logger::toMonologLevel('info'), 200); + $this->assertEquals(Logger::toMonologLevel('notice'), 250); + $this->assertEquals(Logger::toMonologLevel('warning'), 300); + $this->assertEquals(Logger::toMonologLevel('error'), 400); + $this->assertEquals(Logger::toMonologLevel('critical'), 500); + $this->assertEquals(Logger::toMonologLevel('alert'), 550); + $this->assertEquals(Logger::toMonologLevel('emergency'), 600); + } + + /** + * @covers Monolog\Logger::getLevelName + * @expectedException InvalidArgumentException + */ + public function testGetLevelNameThrows() + { + Logger::getLevelName(5); + } + + /** + * @covers Monolog\Logger::__construct + */ + public function testChannel() + { + $logger = new Logger('foo'); + $handler = new TestHandler; + $logger->pushHandler($handler); + $logger->addWarning('test'); + list($record) = $handler->getRecords(); + $this->assertEquals('foo', $record['channel']); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testLog() + { + $logger = new Logger(__METHOD__); + + $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle')); + $handler->expects($this->once()) + ->method('handle'); + $logger->pushHandler($handler); + + $this->assertTrue($logger->addWarning('test')); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testLogNotHandled() + { + $logger = new Logger(__METHOD__); + + $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'), array(Logger::ERROR)); + $handler->expects($this->never()) + ->method('handle'); + $logger->pushHandler($handler); + + $this->assertFalse($logger->addWarning('test')); + } + + public function testHandlersInCtor() + { + $handler1 = new TestHandler; + $handler2 = new TestHandler; + $logger = new Logger(__METHOD__, array($handler1, $handler2)); + + $this->assertEquals($handler1, $logger->popHandler()); + $this->assertEquals($handler2, $logger->popHandler()); + } + + public function testProcessorsInCtor() + { + $processor1 = new WebProcessor; + $processor2 = new WebProcessor; + $logger = new Logger(__METHOD__, array(), array($processor1, $processor2)); + + $this->assertEquals($processor1, $logger->popProcessor()); + $this->assertEquals($processor2, $logger->popProcessor()); + } + + /** + * @covers Monolog\Logger::pushHandler + * @covers Monolog\Logger::popHandler + * @expectedException LogicException + */ + public function testPushPopHandler() + { + $logger = new Logger(__METHOD__); + $handler1 = new TestHandler; + $handler2 = new TestHandler; + + $logger->pushHandler($handler1); + $logger->pushHandler($handler2); + + $this->assertEquals($handler2, $logger->popHandler()); + $this->assertEquals($handler1, $logger->popHandler()); + $logger->popHandler(); + } + + /** + * @covers Monolog\Logger::pushProcessor + * @covers Monolog\Logger::popProcessor + * @expectedException LogicException + */ + public function testPushPopProcessor() + { + $logger = new Logger(__METHOD__); + $processor1 = new WebProcessor; + $processor2 = new WebProcessor; + + $logger->pushProcessor($processor1); + $logger->pushProcessor($processor2); + + $this->assertEquals($processor2, $logger->popProcessor()); + $this->assertEquals($processor1, $logger->popProcessor()); + $logger->popProcessor(); + } + + /** + * @covers Monolog\Logger::pushProcessor + * @expectedException InvalidArgumentException + */ + public function testPushProcessorWithNonCallable() + { + $logger = new Logger(__METHOD__); + + $logger->pushProcessor(new \stdClass()); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testProcessorsAreExecuted() + { + $logger = new Logger(__METHOD__); + $handler = new TestHandler; + $logger->pushHandler($handler); + $logger->pushProcessor(function ($record) { + $record['extra']['win'] = true; + + return $record; + }); + $logger->addError('test'); + list($record) = $handler->getRecords(); + $this->assertTrue($record['extra']['win']); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testProcessorsAreCalledOnlyOnce() + { + $logger = new Logger(__METHOD__); + $handler = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler->expects($this->any()) + ->method('handle') + ->will($this->returnValue(true)) + ; + $logger->pushHandler($handler); + + $processor = $this->getMockBuilder('Monolog\Processor\WebProcessor') + ->disableOriginalConstructor() + ->setMethods(array('__invoke')) + ->getMock() + ; + $processor->expects($this->once()) + ->method('__invoke') + ->will($this->returnArgument(0)) + ; + $logger->pushProcessor($processor); + + $logger->addError('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testProcessorsNotCalledWhenNotHandled() + { + $logger = new Logger(__METHOD__); + $handler = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler->expects($this->once()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler); + $that = $this; + $logger->pushProcessor(function ($record) use ($that) { + $that->fail('The processor should not be called'); + }); + $logger->addAlert('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testHandlersNotCalledBeforeFirstHandling() + { + $logger = new Logger(__METHOD__); + + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->never()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + $handler1->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler1); + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->once()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler2->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler2); + + $handler3 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler3->expects($this->once()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + $handler3->expects($this->never()) + ->method('handle') + ; + $logger->pushHandler($handler3); + + $logger->debug('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testBubblingWhenTheHandlerReturnsFalse() + { + $logger = new Logger(__METHOD__); + + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler1->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler1); + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler2->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler2); + + $logger->debug('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testNotBubblingWhenTheHandlerReturnsTrue() + { + $logger = new Logger(__METHOD__); + + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler1->expects($this->never()) + ->method('handle') + ; + $logger->pushHandler($handler1); + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler2->expects($this->once()) + ->method('handle') + ->will($this->returnValue(true)) + ; + $logger->pushHandler($handler2); + + $logger->debug('test'); + } + + /** + * @covers Monolog\Logger::isHandling + */ + public function testIsHandling() + { + $logger = new Logger(__METHOD__); + + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + + $logger->pushHandler($handler1); + $this->assertFalse($logger->isHandling(Logger::DEBUG)); + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + + $logger->pushHandler($handler2); + $this->assertTrue($logger->isHandling(Logger::DEBUG)); + } + + /** + * @dataProvider logMethodProvider + * @covers Monolog\Logger::addDebug + * @covers Monolog\Logger::addInfo + * @covers Monolog\Logger::addNotice + * @covers Monolog\Logger::addWarning + * @covers Monolog\Logger::addError + * @covers Monolog\Logger::addCritical + * @covers Monolog\Logger::addAlert + * @covers Monolog\Logger::addEmergency + * @covers Monolog\Logger::debug + * @covers Monolog\Logger::info + * @covers Monolog\Logger::notice + * @covers Monolog\Logger::warn + * @covers Monolog\Logger::err + * @covers Monolog\Logger::crit + * @covers Monolog\Logger::alert + * @covers Monolog\Logger::emerg + */ + public function testLogMethods($method, $expectedLevel) + { + $logger = new Logger('foo'); + $handler = new TestHandler; + $logger->pushHandler($handler); + $logger->{$method}('test'); + list($record) = $handler->getRecords(); + $this->assertEquals($expectedLevel, $record['level']); + } + + public function logMethodProvider() + { + return array( + // monolog methods + array('addDebug', Logger::DEBUG), + array('addInfo', Logger::INFO), + array('addNotice', Logger::NOTICE), + array('addWarning', Logger::WARNING), + array('addError', Logger::ERROR), + array('addCritical', Logger::CRITICAL), + array('addAlert', Logger::ALERT), + array('addEmergency', Logger::EMERGENCY), + + // ZF/Sf2 compat methods + array('debug', Logger::DEBUG), + array('info', Logger::INFO), + array('notice', Logger::NOTICE), + array('warn', Logger::WARNING), + array('err', Logger::ERROR), + array('crit', Logger::CRITICAL), + array('alert', Logger::ALERT), + array('emerg', Logger::EMERGENCY), + ); + } + + /** + * @dataProvider setTimezoneProvider + * @covers Monolog\Logger::setTimezone + */ + public function testSetTimezone($tz) + { + Logger::setTimezone($tz); + $logger = new Logger('foo'); + $handler = new TestHandler; + $logger->pushHandler($handler); + $logger->info('test'); + list($record) = $handler->getRecords(); + $this->assertEquals($tz, $record['datetime']->getTimezone()); + } + + public function setTimezoneProvider() + { + return array_map( + function ($tz) { return array(new \DateTimeZone($tz)); }, + \DateTimeZone::listIdentifiers() + ); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php new file mode 100644 index 00000000..5adb505d --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php @@ -0,0 +1,29 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class GitProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\GitProcessor::__invoke + */ + public function testProcessor() + { + $processor = new GitProcessor(); + $record = $processor($this->getRecord()); + + $this->assertArrayHasKey('git', $record['extra']); + $this->assertTrue(!is_array($record['extra']['git']['branch'])); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php new file mode 100644 index 00000000..0dd411d7 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php @@ -0,0 +1,123 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Acme; + +class Tester +{ + public function test($handler, $record) + { + $handler->handle($record); + } +} + +function tester($handler, $record) +{ + $handler->handle($record); +} + +namespace Monolog\Processor; + +use Monolog\Logger; +use Monolog\TestCase; +use Monolog\Handler\TestHandler; + +class IntrospectionProcessorTest extends TestCase +{ + public function getHandler() + { + $processor = new IntrospectionProcessor(); + $handler = new TestHandler(); + $handler->pushProcessor($processor); + + return $handler; + } + + public function testProcessorFromClass() + { + $handler = $this->getHandler(); + $tester = new \Acme\Tester; + $tester->test($handler, $this->getRecord()); + list($record) = $handler->getRecords(); + $this->assertEquals(__FILE__, $record['extra']['file']); + $this->assertEquals(18, $record['extra']['line']); + $this->assertEquals('Acme\Tester', $record['extra']['class']); + $this->assertEquals('test', $record['extra']['function']); + } + + public function testProcessorFromFunc() + { + $handler = $this->getHandler(); + \Acme\tester($handler, $this->getRecord()); + list($record) = $handler->getRecords(); + $this->assertEquals(__FILE__, $record['extra']['file']); + $this->assertEquals(24, $record['extra']['line']); + $this->assertEquals(null, $record['extra']['class']); + $this->assertEquals('Acme\tester', $record['extra']['function']); + } + + public function testLevelTooLow() + { + $input = array( + 'level' => Logger::DEBUG, + 'extra' => array(), + ); + + $expected = $input; + + $processor = new IntrospectionProcessor(Logger::CRITICAL); + $actual = $processor($input); + + $this->assertEquals($expected, $actual); + } + + public function testLevelEqual() + { + $input = array( + 'level' => Logger::CRITICAL, + 'extra' => array(), + ); + + $expected = $input; + $expected['extra'] = array( + 'file' => null, + 'line' => null, + 'class' => 'ReflectionMethod', + 'function' => 'invokeArgs', + ); + + $processor = new IntrospectionProcessor(Logger::CRITICAL); + $actual = $processor($input); + + $this->assertEquals($expected, $actual); + } + + public function testLevelHigher() + { + $input = array( + 'level' => Logger::EMERGENCY, + 'extra' => array(), + ); + + $expected = $input; + $expected['extra'] = array( + 'file' => null, + 'line' => null, + 'class' => 'ReflectionMethod', + 'function' => 'invokeArgs', + ); + + $processor = new IntrospectionProcessor(Logger::CRITICAL); + $actual = $processor($input); + + $this->assertEquals($expected, $actual); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php new file mode 100644 index 00000000..eb666144 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php @@ -0,0 +1,42 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class MemoryPeakUsageProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke + * @covers Monolog\Processor\MemoryProcessor::formatBytes + */ + public function testProcessor() + { + $processor = new MemoryPeakUsageProcessor(); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('memory_peak_usage', $record['extra']); + $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_peak_usage']); + } + + /** + * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke + * @covers Monolog\Processor\MemoryProcessor::formatBytes + */ + public function testProcessorWithoutFormatting() + { + $processor = new MemoryPeakUsageProcessor(true, false); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('memory_peak_usage', $record['extra']); + $this->assertInternalType('int', $record['extra']['memory_peak_usage']); + $this->assertGreaterThan(0, $record['extra']['memory_peak_usage']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php new file mode 100644 index 00000000..4692dbfc --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php @@ -0,0 +1,42 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class MemoryUsageProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\MemoryUsageProcessor::__invoke + * @covers Monolog\Processor\MemoryProcessor::formatBytes + */ + public function testProcessor() + { + $processor = new MemoryUsageProcessor(); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('memory_usage', $record['extra']); + $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_usage']); + } + + /** + * @covers Monolog\Processor\MemoryUsageProcessor::__invoke + * @covers Monolog\Processor\MemoryProcessor::formatBytes + */ + public function testProcessorWithoutFormatting() + { + $processor = new MemoryUsageProcessor(true, false); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('memory_usage', $record['extra']); + $this->assertInternalType('int', $record['extra']['memory_usage']); + $this->assertGreaterThan(0, $record['extra']['memory_usage']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php new file mode 100644 index 00000000..458d2a33 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php @@ -0,0 +1,30 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class ProcessIdProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\ProcessIdProcessor::__invoke + */ + public function testProcessor() + { + $processor = new ProcessIdProcessor(); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('process_id', $record['extra']); + $this->assertInternalType('int', $record['extra']['process_id']); + $this->assertGreaterThan(0, $record['extra']['process_id']); + $this->assertEquals(getmypid(), $record['extra']['process_id']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php new file mode 100644 index 00000000..81bfbdc3 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php @@ -0,0 +1,43 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +class PsrLogMessageProcessorTest extends \PHPUnit_Framework_TestCase +{ + /** + * @dataProvider getPairs + */ + public function testReplacement($val, $expected) + { + $proc = new PsrLogMessageProcessor; + + $message = $proc(array( + 'message' => '{foo}', + 'context' => array('foo' => $val) + )); + $this->assertEquals($expected, $message['message']); + } + + public function getPairs() + { + return array( + array('foo', 'foo'), + array('3', '3'), + array(3, '3'), + array(null, ''), + array(true, '1'), + array(false, ''), + array(new \stdClass, '[object stdClass]'), + array(array(), '[array]'), + ); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php new file mode 100644 index 00000000..851a9dc2 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php @@ -0,0 +1,29 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class TagProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\TagProcessor::__invoke + */ + public function testProcessor() + { + $tags = array(1, 2, 3); + $processor = new TagProcessor($tags); + $record = $processor($this->getRecord()); + + $this->assertEquals($tags, $record['extra']['tags']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php new file mode 100644 index 00000000..7ced62ca --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php @@ -0,0 +1,27 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class UidProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\UidProcessor::__invoke + */ + public function testProcessor() + { + $processor = new UidProcessor(); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('uid', $record['extra']); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php b/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php new file mode 100644 index 00000000..dba89412 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php @@ -0,0 +1,98 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class WebProcessorTest extends TestCase +{ + public function testProcessor() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'HTTP_REFERER' => 'D', + 'SERVER_NAME' => 'F', + 'UNIQUE_ID' => 'G', + ); + + $processor = new WebProcessor($server); + $record = $processor($this->getRecord()); + $this->assertEquals($server['REQUEST_URI'], $record['extra']['url']); + $this->assertEquals($server['REMOTE_ADDR'], $record['extra']['ip']); + $this->assertEquals($server['REQUEST_METHOD'], $record['extra']['http_method']); + $this->assertEquals($server['HTTP_REFERER'], $record['extra']['referrer']); + $this->assertEquals($server['SERVER_NAME'], $record['extra']['server']); + $this->assertEquals($server['UNIQUE_ID'], $record['extra']['unique_id']); + } + + public function testProcessorDoNothingIfNoRequestUri() + { + $server = array( + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + ); + $processor = new WebProcessor($server); + $record = $processor($this->getRecord()); + $this->assertEmpty($record['extra']); + } + + public function testProcessorReturnNullIfNoHttpReferer() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'SERVER_NAME' => 'F', + ); + $processor = new WebProcessor($server); + $record = $processor($this->getRecord()); + $this->assertNull($record['extra']['referrer']); + } + + public function testProcessorDoesNotAddUniqueIdIfNotPresent() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'SERVER_NAME' => 'F', + ); + $processor = new WebProcessor($server); + $record = $processor($this->getRecord()); + $this->assertFalse(isset($record['extra']['unique_id'])); + } + + public function testProcessorAddsOnlyRequestedExtraFields() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'SERVER_NAME' => 'F', + ); + + $processor = new WebProcessor($server, array('url', 'http_method')); + $record = $processor($this->getRecord()); + + $this->assertSame(array('url' => 'A', 'http_method' => 'C'), $record['extra']); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testInvalidData() + { + new WebProcessor(new \stdClass); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php b/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php new file mode 100644 index 00000000..ab899449 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php @@ -0,0 +1,47 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use Monolog\Handler\TestHandler; +use Monolog\Formatter\LineFormatter; +use Monolog\Processor\PsrLogMessageProcessor; +use Psr\Log\Test\LoggerInterfaceTest; + +class PsrLogCompatTest extends LoggerInterfaceTest +{ + private $handler; + + public function getLogger() + { + $logger = new Logger('foo'); + $logger->pushHandler($handler = new TestHandler); + $logger->pushProcessor(new PsrLogMessageProcessor); + $handler->setFormatter(new LineFormatter('%level_name% %message%')); + + $this->handler = $handler; + + return $logger; + } + + public function getLogs() + { + $convert = function ($record) { + $lower = function ($match) { + return strtolower($match[0]); + }; + + return preg_replace_callback('{^[A-Z]+}', $lower, $record['formatted']); + }; + + return array_map($convert, $this->handler->getRecords()); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/RegistryTest.php b/vendor/monolog/monolog/tests/Monolog/RegistryTest.php new file mode 100644 index 00000000..29925f8a --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/RegistryTest.php @@ -0,0 +1,63 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + + +class RegistryTest extends \PHPUnit_Framework_TestCase +{ + protected function setUp() + { + Registry::clear(); + } + + /** + * @dataProvider hasLoggerProvider + * @covers Monolog\Registry::hasLogger + */ + public function testHasLogger(array $loggersToAdd, array $loggersToCheck, array $expectedResult) + { + foreach ($loggersToAdd as $loggerToAdd) { + Registry::addLogger($loggerToAdd); + } + foreach ($loggersToCheck as $index => $loggerToCheck) { + $this->assertSame($expectedResult[$index], Registry::hasLogger($loggerToCheck)); + } + } + + public function hasLoggerProvider() + { + $logger1 = new Logger('test1'); + $logger2 = new Logger('test2'); + $logger3 = new Logger('test3'); + + return array( + // only instances + array( + array($logger1), + array($logger1, $logger2), + array(true, false), + ), + // only names + array( + array($logger1), + array('test1', 'test2'), + array(true, false), + ), + // mixed case + array( + array($logger1, $logger2), + array('test1', $logger2, 'test3', $logger3), + array(true, true, false, false), + ), + ); + } +} diff --git a/vendor/monolog/monolog/tests/Monolog/TestCase.php b/vendor/monolog/monolog/tests/Monolog/TestCase.php new file mode 100644 index 00000000..cae79340 --- /dev/null +++ b/vendor/monolog/monolog/tests/Monolog/TestCase.php @@ -0,0 +1,58 @@ +<?php + +/* + * This file is part of the Monolog package. + * + * (c) Jordi Boggiano <j.boggiano@seld.be> + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +class TestCase extends \PHPUnit_Framework_TestCase +{ + /** + * @return array Record + */ + protected function getRecord($level = Logger::WARNING, $message = 'test', $context = array()) + { + return array( + 'message' => $message, + 'context' => $context, + 'level' => $level, + 'level_name' => Logger::getLevelName($level), + 'channel' => 'test', + 'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true))), + 'extra' => array(), + ); + } + + /** + * @return array + */ + protected function getMultipleRecords() + { + return array( + $this->getRecord(Logger::DEBUG, 'debug message 1'), + $this->getRecord(Logger::DEBUG, 'debug message 2'), + $this->getRecord(Logger::INFO, 'information'), + $this->getRecord(Logger::WARNING, 'warning'), + $this->getRecord(Logger::ERROR, 'error') + ); + } + + /** + * @return Monolog\Formatter\FormatterInterface + */ + protected function getIdentityFormatter() + { + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $formatter->expects($this->any()) + ->method('format') + ->will($this->returnCallback(function ($record) { return $record['message']; })); + + return $formatter; + } +} |